Code
|
Display
|
962548 |
(R)-N-Ethyl-2-(((phenylamino)carbonyl)oxy)propanamide |
202101 |
.alpha.-D-Glucofuranose, 1,2-O-[(1R)-2,2,2-trichloroethylidene]- |
1714551 |
.alpha.-D-Glucopyranose, 3-O-methyl- |
1714746 |
.alpha.-D-Glucopyranoside, (1S,4R,5R,6R,6aS,9S,10aR)-3-[(1S)-2-(acetyloxy)-1-methylethyl]-1,2,4,5,6,6a,7,8,9,10a-decahydro-1,5-dihydroxy-9-(methoxymethyl)-6,10a-dimethyldicyclopenta[a,d]cycloocten-4-yl 6-O-(1,1-dimethyl-2-propenyl)-, 4-acetate |
1714756 |
.alpha.-D-Glucopyranoside, (4R,5R,6R,6aS,9R,10aR)-1,2,4,5,6,6a,7,8,9,10a-decahydro-5,9-dihydroxy-9-(methoxymethyl)-6,10a-dimethyl-3-(1-methylethyl)dicyclopenta[a,d]cycloocten-4-yl 3,4-O-[(1R,2S)-2-hydroxy-1-(hydroxymethyl)-1-methyl-1,3-propanediyl]-6-O-me |
2568 |
.alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl |
49429 |
.alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl O-.alpha.-D-galactopyranosyl-(1.fwdarw.6)- |
33811 |
.alpha.-D-Glucopyranoside, 1,3,4,6-tetra-O-acetyl-.beta.-D-fructofuranosyl, tetraacetate |
1714752 |
.alpha.-D-Glucopyranoside, 3-[2-(acetyloxy)-1-methylethyl]-1,2,4,5,6,6a,7,8,9,10a-decahydro-1,5-dihydroxy-9-(methoxymethyl)-6,10a-dimethyldicyclopenta[a,d]cycloocten-4-yl 6-O-(1,1-dimethyl-2-propenyl)-, 2-acetate, [1S-[1.alpha.,3(R*),4.alpha.,5.beta.,6.be |
295527 |
.alpha.-L-xylo-2-Hexulofuranosonic acid, 2,3:4,6-bis-O-(1-methylethylidene)-, sodium salt |
147850 |
.beta.,.beta.-Carotene |
36855 |
.beta.-Alanine, N-[(2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl]-, calcium salt (2:1) |
87080 |
.beta.-Alanine, N-dodecyl- |
961599 |
.beta.-D-erythro-Hex-2-enopyranuronic acid, 4-[[3-amino-5-[(aminoiminomethyl)methylamino]-1-oxopentyl]amino]-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,2,3,4-tetradeoxy-, (S)- |
172809 |
.beta.-D-Galactopyranoside, (2.alpha.,3.beta.,5.alpha.,15.beta.,25R)-2,15-dihydroxyspirostan-3-yl O-.beta.-D-glucopyranosyl-(1.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.2)-O-[.beta.-D-xylopyranosyl-(1.fwdarw.3)]-O-.beta.-D-glucopyranosyl-(1.fwdarw.4 |
17295288 |
.beta.-D-Glucopyranose, 1,6-anhydro- |
962498 |
.beta.-D-Glucopyranoside, [(Z)-methyl-ONN-azoxy] methyl |
17295270 |
.beta.-D-Glucopyranoside, 4-hydroxyphenyl |
87106 |
.beta.-D-Glucopyranoside, phenyl |
4358 |
[1,1'-Bicyclohexyl]-1-carboxylic acid, 2-(diethylamino)ethyl ester, hydrochloride |
58461 |
[1,1'-Binaphthalene]-2,2'-diol |
17151911 |
[1,1'-Biphenyl]-2,2'-dicarbonitrile, 3,3',4,4',5,5',6,6'-octafluoro- |
92692 |
[1,1'-Biphenyl]-2,2'-diol |
12989 |
[1,1'-Biphenyl]-2-amine |
13003 |
[1,1'-Biphenyl]-2-ol |
712448 |
[1,1'-Biphenyl]-2-ol, 3(or 5)-chloro- |
17124686 |
[1,1'-Biphenyl]-2-ol, 3,5-dichloro- |
59014 |
[1,1'-Biphenyl]-2-ol, 5-chloro- |
35592 |
[1,1'-Biphenyl]-2-ol, sodium salt |
13763 |
[1,1'-Biphenyl]-3,3',4,4'-tetramine |
41673 |
[1,1'-Biphenyl]-3-carboxylic acid, 2-hydroxy- |
55491 |
[1,1'-Biphenyl]-3-ol |
14498 |
[1,1'-Biphenyl]-4,4'-diamine |
13755 |
[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro- |
60129 |
[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dichloro-, dihydrochloride |
30940 |
[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl- |
14506 |
[1,1'-Biphenyl]-4,4'-diol |
123422 |
[1,1'-Biphenyl]-4-acetic acid, 2-fluoroethyl ester |
14308 |
[1,1'-Biphenyl]-4-amine |
108837 |
[1,1'-Biphenyl]-4-carbonitrile |
709881 |
[1,1'-Biphenyl]-4-carboxaldehyde |
17155797 |
[1,1'-Biphenyl]-4-methanol |
14324 |
[1,1'-Biphenyl]-4-ol |
1714712 |
[1,1'-Biphenyl]-4-ol, 2',4',6'-trichloro- |
117655 |
[1,1'-Biphenyl]-4-ol, sodium salt |
709717 |
[1,1'-Biphenyl]-4-sulfonic acid, sodium salt |
252254 |
[1,1'-Biphenyl]triol |
17154006 |
[1,2,4]Triazino[6,1-a]isoquinolin-5-ium, 1-(4-chlorophenyl)-1,2-dihydro-1-hydroxy-, bromide |
609586 |
[1,2,4]Triazolo[1,5-a]pyrimidine-2-sulfonamide, N-(2,6-difluorophenyl)-5-methyl- |
17131657 |
[1,2,4]Triazolo[1,5-c]pyrimidine-2-sulfonamide, N-(2,6-dichlorophenyl)-5-ethoxy-7-fluoro- |
1714526 |
[1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-5,6-dimethyl-, (3Z,5R,6R,14aR,14bR)- |
9746 |
[1]Benzopyrano[3,4-b]furo[2,3-h][1]benzopyran-6(6aH)-one, 1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)-, (2R,6aS,12aS)- |
17002874 |
[1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,3,7,8-tetrahydroxy- |
17273210 |
[2,2'-Binaphthalene]-8,8'-dicarboxaldehyde, 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)- |
6213 |
[5,5'-Bipyrimidine]-2,2',4,4',6,6'(1H,1'H,3H,3'H,5H,5'H)-hexone, 5,5'-dihydroxy- |
17294984 |
[Bi-1,4-cyclohexadien-1-yl]-3,3',6,6'-tetrone, 2,2',5,5'-tetrahydroxy-4,4'-dimethyl- |
11213 |
1(3H)-Isobenzofuranone |
6452 |
1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)- |
33712 |
1(3H)-Isobenzofuranone, 3,3-bis[4-hydroxy-2-methyl-5-(1-methylethyl)phenyl]- |
17121807 |
1(3H)-Isobenzofuranone, 4,5,6,7-tetrachloro- |
39552 |
1(4H)-Naphthalenone, 4-[(4-hydroxy-1-naphthalenyl)phenylmethylene]- |
708925 |
1(4H)-Pyridinepropanoic acid, .alpha.-amino-3-hydroxy-4-oxo-, (.alpha.S)- |
709105 |
1,1':3',1''-Terphenyl, 5'-phenyl- |
1714438 |
1,10-Decanedithiol |
4101 |
1,10-Phenanthroline |
14175 |
1,1'-Bicyclohexyl |
14183 |
1,1'-Biphenyl |
96222 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decachloro- |
17163742 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decafluoro- |
739359 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6-nonachloro- |
739177 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,5'-octachloro- |
17152042 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,5'-octafluoro-6,6'-dinitro- |
739615 |
1,1'-Biphenyl, 2,2',3,3',4,4',5,6-octachloro- |
692475 |
1,1'-Biphenyl, 2,2',3,3',4,4',5-heptachloro- |
693663 |
1,1'-Biphenyl, 2,2',3,3',4,4',6-heptachloro- |
692848 |
1,1'-Biphenyl, 2,2',3,3',4,4'-hexachloro- |
740001 |
1,1'-Biphenyl, 2,2',3,3',4,5,5',6-octachloro- |
739995 |
1,1'-Biphenyl, 2,2',3,3',4,5,6-heptachloro- |
739060 |
1,1'-Biphenyl, 2,2',3,3',5,5',6,6'-octachloro- |
692517 |
1,1'-Biphenyl, 2,2',3,3',5,5'-hexachloro- |
692863 |
1,1'-Biphenyl, 2,2',3,3',6,6'-hexachloro- |
692962 |
1,1'-Biphenyl, 2,2',3,3'-tetrachloro- |
692467 |
1,1'-Biphenyl, 2,2',3,4,4',5,5'-heptachloro- |
739532 |
1,1'-Biphenyl, 2,2',3,4,4',5',6-heptachloro- |
692459 |
1,1'-Biphenyl, 2,2',3,4,4',5'-hexachloro- |
739169 |
1,1'-Biphenyl, 2,2',3,4,4',5-hexachloro- |
740365 |
1,1'-Biphenyl, 2,2',3,4,4',6,6'-heptachloro- |
739656 |
1,1'-Biphenyl, 2,2',3,4,5,5',6-heptachloro- |
739649 |
1,1'-Biphenyl, 2,2',3,4,5,5'-hexachloro- |
740423 |
1,1'-Biphenyl, 2,2',3,4',5,6,6'-heptachloro- |
739987 |
1,1'-Biphenyl, 2,2',3,4,5,6'-hexachloro- |
693150 |
1,1'-Biphenyl, 2,2',3,4',5'-pentachloro- |
692822 |
1,1'-Biphenyl, 2,2',3,4,5'-pentachloro- |
739508 |
1,1'-Biphenyl, 2,2',3,5,5',6-hexachloro- |
693127 |
1,1'-Biphenyl, 2,2',3,5'-tetrachloro- |
17027418 |
1,1'-Biphenyl, 2,2',4,4',5,5'-hexabromo- |
692442 |
1,1'-Biphenyl, 2,2',4,4',5,5'-hexachloro- |
692343 |
1,1'-Biphenyl, 2,2',4,4',6,6'-hexachloro- |
693036 |
1,1'-Biphenyl, 2,2',4,4',6-pentachloro- |
687640 |
1,1'-Biphenyl, 2,2',4,4'-tetrachloro- |
692731 |
1,1'-Biphenyl, 2,2',4,5,5'-pentachloro- |
693135 |
1,1'-Biphenyl, 2,2',4,5'-tetrachloro- |
739748 |
1,1'-Biphenyl, 2,2',4,6,6'-pentachloro- |
739870 |
1,1'-Biphenyl, 2,2',4,6-tetrachloro- |
692509 |
1,1'-Biphenyl, 2,2',5,5'-tetrachloro- |
692715 |
1,1'-Biphenyl, 2,2',5-trichloro- |
202531 |
1,1'-Biphenyl, 2,2',6,6'-tetrachloro- |
1714531 |
1,1'-Biphenyl, 2,2'-dibromo- |
690032 |
1,1'-Biphenyl, 2,2'-dichloro- |
739391 |
1,1'-Biphenyl, 2,3,3',4,4',5,6-heptachloro- |
692855 |
1,1'-Biphenyl, 2,3,3',4,4',5-hexachloro- |
739227 |
1,1'-Biphenyl, 2,3,3',4',6-pentachloro- |
740258 |
1,1'-Biphenyl, 2,3,3',5,6-pentachloro- |
739458 |
1,1'-Biphenyl, 2,3,3',5'-tetrachloro- |
692152 |
1,1'-Biphenyl, 2,3,3'4,4'-pentachloro- |
692913 |
1,1'-Biphenyl, 2,3,3'-trichloro- |
739888 |
1,1'-Biphenyl, 2,3',4,4',5'-pentachloro- |
692087 |
1,1'-Biphenyl, 2,3',4,4',5-pentachloro- |
740266 |
1,1'-Biphenyl, 2,3,4,4',5-pentachloro- |
739755 |
1,1'-Biphenyl, 2,3',4,4',6-pentachloro- |
692210 |
1,1'-Biphenyl, 2,3,4,4'-tetrachloro- |
739086 |
1,1'-Biphenyl, 2,3,4,5,6-pentachloro- |
692137 |
1,1'-Biphenyl, 2,3',4',5-tetrachloro- |
739136 |
1,1'-Biphenyl, 2,3,4,5-tetrachloro- |
692921 |
1,1'-Biphenyl, 2,3,4'-trichloro- |
739144 |
1,1'-Biphenyl, 2,3,5,6-tetrachloro- |
690511 |
1,1'-Biphenyl, 2,3-dichloro- |
739094 |
1,1'-Biphenyl, 2,4,4',6-tetrachloro- |
689331 |
1,1'-Biphenyl, 2,4,4'-trichloro- |
690529 |
1,1'-Biphenyl, 2,4',5-trichloro- |
690370 |
1,1'-Biphenyl, 2,4,5-trichloro- |
692491 |
1,1'-Biphenyl, 2,4,6-trichloro- |
692426 |
1,1'-Biphenyl, 2,4'-dichloro- |
692251 |
1,1'-Biphenyl, 2,4-dichloro- |
692418 |
1,1'-Biphenyl, 2,5-dichloro- |
687368 |
1,1'-Biphenyl, 2-chloro- |
739102 |
1,1'-Biphenyl, 3,3',4,4',5,5'-hexachloro- |
739771 |
1,1'-Biphenyl, 3,3',4,4',5-pentachloro- |
692145 |
1,1'-Biphenyl, 3,3',4,4'-tetrachloro- |
17151861 |
1,1'-Biphenyl, 3,3',5,5'-tetrabromo- |
739128 |
1,1'-Biphenyl, 3,3',5,5'-tetrachloro- |
740092 |
1,1'-Biphenyl, 3,4,4',5-tetrachloro- |
692954 |
1,1'-Biphenyl, 3,4,4'-trichloro- |
688010 |
1,1'-Biphenyl, 3,4-dichloro- |
17151846 |
1,1'-Biphenyl, 3,5-dibromo- |
739151 |
1,1'-Biphenyl, 3,5-dichloro- |
687376 |
1,1'-Biphenyl, 3-chloro- |
66340 |
1,1'-Biphenyl, 3-methyl- |
17152034 |
1,1'-Biphenyl, 3-phenoxy- |
17154881 |
1,1'-Biphenyl, 4-(chloromethyl)- |
14480 |
1,1'-Biphenyl, 4,4'-dibromo- |
17004649 |
1,1'-Biphenyl, 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluoro- |
687350 |
1,1'-Biphenyl, 4,4'-dichloro- |
687384 |
1,1'-Biphenyl, 4-chloro- |
17152844 |
1,1'-Biphenyl, 4-chloro-4'-(1-methylethyl)- |
60228 |
1,1'-Biphenyl, 4-methoxy- |
17074709 |
1,1'-Biphenyl, ar,ar,ar,ar,ar',ar',ar',ar'-octachloro- |
245282 |
1,1'-Biphenyl, chloro- |
85878 |
1,1'-Biphenyl, chloro derivs. |
271106 |
1,1'-Biphenyl, hexabromo- |
240572 |
1,1'-Biphenyl, hexachloro- |
304964 |
1,1'-Biphenyl, octachloro- |
232678 |
1,1'-Biphenyl, pentachloro- |
242784 |
1,1'-Biphenyl, tetrachloro- |
41574 |
1,1-Ethanediol, 2,2,2-trichloro- |
685743 |
1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a-dimethyl-7-(1-methylethylidene)-, (1R-(1.alpha.,4a.beta.,4b.alpha.,10a.alpha.))- |
1714710 |
1,2,3,4-Butanetetrol, (2R,3S)-rel- |
11320 |
1,2,3-Benzenetriol |
6775 |
1,2,3-Propanetricarboxylic acid, 2-hydroxy- |
80242 |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ammonium iron(3+) salt |
72314 |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, copper(2+) salt (1:2) |
100214 |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, iron salt |
4382 |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, trisodium salt |
2279 |
1,2,3-Propanetriol |
20933 |
1,2,3-Propanetriol, triacetate |
1941 |
1,2,3-Propanetriol, trinitrate |
1714304 |
1,2,4,5-Benzenetetracarboxylic acid, 3,6-difluoro- |
1714339 |
1,2,4,5-Benzenetetracarboxylic acid, 3,6-difluoro-, tetramethyl ester |
582494 |
1,2,4,5-Tetrazine, 3,6-bis(2-chlorophenyl)- |
17003542 |
1,2,4-Benzenetriol, 5-(2-aminoethyl)- |
17005166 |
1,2,4-Benzenetriol, 5-(2-aminoethyl)-, hydrochloride |
1714412 |
1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, (1S,2R,3aR,4R,8aR,9S)- |
217307 |
1,2,4-Oxadiazolidine-3,5-dione, 2-(3,4-dichlorophenyl)-4-methyl- |
104901 |
1,2,4-Thiadiazole, 5-ethoxy-3-(trichloromethyl)- |
17152703 |
1,2,4-Triazin-3-amine, 5,6-dimethyl- |
693119 |
1,2,4-Triazin-5(4H)-one, 4-amino-3-methyl-6-phenyl- |
219204 |
1,2,4-Triazin-5(4H)-one, 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)- |
46383 |
1,2,4-Triazine-3,5(2H,4H)-dione |
284463 |
1,2,4-Triazolo[3,4-b]benzothiazole, 5-methyl- |
23812 |
1,2,6-Hexanetriol |
9423 |
1,2-Acenaphthylenedione |
16204 |
1,2-Benzenediamine |
18762 |
1,2-Benzenediamine, 4-nitro- |
60640 |
1,2-Benzenediamine, dihydrochloride |
13284 |
1,2-Benzenedicarbonitrile |
17153123 |
1,2-Benzenedicarbonitrile, 3,4,5,6-tetrafluoro- |
66332 |
1,2-Benzenedicarboxaldehyde |
12138 |
1,2-Benzenedicarboxylic acid |
10496 |
1,2-Benzenedicarboxylic acid, 2-butoxy-2-oxoethyl butyl ester |
65276 |
1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrachloro- |
58511 |
1,2-Benzenedicarboxylic acid, 3-nitro- |
59600 |
1,2-Benzenedicarboxylic acid, 4-nitro-, dimethyl ester |
29959 |
1,2-Benzenedicarboxylic acid, bis(2-butoxyethyl) ester |
29934 |
1,2-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester |
9993 |
1,2-Benzenedicarboxylic acid, bis(2-methylpropyl) ester |
10488 |
1,2-Benzenedicarboxylic acid, butyl 2-ethylhexyl ester |
10470 |
1,2-Benzenedicarboxylic acid, butyl phenylmethyl ester |
131102 |
1,2-Benzenedicarboxylic acid, cyclohexyl 2-methylpropyl ester |
35337 |
1,2-Benzenedicarboxylic acid, di-2-propenyl ester |
10025 |
1,2-Benzenedicarboxylic acid, dibutyl ester |
9985 |
1,2-Benzenedicarboxylic acid, diethyl ester |
10033 |
1,2-Benzenedicarboxylic acid, dihexyl ester |
241752 |
1,2-Benzenedicarboxylic acid, diisodecyl ester |
249813 |
1,2-Benzenedicarboxylic acid, diisononyl ester |
246157 |
1,2-Benzenedicarboxylic acid, diisooctyl ester |
35295 |
1,2-Benzenedicarboxylic acid, dimethyl ester |
10041 |
1,2-Benzenedicarboxylic acid, dinonyl ester |
29967 |
1,2-Benzenedicarboxylic acid, dioctyl ester |
9951 |
1,2-Benzenedicarboxylic acid, diphenyl ester |
35329 |
1,2-Benzenedicarboxylic acid, dipropyl ester |
202515 |
1,2-Benzenedicarboxylic acid, disodium salt |
30486 |
1,2-Benzenedicarboxylic acid, ditridecyl ester |
117705 |
1,2-Benzenedicarboxylic acid, diundecyl ester |
617282 |
1,2-Benzenedicarboxylic acid, heptyl nonyl ester, branched and linear |
688598 |
1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester |
687558 |
1,2-Benzenedicarboxylic acid, monoethyl ester |
72967 |
1,2-Benzenedicarboxylic acid, monopotassium salt |
31427 |
1,2-Benzenediol |
80937 |
1,2-Benzenediol, 3,4,5,6-tetrachloro- |
712596 |
1,2-Benzenediol, 3,4,5-trichloro- |
711705 |
1,2-Benzenediol, 3,4,6-trichloro- |
710038 |
1,2-Benzenediol, 3,4-dichloro- |
1714589 |
1,2-Benzenediol, 3,5-dichloro- |
47357 |
1,2-Benzenediol, 3-methyl- |
17913 |
1,2-Benzenediol, 4-(1,1-dimethylethyl)- |
17163551 |
1,2-Benzenediol, 4-(2-aminoethyl)- |
17121310 |
1,2-Benzenediol, 4,4'-(2,3-dimethyl-1,4-butanediyl)bis- |
709899 |
1,2-Benzenediol, 4,5-dichloro- |
1339 |
1,2-Benzenediol, 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]- |
17163544 |
1,2-Benzenediol, 4-[(1R)-2-amino-1-hydroxyethyl]- |
17294901 |
1,2-Benzenediol, 4-methyl- |
105544 |
1,2-Benzisothiazol-3(2H)-one |
8557 |
1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide |
34520 |
1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt |
69765 |
1,2-Cyclohexanedione |
17151788 |
1,2-Dithiolan-4-amine, N,N-dimethyl- |
17151796 |
1,2-Dithiolan-4-amine, N,N-dimethyl-, hydrochloride |
24208 |
1,2-Ethanediamine |
42663 |
1,2-Ethanediamine, dihydrochloride |
27490 |
1,2-Ethanediamine, N-(2-aminoethyl)- |
28258 |
1,2-Ethanediamine, N,N'-bis(2-aminoethyl)- |
32516 |
1,2-Ethanediamine, N,N'-bis(phenylmethyl)-, diacetate |
19364 |
1,2-Ethanediamine, N,N-diethyl- |
48884 |
1,2-Ethanediamine, N,N'-dinitro- |
40063 |
1,2-Ethanediamine, N,N'-diphenyl- |
87130 |
1,2-Ethanediamine, N-1-naphthalenyl-, dihydrochloride |
24257 |
1,2-Ethanediol |
46599 |
1,2-Ethanediol, 1,1,2,2-tetraphenyl- |
27649 |
1,2-Ethanediol, diacetate |
1714431 |
1,2-Ethanediol, dibenzenesulfonate |
52415 |
1,2-Ethanediol, monoacetate |
1714486 |
1,2-Ethanedisulfonic acid, compd. with 2-chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine (1:1) |
51912 |
1,2-Ethanedithiol |
38786 |
1,2-Hydrazinedicarbothioamide |
26492 |
1,2-Hydrazinedicarboxamide |
121665 |
1,2-Hydrazinedicarboxylic acid, diethyl ester |
50070 |
1,2-Naphthalenedione |
7427 |
1,2-Propanediamine |
2584 |
1,2-Propanediol |
32938 |
1,2-Propanediol, 3-(2-propenyloxy)- |
16733 |
1,2-Propanediol, 3-chloro- |
16758 |
1,2-Propanediol, 3-mercapto- |
685818 |
1,2-Propanediol,3-phenoxy- |
1714592 |
1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (2S,4R)- |
33738 |
1,3(2H,9bH)-Dibenzofurandione, 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl- |
6833 |
1,3,2-Dioxastannepin-4,7-dione, 2,2-dibutyl- |
203166 |
1,3,2-Dioxastannepin-4,7-dione, 2,2-dioctyl- |
1714496 |
1,3,2-Dioxastibolane-4,5-dicarboxylic acid, 2-hydroxy-, 2-oxide |
118661 |
1,3,2-Dioxathiolane, 2-oxide |
100883 |
1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro- |
693051 |
1,3,4-Metheno-1H-cyclobuta[cd]pentalene, 1,1a,2,2,3,3a,4,5,5,5a,5b-undecachlorooctahydro- |
17004128 |
1,3,4-Metheno-1H-cyclobuta[cd]pentalene-2-pentanoic acid, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2-hydroxy-.gamma.-oxo-, ethyl ester |
39313 |
1,3,4-Metheno-2H-cyclobuta[cd]pentalen-2-one, 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro- |
215327 |
1,3,4-Oxadiazol-2(3H)-one, 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)- |
684787 |
1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4,6,6-hexakis(1-aziridinyl)-2,2,4,4,6,6-hexahydro- |
19844 |
1,3,5,7-Tetraazatricyclo[3.3.1.13,7]decane |
106294 |
1,3,5,7-Tetrazocine, octahydro-1,3,5,7-tetranitro- |
25221 |
1,3,5,7-Tetroxocane, 2,4,6,8-tetramethyl- |
25312 |
1,3,5-Benzenetriamine |
25320 |
1,3,5-Benzenetriol |
17272964 |
1,3,5-Benzenetriol, 2-methyl- |
708966 |
1,3,5-Cycloheptatriene |
708701 |
1,3,5-Naphthalenetrisulfonic acid, 8,8'-[carbonylbis[imino-3,1-phenylenecarbonylimino(4-methyl-3,1-phenylene)carbonylimino]]bis- |
17123530 |
1,3,5-Triazin-2(1H)-one, 4-(ethylamino)-6-[(1-methylethyl)amino]- |
17002726 |
1,3,5-Triazin-2(1H)-one, 4-amino-1-.beta.-D-ribofuranosyl- |
19885 |
1,3,5-Triazin-2-amine, 4,6-dichloro-N-(2-chlorophenyl)- |
688648 |
1,3,5-Triazin-2-amine, 4-azido-N-(1-methylethyl)-6-(methylthio)- |
25353 |
1,3,5-Triazine, 2,4,6-trichloro- |
684746 |
1,3,5-Triazine, 2,4,6-tris(1-aziridinyl)- |
31948 |
1,3,5-Triazine, hexahydro-1,3,5-trinitro- |
127035 |
1,3,5-Triazine-1,3,5(2H,4H,6H)-triethanol |
291062 |
1,3,5-Triazine-2,4(1H,3H)-dione, 3-cyclohexyl-6-(dimethylamino)-1-methyl- |
25387 |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione |
11478 |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro- |
99333 |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, potassium salt |
108449 |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt |
291898 |
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt, dihydrate |
365270 |
1,3,5-Triazine-2,4,6-triamine, ethanedioate (1:1) |
152454 |
1,3,5-Triazine-2,4,6-triamine, N,N',N''-trichloro- |
355479 |
1,3,5-Triazine-2,4,6-triamine, N-cyclopropyl- |
161323 |
1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde |
52466414 |
1,3,5-Triazine-2,4-diamine, 6-(ethylthio)-N,N'-bis(1-methylethyl)- |
115386 |
1,3,5-Triazine-2,4-diamine, 6-chloro- |
136101 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N-(1,1-dimethylethyl)-N'-ethyl- |
775908 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N-(1-methylethyl)- |
17122805 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N,N',N'-tetraethyl- |
94136 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N,N'-triethyl- |
37416 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N'-bis(1-methylethyl)- |
32219 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N'-diethyl- |
17123423 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N,N-diethyl-N'-(1-methylethyl)- |
962704 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N-cyclopropyl-N'-(1-methylethyl)- |
94128 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N-ethyl-N'-(1-methylethyl)- |
109983 |
1,3,5-Triazine-2,4-diamine, 6-chloro-N-methyl-N'-(1-methylethyl)- |
89474 |
1,3,5-Triazine-2,4-diamine, 6-methoxy-N,N'-bis(1-methylethyl)- |
961532 |
1,3,5-Triazine-2,4-diamine, 6-methoxy-N,N'-bis(3-methoxypropyl)- |
73189 |
1,3,5-Triazine-2,4-diamine, N-(1,1-dimethylethyl)-N'-ethyl-6-(methylthio)- |
264945 |
1,3,5-Triazine-2,4-diamine, N-(1,1-dimethylethyl)-N'-ethyl-6-methoxy- |
222828 |
1,3,5-Triazine-2,4-diamine, N-(1,2-dimethylpropyl)-N'-ethyl-6-(methylthio)- |
17122920 |
1,3,5-Triazine-2,4-diamine, N-(3-methoxypropyl)-N'-(1-methylethyl)-6-(methylthio)- |
17121328 |
1,3,5-Triazine-2,4-diamine, N-(4-chlorophenyl)- |
148098 |
1,3,5-Triazine-2,4-diamine, N,N'-bis(1-methylethyl)-6-(methylthio)- |
961342 |
1,3,5-Triazine-2,4-diamine, N,N'-diethyl-6-(methylthio)- |
961250 |
1,3,5-Triazine-2,4-diamine, N,N'-diethyl-6-methoxy- |
17124025 |
1,3,5-Triazine-2,4-diamine, N,N-diethyl-6-methoxy-N'-(1-methylethyl)- |
248120 |
1,3,5-Triazine-2,4-diamine, N-cyclopropyl-N'-(1,1-dimethylethyl)-6-(methylthio)- |
961508 |
1,3,5-Triazine-2,4-diamine, N-ethyl-6-methoxy-N'-(1-methylethyl)- |
237990 |
1,3,5-Triazine-2,4-diamine, N-ethyl-6-methoxy-N'-(1-methylpropyl)- |
71894 |
1,3,5-Triazine-2,4-diamine, N-ethyl-N'-(1-methylethyl)-6-(methylthio)- |
17123043 |
1,3,5-Triazine-2,4-diamine, N-methyl-N'-(1-methylethyl)-6-(methylthio)- |
27052 |
1,3,5-Trioxane |
25122 |
1,3-Benzenediamine |
251843 |
1,3-Benzenediamine, 2,6-dinitro-N1,N1-dipropyl-4-(trifluoromethyl)- |
47845 |
1,3-Benzenediamine, 4-(phenylazo)- |
168187 |
1,3-Benzenediamine, 4,4'-[1,3-phenylenebis(azo)]bis-, dihydrochloride |
16410 |
1,3-Benzenediamine, 4-methyl- |
52191 |
1,3-Benzenediamine, dihydrochloride |
251819 |
1,3-Benzenediamine, N1,N1-diethyl-2,6-dinitro-4-(trifluoromethyl)- |
63669 |
1,3-Benzenedicarbonitrile |
93971 |
1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro- |
25130 |
1,3-Benzenediol |
9381 |
1,3-Benzenediol, 2,4,6-trinitro- |
198986 |
1,3-Benzenediol, 2,4,6-trinitro-, lead(2+) salt (1:1) |
65425 |
1,3-Benzenediol, 2-amino-, hydrochloride |
96297 |
1,3-Benzenediol, 4-(phenylazo)- |
131433 |
1,3-Benzenediol, 4,6-bis(1,1-dimethylethyl)- |
36897 |
1,3-Benzenediol, 4,6-dichloro- |
5041 |
1,3-Benzenediol, 4-[(4-nitrophenyl)azo]- |
16477 |
1,3-Benzenediol, 4-chloro- |
36723 |
1,3-Benzenediol, 4-hexyl- |
39917 |
1,3-Benzenedisulfonic acid, 4,5-dihydroxy-, disodium salt |
222505 |
1,3-Benzodioxol-4-ol, 2,2-dimethyl-, methylcarbamate |
50898 |
1,3-Benzodioxol-5-ol |
40907 |
1,3-Benzodioxole |
15537 |
1,3-Benzodioxole, 5-(2-propenyl)- |
1263 |
1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl- |
1714393 |
1,3-Benzodioxole, 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl-, mixt. with kerosine and pyrethrins |
31328 |
1,3-Benzodioxole, 5-[2-(octylsulfinyl)propyl]- |
31294 |
1,3-Benzodioxole-5-carboxaldehyde |
15503 |
1,3-Benzodioxole-5-carboxylic acid |
11346 |
1,3-Butadiene, 1,1,2,3,4,4-hexachloro- |
49585 |
1,3-Butadiene, 2,3-dimethyl- |
7328 |
1,3-Butadiene, 2-methyl- |
15164 |
1,3-Butanedione, 1-phenyl- |
57224 |
1,3-Cyclohexadiene |
18978 |
1,3-Cyclohexadiene, 1-methyl-4-(1-methylethyl)- |
33993 |
1,3-Cyclohexanedione, 5,5-dimethyl- |
17295205 |
1,3-Cyclohexanedione, 5-phenyl- |
6494 |
1,3-Cyclopentadiene, 1,2,3,4,5,5-hexachloro- |
71662 |
1,3-Dioxan-4-ol, 2,6-dimethyl-, acetate |
17128299 |
1,3-Dioxane, 2-ethyl-5-methyl-5-[(2-methylphenyl)methoxy]-, cis- |
16881 |
1,3-Dioxolan-2-one |
66605 |
1,3-Dioxolane |
19711 |
1,3-Dioxolane-4-methanol, 2,2-dimethyl- |
17294992 |
1,3-Dioxolo[4,5-b]acridin-10(5H)-one, 4,11-dimethoxy-5-methyl- |
1714689 |
1,3-Dioxolo[4,5-g]quinoline-7-carboxylic acid, 5-ethyl-5,8-dihydro-8-oxo- |
17151804 |
1,3-Dithiolan-2-one, O-[(methylamino)carbonyl]oxime |
102244 |
1,3-Dithiolo[4,5-b]quinoxalin-2-one, 6-methyl- |
15792 |
1,3-Hexanediol, 2-ethyl- |
10355 |
1,3-Isobenzofurandione |
10348 |
1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro- |
29686 |
1,3-Isobenzofurandione, 4,5,6,7-tetrachloro- |
66266 |
1,3-Isobenzofurandione, 4-nitro- |
10330 |
1,3-Isobenzofurandione, hexahydro- |
105098 |
1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[4-amino-5-hydroxy-, tetrasodium salt |
42101 |
1,3-Naphthalenedisulfonic acid, 6,6'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[4-amino-5-hydroxy-, tetrasodium salt |
72066 |
1,3-Naphthalenedisulfonic acid, 7-hydroxy-, disodium salt |
105148 |
1,3-Naphthalenedisulfonic acid, 7-hydroxy-8-[(4-sulfo-1-naphthalenyl)azo]-, trisodium salt |
17151812 |
1,3-Oxathiolan-2-one, 5-methyl-, O-(methylcarbamoyl)oxime |
1714709 |
1,3-Pentanediol, 2-methyl- |
26112 |
1,3-Propanediamine |
1714334 |
1,3-Propanediamine, dihydrochloride |
147546 |
1,3-Propanediamine, N-(9Z)-9-octadecenyl- |
27110 |
1,3-Propanediamine, N,N,N',N'-tetramethyl- |
133702 |
1,3-Propanediamine, N-dodecyl- |
48751 |
1,3-Propanediol |
33803 |
1,3-Propanediol, 2-(hydroxymethyl)-2-nitro- |
29223 |
1,3-Propanediol, 2,2-bis(hydroxymethyl)- |
6882 |
1,3-Propanediol, 2,2-bis[(nitrooxy)methyl]-, dinitrate (ester) |
17154030 |
1,3-Propanediol, 2-[(1-methyl-2-phenoxyethyl)amino]-1-phenyl-, hydrochloride |
6734 |
1,3-Propanediol, 2-amino-2-(hydroxymethyl)- |
29199 |
1,3-Propanediol, 2-amino-2-methyl- |
1560 |
1,3-Propanediol, 2-bromo-2-nitro- |
6817 |
1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)- |
31203 |
1,3-Propanedione, 1,3-diphenyl- |
26153 |
1,3-Propanedithiol |
208280 |
1,4,7,10,13,16-Hexaoxacyclooctadecane |
1714586 |
1,4:5,8:9,10-Trimethanoanthracene, 1,2,3,4,5,6,7,8,12,12,13,13-dodecachloro-1,4,4a,5,8,8a,9,9a,10,10a-decahydro- |
42002 |
1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1.alpha.,4.alpha.,4a.beta.,5.alpha.,8.alpha.,8a.beta.)- |
46615 |
1,4:5,8-Dimethanonaphthalene, 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-, (1R,4S,4aS,5R,8S,8aR)-rel- |
1714664 |
1,4:5,8-Dimethanophthalazine, 5,6,7,8,9,9-hexachloro-1,4,4a,5,8,8a-hexahydro-, 2-oxide |
258350 |
1,4:6,9-Dimethanodibenzofuran, 1,2,3,4,6,7,8,9,10,10,11,11-dodecachloro-1,4,4a,5a,6,9,9a,9b-octahydro- |
188433 |
1,4:7,10-Dimethanodibenzo[a,e]cyclooctene, 1,2,3,4,7,8,9,10,13,13,14,14-dodecachloro-1,4,4a,5,6,6a,7,10,10a,11,12,12a-dodecahydro- |
23663 |
1,4-Benzenediamine |
59360 |
1,4-Benzenediamine, 2,6-dichloro- |
16311 |
1,4-Benzenediamine, 2-methyl- |
140822 |
1,4-Benzenediamine, 2-methyl-, sulfate |
20297 |
1,4-Benzenediamine, N-(1-methylethyl)-N'-phenyl- |
70508 |
1,4-Benzenediamine, N-(1-methylpropyl)-N'-phenyl- |
51441 |
1,4-Benzenediamine, N-(4-aminophenyl)- |
65748 |
1,4-Benzenediamine, N,N,N',N'-tetramethyl-, dihydrochloride |
20487 |
1,4-Benzenediamine, N,N'-bis(1-methylpropyl)- |
14886 |
1,4-Benzenediamine, N,N'-di-2-naphthalenyl- |
205377 |
1,4-Benzenediamine, N,N-diethyl-, hydrochloride |
19075 |
1,4-Benzenediamine, N,N-dimethyl- |
5033 |
1,4-Benzenediamine, N,N'-diphenyl- |
96271 |
1,4-Benzenediamine, N4,N4-diethyl-2-methyl-, monohydrochloride |
20164 |
1,4-Benzenediamine, N-phenyl- |
17153115 |
1,4-Benzenedicarbonitrile, 2,3,5,6-tetrafluoro- |
19273 |
1,4-Benzenedicarboxylic acid |
775841 |
1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro- |
93518 |
1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, dimethyl ester |
775759 |
1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro-, monomethyl ester |
131425 |
1,4-Benzenedicarboxylic acid, 2-amino-, dimethyl ester |
130658 |
1,4-Benzenedicarboxylic acid, 2-nitro-, dimethyl ester |
709667 |
1,4-Benzenedicarboxylic acid, dibutyl ester |
17124538 |
1,4-Benzenedicarboxylic acid, dioctyl ester |
32904 |
1,4-Benzenediol |
94847 |
1,4-Benzenediol, 2-(1,1-dimethylethyl)- |
11445 |
1,4-Benzenediol, 2,3,5,6-tetrachloro- |
55798 |
1,4-Benzenediol, 2-bromo- |
60848 |
1,4-Benzenediol, 2-chloro- |
16329 |
1,4-Benzenediol, 2-methyl- |
81174 |
1,4-Benzenediol, diacetate |
83717 |
1,4-Benzenediol, dimethyl- |
18028 |
1,4-Benzenedisulfonic acid, 2-amino- |
17295197 |
1,4-Benzodioxin, 2,3-dihydro- |
26799 |
1,4-Butanediamine |
42721 |
1,4-Butanediamine, dihydrochloride |
33472 |
1,4-Butanediamine, N-(3-aminopropyl)- |
4762 |
1,4-Butanediamine, N,N'-bis(3-aminopropyl)- |
41848 |
1,4-Butanediamine, N,N'-bis(3-aminopropyl)-, tetrahydrochloride |
26823 |
1,4-Butanediol |
684837 |
1,4-Butanediol, dimethanesulfonate |
132787 |
1,4-Butanedisulfonic acid, 1,4-dihydroxy-, disodium salt |
80507 |
1,4-Butanedithiol |
18960 |
1,4-Cyclohexadiene, 1-methyl-4-(1-methylethyl)- |
70466 |
1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, diethyl ester |
1714222 |
1,4-Cyclohexanedicarboxylic acid, diethyl ester |
65946 |
1,4-Cyclohexanedione |
40923 |
1,4-Diazabicyclo[2.2.2]octane |
33241 |
1,4-Dioxane |
48793 |
1,4-Dithiane |
303883 |
1,4-Dithiin, 2,3-dihydro-5,6-dimethyl-, 1,1,4,4-tetraoxide |
46938 |
1,4-Methanoazulene, decahydro-4,8,8-trimethyl-9-methylene-, (1S,3aR,4S,8aS)- |
81042 |
1,4-Methanonaphthalene-5,8-dione, 1,4,4a,8a-tetrahydro- |
58859 |
1,4-Naphthalenedicarboxylic acid |
54981 |
1,4-Naphthalenediol |
35139 |
1,4-Naphthalenedione |
29926 |
1,4-Naphthalenedione, 2,3-dichloro- |
17121427 |
1,4-Naphthalenedione, 2-amino-3-chloro- |
9720 |
1,4-Naphthalenedione, 2-hydroxy- |
100354 |
1,4-Naphthalenedione, 2-methoxy- |
2782 |
1,4-Naphthalenedione, 2-methyl- |
10074 |
1,4-Naphthalenedione, 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl]- |
17295031 |
1,4-Naphthalenedione, 5-hydroxy- |
17295049 |
1,4-Naphthalenedione, 5-hydroxy-2-methyl- |
130203 |
1,4-Oxathiin-3-carboxamide, 5,6-dihydro-2-methyl-N-phenyl- |
130302 |
1,4-Oxathiin-3-carboxamide, 5,6-dihydro-2-methyl-N-phenyl-, 4,4-dioxide |
51565 |
1,4-Pentadien-3-one, 1,5-diphenyl- |
17156753 |
1,4-Pentanediamine, N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl- |
684902 |
1,4-Pentanediamine, N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl-, dihydrochloride |
17163486 |
1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, phosphate (1:2) |
49973 |
1,4-Phthalazinedione, 5-amino-2,3-dihydro- |
147710 |
1,4-Piperazinedipropanamine |
128298 |
1,5,9-Cyclododecatriene |
27862 |
1,5-Cyclooctadiene |
64147 |
1,5-Hexadiene, 2,5-dimethyl- |
17003799 |
1,5-Naphthalenediamine |
9662 |
1,5-Naphthalenediol |
113100 |
1,5-Naphthalenedisulfonic acid, 3,3'-[carbonylbis[imino(2-methyl-4,1-phenylene)azo]]bis-, tetrasodium salt |
584797 |
1,5-Naphthalenedisulfonic acid, 3-[(4-amino-5-methoxy-2-methylphenyl)azo]-, lithium sodium salt |
524669900 |
1,5-Pentanediamine |
27417 |
1,5-Pentanediol |
147736 |
1,6,10-Dodecatrien-3-ol, 3,7,11-trimethyl- |
46177 |
1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
137224 |
1,6-Hexanediamine, dihydrochloride |
27318 |
1,6-Hexanediamine, N,N,N',N'-tetramethyl- |
64626 |
1,6-Hexanediol |
7245 |
1,6-Octadien-3-ol, 3,7-dimethyl- |
29314 |
1,6-Octadien-3-ol, 3,7-dimethyl-, acetate |
32946 |
1,6-Octadiene, 7-methyl-3-methylene- |
55152 |
1,7-Naphthalenediol |
47035 |
1,8-Naphthalenediamine |
17002791 |
1,8-Naphthyridine-3-carboxylic acid, 1-ethyl-1,4-dihydro-7-methyl-4-oxo- |
1714522 |
1,8-Naphthyridine-3-carboxylic acid, 7-[(3S)-3-amino-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo- |
90100 |
1,9-Decadiene |
116236 |
1,9-Nonanedithiol |
14464 |
10H-Phenothiazine |
1714534 |
10H-Phenothiazine, 10-[2-(1-methyl-2-piperidinyl)ethyl]-2-(methylthio)-, monohydrochloride |
1714451 |
10H-Phenothiazine, 5-oxide |
684720 |
10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl- |
4507 |
10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-, monohydrochloride |
1677 |
10H-Phenothiazine-10-propanamine, N,N-dimethyl-, monohydrochloride |
2808 |
10H-Phenoxarsine, 10,10'-oxybis- |
108100 |
10H-Phenoxarsine, 10-chloro- |
28381 |
10-Undecenoic acid |
25841 |
10-Undecenoic acid, butyl ester |
27896 |
10-Undecenoic acid, methyl ester |
54155 |
10-Undecenoic acid, zinc salt |
1714435 |
11H,13H-Oxireno[d]pyrano[4',3':3,3a]isobenzofuro[5,4-f][2]benzopyran-4,6,13(2H,5aH)-trione, 8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-, (2aR,4aR,4bR,5aS,8S,8aS,10aR,10bR,14aS)- |
17155250 |
11H-Benzo[a]carbazole |
17155243 |
11H-Benzo[a]fluorene |
300368 |
11-Hexadecenal, (11Z)- |
218321 |
11-Tetradecen-1-ol, acetate, (11Z)- |
17154014 |
12H-Dibenzo[d,g][1,3,6]dioxazocine-12-propanamine, 2-chloro-N,N,.beta.-trimethyl-, hydrochloride |
28761 |
13-Docosenoic acid, (13Z)- |
17163676 |
13H-4,6:21,24-Dietheno-8,12-metheno-1H-pyrido[3',2':14,15][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolinium, 2,3,13a,14,15,16,25,25a-octahydro-9,19-dihydroxy-18,29-dimethoxy-1,14,14-trimethyl-, (13aR,25aS)- |
48710 |
18-Pentatriacontanone |
2626 |
19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol, (17.alpha.)- |
34579 |
1-Anthracenesulfonic acid, 9,10-dihydro-9,10-dioxo-, sodium salt |
26088 |
1-Butanamine |
17151416 |
1-Butanamine, 3,3-dimethyl- |
20990 |
1-Butanamine, N,N-dibutyl- |
27995 |
1-Butanamine, N-butyl- |
179259 |
1-Butanamine, N-butyl-, tetrafluoroborate(1-) |
73700 |
1-Butanamine, N-butyl-N-nitroso- |
90027 |
1-Butanaminium, N,N,N-tributyl-, bromide |
100925 |
1-Butanesulfonic acid, sodium salt |
100958 |
1-Butanesulfonyl chloride |
26146 |
1-Butanethiol |
4739 |
1-Butanol |
16691 |
1-Butanol, 2-amino- |
36947 |
1-Butanol, 2-methyl- |
59410 |
1-Butanol, 2-nitro- |
63370 |
1-Butanol, 3,3-dimethyl- |
33027 |
1-Butanol, 3-methyl- |
33258 |
1-Butanol, 3-methyl-, acetate |
17153578 |
1-Butanol, 4-phenoxy- |
47811 |
1-Butanone, 1-phenyl- |
134379 |
1-Butanone, 2-ethyl-1-phenyl- |
684795 |
1-Butanone, 4-[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]-1-(4-fluorophenyl)- |
69294 |
1-Butene, 3,4-dichloro- |
45575 |
1-Cyclohexene-1-carboxaldehyde, 2,6,6-trimethyl- |
17151614 |
1-Cyclohexene-1-carboxylic acid, 4-[(1R)-1,5-dimethyl-3-oxo-4-hexenyl]-, methyl ester, (4R)- |
17152893 |
1-Cyclohexene-1-carboxylic acid, 4-[(1R)-1,5-dimethyl-3-oxohexyl]-, methyl ester, (4R)- |
95505 |
1-Decanamine |
1714650 |
1-Decanamine, hydrochloride |
96677 |
1-Decanaminium, N,N,N-trimethyl-, bromide |
1714725 |
1-Decanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt |
147520 |
1-Decanaminium, N-decyl-N,N-dimethyl-, chloride |
28308 |
1-Decanol |
137117 |
1-Decanone, 1-phenyl- |
72702 |
1-Decene |
33480 |
1-Dodecanamine |
17152752 |
1-Dodecanamine, compd. with 2,4,6-trinitrophenol (1:1) |
21048 |
1-Dodecanamine, N,N-didodecyl- |
28191 |
1-Dodecanamine, N,N-dimethyl- |
28043 |
1-Dodecanaminium, N,N,N-trimethyl-, chloride |
197731 |
1-Dodecanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt |
114041 |
1-Dodecanaminium, N-dodecyl-N,N-dimethyl-, bromide |
115436 |
1-Dodecanaminium, N-dodecyl-N,N-dimethyl-, chloride |
100917 |
1-Dodecanesulfonic acid, sodium salt |
28506 |
1-Dodecanol |
17121815 |
1-Dodecanol, ethoxy- |
90563 |
1-Dodecanone, 1-phenyl- |
1714432 |
1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione, 3,4,7a,10a-tetrahydro-5-methoxy-, (7aR,10aS)- |
17004466 |
1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione, 3,4,7a,9,10,10a-hexahydro-5-methoxy-, (7aR,10aS)- |
153254 |
1H,3H,5H-Oxazolo[3,4-c]oxazole, 7a-ethyldihydro- |
121053 |
1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-chloro- |
708909 |
1H,3H-Pyrano[4,3-b][1]benzopyran-9-carboxylic acid, 4,10-dihydro-3,7,8-trihydroxy-3-methyl-10-oxo- |
962209 |
1H,7H-Naphtho[1,8-bc:4,4a-c']difuran-5,10a(8H)-dicarboxylic acid, 10-(acetyloxy)octahydro-3,5-dihydroxy-4-methyl-8-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-4-[(1aR,2S,3aS,6aS,7S,7aS)-3a,6a,7,7a-tetrahydro-6a-hydroxy-7a-methyl-2,7-methanofuro[2,3-b]oxireno[e]o |
3533 |
1H-1,2,4-Triazol-3-amine |
316398 |
1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]- |
621508 |
1H-1,2,4-Triazole, 1-[[2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl]methyl]- |
699751 |
1H-1,2,4-Triazole, 1-[[4-bromo-2-(2,4-dichlorophenyl)tetrahydro-2-furanyl]methyl]- |
145359 |
1H-1,2,4-Triazole, 3-chloro- |
604900 |
1H-1,2,4-Triazole-1-ethanol, .alpha.-(4-chlorophenyl)-.alpha.-(1-cyclopropylethyl)- |
699223 |
1H-1,2,4-Triazole-1-ethanol, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-(1,1-dimethylethyl)- |
303719 |
1H-1,2,4-Triazole-1-ethanol, .beta.-(4-chlorophenoxy)-.alpha.-(1,1-dimethylethyl)- |
588822 |
1H-1,2,4-Triazole-1-ethanol, .beta.-[(4-chlorophenyl)methyl]-.alpha.-(1,1-dimethylethyl)-, (.alpha.R,.beta.R)-rel- |
595702 |
1H-1,2,4-Triazole-1-ethanol, .beta.-[(4-chlorophenyl)methylene]-.alpha.-(1,1-dimethylethyl)-, (.alpha.S,.beta.E)- |
17121930 |
1H-1,2,4-Triazole-1-ethanol, .beta.-[(4-chlorophenyl)methylene]-.alpha.-(1,1-dimethylethyl)-, (.beta.E)- |
618793 |
1H-1,2,4-Triazole-1-propanenitrile, .alpha.-[2-(4-chlorophenyl)ethyl]-.alpha.-phenyl- |
600957 |
1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- |
86967 |
1H-1,2,4-Triazole-3,5-diamine |
228676 |
1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-(1-methylethyl)-, 2,2-dioxide |
239954 |
1H-2-Benzoxacyclotetradecin-1-one, 3,4,5,6,7,8,9,10,11,12-decahydro-7,14,16-trihydroxy-3-methyl-, (3S,7R)- |
46656 |
1H-3a,7-Methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, (3R,3aS,7S,8aS)- |
17153479 |
1H-3a,7-Methanoazulene, octahydro-1,4,9,9-tetramethyl- |
1714488 |
1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-, hydrochloride, (5R)- |
700815 |
1H-as-Indaceno[3,2-d]oxacyclododecin-7,15-dione, 2-[(6-deoxy-2,3,4-tri-O-methyl-.alpha.-L-mannopyranosyl)oxy]-13-[[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-14-methyl- |
98590 |
1H-Azepine-1-carbothioic acid, hexahydro-, S-ethyl ester |
17123886 |
1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-[(diethoxyphosphinothioyl)oxy]- |
17123316 |
1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-[(diethoxyphosphinyl)oxy]- |
17151721 |
1H-Benz[f]indene, 2,3-dihydro- |
74559 |
1H-Benzimidazol-2-amine |
1289 |
1H-Benzimidazole |
39826 |
1H-Benzimidazole, 2-(4-thiazolyl)- |
68726 |
1H-Benzimidazole, 2-phenyl- |
60541 |
1H-Benzimidazole, 5-methyl- |
15495 |
1H-Benzimidazole, 5-nitro- |
17126244 |
1H-Benzimidazole-1-carboxylic acid, 5,6-dichloro-2-(trifluoromethyl)-, phenyl ester |
15909 |
1H-Benzotriazole |
100222 |
1H-Benzotriazole, 5-nitro- |
687434 |
1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 3-cyclohexyl-6,7-dihydro- |
122523 |
1-Heptadecanamine |
284356 |
1-Heptadecanol, 16-methyl- |
27771 |
1-Heptanamine |
27797 |
1-Heptanol |
17119124 |
1-Heptanol, 6-methyl- |
90530 |
1-Heptanone, 1-phenyl- |
57240 |
1-Heptene |
17153685 |
1-Heptyn-3-ol, 3,6-dimethyl- |
39271 |
1-Hexadecanamine |
28647 |
1-Hexadecanamine, N,N-dimethyl- |
1714563 |
1-Hexadecanaminium, N,N,N-triethyl-, bromide |
2410 |
1-Hexadecanaminium, N,N,N-trimethyl-, bromide |
28050 |
1-Hexadecanaminium, N,N,N-trimethyl-, chloride |
33332 |
1-Hexadecanaminium, N-ethyl-N,N-dimethyl-, bromide |
17152976 |
1-Hexadecanaminium, N-hexadecyl-N,N-dimethyl-, chloride |
271924 |
1-Hexadecanol |
78857 |
1-Hexadecanol, hydrogen sulfate, sodium salt |
64881 |
1-Hexadecene |
27383 |
1-Hexanamine |
22319 |
1-Hexanamine, 2-ethyl- |
39214 |
1-Hexanamine, N-hexyl- |
27391 |
1-Hexanol |
22327 |
1-Hexanol, 2-ethyl- |
115915 |
1-Hexanol, 3,5,5-trimethyl- |
74922 |
1-Hexanone, 1-phenyl- |
127670 |
1-Hexen-3-ol |
17151754 |
1-Hexen-3-one |
57158 |
1-Hexene |
17273129 |
1H-Imidazo[4,5-b]pyridine |
700989 |
1H-Imidazol-2-amine, 1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydro-N-nitro- |
41053 |
1H-Imidazole |
748954 |
1H-Imidazole, 1,2-dimethyl-5-nitro- |
473413 |
1H-Imidazole, 1-[(1E)-1-[[4-chloro-2-(trifluoromethyl)phenyl]imino]-2-propoxyethyl]- |
269597 |
1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]- |
17005042 |
1H-Imidazole, 1-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-, mononitrate |
710061 |
1H-Imidazole, 1-butyl- |
47217 |
1H-Imidazole, 2,4,5-triphenyl- |
74385 |
1H-Imidazole, 2-ethyl-4-methyl- |
53850 |
1H-Imidazole, 2-heptadecyl-4,5-dihydro-, monoacetate |
67942 |
1H-Imidazole, 2-methyl- |
3210 |
1H-Imidazole, 4,5-dihydro-2-(phenylmethyl)-, monohydrochloride |
362533 |
1H-Imidazole-1-carboxamide, N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]- |
116442 |
1H-Imidazole-1-ethanamine, 2-(8-heptadecenyl)-4,5-dihydro- |
45724 |
1H-Imidazole-1-ethanol, 2-methyl-5-nitro- |
694620 |
1H-Imidazole-1-propanenitrile, .alpha.-butyl-.alpha.-phenyl- |
1354 |
1H-Imidazole-4-ethanamine |
17295254 |
1H-Imidazole-4-ethanaminium, .alpha.-carboxy-2,3-dihydro-N,N,N-trimethyl-2-thioxo-, inner salt, (.alpha.S)- |
214585 |
1H-Indazol-5-amine |
17273111 |
1H-Indazole |
131763 |
1H-Indazole, 5-nitro- |
9563 |
1H-Inden-1-one, 2,3-dihydro- |
87254 |
1H-Inden-5-ol, 2,3-dihydro- |
15891 |
1H-Indene |
47886 |
1H-Indene, 2,3-dihydro- |
58891 |
1H-Indene-1,3(2H)-dione |
9522 |
1H-Indene-1,3(2H)-dione, 2-(2,2-dimethyl-1-oxopropyl)- |
137737 |
1H-Indene-1,3(2H)-dione, 2-(2,2-dimethyl-1-oxopropyl)-, ion(1-), sodium |
151621 |
1H-Indene-1,3(2H)-dione, 2-(3-hydroxy-2-quinolinyl)- |
17122243 |
1H-Indene-1,3(2H)-dione, 2-(3-methyl-1-oxobutyl)- |
9365 |
1H-Indene-1,3(2H)-dione, 2-(diphenylacetyl)- |
47241 |
1H-Indene-1,3(2H)-dione, 2,2-dihydroxy- |
118166 |
1H-Indene-1,3(2H)-dione, 2-[(4-chlorophenyl)phenylacetyl]- |
59121 |
1H-Indol-3-ol, acetate (ester) |
130039 |
1H-Indol-5-amine |
17163494 |
1H-Indol-5-ol, 3-(2-aminoethyl)- |
17295122 |
1H-Indol-5-ol, 3-[2-(dimethylamino)ethyl]- |
31377 |
1H-Indole |
47894 |
1H-Indole, 2,3-dihydro- |
110957 |
1H-Indole, 2,3-dihydro-1,3,3-trimethyl-2-[(2-methyl-3H-indol-3-ylidene)ethylidene]-, monohydrochloride |
15941 |
1H-Indole, 2-methyl- |
9571 |
1H-Indole, 3-methyl- |
710590 |
1H-Indole, 5-bromo- |
13516 |
1H-Indole-2,3-dione |
1714406 |
1H-Indole-2,3-dione, 7-methyl- |
11239 |
1H-Indole-3-acetic acid |
1714698 |
1H-Indole-3-acetic acid, .alpha.-oxo- |
1701 |
1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl- |
70094 |
1H-Indole-3-acetonitrile |
599399 |
1H-Indole-3-butanethioic acid, S-phenyl ester |
35873 |
1H-Indole-3-butanoic acid |
47316 |
1H-Indole-3-carboxaldehyde |
17163734 |
1H-Indole-3-ethanamine |
50146 |
1H-Indole-3-ethanol |
71761 |
1H-Indole-3-propanoic acid |
72207 |
1H-Indole-5-sulfonic acid, 2-(1,3-dihydro-3-oxo-5-sulfo-2H-indol-2-ylidene)-2,3-dihydro-3-oxo-, disodium salt |
10322 |
1H-Isoindole-1,3(2H)-dione |
17001959 |
1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)- |
119909 |
1H-Isoindole-1,3(2H)-dione, 2-(2-hydroxyethyl)- |
30130 |
1H-Isoindole-1,3(2H)-dione, 2-(hydroxymethyl)- |
35808 |
1H-Isoindole-1,3(2H)-dione, 2-[(trichloromethyl)thio]- |
49924 |
1H-Isoindole-1,3(2H)-dione, 2-phenyl- |
101816 |
1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]- |
35790 |
1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[(trichloromethyl)thio]- |
77727 |
1H-Isoindole-1,3(2H)-dione, potassium salt |
17005158 |
1H-Isoindole-1,3(2H)-dione, tetrahydro- |
17273061 |
1H-Phenalene |
1714303 |
1H-Purin-2-amine, 6-chloro- |
4986 |
1H-Purin-6-amine |
50112 |
1H-Purin-6-amine, N-(2-furanylmethyl)- |
81331 |
1H-Purin-6-amine, N-(phenylmethyl)- |
42283 |
1H-Purin-6-amine, sulfate (2:1) |
1714450 |
1H-Purine |
4564 |
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro- |
17153487 |
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, potassium salt |
17153057 |
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt |
94045 |
1H-Purine-2,6-diamine |
4556 |
1H-Purine-2,6-dione, 3,7-dihydro- |
2741 |
1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl- |
2816 |
1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl- |
9712 |
1H-Purine-2,6-dione, 3,7-dihydro-3,7-dimethyl- |
1714584 |
1H-Purine-2,6-dione, 8-chloro-3,7-dihydro- |
41038 |
1H-Pyrazole |
4267 |
1H-Pyrazole, 3,5-dimethyl- |
686923 |
1H-Pyrazole, 3-methyl- |
17127861 |
1H-Pyrazole-1-acetamide, 3,4,5-tribromo-N,N,.alpha.-trimethyl- |
621722 |
1H-Pyrazole-3-carbonitrile, 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]- |
94540 |
1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]-, trisodium salt |
698704 |
1H-Pyrazole-4-carboxylic acid, 3-chloro-5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-, methyl ester |
699926 |
1H-Pyrazole-5-carboxamide, 4-chloro-N-[[4-(1,1-dimethylethyl)phenyl]methyl]-3-ethyl-1-methyl- |
287052 |
1H-Pyrazolium, 1,2-dimethyl-3,5-diphenyl-, methyl sulfate |
26302 |
1H-Pyrrole |
26294 |
1H-Pyrrole, 2,5-dihydro- |
52183 |
1H-Pyrrole-2,5-dione |
34561 |
1H-Pyrrole-2,5-dione, 1-ethyl- |
1714659 |
1H-Pyrrole-2-carboxamide, 4-[[[(aminoiminomethyl)amino]acetyl]amino]-N-[5-[[(3-amino-3-iminopropyl)amino]carbonyl]-1-methyl-1H-pyrrol-3-yl]-1-methyl- |
200790 |
1H-Pyrrole-2-carboxylic acid, (3S,4R,4aR,6S,6aS,7S,8R,8aS,8bR,9S,9aS)-dodecahydro-4,6,7,8a,8b,9a-hexahydroxy-3,6a,9-trimethyl-7-(1-methylethyl)-6,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-8-yl ester |
17148511 |
1H-Pyrrolo[2,3-b]pyridine |
272120 |
1-Imidazolidinecarboxamide, 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo- |
36087 |
1-Naphthalenamine |
35352 |
1-Naphthalenamine, 4-(phenylazo)- |
30189 |
1-Naphthalenamine, N-ethyl- |
12930 |
1-Naphthalenamine, N-phenyl- |
10942 |
1-Naphthaleneacetamide |
10959 |
1-Naphthaleneacetic acid |
10231 |
1-Naphthaleneacetic acid, 2-methyl- |
233221 |
1-Naphthaleneacetic acid, ammonium salt |
97253 |
1-Naphthaleneacetic acid, ethyl ester |
17123944 |
1-Naphthaleneacetic acid, methyl ester |
198739 |
1-Naphthaleneacetic acid, potassium salt |
3491 |
1-Naphthaleneacetic acid, sodium salt |
35741 |
1-Naphthaleneacetonitrile |
10793 |
1-Naphthalenecarbonitrile |
4135 |
1-Naphthalenecarboxaldehyde |
17153669 |
1-Naphthalenecarboxaldehyde, 2-ethoxy- |
1714337 |
1-Naphthalenecarboximidamide, N,N-dibutyl-4-(hexyloxy)-, monohydrochloride |
17153503 |
1-Naphthalenecarboxylic acid, 1,2,3,4-tetrahydro- |
99671 |
1-Naphthalenecarboxylic acid, 2-hydroxy- |
1714627 |
1-Naphthalenecarboxylic acid, 3-methoxy-5-methyl-, (1S)-2-[[(1E)-1-[(3R,4R,5S)-3-(acetyloxy)-4-hydroxy-1-azabicyclo[3.1.0]hex-2-ylidene]-2-[[(1Z)-1-(hydroxymethylene)-2-oxopropyl]amino]-2-oxoethyl]amino]-1-[(2S)-2-methyloxiranyl]-2-oxoethyl ester |
49676 |
1-Naphthalenepropanol, .alpha.-ethenyldecahydro-2-hydroxy-.alpha.,2,5,5,8a-pentamethyl-, (.alpha.R,1R,2R,4aS,8aS)- |
10389 |
1-Naphthalenesulfonic acid |
55038 |
1-Naphthalenesulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[4-amino-, disodium salt |
92494 |
1-Naphthalenesulfonic acid, 3-hydroxy-4-[(1-hydroxy-2-naphthalenyl)azo]-7-nitro-, monosodium salt |
9688 |
1-Naphthalenesulfonic acid, 4-amino-5-hydroxy- |
114835 |
1-Naphthalenesulfonic acid, 8-(phenylamino)-5-[[4-[(3-sulfophenyl)azo]-1-naphthalenyl]azo]-, disodium salt |
12872 |
1-Naphthalenol |
96164 |
1-Naphthalenol, 2,4-dichloro- |
58842 |
1-Naphthalenol, 2,4-dinitro- |
1714290 |
1-Naphthalenol, 2,4-dinitro-, sodium salt, dihydrate |
35642 |
1-Naphthalenol, 2-nitroso- |
136382 |
1-Naphthalenol, 4-amino-, hydrochloride |
71753 |
1-Naphthalenol, acetate |
3723 |
1-Naphthalenol, methylcarbamate |
28217 |
1-Nonanamine |
94748 |
1-Nonanaminium, N,N,N-trimethyl-, bromide |
86959 |
1-Nonanethiol |
39164 |
1-Nonanol |
220798 |
1-Nonen-3-ol |
33407 |
1-Nonene |
54353 |
1-Octacosanol |
33530 |
1-Octadecanamine |
212662 |
1-Octadecanaminium, N,N,N-trimethyl-, methyl sulfate |
184549 |
1-Octadecanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt |
24547 |
1-Octadecanaminium, N,N-dimethyl-N-octadecyl-, chloride |
28811 |
1-Octadecanol |
28779 |
1-Octadecene |
27946 |
1-Octanamine |
148866 |
1-Octanamine, N,N-dimethyl- |
78485 |
1-Octanamine, N,N-dioctyl- |
125039 |
1-Octanamine, N-methyl-N-octyl- |
78980 |
1-Octanamine, N-octyl- |
1714276 |
1-Octanaminium, N,N,N-trimethyl-, chloride |
1714727 |
1-Octanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt |
133694 |
1-Octanaminium, N,N-dimethyl-N-octyl-, chloride |
129650 |
1-Octanaminium, N-methyl-N,N-dioctyl-, chloride |
121954 |
1-Octanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro- |
253245 |
1-Octanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-, lithium salt |
130815 |
1-Octanesulfonic acid, sodium salt |
27953 |
1-Octanol |
17273442 |
1-Octanol, 8-fluoro- |
90555 |
1-Octanone, 1-phenyl- |
123463 |
1-Octen-3-one |
27755 |
1-Octene |
71043 |
1-Octyn-3-ol |
135731 |
1-Octyn-3-ol, 4-ethyl- |
104612 |
1-Pentadecanamine |
135988 |
1-Pentadecanesulfonic acid, sodium salt |
26773 |
1-Pentanamine |
62307 |
1-Pentanamine, N,N-dipentyl- |
17004706 |
1-Pentanamine, N-nitroso-N-pentyl- |
96198 |
1-Pentanamine, N-pentyl- |
4747 |
1-Pentanol |
303107 |
1-Pentanol, methyl- |
76497 |
1-Pentanone, 1-phenyl- |
89730 |
1-Penten-3-one |
6668 |
1-Pentyn-3-ol, 3-methyl- |
49627 |
1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aR,4bR,10aR)- |
195099 |
1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, sodium salt, (1R,4aR,4bR,10aR)- |
687285 |
1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,5,6,9,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1a, 4ab,10aa))- |
91827 |
1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
248138 |
1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, sodium salt, (1R,4aS,10aR)- |
713230 |
1-Phenanthrenecarboxylic acid, 6,8-dichloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
685172 |
1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6, 7,9,10,10a-dodecahydro-1,4a, 7-trimethyl-, (1R-(1.alpha.,4a.beta.,4b.alpha., 7.beta.,10a.alpha.))- |
135202 |
1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
694240 |
1-Phenanthrenecarboxylic acid, chloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
694257 |
1-Phenanthrenecarboxylic acid, dichloro-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R-(1.alpha.,4a.beta.,10a.alpha.))- |
95562 |
1-Phenanthrenemethanamine, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)-, acetate |
119073 |
1-Phenanthrenemethanol, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1R,4aS,10aR)- |
17152091 |
1-Phenanthrenemethanol, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
17152083 |
1-Phenanthrenemethanol, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
13151 |
1-Piperazinecarboxamide, N,N-diethyl-4-methyl- |
37747 |
1-Piperazineethanamine |
21659 |
1-Piperazineethanol |
1714685 |
1-Piperazineethanol, 4-[3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl]-, dihydrochloride |
108472 |
1-Piperidinyloxy, 2,2,6,6-tetramethyl-4-oxo- |
24158 |
1-Propanamine |
126110 |
1-Propanamine, 2-chloro-N,N-dimethyl-, hydrochloride |
7336 |
1-Propanamine, 2-methyl- |
27128 |
1-Propanamine, 2-methyl-N-(2-methylpropyl)- |
17153016 |
1-Propanamine, 2-methyl-N-(2-methylpropyl)-, hydrochloride |
17163478 |
1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl- |
53157 |
1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-, hydrochloride |
131854 |
1-Propanamine, 3-chloro-N,N-dimethyl-, hydrochloride |
20891 |
1-Propanamine, N,N-dipropyl- |
62257 |
1-Propanamine, N-nitroso-N-propyl- |
39008 |
1-Propanamine, N-propyl- |
46334 |
1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, chloride |
1714300 |
1-Propanesulfonic acid, 2,3-dihydroxy- |
24083 |
1-Propanethiol |
4713 |
1-Propanol |
5926 |
1-Propanol, 2,2-dimethyl- |
16626 |
1-Propanol, 2,3-dibromo- |
710152 |
1-Propanol, 2,3-dibromo-, dihydrogen phosphate |
33969 |
1-Propanol, 2,3-dibromo-, phosphate (3:1) |
138081 |
1-Propanol, 2-amino- |
7351 |
1-Propanol, 2-methyl- |
686931 |
1-Propanol, 3-(2-propenyloxy)-2,2-bis[(2-propenyloxy)methyl]- |
1714706 |
1-Propanol, 3-(dibutylamino)-, 4-aminobenzoate (ester) |
48785 |
1-Propanol, 3-(methylthio)- |
40485 |
1-Propanol, 3-amino- |
64063 |
1-Propanol, 3-chloro- |
4689 |
1-Propanone, 1-(4-aminophenyl)- |
4697 |
1-Propanone, 1-(4-hydroxyphenyl)- |
17163726 |
1-Propanone, 1-[2-(.beta.-D-glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)- |
17125485 |
1-Propanone, 1-[2,3-dihydro-1,1-dimethyl-4,6-bis(1-methylethyl)-1H-inden-ar-yl]- |
14944 |
1-Propanone, 1-phenyl- |
17273004 |
1-Propanone, 2-(diethylamino)-1-phenyl- |
59956 |
1-Propanone, 2,3-dibromo-1,3-diphenyl- |
17163619 |
1-Propanone, 2-methyl-1,2-di-3-pyridinyl- |
24950 |
1-Propen-2-ol, acetate |
29009 |
1-Propene |
93849 |
1-Propene, 1,1,2,3,3,3-hexachloro- |
54668 |
1-Propene, 1,2-dichloro- |
52449 |
1-Propene, 1,3-dichloro- |
157347 |
1-Propene, 1,3-dichloro-, mixture with 1,2-dichloropropane |
7401 |
1-Propene, 2,3-dichloro- |
161430 |
1-Propene, 2-methyl-, homopolymer |
24000 |
1-Propene, 3-bromo- |
24109 |
1-Propene, 3-chloro- |
17153297 |
1-Propene, 3-chloro-2-(chloromethyl)- |
54643 |
1-Propene, 3-chloro-2-methyl- |
2402 |
1-Propene, 3-isothiocyanato- |
52466505 |
1-Pyrrolidinecarboxamide, 2,5-dimethyl-N-phenyl-, (2R,5S)-rel- |
95489 |
1-Tetradecanamine |
78840 |
1-Tetradecanaminium, N,N,N-trimethyl-, bromide |
1714711 |
1-Tetradecanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt |
28670 |
1-Tetradecanol |
80556 |
1-Tetradecanol, hydrogen sulfate, sodium salt |
1714434 |
1-Tetradecanol, mixt. with (8E,10E)-8,10-dodecadien-1-ol and 1-dodecanol |
125419 |
1-Tetradecanone, 1-phenyl- |
25742 |
1-Tetrazene-1-carboximidic acid, 4-(aminoiminomethyl)-, 2-nitrosohydrazide |
57398 |
1-Triacontanol |
108159 |
1-Tridecanamine |
28654 |
1-Tridecanol |
17121773 |
1-Tridecanol, benzenesulfonate |
28423 |
1-Undecanol |
50591 |
2(1H)-Naphthalenone, 3,4-dihydro- |
202309 |
2(1H)-Pyridinethione, 1-hydroxy-, sodium salt |
38620 |
2(1H)-Pyridinone |
17125188 |
2(1H)-Pyridinone, 3,5,6-trichloro- |
1714440 |
2(1H)-Pyridinone, 5-methyl- |
17152109 |
2(1H)-Pyridinone, 6-chloro- |
17153164 |
2(1H)-Pyrimidinone, 4,4'-dithiobis[1-.beta.-D-ribofuranosyl- |
358291 |
2(1H)-Pyrimidinone, tetrahydro-5,5-dimethyl-, [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
3053 |
2(1H)-Quinolinone |
39883 |
2(3H)-Benzothiazolethione |
17129123 |
2(3H)-Benzothiazolethione, 5-chloro-, zinc salt |
150300 |
2(3H)-Benzothiazolethione, 6-amino- |
17124926 |
2(3H)-Benzothiazolethione, compd. with 2-aminoethanol (1:1) |
103218 |
2(3H)-Benzothiazolethione, sodium salt |
40345 |
2(3H)-Benzothiazolethione, zinc salt |
100867 |
2(3H)-Benzoxazolethione |
3095 |
2(3H)-Benzoxazolone |
1818 |
2(3H)-Furanone, 3-ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-, monohydrochloride, (3S,4R)- |
22251 |
2(3H)-Furanone, 5-heptyldihydro- |
68502 |
2(3H)-Furanone, 5-hexyldihydro- |
56788 |
2(3H)-Furanone, 5-methyl- |
16873 |
2(3H)-Furanone, dihydro- |
24992 |
2(3H)-Furanone, dihydro-5-methyl- |
17295247 |
2(5H)-Furanone |
17123050 |
2,2':5',2''-Terthiophene |
17002676 |
2,2'-Bioxirane, (2R,2'R)-rel- |
43950 |
2,2'-Bipyridine |
49593 |
2,3-Butanediol |
116137 |
2,3-Butanediol, 1,4-dimercapto-, (2R,3R)-rel- |
145862 |
2,3-Butanediol, 1,4-dimercapto-, (2R,3S)-rel- |
6114 |
2,3-Butanediol, 2,3-dimethyl- |
70136 |
2,3-Naphthalenediamine |
14126 |
2,3-Naphthalenediol |
4069 |
2,4(1H,3H)-Pyrimidinedione |
74450 |
2,4(1H,3H)-Pyrimidinedione, 5-amino- |
1297 |
2,4(1H,3H)-Pyrimidinedione, 5-bromo- |
52466380 |
2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylethyl)- |
42127 |
2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)- |
298505 |
2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-3-(1-methylpropyl)-, lithium salt |
17153008 |
2,4(1H,3H)-Pyrimidinedione, 5-chloro- |
136010 |
2,4(1H,3H)-Pyrimidinedione, 5-chloro-3-(1,1-dimethylethyl)-6-methyl- |
1305 |
2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
4028 |
2,4(1H,3H)-Pyrimidinedione, 5-methyl- |
59832 |
2,4(1H,3H)-Pyrimidinedione, 5-nitro- |
2360 |
2,4,11,13-Tetraazatetradecanediimidamide, N,N''-bis(4-chlorophenyl)-3,12-diimino-, diacetate |
961763 |
2,4,11,13-Tetraazatetradecanediimidamide, N,N''-bis(4-chlorophenyl)-3,12-diimino-, dihydrochloride |
1180 |
2,4,5,6(1H,3H)-Pyrimidinetetrone |
4275 |
2,4,6(1H,3H,5H)-Pyrimidinetrione |
17163643 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl- |
17163429 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl-, sodium salt |
17000613 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-methylbutyl)-5-(2-propenyl)-, monosodium salt |
17163650 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diethyl- |
17003963 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dihydroxy- |
684936 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)- |
2493 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt |
17002064 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(3-methylbutyl)- |
684704 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl- |
684860 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl-, monosodium salt |
47134 |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-nitro- |
17004722 |
2,4,6-Metheno-2H-cyclopenta[4,5]pentaleno[1,2-b]oxirene, 2a,3,3,4,5,5a-hexachlorodecahydro-, (1aR,1bR,2S,2aS,4R,5S,5aS,5bS,6S,6aS,7R)- |
1714570 |
2,4,7-Metheno-1H-cyclopenta[a]pentalene, 1,1,2,3,3a,7a-hexachloro-2,3,3a,3b,4,6a,7,7a-octahydro-, (2R,3R,3aS,3bS,4S,6aR,7S,7aS)-rel- |
1714739 |
2,4-Cresotic acid, 6-anilino-, ethyl ester |
1714386 |
2,4-Dithia-6-aza-3-stannaoctanethioamide, 3,3-dibutyl-N,N,6-triethyl-5-thioxo- |
17121831 |
2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester |
281691 |
2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester, (2E,4E)- |
285825 |
2,4-Dodecadienoic acid, 3,7,11-trimethyl-, 2-propynyl ester, (2E,4E)- |
69526 |
2,4-Hexadiene, 2,5-dimethyl- |
26666 |
2,4-Hexadienoic acid, (2E,4E)- |
46375 |
2,4-Imidazolidinedione |
142745 |
2,4-Imidazolidinedione, 1,3-bis(hydroxymethyl)-5,5-dimethyl- |
6502 |
2,4-Imidazolidinedione, 1,3-dibromo-5,5-dimethyl- |
30247 |
2,4-Imidazolidinedione, 1,3-dichloro-5,5-dimethyl- |
4192 |
2,4-Imidazolidinedione, 1-[[(5-nitro-2-furanyl)methylene]amino]- |
203091 |
2,4-Imidazolidinedione, 1-bromo-3-chloro-5,5-dimethyl- |
6635 |
2,4-Imidazolidinedione, 5,5-dimethyl- |
2535 |
2,4-Imidazolidinedione, 5,5-diphenyl- |
288738 |
2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl- |
17151663 |
2,4-Pentadienenitrile |
1714686 |
2,4-Pentadienoic acid, 5-(1-hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-, (E,Z)- |
24364 |
2,4-Pentanediol, 2-methyl- |
33035 |
2,4-Pentanedione |
960815 |
2,4-Pyrimidinediamine, 5-(4-chlorophenyl)-6-ethyl- |
17003344 |
2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]- |
38703 |
2,5,8,10-Tetraoxatridec-12-enoic acid, 9-oxo-, 2-propenyl ester |
75234 |
2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]- |
1714417 |
2,5-Cyclohexadien-1-one, 2-[[2,4-dihydroxy-6-methoxy-3-(1-oxobutyl)phenyl]methyl]-3,5-dihydroxy-4,4-dimethyl-6-(1-oxobutyl)- |
65888 |
2,5-Cyclohexadien-1-one, 4-(chloroimino)- |
17295304 |
2,5-Cyclohexadien-1-one, 4-[(4-hydroxyphenyl)imino]- |
23671 |
2,5-Cyclohexadiene-1,4-dione |
30353 |
2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrachloro- |
42218 |
2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy- |
93823 |
2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, disodium salt |
11452 |
2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy- |
17153891 |
2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dimethoxy- |
60871 |
2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy- |
41665 |
2,5-Cyclohexadiene-1,4-dione, 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl]-5,6-dimethoxy-3-methyl- |
1714330 |
2,5-Cyclohexadiene-1,4-dione, 2-hydroxy-5-methoxy-3-(8Z,11Z)-8,11,14-pentadecatrienyl- |
53512 |
2,5-Cyclohexadiene-1,4-dione, 2-methyl- |
23507 |
2,5-Cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol (1:1) |
25015 |
2,5-Furandione |
79137 |
2,5-Furandione, 3,4-dichloro- |
25007 |
2,5-Furandione, dihydro- |
259580 |
2,5-Furandione, polymer with 1-tetradecene |
163048 |
2,5-Furandione, polymer with ethenylbenzene |
48686 |
2,5-Heptadien-4-one, 2,6-dimethyl- |
26419 |
2,5-Hexanedione |
245050 |
2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,6a,7,7-octachloro-1a,1b,5,5a,6,6a-hexahydro-, (1aR,1bS,2R,5S,5aR,6S,6aS)-rel- |
76661 |
2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-,(1aR,1bS,2R,5S,5aR,6S,6aR)-rel- |
23721 |
2,5-Piperazinedione |
36665 |
2,5-Pyridinedicarboxylic acid, dipropyl ester |
33043 |
2,5-Pyrrolidinedione |
34470 |
2,5-Pyrrolidinedione, 1-bromo- |
126201 |
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl- |
108092 |
2,6-Anthracenedisulfonic acid, 4,8-diamino-9,10-dihydro-1,5-dihydroxy-9,10-dioxo-, disodium salt |
684993 |
2,6-Dithia-1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane, 2,2,6,6-tetraoxide |
17153768 |
2,6-Methano-3-benzazocin-8-ol, 6-ethyl-1,2,3,4,5,6-hexahydro-3-[(1-hydroxycyclopropyl)methyl]-11,11-dimethyl- |
17153776 |
2,6-Methano-3-benzazocin-8-ol, 6-ethyl-1,2,3,4,5,6-hexahydro-3-[(1-hydroxycyclopropyl)methyl]-11,11-dimethyl-, hydrochloride, (2R)- |
55533 |
2,6-Naphthalenediol |
23416 |
2,6-Octadien-1-ol, 3,7-dimethyl-, (2E)- |
23424 |
2,6-Octadien-1-ol, 3,7-dimethyl-, (2Z)- |
23127 |
2,6-Octadien-1-ol, 3,7-dimethyl-, acetate, (2E)- |
38109 |
2,6-Octadien-1-ol, 3,7-dimethyl-, acetate, (2Z)- |
131540 |
2,6-Octadienal, 3,7-dimethyl- |
1714401 |
2,6-Piperidinedione |
17005133 |
2,6-Piperidinedione, 3-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)- |
1714403 |
2,6-Piperidinedione, 4,4-dimethyl- |
4143 |
2,6-Piperidinedione, 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]- |
38513 |
2,6-Pyridinediamine |
48231 |
2,6-Pyridinedicarboxylic acid |
4887 |
2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel- |
3426 |
2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aR,2R,2aS,3S,6R,6aR,7S,7aS)-rel- |
55574 |
2,7-Naphthalenediol |
4960 |
2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[5-amino-4-hydroxy-, tetrasodium salt |
105015 |
2,7-Naphthalenedisulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxy-, tetrasodium salt |
90720 |
2,7-Naphthalenedisulfonic acid, 3-[(4-aminophenyl)azo]-4,5-dihydroxy-, disodium salt |
76893 |
2,7-Naphthalenedisulfonic acid, 3-[(5-chloro-2-hydroxyphenyl)azo]-4,5-dihydroxy-, disodium salt |
17003989 |
2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[(2,4,5-trimethylphenyl)azo]-, disodium salt |
73361 |
2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-[(4-sulfo-1-naphthalenyl)azo]-, trisodium salt |
118901 |
2,7-Naphthalenedisulfonic acid, 4-[(2,4-dimethylphenyl)azo]-3-hydroxy-, disodium salt |
94599 |
2,7-Naphthalenedisulfonic acid, 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)-, disodium salt |
76927 |
2,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-3-[(4-nitrophenyl)azo]-6-(phenylazo)-, disodium salt |
1714554 |
2,7-Naphthalenedisulfonic acid, 6-(acetylamino)-3-[[4-(aminosulfonyl)phenyl]azo]-4-hydroxy- |
1714574 |
2,7-Naphthalenedisulfonic acid, 6-(acetylamino)-3-[[4-(aminosulfonyl)phenyl]azo]-4-hydroxy-, disodium salt |
1714668 |
2,7-Octanedione, 1,8-bis(diazo)- |
53413 |
2,8-Phenazinediamine, N8,N8,3-trimethyl-, monohydrochloride |
1714665 |
21H,23H-Porphine-2,18-dipropanoic acid, 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl- |
81612 |
2-Anthracenecarboxylic acid, 7-.beta.-D-glucopyranosyl-9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo- |
141861 |
2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-9,10-dioxo-4-(phenylamino)-, monosodium salt |
35170 |
2-Anthracenesulfonic acid, 9,10-dihydro-3,4-dihydroxy-9,10-dioxo-, monosodium salt |
686071 |
2-Anthramine |
47910 |
2-Benzofurancarboxylic acid |
36772 |
2-Benzothiazolamine |
192641 |
2-Butanamine |
58172 |
2-Butanamine, 3-methyl- |
7435 |
2-Butanol |
5934 |
2-Butanol, 2-methyl- |
253575 |
2-Butanol, 3,3,4,4-tetrafluoro-2-methyl- |
46540 |
2-Butanol, 3,3-dimethyl- |
58180 |
2-Butanol, 3-methyl- |
7443 |
2-Butanone |
286872 |
2-Butanone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)- |
267310 |
2-Butanone, 3-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
6023 |
2-Butanone, 3,3-dimethyl- |
54767 |
2-Butanone, 3-methyl- |
221127 |
2-Butanone, 4-(dimethylamino)-3-methyl- |
116962 |
2-Butanone, 4-[4-(acetyloxy)phenyl]- |
104307 |
2-Butanone, 4-phenyl- |
16766 |
2-Butanone, oxime |
137711 |
2-Buten-1-ol |
17151853 |
2-Buten-1-ol, 2-methyl-4-(1H-purin-6-ylamino)-, (2E)- |
47829 |
2-Buten-1-one, 1-phenyl- |
122135 |
2-Butenal |
33142 |
2-Butenal, (2E)- |
69567 |
2-Butene, 1,4-dichloro- |
185199 |
2-Butene, 2-bromo- |
26831 |
2-Butene-1,4-diol |
75291 |
2-Butene-1,4-dione, 1,4-diphenyl-, (2E)- |
26450 |
2-Butenedioic acid (2E)- |
23002 |
2-Butenedioic acid (2E)-, dibutyl ester |
63024 |
2-Butenedioic acid (2E)-, diethyl ester |
63206 |
2-Butenedioic acid (2E)-, dimethyl ester |
26443 |
2-Butenedioic acid (2Z)- |
75978 |
2-Butenedioic acid (2Z)-, di-2-propenyl ester |
38042 |
2-Butenedioic acid (2Z)-, diethyl ester |
44131 |
2-Butenedioic acid (2Z)-, disodium salt |
17152786 |
2-Butenedioic acid (2Z)-, monodecyl ester, sodium salt |
1714567 |
2-Butenedioic acid, 2,3-dihydroxy-, (2E)- |
64154 |
2-Butenedioyl dichloride, (2E)- |
118489 |
2-Butenoic acid |
17121294 |
2-Butenoic acid, (2E)- |
17121468 |
2-Butenoic acid, 2-(1-methylheptyl)-4,6-dinitrophenyl ester |
278739 |
2-Butenoic acid, 2(or 4)-isooctyl-4,6(or 2,6)-dinitrophenyl ester |
152728 |
2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, 1-phenylethyl ester, (2E)- |
155309 |
2-Butenoic acid, 3-[(dimethoxyphosphinyl)oxy]-, methyl ester |
17121880 |
2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester |
258731 |
2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- |
17154139 |
2-Butenoic acid, 3-ethoxy-, ethyl ester |
52142 |
2-Butenoic acid, 3-methyl- |
17121849 |
2-Butenoic acid, 4-methylphenyl ester, (E)- |
98871 |
2-Butyne, 1,4-dibromo- |
26849 |
2-Butyne-1,4-diol |
1714702 |
2-Butyne-1,4-diol, 1,1,4,4-tetraphenyl- |
52548 |
2-Butynediamide |
46714 |
2-Cyclohexen-1-ol, 3,5,5-trimethyl- |
74310 |
2-Cyclohexen-1-one |
609677 |
2-Cyclohexen-1-one, 2-(1-(((3-chloro-2-propenyl)oxy)imino)propyl)-5-(2-(ethylthio)propyl)-3-hydroxy- |
581959 |
2-Cyclohexen-1-one, 2-[1-(ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy- |
697649 |
2-Cyclohexen-1-one, 2-[1-(ethoxyimino)propyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)- |
143313 |
2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5R)- |
99325 |
2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5S)- |
7187 |
2-Cyclohexen-1-one, 3,5,5-trimethyl- |
80689 |
2-Cyclohexen-1-one, 3-methyl- |
118414 |
2-Cyclohexen-1-one, 3-methyl-5-propyl- |
45567 |
2-Cyclohexene-1-carboxaldehyde, 2,6,6-trimethyl- |
67876 |
2-Decanone |
221143 |
2-Decen-1-ol |
138131 |
2-Dodecanone |
221150 |
2-Dodecen-1-ol |
17004011 |
2-Furanacetamide, .alpha.-[(5-nitro-2-furanyl)methylene]- |
17699 |
2-Furancarboxaldehyde |
132340 |
2-Furancarboxaldehyde, (2-furanylmethylene)hydrazone |
4242 |
2-Furancarboxaldehyde, 5-(hydroxymethyl)- |
79079 |
2-Furancarboxaldehyde, oxime |
17153586 |
2-Furancarboxamide, N-phenyl- |
1714321 |
2-Furancarboxylic acid, 2-(diethylamino)ethyl ester |
61275 |
2-Furanmethanamine |
127423 |
2-Furanmethanamine, N-methyl- |
127662 |
2-Furanmethanamine, tetrahydro- |
17681 |
2-Furanmethanol |
17673 |
2-Furanmethanol, tetrahydro- |
75572 |
2H,3H-Cyclopenta[d']naphtho[1,8-bc:2,3-b']difuran-6-acetic acid, 3-(acetyloxy)-8-(3-furanyl)-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2a,5a,6a,7-tetramethyl-5-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-, methyl ester, (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR |
17000621 |
2H-[1,6]Dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione, 4,5,8,10,12,13,13a,13b-octahydro-4,5-dihydroxy-3,4,5-trimethyl-, (3R,4R,5R,13aR,13bR)- |
1057 |
2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide |
17000993 |
2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide, monohydrate |
50955 |
2H-1,3,5-Thiadiazine-2-thione, tetrahydro-3,5-dimethyl- |
45674 |
2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
66357 |
2H-1-Benzopyran, 6,7-dimethoxy-2,2-dimethyl- |
297895 |
2H-1-Benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl- |
13599 |
2H-1-Benzopyran-2-one |
17129586 |
2H-1-Benzopyran-2-one, 3-(3-[1,1'-biphenyl]-4-yl-1,2,3,4-tetrahydro-1-naphthalenyl)-4-hydroxy- |
4127 |
2H-1-Benzopyran-2-one, 3,3'-methylenebis[4-hydroxy- |
30916 |
2H-1-Benzopyran-2-one, 3,4-dihydro- |
29843 |
2H-1-Benzopyran-2-one, 3-[1-(2-furanyl)-3-oxobutyl]-4-hydroxy- |
17122235 |
2H-1-Benzopyran-2-one, 3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxy- |
306068 |
2H-1-Benzopyran-2-one, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenyl]-4-hydroxy- |
250688 |
2H-1-Benzopyran-2-one, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy- |
17153214 |
2H-1-Benzopyran-2-one, 3-benzoyl- |
77743 |
2H-1-Benzopyran-2-one, 4-hydroxy- |
8979 |
2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)- |
34850 |
2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-, sodium salt |
97022 |
2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-methyl- |
17295106 |
2H-1-Benzopyran-2-one, 5,7-dimethoxy- |
17273244 |
2H-1-Benzopyran-2-one, 6,7-dihydroxy- |
50500 |
2H-1-Benzopyran-2-one, 6,7-dihydroxy-4-methyl- |
14142 |
2H-1-Benzopyran-2-one, 6-methyl- |
11056 |
2H-1-Benzopyran-2-one, 7-ethoxy-4-methyl- |
17273046 |
2H-1-Benzopyran-2-one, 7-hydroxy- |
12963 |
2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl- |
17272931 |
2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl-3-(phenylmethyl)- |
17273038 |
2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy- |
50674 |
2H-1-Benzopyran-2-one, 7-methoxy- |
102400 |
2H-1-Benzopyran-2-one, 7-methyl- |
2964 |
2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, acetate, (2R)- |
1750 |
2H-1-Benzopyran-6-ol, 3,4-dihydro-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- |
613836 |
2H-1-Benzothiopyran-2-one, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenyl]-4-hydroxy- |
22921 |
2H-Azepin-2-one, hexahydro- |
60590 |
2H-Benzimidazol-2-one, 1,3-dihydro- |
594762 |
2H-Cyclopent[d]isothiazol-3(4H)-one, 5,6-dihydro-2-methyl- |
52597 |
2-Heptanol |
26658 |
2-Heptanone |
264465 |
2-Hepten-1-ol, (2E)- |
1714264 |
2-Heptyn-1-ol |
40139 |
2-Hexadecen-1-ol, 3,7,11,15-tetramethyl-, (2E,7R,11R)- |
63925 |
2-Hexanol |
57000 |
2-Hexanone |
26401 |
2-Hexanone, 5-methyl- |
74179 |
2-Hexen-1-ol, (2E)- |
66555 |
2-Hexenal, 2-ethyl- |
57174 |
2-Hexene |
186049 |
2-Hexenoic acid, (2E)- |
17153248 |
2H-Furo[2,3-f][2]benzopyran-2,8(3H)-dione, 5a-ethenyloctahydro-4-hydroxy-3,9-bis(methylene)-, (3aR,4S,5aR,9aR,9bR)- |
17295064 |
2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methoxy- |
17152927 |
2H-Imidazol-2-one, 4,5-diphenyl- |
3418 |
2H-Imidazole-2-thione, 1,3-dihydro-1-methyl- |
60574 |
2H-Inden-2-one, 1,3-dihydro- |
1714378 |
2H-Indeno[1,2-b]furan-2-one, 3-[[[(2R)-2,5-dihydro-4-methyl-5-oxo-2-furanyl]oxy]methylene]-3,3a,4,5,6,7,8,8b-octahydro-5-hydroxy-8,8-dimethyl-, (3E,3aR,5S,8bS)- |
17163692 |
2H-Indol-2-one, 1,3-dihydro- |
3483 |
2H-Indol-2-one, 1-ethyl-1,3-dihydro- |
180786 |
2H-Naphtho[1,2-d]triazole-5-sulfonic acid, 2,2'-[azobis[(2-sulfo-4,1-phenylene)-2,1-ethenediyl(3-sulfo-4,1-phenylene)]]bis-, hexasodium salt |
1714708 |
2H-Oxacyclotetradecino[2,3-d]isoindole-2,18(5H)-dione, 6,7,8,9,10,12a,13,14,15,15a,16,17-dodecahydro-5,13-dihydroxy-9,15-dimethyl-14-methylene-16-(phenylmethyl)-, (3E,5R,9R,11E,12aS,13S,15S,15aS,16S,18aS)- |
1714635 |
2H-Oxacyclotetradecino[2,3-d]isoindole-2,5,18-trione, 6,7,8,9,10,12a,13,14,15,15a,16,17-dodecahydro-13-hydroxy-9,15-dimethyl-14-methylene-16-(phenylmethyl)-, (3E,9R,11E,12aS,13S,15S,15aS,16S,18aS)- |
27045 |
2H-Pyran, 3,4-dihydro- |
38893 |
2H-Pyran, tetrahydro- |
49940 |
2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl- |
124420 |
2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, ion(1-), sodium |
1648674 |
2H-Pyran-2-one, tetrahydro- |
50781 |
2H-Pyran-6-carboxylic acid, 3,4-dihydro-2,2-dimethyl-4-oxo-, butyl ester |
41301 |
2H-Tetrazolium, 2,3,5-triphenyl-, chloride |
16857 |
2-Imidazolidinethione |
31492 |
2-Imidazolidinone |
17000506 |
2-Imidazolidinone, 1-(5-nitro-2-thiazolyl)- |
52466612 |
2-Imidazolidinone, 3-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methyl- |
7906 |
2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, (4S,4aR,5S,5aR,6S,12aS)- |
96495 |
2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, (4S,4aR,5S,5aR,6S,12aS)- |
17163718 |
2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, (4S,4aS,5aS,6S,12aS)- |
3905 |
2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, (4S,4aS,5aS,6S,12aS)- |
2618 |
2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, (4S,4aS,5aS,6S,12aS)- |
17272683 |
2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, (4S,4aS,5aS,6S,12aS)- |
13540 |
2-Naphthalenamine |
10553 |
2-Naphthalenamine, 1-(phenylazo)- |
1714546 |
2-Naphthalenamine, 1-[(2-methylphenyl)azo]- |
36558 |
2-Naphthalenamine, N-phenyl- |
1714533 |
2-Naphthaleneacetic acid, 5,6,7,8-tetrahydro- |
17272717 |
2-Naphthalenecarboxaldehyde |
14662 |
2-Naphthalenecarboxylic acid |
14332 |
2-Naphthalenecarboxylic acid, 3-hydroxy- |
17151317 |
2-Naphthalenecarboxylic acid, 3-hydroxy-7-sulfo- |
17158577 |
2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, compd. with 1,4,5,6-tetrahydro-1-methyl-2-[(1E)-2-(2-thienyl)ethenyl]pyrimidine (1:1) |
31047 |
2-Naphthalenesulfonic acid |
115766 |
2-Naphthalenesulfonic acid, 3-[[4-(acetylamino)phenyl]azo]-4-hydroxy-7-[[[[5-hydroxy-6-(phenylazo)-7-sulfo-2-naphthalenyl]amino]carbonyl]amino]-, disodium salt |
140616 |
2-Naphthalenesulfonic acid, 5-[[4-(acetylamino)-2-sulfophenyl]azo]-6-amino-4-hydroxy-, disodium salt |
157388 |
2-Naphthalenesulfonic acid, 6-[(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)azo]-3-[[4-[[4-amino-6(or 7)-sulfo-1-naphthalenyl]azo]phenyl]azo]-4-hydroxy-, trisodium salt |
13052 |
2-Naphthalenesulfonic acid, 6-amino-4-hydroxy- |
107334 |
2-Naphthalenesulfonic acid, 6-hydroxy-5-[(4-sulfophenyl)azo]-, disodium salt |
105114 |
2-Naphthalenesulfonic acid, 7-(benzoylamino)-4-hydroxy-3-[[4-[(4-sulfophenyl)azo]phenyl]azo]-, disodium salt |
72116 |
2-Naphthalenesulfonic acid, 8-hydroxy-5,7-dinitro-, disodium salt |
50716 |
2-Naphthalenesulfonic acid, sodium salt |
36293 |
2-Naphthalenol |
10561 |
2-Naphthalenol, 1-(2-pyridinylazo)- |
1714358 |
2-Naphthalenol, 1,1'-methylenebis- |
17151713 |
2-Naphthalenol, 1,6-dibromo- |
35527 |
2-Naphthalenol, 1-nitroso- |
1714733 |
2-Naphthalenol, 6-bromo- |
1714647 |
2-Naphthalenol, decahydro-, (2R,4aR,8aS)-rel- |
17151671 |
2-Naphthalenol, decahydro-2,5,5,8a-tetramethyl-1-(3-methyl-2,4-pentadienyl)-, (1R,2R,4aS,8aS)- |
64543 |
2-Nonanol |
71142 |
2-Nonanone |
221135 |
2-Nonen-1-ol |
118885 |
2-Nonenoic acid |
17153206 |
2-Nonynoic acid |
67801 |
2-Octanamine |
33290 |
2-Octanol |
27268 |
2-Octanone |
211839 |
2-Octen-1-ol, (2E)- |
17153305 |
2-Octenoic acid, (2E)- |
17124884 |
2-Oxa-4-thia-7-aza-3-phosphaoctan-8-oic acid, 3-methoxy-, ethyl ester, 3-sulfide |
46698 |
2-Oxabicyclo[2.2.2]octane, 1,3,3-trimethyl- |
4234 |
2-Oxazolidinone, 3-[[(5-nitro-2-furanyl)methylene]amino]- |
17000589 |
2-Oxazolidinone, 5-(4-morpholinylmethyl)-3-[[(5-nitro-2-furanyl)methylene]amino]- |
2600 |
2-Oxetanone |
1714545 |
2-Pentadecanamine |
24398 |
2-Pentanamine, 2,4,4-trimethyl- |
136986 |
2-Pentanol |
24869 |
2-Pentanol, 4-methyl- |
25411 |
2-Pentanol, 4-methyl-, acetate |
24687 |
2-Pentanone |
32987 |
2-Pentanone, 4-hydroxy-4-methyl- |
24851 |
2-Pentanone, 4-methyl- |
131276 |
2-Pentanone, 4-methyl-1-phenyl- |
1714331 |
2-Pentanone, 5-(diethylamino)- |
89011 |
2-Penten-1-ol, (2Z)- |
32136 |
2-Pentenedioic acid, 3-[(dimethoxyphosphinyl)oxy]-, dimethyl ester |
1714620 |
2-Pentenoic acid, (2E)- |
17126806 |
2-Pentenoic acid, 2,3,5,5,5-pentachloro-4-oxo-, (2Z)- |
138990 |
2-Pentyn-1-ol |
91439 |
2-Piperidinecarboxamide, N-(2,6-dimethylphenyl)-1-methyl-, monohydrochloride |
51169 |
2-Piperidinecarboxylic acid |
67140 |
2-Piperidinone |
5504 |
2-Propanamine |
5744 |
2-Propanamine, 2-methyl- |
24919 |
2-Propanamine, N-(1-methylethyl)- |
4291 |
2-Propanol |
120303 |
2-Propanol, 1-(1-methylethoxy)- |
21089 |
2-Propanol, 1-(cyclohexylamino)- |
24901 |
2-Propanol, 1-(dimethylamino)- |
73593 |
2-Propanol, 1,1,1,3,3,3-hexafluoro- |
32177 |
2-Propanol, 1,1',1''-nitrilotris- |
17163403 |
2-Propanol, 1,1,1-tribromo-2-methyl- |
2477 |
2-Propanol, 1,1,1-trichloro-2-methyl- |
29488 |
2-Propanol, 1,1'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis- |
27136 |
2-Propanol, 1,1'-iminobis- |
27144 |
2-Propanol, 1,1'-oxybis- |
16725 |
2-Propanol, 1,3-dichloro- |
189563 |
2-Propanol, 1,3-dichloro-, phosphate (3:1) |
17273301 |
2-Propanol, 1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)-, hydrochloride |
217182 |
2-Propanol, 1-[2-(2-methoxy-1-methylethoxy)-1-methylethoxy]- |
7476 |
2-Propanol, 1-amino- |
129601 |
2-Propanol, 1-butoxy- |
34108 |
2-Propanol, 1-chloro- |
126441 |
2-Propanol, 1-chloro-3-(2-propenyloxy)- |
650309 |
2-Propanol, 1-ethoxy- |
24778 |
2-Propanol, 1-methoxy- |
25254 |
2-Propanol, 1-methoxy-, acetate |
5751 |
2-Propanol, 2-methyl- |
4309 |
2-Propanone |
17152760 |
2-Propanone, 1,1,1,3,3-pentachloro- |
650242 |
2-Propanone, 1,1,1-trichloro- |
34116 |
2-Propanone, oxime |
24166 |
2-Propen-1-amine |
33324 |
2-Propen-1-amine, N-2-propenyl- |
87841 |
2-Propen-1-aminium, N,N,N-trimethyl-, chloride |
149138 |
2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride |
24224 |
2-Propen-1-ol |
710244 |
2-Propen-1-ol, 2-chloro- |
49494 |
2-Propen-1-ol, 2-methyl- |
22152 |
2-Propen-1-ol, 3-phenyl- |
15438 |
2-Propen-1-one, 1,3-diphenyl- |
24075 |
2-Propenal |
91728 |
2-Propenal, 3-(4-nitrophenyl)- |
138248 |
2-Propenal, 3-[4-(dimethylamino)phenyl]- |
22160 |
2-Propenal, 3-phenyl- |
7575 |
2-Propenamide |
7815 |
2-Propenamide, 2-methyl- |
62323 |
2-Propenamide, 3-phenyl- |
17123555 |
2-Propenamide, N-(3,4-dichlorophenyl)-2-methyl- |
26526 |
2-Propenamide, N,N'-methylenebis- |
17122953 |
2-Propene-1,1-diol, diacetate |
88591 |
2-Propene-1-sulfonic acid, 2-methyl-, sodium salt |
72561 |
2-Propene-1-thiol |
24182 |
2-Propenenitrile |
161620 |
2-Propenenitrile, polymer with 1,3-butadiene and ethenylbenzene |
7617 |
2-Propenoic acid |
90365 |
2-Propenoic acid, 1,1-dimethylethyl ester |
101899 |
2-Propenoic acid, 2-(diethylamino)ethyl ester |
102269 |
2-Propenoic acid, 2-(dimethylamino)ethyl ester |
1714278 |
2-Propenoic acid, 2-cyano-3-phenyl- |
95554 |
2-Propenoic acid, 2-cyano-3-phenyl-, ethyl ester |
21162 |
2-Propenoic acid, 2-ethylhexyl ester |
71035 |
2-Propenoic acid, 2-hydroxyethyl ester |
76000 |
2-Propenoic acid, 2-hydroxypropyl ester |
7831 |
2-Propenoic acid, 2-methyl- |
113688 |
2-Propenoic acid, 2-methyl-, (1-methylethylidene)di-4,1-phenylene ester |
102509 |
2-Propenoic acid, 2-methyl-, (tetrahydro-2-furanyl)methyl ester |
126557 |
2-Propenoic acid, 2-methyl-, 1-methylethyl ester |
108134 |
2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester |
100610 |
2-Propenoic acid, 2-methyl-, 2-ethoxyethyl ester |
72504 |
2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester |
16568 |
2-Propenoic acid, 2-methyl-, 2-propenyl ester |
17582 |
2-Propenoic acid, 2-methyl-, butyl ester |
39040 |
2-Propenoic acid, 2-methyl-, dodecyl ester |
17459 |
2-Propenoic acid, 2-methyl-, ethyl ester |
8458 |
2-Propenoic acid, 2-methyl-, methyl ester |
162214 |
2-Propenoic acid, 2-methyl-, methyl ester, polymer with sodium 2-methyl-2-propenoate |
103325 |
2-Propenoic acid, 2-methyl-, phenylmethyl ester |
23754 |
2-Propenoic acid, 2-methylpropyl ester |
287730 |
2-Propenoic acid, 2-phenoxyethyl ester |
81117 |
2-Propenoic acid, 3-(1H-indol-3-yl)- |
1714446 |
2-Propenoic acid, 3-(2,4-dichlorophenyl)- |
1714328 |
2-Propenoic acid, 3-(2-chlorophenyl)-2-cyano- |
17294893 |
2-Propenoic acid, 3-(2-fluorophenyl)- |
51706 |
2-Propenoic acid, 3-(2-furanyl)- |
60459 |
2-Propenoic acid, 3-(2-hydroxyphenyl)-, (2E)- |
1714277 |
2-Propenoic acid, 3-(2-methoxyphenyl)-, (2E)- |
17157066 |
2-Propenoic acid, 3-(3,4-dihydroxyphenyl)- |
1714743 |
2-Propenoic acid, 3-(3,4-dioxo-1,5-cyclohexadien-1-yl)- |
1714667 |
2-Propenoic acid, 3-(3-bromophenyl)-, (2E)- |
17153255 |
2-Propenoic acid, 3-(3-chlorophenyl)- |
1714696 |
2-Propenoic acid, 3-(3-hydroxyphenyl)-, (2E)- |
17152000 |
2-Propenoic acid, 3-(3-nitrophenyl)-, methyl ester |
17151655 |
2-Propenoic acid, 3-(4-chlorophenyl)- |
79657 |
2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- |
149153 |
2-Propenoic acid, 3-(4-hydroxyphenyl)- |
17295338 |
2-Propenoic acid, 3-(4-hydroxyphenyl)-, (2E)- |
71738 |
2-Propenoic acid, 3-(4-methoxyphenyl)- |
61812 |
2-Propenoic acid, 3-(4-nitrophenyl)- |
75168 |
2-Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester |
17151630 |
2-Propenoic acid, 3-(4-nitrophenyl)-, methyl ester |
17153313 |
2-Propenoic acid, 3-(5-nitro-2-furanyl)-, ethyl ester |
62331 |
2-Propenoic acid, 3-phenyl- |
37648 |
2-Propenoic acid, 3-phenyl-, (2E)- |
154245 |
2-Propenoic acid, 3-phenyl-, 1-methylethyl ester |
21352 |
2-Propenoic acid, 3-phenyl-, ethyl ester |
203133 |
2-Propenoic acid, 3-phenyl-, potassium salt |
154005 |
2-Propenoic acid, 3-phenyl-, propyl ester |
38281 |
2-Propenoic acid, butyl ester |
139501 |
2-Propenoic acid, calcium salt |
111146 |
2-Propenoic acid, cyclohexyl ester |
97766 |
2-Propenoic acid, dodecyl ester |
37929 |
2-Propenoic acid, ethyl ester |
103481 |
2-Propenoic acid, hexyl ester |
16790 |
2-Propenoic acid, methyl ester |
103473 |
2-Propenoic acid, octyl ester |
24232 |
2-Propyn-1-ol |
1714717 |
2-Propyn-1-ol, 3-phenyl- |
46748 |
2-Propynoic acid |
65805 |
2-Propynoic acid, 3-phenyl- |
48702 |
2-Pyridinamine |
696591 |
2-Pyridinamine, 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)- |
131862 |
2-Pyridinamine, 4,6-dimethyl- |
1714350 |
2-Pyridinamine, 5-bromo- |
89300 |
2-Pyridinamine, 5-methyl- |
122713 |
2-Pyridinamine, 5-nitro- |
19661 |
2-Pyridinecarbonitrile |
79087 |
2-Pyridinecarboxaldehyde |
18424 |
2-Pyridinecarboxylic acid |
90985 |
2-Pyridinecarboxylic acid, 3,6-dichloro- |
310516 |
2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1) |
94227 |
2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro- |
145078 |
2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, compd. with 1,1',1''-nitrilotris[2-propanol] (1:1) |
17127994 |
2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, compd. with N,N-diethylethanamine (1:1) |
243071 |
2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, isooctyl ester |
104158 |
2-Pyridinecarboxylic acid, 4-amino-3,5,6-trichloro-, monopotassium salt |
17124553 |
2-Pyridinecarboxylic acid, 6-chloro- |
106450 |
2-Pyridineethanamine |
21634 |
2-Pyridineethanol |
1714280 |
2-Pyridineethanol, .alpha.-(trichloromethyl)- |
1714578 |
2-Pyridinemethanol, 6-[2-(5-nitro-2-furanyl)ethenyl]- |
28894 |
2-Pyridinepropanamine, .gamma.-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
700062 |
2-Pyridinesulfonamide, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(ethylsulfonyl)- |
79061 |
2-Pyridinethiol, 1-oxide |
119388 |
2-Pyridinethiol, 1-oxide, sodium salt |
25643 |
2-Pyrimidinamine |
69880 |
2-Pyrimidinamine, 4,6-dimethyl- |
964288 |
2-Pyrimidinamine, 4-cyclopropyl-6-methyl-N-phenyl- |
61077 |
2-Pyrrolidinone |
161539 |
2-Pyrrolidinone, 1-ethenyl-, homopolymer |
234112 |
2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine |
17129826 |
2-Pyrrolidinone, 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]- |
17295171 |
2-Quinolinecarboxylic acid, 4-hydroxy- |
16899 |
2-Thiazolamine |
31864 |
2-Thiazolamine, 5-nitro- |
590976 |
2-Thiophenecarboxylic acid, 3-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]-, methyl ester |
57349 |
2-Tridecanone |
28134 |
2-Undecanone |
961797 |
3(2H)-benzothiazolacetic acid, 4-chloro-2-oxo- |
106138 |
3(2H)-Isothiazolone, 2-methyl- |
239871 |
3(2H)-Isothiazolone, 2-octyl- |
338897 |
3(2H)-Isothiazolone, 4,5-dichloro-2-octyl- |
237594 |
3(2H)-Isothiazolone, 5-chloro-2-methyl- |
963348 |
3(2H)-Isothiazolone, 5-chloro-2-methyl-, mixt. with 2-methyl-3(2H)-isothiazolone |
166181 |
3(2H)-Isoxazolone, 5-methyl- |
607481 |
3(2H)-Pyridazinone, 4-chloro-2-(1,1-dimethylethyl)-5-[[[4-(1,1-dimethylethyl)phenyl]methyl]thio]- |
17127184 |
3(2H)-Pyridazinone, 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]- |
1714751 |
3(2H)-Pyridazinone, 4-chloro-5-(dimethylamino)-2-phenyl- |
245191 |
3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]- |
17152190 |
3(2H)-Pyridazinone, 4-chloro-5-(methylamino)-2-phenyl- |
17127192 |
3(2H)-Pyridazinone, 5-amino-4-chloro-2-[3-(trifluoromethyl)phenyl]- |
90951 |
3(2H)-Pyridazinone, 5-amino-4-chloro-2-phenyl- |
2824 |
3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, hydrochloride |
17153099 |
3,5,7-Octatrien-2-one, 8-[(1R,2R,4S)-4-(acetyloxy)-2-hydroxy-2,6,6-trimethylcyclohexylidene]-6-methyl-, (3E,5E,7R)- |
121244 |
3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-(3-chloro-2-propenyl)-, chloride |
102137 |
3,5-Cyclohexadiene-1,2-dione, 3,4,5,6-tetrachloro- |
17126327 |
3,5-Dioxa-6-aza-4-phosphaoct-6-ene-8-nitrile, 4-ethoxy-7-phenyl-, 4-sulfide |
1714701 |
3,5-Dioxa-6-aza-4-phosphaoct-6-ene-8-nitrile, 7-(2-chlorophenyl)-4-ethoxy-, 4-sulfide |
17123076 |
3,5-Pyridinedicarbonitrile, 2,6-dichloro-4-phenyl- |
608869 |
3,5-Pyridinedicarbothioic acid, 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-, S,S-dimethyl ester |
110932 |
3,6,9,12,15,18,21-Heptaoxatritriacontan-1-ol |
4010 |
3,6-Acridinediamine, N,N,N',N'-tetramethyl-, monohydrochloride |
92783 |
3,6-Acridinediamine, sulfate (2:1) |
33688 |
3,6-Methano-8H-1,5,7-trioxacyclopenta[ij]cycloprop[a]azulene-4,8(3H)-dione, hexahydro-2a-hydroxy-9-(1-hydroxy-1-methylethyl)-8b-methyl-, (1aR,2aR,3S,6R,6aS,8aS,8bR,9S)-, compd. with (1aR,2aR,3S,6R,6aS,8aS,8bR,9R)-hexahydro-2a-hydroxy-8b-methyl-9-(1-methyl |
32920 |
3,6-Pyridazinedione, 1,2-dihydro- |
134551 |
3,6-Pyridazinedione, 1,2-dihydro-, compd. with 2,2'-iminobis[ethanol] (1:1) |
249078 |
3,6-Pyridazinedione, 1,2-dihydro-, monopotassium salt |
692194 |
3-Azabicyclo[3.1.0]hexane-2,4-dione, 3-(3,5-dichlorophenyl)-1,5-dimethyl- |
64055 |
3-Buten-1-ol |
29041 |
3-Buten-2-ol, 2-methyl- |
7450 |
3-Buten-2-one |
197616 |
3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)- |
7989 |
3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3E)- |
62729 |
3-Buten-2-one, 4-(2-furanyl)- |
77933 |
3-Buten-2-one, 4-(4-hydroxy-3-methoxyphenyl)- |
32367 |
3-Buten-2-one, 4-phenyl- |
26104 |
3-Butenenitrile |
17005919 |
3-Butyn-1-ol |
95596 |
3-Butyn-2-ol |
29058 |
3-Butyn-2-ol, 2-methyl- |
1714646 |
3-Butyn-2-one |
54528 |
3-Cyclohexen-1-ol, 4-methyl-1-(1-methylethyl)- |
1714599 |
3-Cyclohexen-1-one, 2,2,3,4,5,5,6,6-octachloro- |
18127 |
3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl- |
171660 |
3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl-, (1S)- |
74120 |
3-Decanone |
112763 |
3H-1,2,4-Triazole-3-thione, 1,2-dihydro- |
80648 |
3H-1,2-Dithiol-3-one, 4,5-dichloro- |
17000662 |
3H-2-Benzopyran-7-carboxylic acid, 4,6-dihydro-8-hydroxy-3,4,5-trimethyl-6-oxo-, (3R,4S)- |
17294844 |
3'H-Cyclopropa[1,2]pregna-1,4,6-triene-3,20-dione, 17-(acetyloxy)-6-chloro-1,2-dihydro-, (1.beta.,2.beta.)- |
52225 |
3-Heptanone, 5-methyl- |
78774 |
3-Hepten-2-one |
62836 |
3-Hexanol |
56408 |
3-Hexanone |
74195 |
3-Hexen-1-ol, (3E)- |
74187 |
3-Hexen-1-ol, (3Z)- |
124768 |
3-Hexene-2,5-dione |
89029 |
3-Hexenoic acid, (3E)- |
76166 |
3-Hexyn-1-ol |
17152059 |
3-Hexyn-2-one |
110544 |
3-Hexyne-2,5-diol |
38752 |
3-Hexyne-2,5-diol, 2,5-dimethyl- |
47183 |
3H-Indol-3-one, 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- |
126573 |
3H-Indolium, 1,3,3-trimethyl-2-[2-(1-methyl-2-phenyl-1H-indol-3-yl)ethenyl]-, chloride |
122655 |
3H-Indolium, 2-[2-[(2,4-dimethoxyphenyl)amino]ethenyl]-1,3,3-trimethyl-, chloride |
142752 |
3H-Indolium, 2-[2-[4-[(2-chloroethyl)ethylamino]-2-methylphenyl]ethenyl]-1,3,3-trimethyl-, chloride |
117721 |
3H-Indolium, 2-[2-[4-[(2-chloroethyl)methylamino]phenyl]ethenyl]-1,3,3-trimethyl-, chloride |
1714271 |
3H-Purin-6-amine, 3-(3-methyl-2-butenyl)- |
3434 |
3H-Pyrazol-3-one, 1,2-dihydro-1,5-dimethyl-2-phenyl- |
12237 |
3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
9464 |
3H-Pyrazol-3-one, 4-amino-1,2-dihydro-1,5-dimethyl-2-phenyl- |
17273228 |
3H-Pyrido[3,4-b]indole, 4,9-dihydro-7-methoxy-1-methyl- |
593384 |
3-Isoxazolidinone, 2-[(2-chlorophenyl)methyl]-4,4-dimethyl- |
1714355 |
3-Morpholinone |
63214 |
3-Nonanol |
194852 |
3-Nonen-2-one |
56549 |
3-Octanol |
23804 |
3-Octanone |
90480 |
3-Octen-2-one |
197681 |
3-Octyn-1-ol |
40360 |
3-Oxa-9-azoniatricyclo[3.3.1.02,4]nonane, 7-[(2S)-3-hydroxy-1-oxo-2-phenylpropoxy]-9,9-dimethyl-, bromide, (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)- |
55848 |
3-Pentanol |
58412 |
3-Pentanol, 2,4-dimethyl- |
6650 |
3-Pentanol, 3-methyl- |
16717 |
3-Pentanone |
63453 |
3-Penten-2-one |
38463 |
3-Penten-2-one, 4-methyl- |
169540 |
3-Pentyn-1-ol |
595645 |
3-Pyridazinecarboxylic acid, 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-, potassium salt |
46417 |
3-Pyridinamine |
19521 |
3-Pyridinecarbonitrile |
48272 |
3-Pyridinecarboxaldehyde |
18382 |
3-Pyridinecarboxamide |
617548 |
3-Pyridinecarboxamide, 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-N,N-dimethyl- |
17002742 |
3-Pyridinecarboxamide, 6-amino- |
1714680 |
3-Pyridinecarboxamide, N-(4-chlorophenyl)- |
1714623 |
3-Pyridinecarboxamide, N-[(butylamino)carbonyl]- |
3152 |
3-Pyridinecarboxylic acid |
17273160 |
3-Pyridinecarboxylic acid, 1,2,5,6-tetrahydro-1-methyl-, methyl ester, hydrobromide |
696708 |
3-Pyridinecarboxylic acid, 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxo-, potassium salt |
620708 |
3-Pyridinecarboxylic acid, 2-(difluoromethyl)-5-(4,5-dihydro-2-thiazolyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-, methyl ester |
964163 |
3-Pyridinecarboxylic acid, 2-[1-[[[(3,5-difluorophenyl)amino]carbonyl]hydrazono]ethyl]-, monosodium salt |
592782 |
3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- |
593160 |
3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-, compd. with 2-propanamine (1:1) |
618777 |
3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)- |
592824 |
3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl- |
619601 |
3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-methyl-, monoammonium salt |
131219 |
3-Pyridinecarboxylic acid, 2-amino- |
112615 |
3-Pyridinecarboxylic acid, 6-amino- |
19539 |
3-Pyridinemethanol |
17126699 |
3-Pyridinemethanol, .alpha.,.alpha.-bis(4-chlorophenyl)- |
108068 |
3-Pyridinepropanol |
25551 |
3-Pyridinol |
1714722 |
3-Pyridinol, 2-nitro- |
17295114 |
3-Pyrrolidineacetic acid, 2-carboxy-4-(1-methylethenyl)-, (2S,3S,4S)- |
1714648 |
3-Pyrrolidineacetic acid, 2-carboxy-4-[(1Z,3E,5R)-5-carboxy-1-methyl-1,3-hexadienyl]-, (2S,3S,4S)- |
55467 |
3-Quinolinamine |
592790 |
3-Quinolinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- |
1714405 |
3-Quinolinecarboxylic acid, 5-amino-7-(3-amino-1-pyrrolidinyl)-1-cyclopropyl-6,8-difluoro-1,4-dihydro-4-oxo- |
17153230 |
3-Quinolinecarboxylic acid, 6-(decyloxy)-7-ethoxy-4-hydroxy-, ethyl ester |
1714340 |
3-Quinolinecarboxylic acid, 7-(3-amino-1-pyrrolidinyl)-8-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo- |
590455 |
3-Thiazolidinecarboxamide, 5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-, (4R,5R)-rel- |
315366 |
4(1H)-Pyridinone, 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]- |
38521 |
4(1H)-Pyrimidinone, 2,3-dihydro-2-thioxo- |
1388 |
4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo- |
2014 |
4(1H)-Pyrimidinone, 2,6-diamino- |
961912 |
4(1H)-Pyrimidinone, 5-butyl-2-(dimethylamino)-6-methyl- |
107615 |
4(1H)-Pyrimidinone, 6-methyl-2-(1-methylethyl)- |
53421 |
4,4'-Bipyridine |
1714539 |
4,4'-Bipyridinium, 1,1'-bis(phenylmethyl)- |
1714465 |
4,4'-Bipyridinium, 1,1'-dibutyl- |
126730 |
4,4'-Bipyridinium, 1,1'-dimethyl- |
96578 |
4,4'-Bipyridinium, 1,1'-dimethyl-, bis(methyl sulfate) |
94110 |
4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride |
130146 |
4,6(1H,5H)-Pyrimidinedione, 1,3-diethyldihydro-2-thioxo- |
17272758 |
4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-, monosodium salt |
17273343 |
4,6(1H,5H)-Pyrimidinedione, dihydro-5-(1-methylbutyl)-5-(2-propenyl)-2-thioxo-, monosodium salt |
17163668 |
4,6-Dioxa-5-thia-3,7-distannanonane, 3,3,7,7-tetraethyl-, 5,5-dioxide |
35865 |
4,7-Methano-1H-inden-5-ol, 3a,4,5,6,7,7a-hexahydro- |
280156 |
4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-, (1.alpha.,2.beta.,3.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
2683 |
4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
129379 |
4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2R,3aS,4S,7R,7aS)-rel- |
129353 |
4,7-Methano-1H-indene, 1,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro-, (1R,2S,3aS,4S,7R,7aS)-rel |
6262 |
4,7-Methano-1H-indene, 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro- |
133777 |
4,7-Methano-1H-indene, 2,2,4,5,6,7,8,8-octachloro-2,3,3a,4,7,7a-hexahydro- |
1714641 |
4,7-Methano-1H-indene, 2,4,5,6,7,8,8-heptachloro-2,3,3a,4,7,7a-hexahydro-, (2.alpha.,3a.alpha.,4.beta.,7.beta.,7a.alpha.)- |
6643 |
4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro- |
118554 |
4,7-Methano-1H-indene, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro- |
28878 |
4,7-Methano-1H-isoindole-1,3(2H)-dione, 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro- |
41178 |
4,7-Methanoisobenzofuran, 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro- |
1714294 |
4,7-Methanoisobenzofuran-1-ol, 4,5,6,7,8,8-hexachloro-1,3,3a,4,7,7a-hexahydro- |
1714338 |
4,8:11,15-Dimethano-20H-bisbenzofuro[2,3-a:3',2'-i]dipyrido[4,3-b:3',4'-h]carbazole-1,8a,10a,18-tetrol, 7,12-bis(cyclopropylmethyl)-5,6,7,8,9,10,11,12,13,14,19a,20b-dodecahydro-, (4bS,8R,8aS,10aS,11R,14aS,19aR,20bR)- |
17136458 |
4-Amino-3,5,6-trichloro-2-pyridinecarboxylic acid compd with 1,1',1-nitrilotris[2-propanol] mixture with (2,4-dichlorophenoxy)acetic acid cmpd with 1,1',1-nitrilotris[2-propanol (1:1) |
99978 |
4-Cyclohexene-1,2-dicarboxylic acid, (1R,2S)-rel- |
17151432 |
4-Cyclohexene-1,3-dione, 2,2,4,6,6-pentachloro- |
709022 |
4H-1,2,4-Triazol-4-amine |
17123985 |
4H-1,3,2-Benzodioxaphosphorin, 2-chlorohexahydro-4-methyl-, 2-sulfide |
961789 |
4H-1,3,2-Benzodioxaphosphorin, 2-methoxy-, 2-sulfide |
963629 |
4H-1,3,5-Thiadiazin-4-one, 2-[(1,1-dimethylethyl)imino]tetrahydro-3-(1-methylethyl)-5-phenyl- |
47092 |
4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
29793 |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy- |
50377 |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy- |
17122136 |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy- |
17295007 |
4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, (2R,3R)- |
17295023 |
4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-, (2S)- |
17295015 |
4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-phenyl-, (2S)- |
50120 |
4H-1-Benzopyran-4-one, 2-phenyl- |
40295 |
4H-1-Benzopyran-4-one, 3-[[6-O-(6-deoxy-.alpha.-L-mannopyranosyl)-.beta.-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy- |
55293 |
4H-1-Benzopyran-4-one, 3-hydroxy-2-phenyl- |
45823 |
4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxyphenyl)- |
47605 |
4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-methoxyphenyl)- |
17295098 |
4H-1-Benzopyran-4-one, 7-hydroxy-3-(4-hydroxyphenyl)- |
42119 |
4H-Dibenzo[de,g]quinoline-10,11-diol, 5,6,6a,7-tetrahydro-6-methyl-, hydrochloride, (6aR)- |
32839 |
4-Heptanone |
25403 |
4-Heptanone, 2,6-dimethyl- |
74153 |
4-Hexen-1-ol, (4E)- |
103374 |
4-Hexen-3-one |
1714707 |
4H-Furo[3,2-c]pyran-2(6H)-one, 4-hydroxy- |
58719 |
4H-Naphtho[1,2-b]pyran-4-one, 2-phenyl- |
1714267 |
4H-Pyran-4-one, 2,6-dimethyl- |
961128 |
4H-Pyran-4-one, 5-hydroxy-2-(hydroxymethyl)- |
17152166 |
4H-Pyrano[2,3-b][1,4]benzodioxin-4-one, decahydro-4a,7,9-trihydroxy-2-methyl-6,8-bis(methylamino)-, (2R,4aR,5aR,6S,7S,8R,9S,9aR,10aS)- |
712513 |
4H-Pyrazino[2,1-a]isoquinolin-4-one, 2-(cyclohexylcarbonyl)-1,2,3,6,7,11b-hexahydro- |
42143 |
4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1,5-dihydro- |
48629 |
4-Imidazolidinone, 2-thioxo- |
62497 |
4-Morpholineethanol |
17121872 |
4-Nonanol, (4S)- |
57018 |
4-Pentenoic acid |
1714524 |
4-Pyridazinecarboxylic acid, 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo- |
48694 |
4-Pyridinamine |
79178 |
4-Pyridinamine, N,N-dimethyl- |
19463 |
4-Pyridinecarbonitrile |
72751 |
4-Pyridinecarboxaldehyde |
17272709 |
4-Pyridinecarboxaldehyde, 3-hydroxy-5-(hydroxymethyl)-2-methyl- |
86934 |
4-Pyridinecarboxamide |
1891 |
4-Pyridinecarboxylic acid |
18523 |
4-Pyridinecarboxylic acid, 1,2-dihydro-6-hydroxy-2-oxo- |
1826 |
4-Pyridinecarboxylic acid, hydrazide |
102582 |
4-Pyridinecarboxylic acid, methyl ester |
56143 |
4-Pyridinemethanol |
63834 |
4-Pyridinol |
17123506 |
4-Pyridinol, 2,3,5-trichloro- |
17123902 |
4-Pyridinol, 3,5-dichloro-2,6-difluoro- |
51201 |
4-Pyrimidinamine, 2-chloro-N,N,6-trimethyl- |
126367 |
4-Pyrimidineacetic acid, 1,2,3,6-tetrahydro-2,6-dioxo- |
4051 |
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo- |
28902 |
4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]- (2S,5R,6R)-, monopotassium salt |
17164245 |
4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(2R)-aminophenylacetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)- |
1714741 |
4-Thiazolidinone, 5-(3-phenyl-2-propenylidene)-2-thioxo- |
51219 |
4-Thiazolidinone, 5-[[4-(dimethylamino)phenyl]methylene]-2-thioxo- |
350967 |
4-Tridecen-1-ol, acetate, (4Z)- |
17005000 |
5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, (8S,10S)- |
218735 |
5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)- |
28845 |
5,8,11,14,17-Pentaoxaheneicosane |
8953 |
5,9,14,18-Anthrazinetetrone, 6,15-dihydro- |
35162 |
5,9,14,18-Anthrazinetetrone, 7,16-dichloro-6,15-dihydro- |
3467 |
5'-Adenylic acid |
237842 |
5-Benzofuranol, 2-ethoxy-2,3-dihydro-3,3-dimethyl-, methanesulfonate |
28886 |
5H-Dibenz[b,f]azepine-5-propanamine, 10,11-dihydro-N,N-dimethyl-, monohydrochloride |
27094 |
5-Hepten-2-one, 6-methyl- |
17119330 |
5-Hexen-1-ol |
25882 |
5-Hexen-2-one |
113480 |
5-Hexen-2-one, 5-methyl- |
17272873 |
5H-Furo[3,2-g][1]benzopyran-5-one, 4,9-dimethoxy-7-methyl- |
1714687 |
5-Isoxazolamine |
48447 |
5-Nonanone |
306985 |
5-Pyrimidinemethanol, .alpha.-(1-methylethyl)-.alpha.-[4-(trifluoromethoxy)phenyl]- |
52466463 |
5-Pyrimidinemethanol, .alpha.-(2,4-dichlorophenyl)-.alpha.-phenyl- |
316356 |
5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- |
183095 |
5-Pyrimidinemethanol, .alpha.-cyclopropyl-.alpha.-(4-methoxyphenyl)- |
53116 |
5-Quinolinesulfonic acid, 8-hydroxy-7-iodo- |
1714284 |
6(5H)-Phenanthridinone |
194530 |
6,11-Dioxa-5,12-distannahexadec-8-ene, 5,5,12,12-tetrabutyl-7,10-dioxo-, (8Z)- |
4218 |
6,9-Dioxa-3,12-diazatetradecanedioic acid, 3,12-bis(carboxymethyl)- |
76737 |
6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3,3-dioxide |
29132 |
6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |
263996 |
6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.alpha.,6.beta.,9.beta.,9a.alpha.)- |
75333 |
6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide, (3.alpha.,5a.beta.,6.alpha.,9.alpha.,9a.beta.)- |
17123787 |
6,9-Methano-2,4-benzodioxepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-3-methyl- |
17003682 |
6H-Dibenzo[b,d]pyran-1-ol, 6a,7,8,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-, (6aR,10aR)- |
1714719 |
6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 5-methoxy- |
4499 |
6H-Purin-6-one, 1,7-dihydro- |
5009 |
6H-Purin-6-one, 2-amino-1,7-dihydro- |
17001967 |
6H-Purine-6-thione, 1,7-dihydro- |
44982 |
6-Nonenamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl-, (6E)- |
23390 |
6-Octen-1-ol, 3,7-dimethyl- |
23408 |
6-Octenal, 3,7-dimethyl- |
17273103 |
7,8-Dibenzocarbazole |
88658 |
7-Benzofuranol, 2,3-dihydro-2,2-dimethyl- |
88666 |
7-Benzofuranol, 2,3-dihydro-2,2-dimethyl-, methylcarbamate |
197848 |
7-Dodecen-1-ol, acetate, (7Z)- |
1714581 |
7H-1,2,3-Triazolo[4,5-d]pyrimidin-7-one, 5-amino-1,4-dihydro- |
9084 |
7H-Benz[de]anthracen-7-one |
40634 |
7H-Dibenzo[c,g]carbazole |
17001033 |
7H-Furo[3',2':4,5]furo[2,3-c]xanthen-7-one, 3a,12c-dihydro-8-hydroxy-6-methoxy-, (3aR,12cS)- |
41269 |
7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy- |
17164179 |
7H-Pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid, 9-fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo- |
687814 |
7-Oxa-5-thia-2-aza-6-phosphanonanoic acid, 6-ethoxy-2-methyl-3-oxo-, ethyl ester, 6-sulfide |
17121476 |
7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, disodium salt, (endo,endo)- |
39560 |
7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
17126624 |
7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid, diammonium salt |
97998 |
7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid, dipotassium salt |
35014 |
7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid, disodium salt |
17294935 |
7-Tridecanone |
1714348 |
8-Dodecen-1-ol, (8Z)-, mixt. with 8-dodecenyl acetate |
17130618 |
8-Oxa-3-thia-2,4-diazadecanoic acid, 2-methyl-4-(1-methylethyl)-7-oxo-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
596247 |
8-Quinolinecarboxylic acid, 3,7-dichloro- |
39735 |
8-Quinolinol |
71563 |
8-Quinolinol, 2-methyl- |
49981 |
8-Quinolinol, 5,7-dibromo- |
9738 |
8-Quinolinol, 5,7-diiodo- |
35196 |
8-Quinolinol, 5-chloro-7-iodo- |
36079 |
8-Quinolinol, sulfate (2:1) (salt) |
55368 |
9(10H)-Acridinone |
17295445 |
9(10H)-Acridinone, 1,2,3,4-tetramethoxy-10-methyl- |
9977 |
9,10-Anthracenedione |
17272881 |
9,10-Anthracenedione, 1,2,3,5,6,7-hexahydroxy- |
17272865 |
9,10-Anthracenedione, 1,2,4-trihydroxy- |
8888 |
9,10-Anthracenedione, 1,2,5,8-tetrahydroxy- |
4929 |
9,10-Anthracenedione, 1,2-dihydroxy- |
17295460 |
9,10-Anthracenedione, 1,3-dihydroxy- |
8904 |
9,10-Anthracenedione, 1,4-dihydroxy- |
112847 |
9,10-Anthracenedione, 1,4-dihydroxy-5,8-bis[(2-hydroxyethyl)amino]- |
29710 |
9,10-Anthracenedione, 1,5-dihydroxy- |
9274 |
9,10-Anthracenedione, 1,8-dichloro- |
29694 |
9,10-Anthracenedione, 1,8-dihydroxy- |
9290 |
9,10-Anthracenedione, 1-amino- |
208199 |
9,10-Anthracenedione, 1-amino-4-hydroxy-2-phenoxy- |
9282 |
9,10-Anthracenedione, 1-chloro- |
9936 |
9,10-Anthracenedione, 2,6-dihydroxy- |
29918 |
9,10-Anthracenedione, 2-amino- |
35287 |
9,10-Anthracenedione, 2-chloro- |
9894 |
9,10-Anthracenedione, 2-ethyl- |
58768 |
9,10-Anthracenedione, 2-hydroxy- |
9902 |
9,10-Anthracenedione, 2-methyl- |
9803 |
9,10-Phenanthrenedione |
46466 |
9,12,15-Octadecatrienoic acid, (9Z,12Z,15Z)- |
41467 |
9,12,15-Octadecatrienoic acid, methyl ester, (9Z,12Z,15Z)- |
3368 |
9,12-Octadecadienoic acid (9Z,12Z)- |
17295353 |
9,12-Octadecadienoic acid, (9E,12E)- |
1714336 |
9,9'-Bianthracene |
17002288 |
9-Acridinamine |
68874 |
9-Anthracenecarboxylic acid |
10900 |
9H-Carbazole |
17151549 |
9H-Carbazole, 3-bromo- |
1714414 |
9H-Carbazole, 9-(2-chloroethyl)- |
17153552 |
9H-Carbazole, 9-benzoyl- |
87411 |
9H-Carbazole, 9-ethenyl- |
107441 |
9H-Carbazole, 9-nitroso- |
17295056 |
9H-Dibenzo[f,h]pyrido[1,2-b]isoquinoline, 11,12,13,14,14a,15-hexahydro-2,3,6-trimethoxy-, (14aR)- |
17074535 |
9-Hexadecenoic acid, (9Z)- |
685271 |
9H-Fluoren-2-amine |
90803 |
9H-Fluoren-9-ol |
47266 |
9H-Fluoren-9-one |
35055 |
9H-Fluoren-9-one, 2,4,7-trinitro- |
10892 |
9H-Fluorene |
59048 |
9H-Fluorene, 2-nitro- |
962670 |
9H-Fluorene-9-carboxylic acid, 2,7-dichloro-9-hydroxy-, methyl ester |
17122011 |
9H-Fluorene-9-carboxylic acid, 2-chloro-9-hydroxy- |
104034 |
9H-Fluorene-9-carboxylic acid, 2-chloro-9-hydroxy-, methyl ester |
17132960 |
9H-Fluorene-9-carboxylic acid, 9-hydroxy- |
17123647 |
9H-Fluorene-9-carboxylic acid, 9-hydroxy-, butyl ester |
100081 |
9H-Purin-6-amine, N-(phenylmethyl)-9-(tetrahydro-2H-pyran-2-yl)- |
17152992 |
9H-Pyrrolo[1',2':2,3]isoindolo[4,5,6-cd]indol-9-one, 10-acetyl-2,6,6a,7,11a,11b-hexahydro-11-hydroxy-7,7-dimethyl-, (6aR,11aS,11bR)-rel- |
47613 |
9H-Thioxanthen-9-one |
17005026 |
9H-Thioxanthen-9-one, 1-[[2-(diethylamino)ethyl]amino]-4-(hydroxymethyl)-, monomethanesulfonate (salt) |
13037 |
9H-Xanthen-9-one |
14456 |
9H-Xanthene |
28795 |
9-Octadecen-1-amine, (9Z)- |
142968 |
9-Octadecen-1-aminium, N-ethyl-N,N-dimethyl-, bromide |
39289 |
9-Octadecen-1-ol, (9Z)- |
28720 |
9-Octadecenoic acid (9Z)- |
32201 |
9-Octadecenoic acid (9Z)-, 1,2,3-propanetriyl ester |
17152646 |
9-Octadecenoic acid (9Z)-, 4-nitrophenyl ester |
27714 |
9-Octadecenoic acid (9Z)-, ethyl ester |
28597 |
9-Octadecenoic acid (9Z)-, methyl ester |
39222 |
9-Octadecenoic acid (9Z)-, potassium salt |
39230 |
9-Octadecenoic acid (9Z)-, sodium salt |
524672052 |
9-Octadecenoic acid, 12-(acetyloxy)-, 2-methoxyethyl ester, (R-(Z))- |
37614 |
9-Octadecenoic acid, 12-(acetyloxy)-, butyl ester, (9Z,12R)- |
37606 |
9-Octadecenoic acid, 12-(acetyloxy)-, methyl ester, (9Z,12R)- |
38208 |
9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)- |
1714644 |
9-Octadecenoic acid, 12-hydroxy-, 2-methoxyethyl ester, [R-(Z)]- |
127084 |
9-Octadecenoic acid, 12-hydroxy-, barium salt (2:1), (9Z,12R)- |
40196 |
9-Octadecenoic acid, 12-hydroxy-, butyl ester, (9Z,12R)- |
145706 |
9-Octadecenoic acid, 12-hydroxy-, calcium salt (2:1), (9Z,12R)- |
38224 |
9-Octadecenoic acid, 12-hydroxy-, methyl ester, (9Z,12R)- |
239160 |
9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2-propanediol |
150854 |
9-Octadecenoic acid, 12-hydroxy-, monopotassium salt, (9Z,12R)- |
130807 |
9-Octadecenoic acid, 12-hydroxy-, monosodium salt, (9Z,12R)- |
17152331 |
A 610 Petrobond |
1939339 |
Abarenicola pacifica |
17112889 |
Abelia sp. |
17102302 |
Abelmoschus esculentus |
17102310 |
Abies balsamea |
17102328 |
Abies concolor |
17102336 |
Abies magnifica |
1876671 |
Ablabesmyia |
1907013 |
Abra aequalis |
17090697 |
Abra alba |
17085911 |
Abramis ballerus |
17076431 |
Abramis brama |
17102344 |
Abutilon theophrasti |
17102351 |
Acacia constricta |
17102369 |
Acacia farnesiana |
17113242 |
Acacia flavescens |
17102377 |
Acacia greggii |
17102393 |
Acacia macracantha |
17102401 |
Acacia nilotica |
17102419 |
Acacia pennata |
17113259 |
Acacia rigidula |
17102427 |
Acacia rubida |
17110669 |
Acacia tortilis |
17113267 |
Acacia tortuosa |
17113275 |
Acalypha ostryifolia |
17102435 |
Acalypha virginica |
17082322 |
Acanthamoeba castellanii |
17088519 |
Acanthamoeba hatchetti |
1918457 |
Acanthocyclops vernalis |
17085929 |
Acanthocyclops viridis |
17096926 |
Acanthodiaptomus sp. |
1958255 |
Acanthogobius flavimanus |
1962018 |
Acantholeberis curvirostris |
1946748 |
Acanthomysis costata |
17086968 |
Acanthopagrus australis |
17088527 |
Acanthopagrus schlegeli |
17093626 |
Acari |
17080110 |
Acaridei |
1918473 |
Acarina |
17085531 |
Acartia |
17079526 |
Acartia bifilosa |
17082017 |
Acartia clausi |
17082314 |
Acartia hudsonica |
17087586 |
Acartia lilljeborgi |
17077637 |
Acartia simplex |
17081993 |
Acartia spinicauda |
17076688 |
Acartia tonsa |
1918481 |
Accipiter cooperii |
17086950 |
Accipiter gentilis |
40717 |
Acenaphthylene |
9555 |
Acenaphthylene, 1,2-dihydro- |
17102443 |
Acer ginnala |
17102450 |
Acer macrophyllum |
17102468 |
Acer negundo |
17102476 |
Acer palmatum |
17113283 |
Acer pensylvanicum |
17102484 |
Acer pseudoplatanus |
17102492 |
Acer rubrum |
17102500 |
Acer saccharinum |
17102518 |
Acer saccharum |
17109497 |
Acer sp. |
1870534 |
Acerpenna pygmaea |
17111451 |
Acetabularia |
17101486 |
Acetabularia acetabulum |
17115932 |
Acetabularia calyculus |
5280 |
Acetaldehyde |
24240 |
Acetaldehyde, chloro- |
7534 |
Acetaldehyde, dichloro- |
24281 |
Acetaldehyde, oxime |
97246 |
Acetaldehyde, phenoxy- |
5959 |
Acetaldehyde, trichloro- |
3384 |
Acetamide |
1714758 |
Acetamide, 2-(2-benzothiazolyloxy)-N-methyl-N-phenyl- |
37051 |
Acetamide, 2-(diethylamino)-N-(2,6-dimethylphenyl)- |
17121963 |
Acetamide, 2,2-dibromo- |
169524 |
Acetamide, 2,2-dibromo-2-cyano- |
67421 |
Acetamide, 2,2-dichloro- |
2261 |
Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]- |
1714740 |
Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-[4-(methylsulfonyl)phenyl]ethyl]- |
7583 |
Acetamide, 2-chloro- |
17126939 |
Acetamide, 2-chloro-N-(1-methyl-2-propynyl)-N-phenyl- |
94235 |
Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl- |
600437 |
Acetamide, 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-(2-methoxy-1-methylethyl)- |
17131772 |
Acetamide, 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-[(1S)-2-methoxy-1-methylethyl]- |
202549 |
Acetamide, 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)- |
288902 |
Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)- |
690602 |
Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-[(1-methylethoxy)methyl]- |
691253 |
Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-[(2-methylpropoxy)methyl]- |
291013 |
Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- |
1714420 |
Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)-, mixt. with N,N'-bis(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine and 6-chloro-N-ethyl-N'-(1-methylethyl)-1,3,5-triazine-2,4-diamine |
600338 |
Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]- |
17151994 |
Acetamide, 2-chloro-N-(4-methylphenyl)- |
266114 |
Acetamide, 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)- |
15040 |
Acetamide, 2-chloro-N,N-di-2-propenyl- |
24711 |
Acetamide, 2-cyano- |
310995 |
Acetamide, 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)- |
66217 |
Acetamide, 2-fluoro- |
39412 |
Acetamide, 2-iodo- |
96057 |
Acetamide, N-(2,4-dimethylphenyl)- |
59691 |
Acetamide, N-(2,4-dinitrophenyl)- |
589515 |
Acetamide, N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-3-oxazolidinyl)- |
60491 |
Acetamide, N-(2-hydroxyphenyl)- |
106583 |
Acetamide, N-(2-methyl-4-nitrophenyl)- |
31344 |
Acetamide, N-(2-methylphenyl)- |
53314 |
Acetamide, N-(2-nitrophenyl)- |
147405 |
Acetamide, N-(3-chloro-4-methylphenyl)- |
62216 |
Acetamide, N-(3-hydroxyphenyl)- |
51474 |
Acetamide, N-(3-methylphenyl)- |
32193 |
Acetamide, N-(3-nitrophenyl)- |
17272949 |
Acetamide, N-(4,5-dihydro-4-methyl-5-oxo-1,2-dithiolo[4,3-b]pyrrol-6-yl)- |
32540 |
Acetamide, N-(4-aminophenyl)- |
21758 |
Acetamide, N-(4-bromophenyl)- |
51656 |
Acetamide, N-(4-chlorophenyl)- |
3590 |
Acetamide, N-(4-ethoxyphenyl)- |
964510 |
Acetamide, N-(4-fluorophenyl)-N-(1-methylethyl)-2-((5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl)oxy)- |
21774 |
Acetamide, N-(4-hydroxyphenyl)- |
62513 |
Acetamide, N-(4-iodophenyl)- |
30908 |
Acetamide, N-(4-methoxy-2-nitrophenyl)- |
21873 |
Acetamide, N-(4-nitrophenyl)- |
56770 |
Acetamide, N-(aminothioxomethyl)- |
223263 |
Acetamide, N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)- |
67504 |
Acetamide, N,N-diethyl- |
34165 |
Acetamide, N,N-dimethyl- |
49916 |
Acetamide, N,N-diphenyl- |
3921 |
Acetamide, N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]- |
299875 |
Acetamide, N-[2,4-dimethyl-5-[[(trifluoromethyl)sulfonyl]amino]phenyl]- |
299883 |
Acetamide, N-[2,4-dimethyl-5-[[(trifluoromethyl)sulfonyl]amino]phenyl]-, compd. with 2,2'-iminobis[ethanol] (1:1) |
595694 |
Acetamide, N-[2,4-dimethyl-5-[[(trifluoromethyl)sulfonyl]amino]phenyl]-, monopotassium salt |
288605 |
Acetamide, N-[4-(2-hydroxyethoxy)phenyl]- |
105320 |
Acetamide, N-[4-(acetyloxy)phenyl]- |
1714467 |
Acetamide, N-[4-(aminosulfonyl)phenyl]- |
107755 |
Acetamide, N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]- |
963140 |
Acetamide, N-[4-methyl-3-[[(trifluoromethyl)sulfonyl]amino]phenyl]- |
3145 |
Acetamide, N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]- |
117416 |
Acetamide, N-[5-[bis[2-(acetyloxy)ethyl]amino]-2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxyphenyl]- |
55145 |
Acetamide, N-1-naphthalenyl- |
1719 |
Acetamide, N-9H-fluoren-2-yl- |
7658 |
Acetamide, N-methyl- |
55384 |
Acetamide, N-methyl-N-phenyl- |
21725 |
Acetamide, N-phenyl- |
3848 |
Acetic acid |
24828 |
Acetic acid ethenyl ester |
227355 |
Acetic acid ethenyl ester, polymer with ethene |
38455 |
Acetic acid ethyl ester |
963637 |
Acetic acid, ((4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy)- |
963793 |
Acetic acid, ((4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy)-, 1-methylheptyl ester |
15065 |
Acetic acid, (2,4,5-trichlorophenoxy)- |
960864 |
Acetic acid, (2,4,5-trichlorophenoxy)-, 1-methylethyl ester |
104141 |
Acetic acid, (2,4,5-trichlorophenoxy)-, 2-butoxyethyl ester |
17123472 |
Acetic acid, (2,4,5-trichlorophenoxy)-, 3-butoxypropyl ester |
15081 |
Acetic acid, (2,4,5-trichlorophenoxy)-, butyl ester |
119420 |
Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |
95406 |
Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine (1:1) |
140855 |
Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
230599 |
Acetic acid, (2,4,5-trichlorophenoxy)-, isooctyl ester |
17122458 |
Acetic acid, (2,4,5-trichlorophenoxy)-, pentyl ester |
188441 |
Acetic acid, (2,4,5-trichlorophenoxy)-, sodium salt |
15651 |
Acetic acid, (2,4-dichlorophenoxy)- |
15289 |
Acetic acid, (2,4-dichlorophenoxy)-, 1-methylethyl ester |
94201 |
Acetic acid, (2,4-dichlorophenoxy)-, 1-methylheptyl ester |
17124363 |
Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxy-1-methylethyl ester |
94441 |
Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxyethyl ester |
83626 |
Acetic acid, (2,4-dichlorophenoxy)-, 2-butoxymethylethyl ester |
94383 |
Acetic acid, (2,4-dichlorophenoxy)-, 2-ethylhexyl ester |
94391 |
Acetic acid, (2,4-dichlorophenoxy)-, 3-butoxypropyl ester |
100032 |
Acetic acid, (2,4-dichlorophenoxy)-, ammonium salt |
15685 |
Acetic acid, (2,4-dichlorophenoxy)-, butyl ester |
777284 |
Acetic acid, (2,4-dichlorophenoxy)-, butyl ester, mixt. with butyl (2,4,5-trichlorophenoxy)acetate |
261826 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with 1,1',1''-nitrilotris[2-propanol] (1:1) |
17128042 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with 1-heptanamine (1:1) |
104604 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with 2,2',2-nitrilotris[ethanol] (1:1) |
134734 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with 2,2'-iminobis[ethanol] (1:1) |
134726 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with 2-propanamine (1:1) |
105726 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with N,N-diethylethanamine (1:1) |
98582 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-9-octadecenyl-1,3-propanediamine (1:1), (Z)- |
17121443 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-9-octadecenyl-1,3-propanediamine (2:1) |
218891 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-ethylethanamine (1:1) |
95380 |
Acetic acid, (2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
17122755 |
Acetic acid, (2,4-dichlorophenoxy)-, ethyl ester |
230631 |
Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester |
17128471 |
Acetic acid, (2,4-dichlorophenoxy)-, isooctyl ester, mixt. with isooctyl (2,4,5-trichlorophenoxy)acetate |
118935 |
Acetic acid, (2,4-dichlorophenoxy)-, lithium salt |
94375 |
Acetic acid, (2,4-dichlorophenoxy)-, methyl ester |
17125527 |
Acetic acid, (2,4-dichlorophenoxy)-, mixt. with (2,4,5-trichlorophenoxy)acetic acid |
17126236 |
Acetic acid, (2,4-dichlorophenoxy)-, potassium salt |
106419 |
Acetic acid, (2,4-dichlorophenoxy)-, sodium salt |
17153370 |
Acetic acid, (2-bromophenoxy)- |
17151333 |
Acetic acid, (2-chloro-5-methylphenoxy)- |
17153354 |
Acetic acid, (2-methoxyphenoxy)- |
17123407 |
Acetic acid, (2-methylphenoxy)- |
31088 |
Acetic acid, (2-naphthalenyloxy)- |
17125667 |
Acetic acid, (2-naphthalenyloxy)-, sodium salt |
17153362 |
Acetic acid, (2-nitrophenoxy)- |
17151887 |
Acetic acid, (3-methylphenoxy)- |
93732 |
Acetic acid, (4-bromophenoxy)- |
15644 |
Acetic acid, (4-chloro-2-methylphenoxy)- |
215004 |
Acetic acid, (4-chloro-2-methylphenoxy)-, 2-butoxyethyl ester |
91298 |
Acetic acid, (4-chloro-2-methylphenoxy)-, 2-methylpropyl ester |
91306 |
Acetic acid, (4-chloro-2-methylphenoxy)-, butyl ester |
95778 |
Acetic acid, (4-chloro-2-methylphenoxy)-, compd. with N-methylmethanamine (1:1) |
239970 |
Acetic acid, (4-chloro-2-methylphenoxy)-, isooctyl ester |
17124629 |
Acetic acid, (4-chloro-2-methylphenoxy)-, potassium salt |
117754 |
Acetic acid, (4-chloro-2-methylphenoxy)-, sodium salt |
32599 |
Acetic acid, (4-chlorophenoxy)- |
93682 |
Acetic acid, (4-methoxyphenoxy)- |
1714302 |
Acetic acid, (phenylthio)- |
303958 |
Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]- |
340570 |
Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, 2-butoxyethyl ester |
309120 |
Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. with N,N-diethylethanamine (1:1) |
17124652 |
Acetic acid, [(benzoylamino)oxy]- |
17124645 |
Acetic acid, [(benzoylamino)oxy]-, monoammonium salt |
691535 |
Acetic acid, [(tributylstannyl)thio]-, isooctyl ester |
17131194 |
Acetic acid, [[2-chloro-4-fluoro-5-[(tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]thio]-, methyl ester |
17002072 |
Acetic acid, [2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]- |
600387 |
Acetic acid, [2-chloro-4-fluoro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenoxy]-, pentyl ester |
51979 |
Acetic acid, 1,1-dimethylethyl ester |
24943 |
Acetic acid, 1-methylethyl ester |
22814 |
Acetic acid, 1-methylpropyl ester |
27151 |
Acetic acid, 2,2'-oxybis- |
33266 |
Acetic acid, 2,2'-thiobis- |
17136698 |
Acetic acid, 2,4-dichlorophenoxy-, mixed butyl and isopropyl esters |
50880 |
Acetic acid, 2-methylphenyl ester |
26476 |
Acetic acid, 2-methylpropyl ester |
28977 |
Acetic acid, 2-phenylhydrazide |
1714732 |
Acetic acid, 3-nitrophenyl ester |
71720 |
Acetic acid, 4-nitrophenyl ester |
65185 |
Acetic acid, ammonium salt |
24976 |
Acetic acid, anhydride |
52621 |
Acetic acid, barium salt |
7591 |
Acetic acid, bromo- |
218255 |
Acetic acid, bromo-, 2-butene-1,4-diyl ester |
17124439 |
Acetic acid, bromo-, 2-hydroxypropyl ester |
22731 |
Acetic acid, bromo-, ethyl ester |
16782 |
Acetic acid, bromo-, methyl ester |
33233 |
Acetic acid, butyl ester |
52654 |
Acetic acid, cadmium salt |
51383 |
Acetic acid, cerium(3+) salt |
7625 |
Acetic acid, chloro- |
22764 |
Acetic acid, chloro-, ethyl ester |
16808 |
Acetic acid, chloro-, methyl ester |
62000 |
Acetic acid, chloro-, phenyl ester |
120204 |
Acetic acid, chloro-, sodium salt |
76950 |
Acetic acid, chromium(3+) salt |
4770 |
Acetic acid, cobalt(2+) salt |
122242 |
Acetic acid, copper salt |
58081 |
Acetic acid, copper(1+) salt |
38901 |
Acetic acid, copper(2+) salt |
44164 |
Acetic acid, cyano- |
22723 |
Acetic acid, cyano-, methyl ester |
62505 |
Acetic acid, cyclohexyl ester |
65201 |
Acetic acid, dibromo- |
7856 |
Acetic acid, dichloro- |
17153081 |
Acetic acid, dichloro-, 1,2-ethanediyl ester |
29504 |
Acetic acid, dichloro-, methyl ester |
39420 |
Acetic acid, fluoro- |
3699 |
Acetic acid, fluoro-, sodium salt |
104638 |
Acetic acid, gallium salt |
39065 |
Acetic acid, hexyl ester |
77180 |
Acetic acid, hydrazide |
7633 |
Acetic acid, hydroxy- |
3897 |
Acetic acid, iodo- |
41756 |
Acetic acid, iodo-, sodium salt |
684910 |
Acetic acid, ion(1-) |
73445 |
Acetic acid, lanthanum(3+) salt |
41483 |
Acetic acid, lead(2+) salt |
17004235 |
Acetic acid, lead(2+) salt, trihydrate |
52969 |
Acetic acid, lead(4+) salt |
66076 |
Acetic acid, manganese(2+) salt |
4408 |
Acetic acid, mercapto- |
132159 |
Acetic acid, mercapto-, monoammonium salt |
89268 |
Acetic acid, mercury(2+) salt |
7674 |
Acetic acid, methyl ester |
44230 |
Acetic acid, nickel(2+) salt |
1714675 |
Acetic acid, oxo(phenylamino)-, ethyl ester |
64394 |
Acetic acid, pentyl ester |
32375 |
Acetic acid, phenoxy- |
32532 |
Acetic acid, phenyl ester |
37655 |
Acetic acid, phenylmethyl ester |
34124 |
Acetic acid, potassium salt |
25973 |
Acetic acid, propyl ester |
17121757 |
Acetic acid, samarium(3+) salt, hydrate (2:7) |
54684 |
Acetic acid, silver(1+) salt |
34132 |
Acetic acid, sodium salt |
32995 |
Acetic acid, sulfo- |
54700 |
Acetic acid, thallium(1+) salt |
29140 |
Acetic acid, thiocyanato-, (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester, rel- |
6072 |
Acetic acid, trichloro- |
17125469 |
Acetic acid, trichloro-, ammonium salt |
37762 |
Acetic acid, trichloro-, compd. with N'-(4-chlorophenyl)-N,N-dimethylurea (1:1) |
125260 |
Acetic acid, trichloro-, compd. with N,N-dimethyl-N'-phenylurea (1:1) |
66704 |
Acetic acid, trichloro-, sodium salt |
6098 |
Acetic acid, trifluoro- |
44701 |
Acetic acid, trifluoro-, ethyl ester |
54262 |
Acetic acid, zinc salt |
5272 |
Acetonitrile |
26179 |
Acetonitrile, (methyleneamino)- |
24190 |
Acetonitrile, chloro- |
113654 |
Acetonitrile, dibromo- |
52902 |
Acetonitrile, trichloro- |
49130 |
Acetyl bromide |
5546 |
Acetyl chloride |
7559 |
Acetyl chloride, chloro- |
17075904 |
Acheilognathus moriokae |
17093246 |
Acheta domesticus |
17102526 |
Achillea millefolium |
17117524 |
Achlya racemosa |
1853746 |
Achnanthes |
17101189 |
Achnanthes brevipes |
1853779 |
Achnanthes hauckiana |
1853803 |
Achnanthes lanceolata |
1853811 |
Achnanthes lanceolata dubia |
17112459 |
Achnanthes lewisiana |
1853837 |
Achnanthes linearis |
1918705 |
Achnanthes marginulata |
1853845 |
Achnanthes microcephala |
1853852 |
Achnanthes minutissima |
17106113 |
Achnatherum hymenoides |
1714392 |
Acid Red |
17075557 |
Acilius sulcatus |
17083684 |
Acineria uncinata |
17087602 |
Acipenser baeri |
1918770 |
Acipenser fulvescens |
17078619 |
Acipenser gueldenstaedti |
17081431 |
Acipenser gueldenstaedti colch |
17088741 |
Acipenser ruthenus |
17078627 |
Acipenser stellatus |
1960798 |
Acipenser transmontanus |
17085309 |
Acipenseridae |
17095118 |
Acrididae |
40840 |
Acridine |
10736 |
Acridinium, 3,6-diamino-10-methyl-, chloride |
17125584 |
Acridinium, 3,6-diamino-10-methyl-, chloride, mixt. with 3,6-acridinediamine |
17076613 |
Acris crepitans |
17087263 |
Acris gryllus |
17093253 |
Acrobeles sp. |
17083189 |
Acrobeloides buetschlii |
17093261 |
Acrobeloides sp. |
17116195 |
Acroceras macrum |
1900141 |
Acrocheilus alutaceus |
1887835 |
Acroneuria |
1887843 |
Acroneuria abnormis |
1887884 |
Acroneuria lycorias |
1918788 |
Acroperus harpae |
17108994 |
Acroptilon repens |
17098740 |
Acrosiphonia centralis |
17102005 |
Acrosiphonia sonderi |
17096884 |
Acrossocheilus paradoxus |
17075862 |
Actinia equina |
1901610 |
Actiniaria |
17117904 |
Actinidia arguta |
17118019 |
Actinomycetes |
1714624 |
Actinomycin |
17001975 |
Actinomycin D |
17092990 |
Actinonaias pectorosa |
17084245 |
Actinophrys |
1955095 |
Actinopterygii |
17117433 |
Actinosphaerium eichhorni |
1714477 |
Activator NF |
17080433 |
Adelotus brevis |
17078874 |
Adenorhynchus |
2840 |
Adenosine |
2220 |
Adenosine 5'-(tetrahydrogen triphosphate) |
2865 |
Adenosine 5'-(trihydrogen diphosphate) |
17163601 |
Adenosine, 3'-[[(2S)-2-amino-3-(4-methoxyphenyl)-1-oxopropyl]amino]-3'-deoxy-N,N-dimethyl- |
17156951 |
Adenosine, 3'-[[(2S)-2-amino-3-(4-methoxyphenyl)-1-oxopropyl]amino]-3'-deoxy-N,N-dimethyl-, dihydrochloride |
17272774 |
Adenosine, 3'-deoxy- |
3442 |
Adenosine, cyclic 3',5'-(hydrogen phosphate) |
17113291 |
Adenostoma fasciculatum |
17113309 |
Adenostoma sparsifolium |
17086349 |
Adineta vaga |
17079997 |
Adinia xenica |
1877414 |
Aedes |
17118621 |
Aedes aegypti |
17081928 |
Aedes albopictus |
17093063 |
Aedes atropalpus |
17084385 |
Aedes canadensis |
17079781 |
Aedes cantans |
17085028 |
Aedes caspius |
17080094 |
Aedes communis |
17118290 |
Aedes cyprius |
17084278 |
Aedes dorsalis |
17082991 |
Aedes epactius |
17087271 |
Aedes euedes |
17079971 |
Aedes excrucians |
17080359 |
Aedes flavescens |
17091695 |
Aedes hendersoni |
17082868 |
Aedes melanimon |
17118670 |
Aedes nigromaculis |
17080060 |
Aedes punctor |
17080961 |
Aedes scutellaris |
1877422 |
Aedes sollicitans |
17080102 |
Aedes sticticus |
17082108 |
Aedes stimulans |
17081704 |
Aedes taeniorhynchus |
17084377 |
Aedes triseriatus |
17091158 |
Aedes trivittatus |
1877430 |
Aedes vexans |
17102534 |
Aegilops bicornis |
17102542 |
Aegilops biuncialis |
17113317 |
Aegilops columnaris |
17102559 |
Aegilops crassa |
17102567 |
Aegilops cylindrica |
17102575 |
Aegilops juvenalis |
17102583 |
Aegilops kotschyi |
17110891 |
Aegilops neglecta neglecta |
17113325 |
Aegilops speltoides |
17110602 |
Aegilops tauschii |
17102591 |
Aegilops triuncialis |
17113333 |
Aegilops umbellulata |
17113341 |
Aegilops variabilis |
17113358 |
Aegilops ventricosa |
17089418 |
Aegolius acadicus |
1962711 |
Aeolosoma headleyi |
17094624 |
Aeolosoma hemprichi |
17083007 |
Aeolosoma sp. |
17081647 |
Aequipecten opercularis |
1885391 |
Aeschna |
17095480 |
Aeschna sp. |
1885409 |
Aeschna umbrosa |
17102609 |
Aesculus hippocastanum |
17085432 |
Aeshna canadensis |
17118258 |
Aeshna cyanea |
1885383 |
Aeshnidae |
17113366 |
Aethusa cynapium |
17078254 |
Agabus seriatus |
161117 |
Agar |
17117144 |
Agardhiella subulata |
17087289 |
Agaricia fragilis |
17117664 |
Agaricus bisporus |
1918846 |
Agelaius phoeniceus |
17094152 |
Agelenopsis utahana |
17114356 |
Ageratina adenophora |
17109000 |
Ageratum conyzoides |
17102617 |
Ageratum houstonianum |
17096041 |
Agkistrodon piscivorus |
17098294 |
Agmenellum quadruplicatum |
1887918 |
Agnetina |
1887926 |
Agnetina capitata |
17096355 |
Agonum melanarium |
17097122 |
Agonum placida |
17074337 |
Agonus cataphractus |
1961069 |
Agosia chrysogaster |
1882570 |
Agraylea |
17096975 |
Agriocnemis sp. |
1888544 |
Agrion |
17097221 |
Agriotes obscurus |
17097213 |
Agriotes sputator |
17094160 |
Agroeca ornata |
17102625 |
Agropyron desertorum |
17102633 |
Agrostemma githago |
17102666 |
Agrostis capillaris |
17102641 |
Agrostis gigantea |
17101411 |
Agrostis palustris |
17109505 |
Agrostis sp. |
17102658 |
Agrostis stolonifera |
17094830 |
Agrotis ipsilon |
17116856 |
Ahnfeltia sp. |
17095100 |
Aiolopus thalassinus |
17076175 |
Aiptasia pallida |
17097981 |
Aiptasia pulchella |
17110768 |
Ajuga reptans |
17093956 |
Alaimus sp. |
41582 |
Alanine |
310664 |
Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
691063 |
Alanine, N-benzoyl-N-(3,4-dichlorophenyl)-, ethyl ester |
1852102 |
Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-, 1-methylethyl ester |
693697 |
Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-, methyl ester |
17117656 |
Alatospora acuminata |
17116674 |
Alatospora constricta |
17113374 |
Albizzia julibrissin durazzini |
1860907 |
Alboglossiphonia heteroclita |
17078122 |
Alburnus albidus |
17118522 |
Alburnus alburnus |
17089392 |
Alces alces |
396333 |
Alcohols, C11-15-secondary, ethoxylated |
356048 |
Alcohols, C12-13, ethoxylated |
431320 |
Alcohols, C12-14, ethoxylated |
396325 |
Alcohols, C12-15, ethoxylated |
497826 |
Alcohols, C14-15, ethoxylated |
403931 |
Alcohols, C16 and C18-unsatd., ethoxylated |
431312 |
Alcohols, C16-18, ethoxylated |
460949 |
Alcohols, C6-12 |
537779 |
Alcohols, C8-10, ethoxylated |
431288 |
Alcohols, C9-11, ethoxylated |
322594 |
Alcohols, tallow, ethoxylated |
17152349 |
Alcopol 60 |
17086976 |
Aldrichetta forsteri |
17086570 |
Alectoris chukar |
17089434 |
Alectoris rufa |
17102674 |
Alectryon excelsum |
17095274 |
Aleochara bilineata |
17116609 |
Alexandrium catenella |
17116591 |
Alexandrium tamarense |
764357 |
Algae |
162255 |
Alginic acid |
162305 |
Alginic acid, sodium salt |
17101452 |
Alisma |
17115775 |
Alisma gramineum |
17101965 |
Alisma plantagoaquatica |
17096850 |
Alitropus sp. |
320762 |
Alkanes, chloro |
760306 |
Alkanes, iso- |
760249 |
Alkyd resins |
17093576 |
Allajulus nitidus |
17094897 |
Alligator mississippiensis |
17109513 |
Allium |
17102690 |
Allium canadense canadense |
17102070 |
Allium cepa |
17102708 |
Allium fistulosum |
17102716 |
Allium porrum |
52466653 |
Allium sativum |
17113390 |
Allium textile |
17102724 |
Allium vineale |
1887058 |
Allocapnia |
17089459 |
Allolobophora caliginosa |
17089467 |
Allolobophora chlorotica |
17089475 |
Allolobophora longa |
17089483 |
Allolobophora tuberculata |
17117490 |
Allomyces arbuscula |
1887660 |
Alloperla |
17081753 |
Allorchestes compressa |
17102732 |
Alnus glutinosa |
17102740 |
Alnus incana |
1918903 |
Alona |
1918911 |
Alona affinis |
1918929 |
Alona costata |
17084765 |
Alona guttata |
1868934 |
Alonella |
1918952 |
Alonella nana |
17084757 |
Alonopsis elongata |
17095373 |
Alopecosa aculeata |
17102757 |
Alopecurus myosuroides |
17102765 |
Alopecurus pratensis |
1918960 |
Alosa aestivalis |
1899673 |
Alosa chrysochloris |
1899681 |
Alosa pseudoharengus |
1918986 |
Alosa sapidissima |
17108655 |
Aloysia gratissima |
17093279 |
Alpheopsis sp. |
17097346 |
Alpheus sp. |
17098682 |
Alternanthera philoxeroides |
81919 |
Aluminate (AlO21-), sodium |
84699 |
Aluminatesilicate |
149476 |
Aluminum |
150482 |
Aluminum chloride (AlCl3) |
84715 |
Aluminum chloride, basic |
154963 |
Aluminum fluoride (AlF3) |
218818 |
Aluminum phosphide (AlP) |
775999 |
Aluminum sodium oxide |
17117078 |
Alyssum pintodasilvae |
17097080 |
Amara avidus |
17096132 |
Amara bifrons |
17096181 |
Amara fusca |
17096199 |
Amara municipalis |
17109521 |
Amaranthus |
17108705 |
Amaranthus albus |
17110867 |
Amaranthus australis |
17108713 |
Amaranthus blitoides |
17102773 |
Amaranthus caudatus |
17113408 |
Amaranthus dubius |
17102781 |
Amaranthus hybridus |
17108721 |
Amaranthus palmeri |
17102799 |
Amaranthus retroflexus |
17102807 |
Amaranthus spinosus |
17102815 |
Amaranthus tricolor |
17102823 |
Amaranthus viridis |
17094186 |
Amaurobius borealis |
17085325 |
Ambassis |
17090705 |
Ambassis commersoni |
17090531 |
Ambassis gymnocephalus |
17084161 |
Ambassis natalensis |
17088170 |
Ambassis ranga |
1714495 |
Amberlite LA 1 |
17091414 |
Amblema plicata plicata |
1898568 |
Ambloplites rupestris |
17083726 |
Amblypharyngodon melettinus |
17095167 |
Amblyseius hibisci |
17109018 |
Ambrosia artemisiifolia |
17114414 |
Ambrosia confertiflora |
17114422 |
Ambrosia grayi |
17109026 |
Ambrosia psilostachya |
17087495 |
Ambystoma |
17083924 |
Ambystoma gracile |
17090713 |
Ambystoma jeffersonianum |
17093287 |
Ambystoma macrodactylum |
17079021 |
Ambystoma maculatum |
17081845 |
Ambystoma mexicanum |
17079013 |
Ambystoma opacum |
17075912 |
Ambystoma texanum |
17078635 |
Ambystoma tigrinum |
1919075 |
Ameiurus catus |
1900927 |
Ameiurus melas |
1900935 |
Ameiurus natalis |
1900943 |
Ameiurus nebulosus |
17102831 |
Amelanchier alnifolia |
17109190 |
Amelanchier laevis |
1871482 |
Ameletus |
17075466 |
Americamysis bahia |
149955 |
Americium |
1898394 |
Amia calva |
524678 |
Amines, C10-16-alkyldimethyl, N-oxides |
320499 |
Amines, coco alkyl |
322495 |
Amines, coco alkyl, ethoxylated |
602672 |
Amines, coco alkyl, hydrochlorides |
322883 |
Amines, N-coco alkyltrimethylenedi- |
322842 |
Amines, N-tall-oil alkyltrimethylenedi- |
322818 |
Amines, N-tallow alkyltrimethylenedi- |
322552 |
Amines, soya alkyl, ethoxylated |
322578 |
Amines, tallow alkyl, ethoxylated |
478073 |
Amines, tri-C8-10-alkyl |
17117409 |
Ammania sp. |
17113416 |
Ammannia coccinea |
17090549 |
Ammodytes americanus |
17081639 |
Ammodytes hexapterus |
152389 |
Ammonia |
1714472 |
Ammoniojarosite ((NH4)[Fe3(OH)6(SO4)2]) |
197202 |
Ammonium |
179416 |
Ammonium chloride ((NH4)Cl) |
85860 |
Ammonium hydroxide ((NH4)(OH)) |
179606 |
Ammonium sulfide ((NH4)2S) |
17096249 |
Amnemus quadrituberculatus |
1909993 |
Amnicola |
1910033 |
Amnicola limosus |
1852458 |
Amoeba |
17080631 |
Amoeba proteus |
1852631 |
Ampelisca abdita |
1919125 |
Ampharete arctica |
17087297 |
Amphiascus tenuiremis |
17075946 |
Amphibia |
17091554 |
Amphibola crenata |
17098286 |
Amphidinium carterae |
17096439 |
Amphilocus sp. |
17088535 |
Amphimelania holandri |
1887231 |
Amphinemura |
17090119 |
Amphinemura sulcicollis |
1891902 |
Amphipoda |
17088188 |
Amphiprion ocellaris |
1854652 |
Amphiprora |
17116252 |
Amphiprora hyalina |
17100959 |
Amphiprora paludosa |
17082173 |
Amphitnous cuchia |
17086059 |
Amphiura filiformis |
1714352 |
Ampholan B 171 |
1853951 |
Amphora |
17098781 |
Amphora coffeaeformis |
17100652 |
Amphora coffeaeformis boreal |
17100967 |
Amphora exigua |
1853969 |
Amphora ovalis |
1919216 |
Amphora ovalis pediculus |
1853977 |
Amphora perpusilla |
17116922 |
Amphora veneta |
17003583 |
Amphotericin B |
17113424 |
Amsinckia menziesii |
17113432 |
Amsinckia sp. |
1852938 |
Anabaena |
17117862 |
Anabaena aphanizomendoides |
17118035 |
Anabaena azollae |
17117870 |
Anabaena catenula |
17117839 |
Anabaena circinalis |
17117821 |
Anabaena cylindrica |
17117896 |
Anabaena doliolum |
17117805 |
Anabaena flosaquae |
17117847 |
Anabaena inaequalis |
17117938 |
Anabaena lemmermannii |
17117946 |
Anabaena oryzae |
17117953 |
Anabaena oscillarioides |
17117920 |
Anabaena solitaria |
17117979 |
Anabaena sphaerica |
1852961 |
Anabaena spiroides |
17118084 |
Anabaena subcylindrica |
17118001 |
Anabaena torulosa |
17117813 |
Anabaena variabilis |
17117854 |
Anabaenopsis raciborskii |
17080508 |
Anabas scandens |
17118936 |
Anabas testudineus |
17079658 |
Anabolia nervosa |
17102849 |
Anacardium occidentale |
1852722 |
Anacystis |
17099524 |
Anacystis aeruginosa |
17100082 |
Anacystis alpicola |
17098864 |
Anacystis cyanea |
17099680 |
Anacystis dimidiata |
17100702 |
Anacystis flosaquae |
17100033 |
Anacystis incerta |
17098302 |
Anacystis marina |
17098344 |
Anacystis nidulans |
17082066 |
Anadara broughtoni |
17082041 |
Anadara granosa |
17087537 |
Anadara rhombea |
17102856 |
Anagallis arvensis foemina |
1930213 |
Anaitides maculata |
17102864 |
Ananas comosus |
17096785 |
Anaplectus sp. |
17097759 |
Anarhichas lupus |
1919273 |
Anas platyrhynchos |
1919281 |
Anas rubripes |
17097270 |
Anas sp. |
1885417 |
Anax |
17081357 |
Anculosa |
17078791 |
Ancylus fluviatilis |
17113440 |
Andromeda polifolia |
17102872 |
Andropogon gerardii |
17102880 |
Andropogon virginicus |
2774 |
Androst-4-en-3-one, 17-hydroxy-, (17.beta.)- |
2766 |
Androst-4-en-3-one, 17-hydroxy-17-methyl-, (17.beta.)- |
17122185 |
Androst-5-en-17-one, 3-hydroxy-, (3.beta.)- |
17153941 |
Androsta-1,4-diene-3,17-dione, 1-methyl- |
17122177 |
Androstan-17-one, 3-hydroxy-, (3.alpha.,5.alpha.)- |
17115957 |
Anemone cylindrica |
17075722 |
Anemonia sulcata |
17083486 |
Anemonia viridis |
1899772 |
Anguilla |
17077330 |
Anguilla anguilla |
17118118 |
Anguilla australis |
17118175 |
Anguilla dieffenbachii |
17076746 |
Anguilla japonica |
1899780 |
Anguilla rostrata |
17096520 |
Anguillicola crassus |
1899756 |
Anguilliformes |
17117631 |
Anguillospora |
17116880 |
Anguillospora crassa |
17117615 |
Anguillospora longissima |
1859024 |
Animalia |
17097130 |
Anisodactylus sanctaecrucis |
17080318 |
Anisogammarus confervicolus |
17091208 |
Anisops |
17083700 |
Anisops bouvieri |
1919406 |
Anisoptera |
17088543 |
Anisus vortex |
1855931 |
Ankistrodesmus |
1855949 |
Ankistrodesmus braunii |
1855964 |
Ankistrodesmus falcatus |
17099235 |
Ankistrodesmus falcatus acicularis |
17099144 |
Ankistrodesmus spiralis |
1859032 |
Annelida |
17102898 |
Anoda cristata |
1904903 |
Anodonta |
17085069 |
Anodonta anatina |
1915628 |
Anodonta cataracta |
17077306 |
Anodonta complanata |
17077041 |
Anodonta cygnea |
17090978 |
Anodonta cygnea zellensis |
1904937 |
Anodonta grandis grandis |
1904945 |
Anodonta imbecillis |
17118647 |
Anodonta piscinalis |
17086588 |
Anolis carolinensis |
17076035 |
Anomia ephippium |
17112632 |
Anomoeneis vitrea |
1948652 |
Anonyx |
17091562 |
Anonyx makarovi |
1964253 |
Anonyx nugax |
1877364 |
Anopheles |
17077868 |
Anopheles albimanus |
17091141 |
Anopheles coustani |
17084120 |
Anopheles culicifacies |
17088436 |
Anopheles farauti |
17078429 |
Anopheles freeborni |
17085663 |
Anopheles gambiae |
17118324 |
Anopheles maculipennis |
17079245 |
Anopheles maculipennis messeae |
17085291 |
Anopheles pharoensis |
1877398 |
Anopheles quadrimaculatus |
17084138 |
Anopheles stephensi |
17080847 |
Anoplostoma |
17084690 |
Anostraca |
17097049 |
Anthicidae |
17080375 |
Anthocidaris crassispina |
763219 |
Anthocoridae |
17095886 |
Anthopleura sp. |
17113218 |
Anthoxanthum odoratum |
113936 |
Anthra[2,1,9-mna]naphth[2,3-h]acridine-5,10,15(16H)-trione |
34868 |
Anthra[2,1-d:6,5-d']bisthiazole-6,12-dione, 2,8-diphenyl- |
34587 |
Anthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione, 16,17-dimethoxy- |
31013 |
Anthracene |
60178 |
Anthracene, 2-methyl- |
17156431 |
Anthracene, 9,10-dihydro- |
70367 |
Anthracene, 9-methyl- |
17151929 |
Anthranilonitrile, 3,4,5,6-tetrafluoro- |
694711 |
Antiblaze 19 |
17121609 |
Antimonate (Sb(OH)61-), potassium, (OC-6-11)- |
265389 |
Antimonate (Sb(OH)61-), sodium, (OC-6-11)- |
17121682 |
Antimonate (SbO31-), potassium |
172916 |
Antimonate(2-), bis[.mu.-[(2R,3R)-2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium |
248807 |
Antimonate(2-), bis[.mu.-[2,3-di(hydroxy-.kappa.O)butanedioato(4-)-.kappa.O1:.kappa.O4]]di-, dipotassium, trihydrate, stereoisomer |
149963 |
Antimony |
152280 |
Antimony chloride (SbCl5) |
82545 |
Antimony oxide (Sb2O3) |
85563 |
Antimony potassium oxide |
1714390 |
Antimycin |
86413 |
Antimycin A |
17110511 |
Antirrhinum |
17102906 |
Antirrhinum majus |
17112723 |
Antithamnion plumula |
1881192 |
Antocha |
17076563 |
Anura |
17094996 |
Aonides oxycephala |
1919455 |
Apeltes quadracus |
17113457 |
Aphanes arvensis |
17113382 |
Aphanes microcarpa |
17075953 |
Aphanius dispar |
17080011 |
Aphanius fasciatus |
1852995 |
Aphanizomenon flosaquae |
17112327 |
Aphanizomenon gracile |
1852730 |
Aphanocapsa |
17111436 |
Aphanocapsa pulchra |
17117227 |
Aphanochaete repens |
17093295 |
Aphelenchoides sp. |
17083361 |
Aphelenchus avenae |
17093733 |
Aphelenchus sp. |
17083379 |
Aphelocheirus aestivalis |
17091570 |
Aphelocheirus vittatus |
17097916 |
Aphelocoma coerulescens |
1885367 |
Aphididae |
17095159 |
Aphidius rhopalosiphi |
17094806 |
Aphis craccivora |
17096033 |
Aphyocharax rubripinnis |
17091240 |
Aphyosemion gardneri |
17092693 |
Aphytis melinus |
17095605 |
Apidae |
17091406 |
Apis ligustica |
17089178 |
Apis mellifera |
17109539 |
Apium graveolens |
17108788 |
Apium graveolens dulce |
17118910 |
Aplexa hypnorum |
17082660 |
Aplocheilichthys johnstonii |
17088980 |
Aplocheilus blocki |
17076282 |
Aplocheilus lineatus |
17079575 |
Aplocheilus melanostigma |
17090556 |
Aplocheilus panchax |
1899178 |
Aplodinotus grunniens |
17086463 |
Aplysia punctata |
17096892 |
Apocryptes bato |
17092859 |
Apocyclops spartinus |
17102914 |
Apocynum cannabinum |
17091596 |
Aporcelaimellus obtusicaudatus |
17093998 |
Aporcelaimellus sp. |
17093618 |
Aporrectodea caliginosa |
17093600 |
Aporrectodea longa |
17093170 |
Aporrectodea rosea |
17093592 |
Aporrectodea trapezoides |
17093303 |
Aporrectodea tuberculata |
17094905 |
Aporrectodea turgida |
17076027 |
Aporrhais pespelecanis |
17074279 |
Aquatic community |
17089491 |
Aquila chrysaetos |
17102922 |
Arabidopsis thaliana |
17102930 |
Arachis hypogaea |
1868140 |
Arachnida |
1868850 |
Araneae |
17091216 |
Araneidae |
17075987 |
Arbacia lixula |
1902212 |
Arbacia punctulata |
17096421 |
Arbacia sp. |
17110909 |
Arbutus menziesii |
17091612 |
Arca granosa |
17097429 |
Archaeomysis kokuboi |
17096215 |
Archegozetes sp. |
17078841 |
Archiloa wilsoni |
17078882 |
Archimonotresis |
1899228 |
Archosargus probatocephalus |
17091620 |
Arcitalitrus dorrieni |
1919539 |
Arctica islandica |
17102948 |
Arctium lappa |
1882091 |
Arctopsyche grandis |
17082892 |
Arctopsyche ladogensis |
17113473 |
Arctostaphylos sp. |
17116070 |
Arctotheca calendula |
17113481 |
Ardisia sp. |
1861731 |
Arenicola cristata |
1966878 |
Arenicola marina |
1888676 |
Argia |
1888684 |
Argia apicalis |
1904200 |
Argopecten irradians |
17091638 |
Argopecten purpuratus |
1869155 |
Argulus |
17079393 |
Argulus coregoni |
17076670 |
Argyroneta aquatica |
17097452 |
Ariopsis bonillai |
1919604 |
Arius felis |
17091539 |
Arius nenga |
17089202 |
Armadillidium vulgare |
1939172 |
Armandia brevis |
1864289 |
Armandia maculata |
17116054 |
Armeria maritima |
17081811 |
Armigeres subalbatus |
17102955 |
Armoracia rusticana |
183020 |
Aroclor |
182782 |
Aroclor 1016 |
173153 |
Aroclor 1221 |
173583 |
Aroclor 1232 |
274183 |
Aroclor 1262 |
173120 |
Aroclor 1268 |
710665 |
Aroclor 4465 |
182600 |
Aroclor 5442 |
173427 |
Aroclor 5460 |
17102963 |
Aronia melanocarpa |
1714500 |
Arquard |
17118878 |
Arrenurus globator |
17093071 |
Arrenurus manubriator |
17116179 |
Arrhenatherum elatius |
17151366 |
Arsenate (AsO43-) |
17121708 |
Arsenenic acid, sodium salt |
17121724 |
Arsenenite |
155101 |
Arsenenous acid, sodium salt |
149989 |
Arsenic |
153866 |
Arsenic acid (H3AsO4) |
153890 |
Arsenic acid (H3AsO4), calcium salt (2:3) |
153882 |
Arsenic acid (H3AsO4), disodium salt |
17004607 |
Arsenic acid (H3AsO4), disodium salt, heptahydrate |
152173 |
Arsenic acid (H3AsO4), lead salt |
155069 |
Arsenic acid (H3AsO4), lead(2+) salt (1:1) |
155077 |
Arsenic acid (H3AsO4), monopotassium salt |
17121534 |
Arsenic acid (H3AsO4), monosodium salt |
151985 |
Arsenic acid (H3AsO4), sodium salt |
186965 |
Arsenic acid (H3AsO4), trisodium salt |
17121641 |
Arsenic oxide |
84749 |
Arsenic oxide (As2O3) |
82057 |
Arsenic oxide (As2O5) |
82073 |
Arsenic sulfide (As2S3) |
710947 |
Arsenite |
17121658 |
Arsenous acid, trisodium salt |
155036 |
Arsenous trichloride |
58537 |
Arsine, triphenyl- |
5702 |
Arsinic acid, dimethyl- |
33621 |
Arsinic acid, dimethyl-, sodium salt |
17000779 |
Arsinous chloride, diphenyl- |
17158601 |
Arsinous cyanide, diphenyl- |
18077 |
Arsonic acid, (4-aminophenyl)- |
31609 |
Arsonic acid, (4-hydroxy-3-nitrophenyl)- |
17154097 |
Arsonic acid, (4-nitrophenyl)- |
17002429 |
Arsonic acid, [4-[(aminocarbonyl)amino]phenyl]- |
17121666 |
Arsonic acid, disodium salt |
17295387 |
Arsonic acid, ethyl- |
52450079 |
Arsonic acid, methyl- |
136028 |
Arsonic acid, methyl-, calcium salt (2:1) |
39354 |
Arsonic acid, methyl-, disodium salt |
97972 |
Arsonic acid, methyl-, monosodium salt |
17731 |
Arsonic acid, phenyl- |
17295379 |
Arsonium, tetraphenyl-, chloride |
52068 |
Arsonous dichloride, (2-chloroethenyl)- |
17086067 |
Artemia franchiscana |
17096256 |
Artemia parthenogenetica |
17076647 |
Artemia salina |
17076860 |
Artemia sp. |
17109547 |
Artemisia |
17102971 |
Artemisia absinthium |
17113507 |
Artemisia campestris |
17113515 |
Artemisia filifolia |
17102989 |
Artemisia frigida |
17109034 |
Artemisia tridentata |
17094145 |
Arthropleona |
1868132 |
Arthropoda |
1853043 |
Arthrospira |
17117722 |
Articulospora sp. |
17108382 |
Artocarpus heterophyllus |
85282 |
Asbestos |
1954239 |
Ascidia |
1897933 |
Ascidiacea |
17086984 |
Ascidiella aspersa |
17082397 |
Ascidiella scabra |
17113127 |
Asclepias sp. |
17102997 |
Asclepias syriaca |
17103003 |
Asclepias tuberosa |
17099045 |
Ascophyllum nodosum |
1895176 |
Asellidae |
1895184 |
Asellus |
17077496 |
Asellus aquaticus |
17118092 |
Asellus brevicaudus |
1895192 |
Asellus communis |
17078817 |
Asellus hilgendorfi |
17118225 |
Asellus intermedius |
17091265 |
Asellus meridianus |
17118217 |
Asellus racovitzai |
17109554 |
Asparagus officinalis |
61200 |
Aspartic acid |
160119 |
Asphalt |
17121955 |
Asphalt, sulfonated |
17088428 |
Aspidisca cicada |
17090721 |
Aspidisca lynceus |
1915123 |
Asplanchna |
17082132 |
Asplanchna brightwelli |
17078544 |
Asplanchna girodi |
17097361 |
Asplanchna intermedia |
1919653 |
Asplanchna priodonta |
17094418 |
Asplanchna sieboldi |
1891571 |
Astacidae |
17097619 |
Astacopsis gouldi |
17081696 |
Astacus astacus |
17079039 |
Astacus fluviatilis |
17081399 |
Astacus leptodactylus |
17100173 |
Astasia longa |
17103060 |
Aster cordifolius |
17103078 |
Aster ericoides |
17103086 |
Aster novae-angliae |
17077090 |
Asterias forbesii |
17074436 |
Asterias rubens |
1971290 |
Asterias vulgaris |
17075755 |
Asterina gibbosa |
1854033 |
Asterionella formosa |
1854041 |
Asterionella japonica |
17093634 |
Astigmata |
17103094 |
Astragalus cicer |
17103102 |
Astragalus drummondii |
17109562 |
Astragalus miser |
17084096 |
Astronotus ocellatus |
17090564 |
Astyanax bimaculatus |
17075680 |
Astyanax fasciatus |
17097072 |
Ataenius sp. |
17080870 |
Atalophlebia australis |
17094814 |
Atherigona soccata |
17082785 |
Atherina hepsetus |
17097627 |
Atherinasoma microstoma |
1956028 |
Atherinops affinis |
1875913 |
Atherix |
1875947 |
Atherix variegata |
17113531 |
Atropa bella-donna |
1887942 |
Attaneuria ruralis |
1853324 |
Attheya |
17091646 |
Aulacomya ater |
17116724 |
Aulacoseira ambigua |
17100801 |
Aulosira |
17099623 |
Aulosira fertilissima |
17102096 |
Aulosira laxa |
17098070 |
Aulosira prolifica |
1714655 |
Aurate(1-), tetrachloro-, (SP-4-1)- |
206094 |
Aurate(1-), tetrachloro-, hydrogen, (SP-4-1)- |
17095894 |
Aurelia sp. |
17117383 |
Aureococcus anophagefferens |
17091653 |
Australonereis ehlersi |
17080888 |
Austrochiltonia subtenuis |
17087966 |
Austrocochlea constricta |
17078999 |
Austrognathia christianne |
17076530 |
Austropotamobius pallipes |
17077793 |
Austropotamobius pallipes pall |
1640119 |
Avena |
17103110 |
Avena fatua |
17113549 |
Avena ludoviciana |
17103128 |
Avena sativa |
17103136 |
Avena sterilis |
17103144 |
Avena strigosa |
346593 |
Avermectin A1a, 5-O-demethyl- |
1714442 |
Avermectin B1, 4''-deoxy-4''-(methylamino)-, (4''R)- |
964601 |
Avermectin B1, 4''-deoxy-4''-(methylamino)-, (4''R)-, benzoate (salt) |
17103151 |
Averrhoa carambola |
1898303 |
Aves |
1714443 |
Avolan UL 75 |
17081605 |
Axonolaimus paraponticus |
17103177 |
Axonopus compressus |
17113556 |
Axonopus fissifolius |
17103169 |
Azadirachta indica |
962423 |
Azide |
40279 |
Aziridine |
684779 |
Aziridine, 1,1',1''-phosphinothioylidynetris- |
775726 |
Aziridine, 1,1',1''-phosphinylidynetris- |
2519 |
Aziridine, 1,1',1''-phosphinylidynetris[2-methyl- |
1032 |
Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)- |
17099318 |
Azolla |
17111055 |
Azolla caroliniana |
17112517 |
Azolla filiculoides |
17102021 |
Azolla pinnata |
17113564 |
Azukia angularis |
40915 |
Azulene |
17085804 |
Babylonia japonica |
17096538 |
Babylonia lutosa |
1853258 |
Bacillariophyceae |
1853241 |
Bacillariophyta |
386763 |
Bacillus thuringiensis |
86488 |
Bacitracin |
86496 |
Bacitracin zinc |
17099367 |
Bacopa caroliniana |
17102104 |
Bacopa monnieri |
52451846 |
Bacteria |
1870328 |
Baetidae |
1870344 |
Baetis |
1870484 |
Baetis intermedius |
17088949 |
Baetis parvus |
17080250 |
Baetis rhodani |
17083841 |
Baetis sahoensis |
17086661 |
Baetis thermicus |
1870567 |
Baetis tricaudatus |
17083833 |
Baetis yoshinensis |
17078221 |
Baetisca bajkovi |
1872225 |
Baetisca obesa |
1919786 |
Bairdiella chrysoura |
1869270 |
Balanus |
1869288 |
Balanus amphitrite |
1869296 |
Balanus amphitrite amphitrite |
1869304 |
Balanus amphitrite niveus |
1919810 |
Balanus balanoides |
1919828 |
Balanus crenatus |
1869320 |
Balanus eburneus |
1869338 |
Balanus improvisus |
17087743 |
Balanus tintinnabulum tintinna |
17077629 |
Balanus variegatus variegatus |
17152356 |
Balchip 215 |
1714376 |
Bambermycin |
17113572 |
Bambusa textilis |
17103185 |
Bambusa tulda |
17103193 |
Bambusa vulgaris |
17111352 |
Banksia ericifolia |
17109406 |
Barbarea verna |
17082546 |
Barbus |
17080789 |
Barbus anoplus |
17084401 |
Barbus arulius |
17085671 |
Barbus barbus |
17118829 |
Barbus barbus plebejus |
17076308 |
Barbus conchonius |
17078452 |
Barbus dorsalis |
17080235 |
Barbus filamentosus |
17085010 |
Barbus gonionotus |
17082124 |
Barbus guganio |
17076191 |
Barbus gurneyi |
17077710 |
Barbus holubi |
17075615 |
Barbus javanicus |
17088196 |
Barbus macrops |
17080425 |
Barbus natalensis |
17085200 |
Barbus sarana |
17089673 |
Barbus sharpeyi |
17081407 |
Barbus sophore |
17088550 |
Barbus stigma |
17074493 |
Barbus ticto |
17091679 |
Barentsia matsushimana |
17084948 |
Barilius bendelisis |
17083775 |
Barilius vagra |
962308 |
Barite (Ba(SO4)) |
149997 |
Barium |
170589 |
Barium chloride (BaCl2) |
710616 |
Barium chloride (BaCl2), dihydrate |
219220 |
Barium sulfide (BaS) |
17084872 |
Barytelphusa cunicularis |
17078601 |
Barytelphusa guerini |
1885458 |
Basiaeschna janata |
17088204 |
Basilichthys australis |
17093782 |
Basiria sp. |
17097999 |
Bathygobius fuscus |
17095134 |
Bathyplectes curculionis |
17087974 |
Batillus cornutus |
17100728 |
Batrachospermum |
17097254 |
Bdellodes lapidaria |
17103201 |
Begonia semperflorens |
17109570 |
Begonia sp. |
17087982 |
Bellamya bengalensis |
17087990 |
Bellamya dissimilis |
17099631 |
Bellerochea |
17112467 |
Bellerochea malleus |
17098252 |
Bellerochea polymorpha |
17084567 |
Belone belone |
17081175 |
Belonia |
1884170 |
Belostoma |
17091711 |
Belostoma elegans |
17082207 |
Belostoma indicum |
1884204 |
Belostoma testaceum |
1884147 |
Belostomatidae |
17116682 |
Beltrania rhombica |
17092909 |
Bembidion quadrimaculatum |
17090283 |
Bembidion rapidum |
17097114 |
Bembidion rupicola |
81968 |
Bentonite |
17273087 |
Benz[a]acridine |
2212 |
Benz[a]anthracene |
2733 |
Benz[a]anthracene, 7,12-dimethyl- |
103440 |
Benz[a]anthracene-7,12-dione |
40758 |
Benz[c]acridine |
40683 |
Benz[e]acephenanthrylene |
2188 |
Benz[j]aceanthrylene, 1,2-dihydro-3-methyl- |
19505 |
Benzaldehyde |
250043 |
Benzaldehyde, (dimethylamino)- |
56309 |
Benzaldehyde, (phenylmethylene)hydrazone |
17153602 |
Benzaldehyde, 2,3,4-trichloro- |
308379 |
Benzaldehyde, 2,3,5-trichloro- |
140079 |
Benzaldehyde, 2,3-dichloro- |
17153024 |
Benzaldehyde, 2,3-dichloro-4-hydroxy-5-methoxy- |
125062 |
Benzaldehyde, 2,4,5-trimethoxy- |
47308 |
Benzaldehyde, 2,4,6-trimethyl- |
58925 |
Benzaldehyde, 2,4,6-trinitro- |
72892 |
Benzaldehyde, 2,4-dichloro- |
15842 |
Benzaldehyde, 2,4-dihydroxy- |
9589 |
Benzaldehyde, 2,6-dichloro- |
230664 |
Benzaldehyde, 2,6-dichloro-, oxime |
588228 |
Benzaldehyde, 2,6-dichloro-4-hydroxy-3,5-dimethoxy- |
12757 |
Benzaldehyde, 2-chloro- |
588236 |
Benzaldehyde, 2-chloro-4-hydroxy-3,5-dimethoxy- |
17153032 |
Benzaldehyde, 2-chloro-4-hydroxy-5-methoxy- |
140657 |
Benzaldehyde, 2-chloro-5-nitro- |
44735 |
Benzaldehyde, 2-chloro-6-fluoro- |
12799 |
Benzaldehyde, 2-hydroxy- |
15594 |
Benzaldehyde, 2-hydroxy-, oxime |
39768 |
Benzaldehyde, 2-hydroxy-3-methoxy- |
130427 |
Benzaldehyde, 2-hydroxy-3-nitro- |
36251 |
Benzaldehyde, 2-methoxy- |
53389 |
Benzaldehyde, 2-nitro- |
45955 |
Benzaldehyde, 3-(trifluoromethyl)- |
10926 |
Benzaldehyde, 3,4,5-trimethoxy- |
139428 |
Benzaldehyde, 3,4-dichloro- |
1714619 |
Benzaldehyde, 3,4-dihydroxy- |
31021 |
Benzaldehyde, 3,4-dimethoxy- |
17272998 |
Benzaldehyde, 3,5-dibromo-2-hydroxy- |
690107 |
Benzaldehyde, 3,5-dibromo-4-hydroxy-, O-(2,4-dinitrophenyl)oxime |
169326 |
Benzaldehyde, 3,5-dichloro- |
91181 |
Benzaldehyde, 3-amino- |
109504 |
Benzaldehyde, 3-bromo-4-hydroxy-5-methoxy- |
17153628 |
Benzaldehyde, 3-chloro-4-hydroxy-5-methoxy- |
31658 |
Benzaldehyde, 3-ethoxy-4-hydroxy- |
19752 |
Benzaldehyde, 3-hydroxy- |
18804 |
Benzaldehyde, 3-nitro- |
279620 |
Benzaldehyde, 3-phenoxy- |
32086 |
Benzaldehyde, 4-(1-methylethyl)- |
31062 |
Benzaldehyde, 4-(diethylamino)- |
209460 |
Benzaldehyde, 4-(diethylamino)-2-hydroxy- |
79244 |
Benzaldehyde, 4-bromo- |
22426 |
Benzaldehyde, 4-chloro- |
166835 |
Benzaldehyde, 4-ethoxy- |
31104 |
Benzaldehyde, 4-ethoxy-3-methoxy- |
127381 |
Benzaldehyde, 4-ethyl- |
46219 |
Benzaldehyde, 4-fluoro- |
32755 |
Benzaldehyde, 4-hydroxy- |
36228 |
Benzaldehyde, 4-hydroxy-3,5-dimethoxy- |
31666 |
Benzaldehyde, 4-hydroxy-3-methoxy- |
32789 |
Benzaldehyde, 4-methoxy- |
22418 |
Benzaldehyde, 4-methyl- |
53652 |
Benzaldehyde, 4-nitro- |
17272725 |
Benzaldehyde, 4-phenoxy- |
92148 |
Benzaldehyde, 5-bromo-2-hydroxy- |
65581 |
Benzaldehyde, 5-chloro-2-hydroxy- |
1883 |
Benzamide |
17151945 |
Benzamide, 2,3,4,5-tetrafluoro-6-nitro- |
961573 |
Benzamide, 2,6-dichloro- |
11957 |
Benzamide, 2-amino- |
59493 |
Benzamide, 2-chloro- |
17124033 |
Benzamide, 2-chloro-4-nitro- |
17129958 |
Benzamide, 2-chloro-N-[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]- |
17294869 |
Benzamide, 2-fluoro- |
3970 |
Benzamide, 2-hydroxy- |
1714333 |
Benzamide, 2-hydroxy-N-(4-iodophenyl)-3-nitro- |
11098 |
Benzamide, 2-hydroxy-N-phenyl- |
50328 |
Benzamide, 2-methyl- |
961037 |
Benzamide, 2-methyl-3,5-dinitro- |
694026 |
Benzamide, 2-methyl-N-[3-(1-methylethoxy)phenyl]- |
1714731 |
Benzamide, 3,4-dimethoxy- |
11064 |
Benzamide, 3,5-dibromo-N-(4-bromophenyl)-2-hydroxy- |
225102 |
Benzamide, 3,5-dichloro-N-(1,1-dimethyl-2-propynyl)- |
1714471 |
Benzamide, 3,5-dinitro- |
17152257 |
Benzamide, 3-chloro-N-(2-chloro-4-nitrophenyl)-5-(1,1-dimethylethyl)-6-hydroxy-2-methyl- |
66449 |
Benzamide, 3-nitro- |
61788 |
Benzamide, 4-nitro- |
17151424 |
Benzamide, 5-(aminosulfonyl)-N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-methoxy- |
556662 |
Benzamide, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitro- |
960781 |
Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy- |
86587 |
Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compound with 2-aminoethanol (1:1) |
68908 |
Benzamide, N-(2-nitrophenyl)- |
17153735 |
Benzamide, N-(4-benzoylphenyl)- |
1714332 |
Benzamide, N-(4-bromophenyl)-2-hydroxy-3-nitro- |
17272980 |
Benzamide, N,2-dihydroxy- |
35535 |
Benzamide, N,N'-(10,15,16,17-tetrahydro-5,10,15,17-tetraoxo-5H-dinaphtho[2,3-a:2',3'-i]carbazole-4,9-diyl)bis- |
36137 |
Benzamide, N,N-diethyl-3-methyl- |
59949 |
Benzamide, N,N-dimethyl- |
269233 |
Benzamide, N-[[(4-chlorophenyl)amino]carbonyl]-2,6-difluoro- |
599928 |
Benzamide, N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluoro- |
594713 |
Benzamide, N-[3-(1-ethyl-1-methylpropyl)-5-isoxazolyl]-2,6-dimethoxy- |
355859 |
Benzamide, N-[3-(1-methylethoxy)phenyl]-2-(trifluoromethyl)- |
47803 |
Benzamide, N-hydroxy- |
60327 |
Benzamide, N-methyl- |
15206 |
Benzamide, N-phenyl- |
3632 |
Benzenamine |
70110 |
Benzenamine, 2,3,4,5,6-pentafluoro- |
11262 |
Benzenamine, 2,3-dimethyl- |
65664 |
Benzenamine, 2,4,5-trichloro- |
39677 |
Benzenamine, 2,4,6-tribromo- |
65466 |
Benzenamine, 2,4,6-trichloro- |
11528 |
Benzenamine, 2,4,6-trimethyl- |
35493 |
Benzenamine, 2,4,6-trinitro-N-(2,4,6-trinitrophenyl)- |
53520 |
Benzenamine, 2,4-dichloro- |
16295 |
Benzenamine, 2,4-dimethyl- |
17137 |
Benzenamine, 2,4-dinitro- |
75374 |
Benzenamine, 2,4-dinitro-N-phenyl- |
16428 |
Benzenamine, 2,5-dichloro- |
20859 |
Benzenamine, 2,5-dimethoxy- |
226324 |
Benzenamine, 2,6-bis(1-methylethyl)- |
59162 |
Benzenamine, 2,6-dichloro- |
18630 |
Benzenamine, 2,6-dichloro-4-nitro- |
55400 |
Benzenamine, 2,6-diethyl- |
11296 |
Benzenamine, 2,6-dimethyl- |
89060 |
Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
60657 |
Benzenamine, 2-bromo- |
16170 |
Benzenamine, 2-chloro- |
60822 |
Benzenamine, 2-chloro-4-methyl- |
31963 |
Benzenamine, 2-chloro-4-nitro- |
55319 |
Benzenamine, 2-ethyl- |
226332 |
Benzenamine, 2-ethyl-6-methyl- |
12815 |
Benzenamine, 2-methoxy- |
36053 |
Benzenamine, 2-methoxy-, hydrochloride |
16196 |
Benzenamine, 2-methyl- |
963017 |
Benzenamine, 2-methyl-3,5-dinitro- |
17003161 |
Benzenamine, 2-methyl-3-nitro- |
17400 |
Benzenamine, 2-methyl-4-[(2-methylphenyl)azo]- |
18739 |
Benzenamine, 2-methyl-4-nitro- |
18754 |
Benzenamine, 2-methyl-5-nitro- |
17003070 |
Benzenamine, 2-methyl-6-nitro- |
11999 |
Benzenamine, 2-nitro- |
30858 |
Benzenamine, 2-nitro-N-phenyl- |
17122060 |
Benzenamine, 3(and 4)-methyl- |
1714703 |
Benzenamine, 3-(phenylmethoxy)- |
17830 |
Benzenamine, 3-(trifluoromethyl)- |
58297 |
Benzenamine, 3,3'-sulfonylbis- |
16378 |
Benzenamine, 3,4-dichloro- |
16279 |
Benzenamine, 3,4-dimethyl- |
17128265 |
Benzenamine, 3,4-dimethyl-N-(1-methylpropyl)-2,6-dinitro- |
63768 |
Benzenamine, 3,5-dichloro- |
25288 |
Benzenamine, 3,5-dimethyl- |
961193 |
Benzenamine, 3,5-dinitro- |
56812 |
Benzenamine, 3-bromo- |
25098 |
Benzenamine, 3-chloro- |
43984 |
Benzenamine, 3-chloro-4-fluoro- |
16352 |
Benzenamine, 3-chloro-4-methyl- |
153247 |
Benzenamine, 3-chloro-4-methyl-, hydrochloride |
17151515 |
Benzenamine, 3-chloro-N-sulfinyl- |
51375 |
Benzenamine, 3-methoxy- |
25114 |
Benzenamine, 3-methyl- |
1714293 |
Benzenamine, 3-methyl-2,4-dinitro- |
18507 |
Benzenamine, 3-nitro- |
264762 |
Benzenamine, 4-(1,1-dimethylethyl)-N-(1-methylpropyl)-2,6-dinitro- |
20305 |
Benzenamine, 4-(1-methylethoxy)-N-phenyl- |
265181 |
Benzenamine, 4-(1-methylethyl)-2,6-dinitro-N,N-dipropyl- |
280396 |
Benzenamine, 4-(hexyloxy)- |
775882 |
Benzenamine, 4-(methylsulfonyl)-2,6-dinitro-N,N-dipropyl- |
3244 |
Benzenamine, 4-(phenylazo)- |
138883 |
Benzenamine, 4,4'-azobis[N,N-dimethyl- |
140301 |
Benzenamine, 4,4'-carbonimidoylbis[N,N-diethyl-, monohydrochloride |
47662 |
Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl- |
102707 |
Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl-, monohydrochloride |
20347 |
Benzenamine, 4,4'-methylenebis- |
20362 |
Benzenamine, 4,4'-oxybis- |
8136 |
Benzenamine, 4,4'-sulfonylbis- |
37481 |
Benzenamine, 4,4'-thiobis- |
146407 |
Benzenamine, 4,5-dimethyl-2-nitro- |
120295 |
Benzenamine, 4-[(2-chlorophenyl)[4-(ethylimino)-3-methyl-2,5-cyclohexadien-1-ylidene]methyl]-N-ethyl-2-methyl-, monohydrochloride |
113613 |
Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl- |
65334 |
Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, monohydrochloride |
17153636 |
Benzenamine, 4-[(4-nitrophenyl)sulfonyl]- |
23564 |
Benzenamine, 4-bromo- |
55814 |
Benzenamine, 4-bromo-2-methyl- |
56119 |
Benzenamine, 4-bromo-N,N-dimethyl- |
21923 |
Benzenamine, 4-butyl- |
23630 |
Benzenamine, 4-chloro- |
12518 |
Benzenamine, 4-chloro-2-nitro- |
65508 |
Benzenamine, 4-chloro-3-nitro- |
184432 |
Benzenamine, 4-chloro-N-sulfinyl- |
22061 |
Benzenamine, 4-dodecyl- |
61127 |
Benzenamine, 4-ethoxy-2-nitro- |
56341 |
Benzenamine, 4-ethyl- |
44115 |
Benzenamine, 4-fluoro- |
17273400 |
Benzenamine, 4-fluoro-2-(trifluoromethyl)- |
17294927 |
Benzenamine, 4-fluoro-N-methyl- |
51847 |
Benzenamine, 4-iodo- |
22483 |
Benzenamine, 4-methoxy- |
17087 |
Benzenamine, 4-methoxy-2-nitro- |
23655 |
Benzenamine, 4-methyl- |
12500 |
Benzenamine, 4-methyl-2-nitro- |
962605 |
Benzenamine, 4-methyl-3,5-dinitro- |
30601 |
Benzenamine, 4-methyl-3-nitro- |
19109 |
Benzenamine, 4-nitro- |
71928 |
Benzenamine, 4-nitro-N-phenyl- |
17151747 |
Benzenamine, 4-octyl- |
20255 |
Benzenamine, 4-octyl-N-(4-octylphenyl)- |
122176 |
Benzenamine, 4-octyl-N-phenyl- |
17350 |
Benzenamine, 5-chloro-2,4-dimethoxy- |
17003088 |
Benzenamine, 5-methyl-2-nitro- |
244004 |
Benzenamine, ar,ar-dichloro- |
242800 |
Benzenamine, ar-methyl- |
240614 |
Benzenamine, ar-octyl-N-(octylphenyl)- |
17124066 |
Benzenamine, compd. with 1,3,5-trinitrobenzene (1:1) |
38612 |
Benzenamine, hydrochloride |
281436 |
Benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro- |
264085 |
Benzenamine, N-(2-chloroethyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)- |
962829 |
Benzenamine, N-(cyclopropylmethyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)- |
19067 |
Benzenamine, N,N,4-trimethyl- |
962811 |
Benzenamine, N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitro- |
13615 |
Benzenamine, N,N-diethyl- |
31880 |
Benzenamine, N,N-dimethyl- |
3269 |
Benzenamine, N,N-dimethyl-4-(phenylazo)- |
89490 |
Benzenamine, N,N-dimethyl-4-[2-(2-quinolinyl)ethenyl]- |
37283 |
Benzenamine, N,N-dimethyl-4-nitroso- |
58552 |
Benzenamine, N,N-diphenyl- |
694760 |
Benzenamine, N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)- |
93526 |
Benzenamine, N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)- |
21584 |
Benzenamine, N-ethyl- |
20693 |
Benzenamine, N-ethyl-3-methyl- |
303834 |
Benzenamine, N-ethyl-N-(2-methyl-2-propenyl)-2,6-dinitro-4-(trifluoromethyl)- |
314435 |
Benzenamine, N-hydroxy-2-methyl-3,5-dinitro- |
36301 |
Benzenamine, N-hydroxy-N-nitroso-, ammonium salt |
19588 |
Benzenamine, N-methyl- |
331165 |
Benzenamine, N-methyl-2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)- |
60350 |
Benzenamine, N-methyl-N-nitroso- |
10702 |
Benzenamine, N-nitroso-N-phenyl- |
32250 |
Benzenamine, N-phenyl- |
20321 |
Benzenamine, N-phenyl-4-(phenylazo)- |
79236 |
Benzenamine, N-sulfinyl- |
52316 |
Benzenamine, sulfate (2:1) |
17163700 |
Benzenaminium, 3-[[(dimethylamino)carbonyl]oxy]-N,N,N-trimethyl- |
17273418 |
Benzenaminium, 4,4'-(3-oxo-1,5-pentanediyl)bis[N,N-dimethyl-N-2-propenyl-, dibromide |
9449 |
Benzenaminium, 4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)-2,5-cyclohexadien-1-ylidene]methyl]-N,N,N-trimethyl-, dichloride |
17723 |
Benzenaminium, N,N,N-trimethyl-, iodide |
4754 |
Benzene |
17749 |
Benzene, (1,1-dimethylethyl)- |
14928 |
Benzene, (1,2-dibromoethyl)- |
18309 |
Benzene, (1-methylethyl)- |
52450137 |
Benzene, (1-methylundecyl)- |
147496 |
Benzene, (2-bromo-2-nitroethenyl)- |
56325 |
Benzene, (2-bromoethoxy)- |
62620 |
Benzene, (2-chloroethoxy)- |
99465 |
Benzene, (2-isothiocyanatoethyl)- |
51649 |
Benzene, (2-methylpropyl)- |
21063 |
Benzene, (2-nitroethenyl)- |
56283 |
Benzene, (3-bromopropoxy)- |
19430 |
Benzene, (chloromethyl)- |
255331 |
Benzene, (chloromethyl)ethenyl- |
62596 |
Benzene, (isothiocyanatomethyl)- |
51631 |
Benzene, (methoxymethyl)- |
19646 |
Benzene, (methylthio)- |
17756 |
Benzene, (trichloromethyl)- |
17764 |
Benzene, (trifluoromethyl)- |
1714677 |
Benzene, [(2-propenyloxy)methyl]- |
17153883 |
Benzene, [(chloromethyl)sulfinyl]- |
963769 |
Benzene, 1-((2-(4-ethoxyphenyl)-2-methylpropoxy)methyl)-3-phenoxy- |
9704 |
Benzene, 1-(1,1-dimethylethyl)-2-methoxy-4-methyl-3,5-dinitro- |
8623 |
Benzene, 1-(1,1-dimethylethyl)-3,5-dimethyl-2,4,6-trinitro- |
131649 |
Benzene, 1-(1,1-dimethylethyl)-4-methoxy- |
18085 |
Benzene, 1-(1,1-dimethylethyl)-4-methyl- |
92817 |
Benzene, 1-(1-methylethyl)-4-nitro- |
17152711 |
Benzene, 1-(4-bromophenoxy)-2,4-dinitro- |
300251 |
Benzene, 1-(8-methoxy-4,8-dimethylnonyl)-4-(1-methylethyl)- |
19190 |
Benzene, 1-(bromomethyl)-4-nitro- |
56275 |
Benzene, 1,1'-(1,2-ethenediyl)bis- |
48348 |
Benzene, 1,1'-(1,2-ethynediyl)bis- |
73197 |
Benzene, 1,1'-(1,3-butadiene-1,4-diyl)bis- |
109470 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis- |
1107 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro- |
17122698 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-fluoro- |
4903 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxy- |
124404 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-methyl- |
1714695 |
Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[5-chloro-2-methoxy- |
4937 |
Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-chloro- |
4952 |
Benzene, 1,1'-(2,2-dichloroethylidene)bis[4-ethyl- |
960963 |
Benzene, 1,1'-(2-nitrobutylidene)bis[4-chloro- |
962084 |
Benzene, 1,1'-(2-nitrobutylidene)bis[4-chloro-, mixt. with 1,1'-(2-nitropropylidene)bis[4-chlorobenzene] |
960971 |
Benzene, 1,1'-(2-nitropropylidene)bis[4-chloro- |
709428 |
Benzene, 1,1'-(chloroethenylidene)bis(4-chloro- |
1714575 |
Benzene, 1,1'-(chloromethylene)bis[4-methyl- |
4945 |
Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro- |
17074717 |
Benzene, 1,1'-(dichloroethenylidene)bis[4-chloro-, compd. with 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxybenzene] (1:1) |
1714286 |
Benzene, 1,1'-(methoxymethylene)bis- |
1714329 |
Benzene, 1,1',1'',1'''-(1,4-dimethoxy-2-butyne-1,4-diylidene)tetrakis- |
22244 |
Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis- |
17152026 |
Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[4-chloro- |
1714666 |
Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[4-nitro- |
17152935 |
Benzene, 1,1'-[2-butene-1,4-diylbis(oxy)]bis[4-chloro- |
17122771 |
Benzene, 1,1'-[methylenebis(oxy)]bis[4-chloro- |
21444 |
Benzene, 1,1'-[oxybis(methylene)]bis- |
62091 |
Benzene, 1,1'-[sulfinylbis(methylene)]bis- |
51615 |
Benzene, 1,1'-[thiobis(methylene)]bis- |
50542 |
Benzene, 1,1'-ethenylidenebis- |
59980 |
Benzene, 1,1'-ethylidenebis- |
116624 |
Benzene, 1,1'-ethylidenebis(4-chloro- |
20370 |
Benzene, 1,1'-methylenebis- |
20339 |
Benzene, 1,1'-methylenebis[4-chloro- |
20263 |
Benzene, 1,1'-methylenebis[4-isocyanato- |
20404 |
Benzene, 1,1'-oxybis- |
79996 |
Benzene, 1,1'-oxybis[2,3,4,5,6-pentabromo- |
20222 |
Benzene, 1,1'-oxybis[4-nitro- |
74989 |
Benzene, 1,1'-sulfinylbis- |
34330 |
Benzene, 1,1'-sulfonylbis- |
8128 |
Benzene, 1,1'-sulfonylbis[4-chloro- |
81430 |
Benzene, 1,1'-thiobis[4-nitro- |
65441 |
Benzene, 1,2,3,4-tetrachloro- |
1714359 |
Benzene, 1,2,3,4-tetrachloro-5-(3,4-dichlorophenoxy)- |
709402 |
Benzene, 1,2,3,4-tetrachloro-5,6-dimethoxy- |
17003401 |
Benzene, 1,2,3,4-tetrachloro-5-nitro- |
17151903 |
Benzene, 1,2,3,4-tetrafluoro-5,6-dinitro- |
65458 |
Benzene, 1,2,3,5-tetrachloro- |
17122052 |
Benzene, 1,2,3,5-tetrachloro-4-nitro- |
17273293 |
Benzene, 1,2,3,5-tetrafluoro-4-nitro- |
11288 |
Benzene, 1,2,3-trichloro- |
17004870 |
Benzene, 1,2,3-trichloro-4-nitro- |
65656 |
Benzene, 1,2,4,5-tetrabromo- |
16501 |
Benzene, 1,2,4,5-tetrachloro- |
17003849 |
Benzene, 1,2,4,5-tetrachloro-3-methoxy-6-nitro- |
29736 |
Benzene, 1,2,4,5-tetrachloro-3-nitro- |
16493 |
Benzene, 1,2,4,5-tetramethyl- |
60772 |
Benzene, 1,2,4-tribromo- |
31435 |
Benzene, 1,2,4-trichloro- |
775684 |
Benzene, 1,2,4-trichloro-5-[(4-chlorophenyl)sulfonyl]- |
17123597 |
Benzene, 1,2,4-trichloro-5-[(4-chlorophenyl)thio]- |
137786 |
Benzene, 1,2,4-trichloro-5-methoxy- |
144295 |
Benzene, 1,2,4-trichloro-5-methyl- |
12559 |
Benzene, 1,2,4-trichloro-5-nitro- |
712372 |
Benzene, 1,2,4-trichloro-5-phenoxy- |
16261 |
Benzene, 1,2,4-trimethyl- |
13276 |
Benzene, 1,2-bis(bromomethyl)- |
184713 |
Benzene, 1,2-bis(dibromomethyl)- |
55723 |
Benzene, 1,2-dibromo- |
16162 |
Benzene, 1,2-dichloro- |
95182 |
Benzene, 1,2-dichloro-3-methoxy- |
113084 |
Benzene, 1,2-dichloro-3-nitro- |
17153438 |
Benzene, 1,2-dichloro-4-(2-nitroethenyl)- |
183343 |
Benzene, 1,2-dichloro-4-(trichloromethyl)- |
1714460 |
Benzene, 1,2-dichloro-4-[(2,4-dichlorophenyl)methyl]-5-methyl- |
1714461 |
Benzene, 1,2-dichloro-4-[(2,6-dichlorophenyl)methyl]-5-methyl- |
16360 |
Benzene, 1,2-dichloro-4-methyl- |
18747 |
Benzene, 1,2-dichloro-4-nitro- |
36244 |
Benzene, 1,2-diethyl- |
17273376 |
Benzene, 1,2-difluoro- |
13292 |
Benzene, 1,2-dimethoxy- |
14712 |
Benzene, 1,2-dimethoxy-4-(2-propenyl)- |
47795 |
Benzene, 1,2-dimethoxy-4-methyl- |
16139 |
Benzene, 1,2-dimethyl- |
9605 |
Benzene, 1,2-dimethyl-3-nitro- |
18721 |
Benzene, 1,2-dimethyl-4-nitro- |
50344 |
Benzene, 1,2-dinitro- |
63750 |
Benzene, 1,3,5-tribromo- |
59113 |
Benzene, 1,3,5-tribromo-2-methoxy- |
25296 |
Benzene, 1,3,5-trichloro- |
17123381 |
Benzene, 1,3,5-trichloro-2-(4-nitrophenoxy)- |
139378 |
Benzene, 1,3,5-trichloro-2,4-dinitro- |
708560 |
Benzene, 1,3,5-trichloro-2-methoxy- |
212696 |
Benzene, 1,3,5-trichloro-2-nitro- |
25262 |
Benzene, 1,3,5-trimethyl- |
18671 |
Benzene, 1,3,5-trinitro- |
52217 |
Benzene, 1,3-dichloro- |
1714538 |
Benzene, 1,3-dichloro-2-(3,4-dichlorophenoxy)- |
8649 |
Benzene, 1,3-dichloro-2-(dichloromethyl)- |
95208 |
Benzene, 1,3-dichloro-2-methoxy- |
1714454 |
Benzene, 1,3-dichloro-4-[(2,4-dichlorophenyl)methyl]-2-methyl- |
1714457 |
Benzene, 1,3-dichloro-4-[(2,6-dichlorophenyl)methyl]-2-methyl- |
61416 |
Benzene, 1,3-dichloro-5-nitro- |
38554 |
Benzene, 1,3-diethyl- |
688911 |
Benzene, 1,3-dimethoxy-2-methyl- |
25056 |
Benzene, 1,3-dimethyl- |
17151762 |
Benzene, 1,3-dimethyl-5-(4-nitrophenoxy)- |
18846 |
Benzene, 1,3-dinitro- |
62778 |
Benzene, 1,4-bis(chloromethyl)- |
4465 |
Benzene, 1,4-bis(trichloromethyl)- |
23531 |
Benzene, 1,4-dibromo- |
77677 |
Benzene, 1,4-dibromo-2,5-dimethyl- |
60806 |
Benzene, 1,4-dibromo-2-methyl- |
23622 |
Benzene, 1,4-dichloro- |
106088 |
Benzene, 1,4-dichloro-2,5-dimethoxy- |
12492 |
Benzene, 1,4-dichloro-2-nitro- |
63164 |
Benzene, 1,4-diiodo- |
120998 |
Benzene, 1,4-diisothiocyanato- |
40105 |
Benzene, 1,4-dimethoxy- |
23580 |
Benzene, 1,4-dimethyl- |
12468 |
Benzene, 1,4-dimethyl-2-nitro- |
19307 |
Benzene, 1,4-dinitro- |
17151499 |
Benzene, 1,5-bis(chloromethyl)-2,4-dimethyl- |
118265 |
Benzene, 1,5-dichloro-2,4-dinitro- |
1714455 |
Benzene, 1,5-dichloro-2-[(2,4-dichlorophenyl)methyl]-4-methyl- |
1714456 |
Benzene, 1,5-dichloro-2-[(2,5-dichlorophenyl)methyl]-4-methyl- |
1714458 |
Benzene, 1,5-dichloro-2-[(2,6-dichlorophenyl)methyl]-4-methyl- |
1714459 |
Benzene, 1,5-dichloro-2-[(3,4-dichlorophenyl)methyl]-4-methyl- |
17126160 |
Benzene, 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)- |
185900 |
Benzene, 1-[(2-methyl-2-propenyl)oxy]-2-nitro- |
216200 |
Benzene, 1-[(diiodomethyl)sulfonyl]-4-methyl- |
17152877 |
Benzene, 1-bromo-2,3,4,6-tetrafluoro-5-nitro- |
17152851 |
Benzene, 1-bromo-2,3,5,6-tetrafluoro-4-nitro- |
55905 |
Benzene, 1-bromo-2,4-dinitro- |
55269 |
Benzene, 1-bromo-2-nitro- |
56028 |
Benzene, 1-bromo-3-nitro- |
56127 |
Benzene, 1-bromo-4-nitro- |
20172 |
Benzene, 1-bromo-4-phenoxy- |
97402 |
Benzene, 1-chloro-2-(trichloromethyl)- |
17129 |
Benzene, 1-chloro-2,4-dinitro- |
70516 |
Benzene, 1-chloro-2-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]- |
775866 |
Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]- |
775643 |
Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethyl]- |
69807 |
Benzene, 1-chloro-2-methoxy- |
16154 |
Benzene, 1-chloro-2-methyl- |
9613 |
Benzene, 1-chloro-2-methyl-3-nitro- |
11981 |
Benzene, 1-chloro-2-nitro- |
97394 |
Benzene, 1-chloro-3-(trichloromethyl)- |
107953 |
Benzene, 1-chloro-3-methoxy- |
25080 |
Benzene, 1-chloro-3-methyl- |
31914 |
Benzene, 1-chloro-3-nitro- |
1714525 |
Benzene, 1-chloro-4-(2-chloroethoxy)- |
22376 |
Benzene, 1-chloro-4-(chloromethyl)- |
8094 |
Benzene, 1-chloro-4-(phenylsulfonyl)- |
1714568 |
Benzene, 1-chloro-4-(phenylthio)- |
130138 |
Benzene, 1-chloro-4-(trichloromethyl)- |
21915 |
Benzene, 1-chloro-4-isocyanato- |
62703 |
Benzene, 1-chloro-4-methoxy- |
23598 |
Benzene, 1-chloro-4-methyl- |
12484 |
Benzene, 1-chloro-4-methyl-2-nitro- |
19091 |
Benzene, 1-chloro-4-nitro- |
146647 |
Benzene, 1-chloro-4-phenoxy- |
17121369 |
Benzene, 1-cyclohexen-1-yl- |
59709 |
Benzene, 1-ethoxy-2,4-dinitro- |
19349 |
Benzene, 1-ethoxy-4-nitro- |
59857 |
Benzene, 1-ethyl-2-methyl- |
62653 |
Benzene, 1-ethyl-4-methyl- |
19208 |
Benzene, 1-ethyl-4-nitro- |
4630 |
Benzene, 1-fluoro-2,4-dinitro- |
16188 |
Benzene, 1-fluoro-2-methyl- |
88310 |
Benzene, 1-fluoro-4-isothiocyanato- |
43216 |
Benzene, 1-fluoro-4-nitro- |
17153701 |
Benzene, 1-iodo-4-(phenylmethoxy)- |
114496 |
Benzene, 1-isocyanato-3-nitro- |
19331 |
Benzene, 1-isocyanato-4-nitro- |
30585 |
Benzene, 1-methoxy-2,4-dinitro- |
13359 |
Benzene, 1-methoxy-2-nitro- |
22095 |
Benzene, 1-methoxy-4-(1-propenyl)- |
19240 |
Benzene, 1-methoxy-4-nitro- |
17153073 |
Benzene, 1-methyl-2,3,6-trinitro- |
58453 |
Benzene, 1-methyl-2,3-dinitro- |
31575 |
Benzene, 1-methyl-2,4-dinitro- |
11973 |
Benzene, 1-methyl-2-nitro- |
18499 |
Benzene, 1-methyl-3-nitro- |
18986 |
Benzene, 1-methyl-4-(1-methylethyl)- |
19083 |
Benzene, 1-methyl-4-nitro- |
1714418 |
Benzene, 1-nitro-4-(phenylmethoxy)- |
62042 |
Benzene, 1-nitro-4-phenoxy- |
17122078 |
Benzene, 2(and 3)-dichloro- |
710301 |
Benzene, 2,3,4-trichloro-1,5-dinitro- |
17151507 |
Benzene, 2,4-bis(chloromethyl)-1,3,5-trimethyl- |
93237 |
Benzene, 2,4-dichloro-1-(4-nitrophenoxy)- |
183335 |
Benzene, 2,4-dichloro-1-(trichloromethyl)- |
42242 |
Benzene, 2,4-dichloro-1-(trifluoromethyl)- |
53470 |
Benzene, 2,4-dichloro-1-methoxy- |
16345 |
Benzene, 2,4-dichloro-1-methyl- |
59816 |
Benzene, 2,4-dichloro-1-nitro- |
55939 |
Benzene, 2,4-diisocyanato-1-methyl- |
17153412 |
Benzene, 2,4-dimethoxy-1-(2-nitroethenyl)- |
286278 |
Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)- |
52466588 |
Benzene, 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)- |
31955 |
Benzene, 2-chloro-1-methyl-4-nitro- |
30460 |
Benzene, 2-methyl-1,3,5-trinitro- |
58875 |
Benzene, 2-methyl-1,3-dinitro- |
61564 |
Benzene, 2-methyl-1,4-dinitro- |
199786 |
Benzene, 2-nitro-1-(4-nitrophenoxy)-4-(trifluoromethyl)- |
12476 |
Benzene, 4-chloro-1-methyl-2-nitro- |
59675 |
Benzene, 4-methyl-1,2-dinitro- |
231886 |
Benzene, bis(1-methylethyl)- |
25437 |
Benzene, bromo- |
79400 |
Benzene, butoxy- |
22137 |
Benzene, butyl- |
25478 |
Benzene, chloro- |
426346 |
Benzene, chloro derivs. |
17121781 |
Benzene, chlorodinitro- |
71639 |
Benzene, cyclohexyl- |
231902 |
Benzene, dichloro- |
232207 |
Benzene, diethyl- |
84970 |
Benzene, dimethyl- |
32680 |
Benzene, dodecyl- |
19414 |
Benzene, ethenyl- |
1714550 |
Benzene, ethenylnitro- |
21626 |
Benzene, ethoxy- |
19406 |
Benzene, ethyl- |
46409 |
Benzene, fluoro- |
11395 |
Benzene, hexabromo- |
30346 |
Benzene, hexachloro- |
44750 |
Benzene, hexafluoro- |
56937 |
Benzene, iodo- |
21600 |
Benzene, isocyanato- |
21618 |
Benzene, isothiocyanato- |
19620 |
Benzene, methoxy- |
25452 |
Benzene, methyl- |
18408 |
Benzene, nitro- |
98251 |
Benzene, octyl- |
10272 |
Benzene, pentabromoethyl- |
11403 |
Benzene, pentabromomethyl- |
59261 |
Benzene, pentachloro- |
251777 |
Benzene, pentachloro(trichloroethenyl)- |
687228 |
Benzene, pentachloromethoxy- |
9373 |
Benzene, pentachloronitro- |
45633 |
Benzene, pentafluoro(trifluoromethyl)- |
51599 |
Benzene, pentyl- |
21568 |
Benzene, propyl- |
689919 |
Benzene, tetrachloro- |
173682 |
Benzene, trichloro- |
17125501 |
Benzene, trichloro-1,3-dinitro- |
232215 |
Benzene, triethyl- |
233320 |
Benzene, trimethyl- |
145029 |
Benzene, undecyl- |
21691 |
Benzeneacetamide |
75259 |
Benzeneacetamide, N,N-dimethyl-.alpha.-phenyl- |
145417 |
Benzeneacetamide, N-methyl- |
21709 |
Benzeneacetic acid |
1396 |
Benzeneacetic acid, .alpha.-(hydroxymethyl)- (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |
1917 |
Benzeneacetic acid, .alpha.-(hydroxymethyl)- (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, sulfate (2:1) (salt) |
964528 |
Benzeneacetic acid, .alpha.-(methoxyimino)-2-[(2-methylphenoxy)methyl]-, methyl ester, (E)- |
964486 |
Benzeneacetic acid, .alpha.-(methoxyimino)-2-[[[(E)-[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]-, methyl ester, (.alpha.E)- |
104943 |
Benzeneacetic acid, .alpha.-[(dimethoxyphosphinothioyl)thio]-, ethyl ester |
109033 |
Benzeneacetic acid, .alpha.-amino-, (.alpha.S)- |
12922 |
Benzeneacetic acid, .alpha.-ethyl- |
13078 |
Benzeneacetic acid, .alpha.-hydroxy- |
6429 |
Benzeneacetic acid, .alpha.-hydroxy-.alpha.-phenyl- |
146688 |
Benzeneacetic acid, .alpha.-methoxy- |
47621 |
Benzeneacetic acid, .alpha.-methyl- |
17295189 |
Benzeneacetic acid, .alpha.-methylene- |
29785 |
Benzeneacetic acid, .alpha.-phenyl- |
17152737 |
Benzeneacetic acid, .alpha.-phenyl-, anhydride |
17272659 |
Benzeneacetic acid, .alpha.-phenyl-.alpha.-propyl-, 2-(diethylamino)ethyl ester, hydrochloride |
10306 |
Benzeneacetic acid, 2,3,6-trichloro- |
102236 |
Benzeneacetic acid, 2,3,6-trichloro-, sodium salt |
1714649 |
Benzeneacetic acid, 2,4,5-trichloro-.alpha.-hydroxy- |
66308 |
Benzeneacetic acid, 2,4-dinitro- |
45864 |
Benzeneacetic acid, 2,5-dihydroxy- |
92049 |
Benzeneacetic acid, 2,5-dimethoxy- |
627422 |
Benzeneacetic acid, 2-[[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy]-.alpha.-(methoxymethylene)-, methyl ester, (.alpha.E)- |
17295072 |
Benzeneacetic acid, 2-amino-.alpha.-oxo- |
17153289 |
Benzeneacetic acid, 2-bromo- |
12419 |
Benzeneacetic acid, 2-carboxy- |
60475 |
Benzeneacetic acid, 2-hydroxy- |
118653 |
Benzeneacetic acid, 2-nitro- |
1714296 |
Benzeneacetic acid, 3,4-dihydroxy- |
1714657 |
Benzeneacetic acid, 3-amino- |
17153347 |
Benzeneacetic acid, 3-bromo- |
17153339 |
Benzeneacetic acid, 3-chloro- |
520262 |
Benzeneacetic acid, 4-(difluoromethoxy)-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
1714642 |
Benzeneacetic acid, 4-[2-(diethylamino)-2-oxoethoxy]-3-methoxy-, propyl ester |
80903 |
Benzeneacetic acid, 4-amino- |
93716 |
Benzeneacetic acid, 4-bromo- |
690677 |
Benzeneacetic acid, 4-bromo-.alpha.-(4-bromophenyl)-.alpha.-hydroxy-, 1-methylethyl ester |
93708 |
Benzeneacetic acid, 4-chloro- |
355552 |
Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, (.alpha.S)- |
292094 |
Benzeneacetic acid, 4-chloro-.alpha.-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester |
17272899 |
Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)- |
961953 |
Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, 1-methylethyl ester |
49320 |
Benzeneacetic acid, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-hydroxy-, ethyl ester |
47670 |
Benzeneacetic acid, 4-chloro-.alpha.-hydroxy- |
1714445 |
Benzeneacetic acid, 4-ethoxy-3-methoxy- |
44990 |
Benzeneacetic acid, 4-fluoro- |
40410 |
Benzeneacetic acid, 4-hydroxy- |
21865 |
Benzeneacetic acid, 4-nitro- |
20073 |
Benzeneacetic acid, methyl ester |
183236 |
Benzeneacetic acid, potassium salt |
37739 |
Benzeneacetonitrile |
330803 |
Benzeneacetonitrile, .alpha.-[(cyanomethoxy)imino]- |
1714487 |
Benzeneacetonitrile, .alpha.-[2-(dimethylamino)propyl]-.alpha.-phenyl- |
17163585 |
Benzeneacetonitrile, .alpha.-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-.alpha.-(1-methylethyl)- |
10694 |
Benzeneacetonitrile, .alpha.-phenyl- |
53660 |
Benzeneacetonitrile, 4-nitro- |
92932 |
Benzenebutanoic acid |
41731 |
Benzenebutanoic acid, 4-[bis(2-chloroethyl)amino]- |
17127374 |
Benzenecarbohydrazonoyl chloride, N-(2,4,6-trichlorophenyl)- |
17121419 |
Benzenecarbothioamide, 2,4-dichloro- |
17121393 |
Benzenecarbothioamide, 2,6-dichloro- |
148049 |
Benzenecarbothioic acid, 2-hydroxy- |
961581 |
Benzene-d5, methyl-d3- |
231522 |
Benzenediamine |
232421 |
Benzenediamine, ar-methyl- |
89078 |
Benzenediazonium, 4-chloro-, hexafluorophosphate(1-) |
41764 |
Benzenediazonium, 4-sulfo-, inner salt |
86439 |
Benzenedimethanaminium, ar-dodecyl-ar,N,N,N,N',N',N'-heptamethyl-, dichloride, mixt. with ar-dodecyl-ar,N,N,N-tetramethylbenzenemethanaminium chloride |
3806 |
Benzeneethanamine |
1420 |
Benzeneethanamine, .alpha.-methyl-, (.alpha.S)- |
17002098 |
Benzeneethanamine, .alpha.-methyl-, sulfate |
1412 |
Benzeneethanamine, N,.alpha.-dimethyl-, hydrochloride, (.alpha.S)- |
267989 |
Benzeneethanimidoyl chloride, N,4-dihydroxy-.alpha.-oxo- |
3277 |
Benzeneethanol |
124578 |
Benzeneethanol, .alpha.,.alpha.-diphenyl- |
89961 |
Benzeneethanol, .alpha.-[(1R)-2-(dimethylamino)-1-methylethyl]-.alpha.-phenyl-, propanoate (ester), hydrochloride, (.alpha.S)- |
19448 |
Benzenemethanamine |
12740 |
Benzenemethanamine, 2-chloro- |
327205 |
Benzenemethanamine, 2-chloro-N-(2-6-dinitro-4-(trifluoromethyl)phenyl)-N-ethyl-6-fluoro- |
21071 |
Benzenemethanamine, N-(1-methylethyl)- |
17163635 |
Benzenemethanamine, N-(2-chloroethyl)-N-(phenylmethyl)-, hydrochloride |
1714651 |
Benzenemethanamine, N-(4-nitrophenyl)- |
21436 |
Benzenemethanamine, N-(phenylmethyl)- |
1714565 |
Benzenemethanamine, N,N,.alpha.,.alpha.-tetraphenyl- |
21717 |
Benzenemethanamine, N,N-dimethyl- |
17153321 |
Benzenemethanamine, N,N-dimethyl-, hydrochloride |
17151820 |
Benzenemethanamine, N-cyclohexyl-, hydrochloride |
194894 |
Benzenemethanamine, N-ethyl- |
14241 |
Benzenemethanamine, N-ethyl-N-phenyl- |
21576 |
Benzenemethanamine, N-methyl- |
20545 |
Benzenemethanamine, N-methyl-N-(phenylmethyl)- |
216622 |
Benzenemethanamine, N-octadecyl- |
21329 |
Benzenemethanamine, N-phenyl- |
213728 |
Benzenemethanaminium, 4-dodecyl-N,N,N-trimethyl-, chloride |
17127598 |
Benzenemethanaminium, ar-dodecyl-ar,N,N,N-tetramethyl-, chloride |
85092 |
Benzenemethanaminium, ar-dodecyl-N,N,N-trimethyl-, chloride |
688168 |
Benzenemethanaminium, N,N,N-tributyl-2,4-dichloro-, chloride |
2139 |
Benzenemethanaminium, N,N,N-triethyl-, chloride |
2352 |
Benzenemethanaminium, N,N,N-trimethyl-, chloride |
19778 |
Benzenemethanaminium, N,N,N-trimethyl-, hydroxide |
32110 |
Benzenemethanaminium, N,N,N-trimethyl-, methoxide |
17272824 |
Benzenemethanaminium, N,N-diethyl-N-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethyl]-, chloride |
19836 |
Benzenemethanaminium, N,N-dimethyl-N-(phenylmethyl)-, chloride |
31799 |
Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride |
230383 |
Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[methyl-4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride |
32169 |
Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride |
90878 |
Benzenemethanaminium, N-[4-[[4-(dimethylamino)phenyl][4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-3-sulfo-, inner salt, sodium salt |
148023 |
Benzenemethanaminium, N-dodecyl-N,N-dimethyl-, bromide |
37341 |
Benzenemethanaminium, N-dodecyl-N,N-dimethyl-, chloride |
963934 |
Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, diammonium salt, mixt. with 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]-1H-pyrazol |
119578 |
Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt |
100487 |
Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-hydroxy-2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt |
129726 |
Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt |
126706 |
Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt |
32151 |
Benzenemethanaminium, N-hexadecyl-N,N-dimethyl-, chloride |
17151978 |
Benzenemethanesulfonothioic acid, S-(phenylmethyl) ester |
19497 |
Benzenemethanol |
95331 |
Benzenemethanol, .alpha.-(trichloromethyl)- |
61283 |
Benzenemethanol, .alpha.,.alpha.-dimethyl- |
41350 |
Benzenemethanol, .alpha.-[(1S)-1-(methylamino)ethyl]-, (.alpha.R)- |
34355 |
Benzenemethanol, .alpha.-ethynyl-.alpha.-methyl- |
17155920 |
Benzenemethanol, .alpha.-ethynyl-.alpha.-phenyl- |
1714573 |
Benzenemethanol, .alpha.-methyl-, benzoate |
963496 |
Benzenemethanol, 2,3(or 3,4)-dichloro-, methylcarbamate |
17151580 |
Benzenemethanol, 2,3,4,5,6-pentachloro- |
17152885 |
Benzenemethanol, 2-chloro- |
1714299 |
Benzenemethanol, 2-chloro-.alpha.-(trichloromethyl)- |
12781 |
Benzenemethanol, 2-hydroxy- |
961557 |
Benzenemethanol, 3,4-dichloro-, methylcarbamate |
14613 |
Benzenemethanol, 3,4-dimethoxy- |
191734 |
Benzenemethanol, 3-phenoxy- |
72983 |
Benzenemethanol, 4-(1,1-dimethylethyl)- |
51292 |
Benzenemethanol, 4-(1-methylethyl)- |
49312 |
Benzenemethanol, 4-(dimethylamino)-.alpha.-[4-(dimethylamino)phenyl]-.alpha.-phenyl- |
709378 |
Benzenemethanol, 4-chloro- |
17273020 |
Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)- |
29157 |
Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-(trichloromethyl)- |
1714633 |
Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-cyclopropyl- |
17122219 |
Benzenemethanol, 4-chloro-.alpha.-(4-chlorophenyl)-.alpha.-methyl- |
115303 |
Benzenemethanol, 4-chloro-.alpha.-methyl- |
17294919 |
Benzenemethanol, 4-fluoro- |
709147 |
Benzenemethanol, 4-hydroxy- |
56358 |
Benzenemethanol, 4-methyl- |
66548 |
Benzenepropanenitrile |
60368 |
Benzenepropanenitrile, .beta.-oxo- |
48322 |
Benzenepropanoic acid |
964346 |
Benzenepropanoic acid, .alpha., 2-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]-4-fluoro-, ethyl ester |
962456 |
Benzenepropanoic acid, .alpha.,4-dichloro-, methyl ester |
17151309 |
Benzenepropanoic acid, .beta.-bromo- |
58990 |
Benzenepropanoic acid, .beta.-phenyl- |
17295221 |
Benzenepropanoic acid, 2-hydroxy- |
17295320 |
Benzenepropanoic acid, 4-hydroxy- |
32649 |
Benzenepropanol |
21121 |
Benzenepropanol, .alpha.,.alpha.-dimethyl- |
66514 |
Benzenepropanoyl chloride |
17151531 |
Benzenesulfinic acid, 3-nitro-, sodium salt |
593798 |
Benzenesulfonamide, 2-(2-chloroethoxy)-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
342899 |
Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- |
129502 |
Benzenesulfonamide, 3-nitro-N-phenyl-4-(phenylamino)- |
213793 |
Benzenesulfonamide, 4-(dipropylamino)-3,5-dinitro- |
3764 |
Benzenesulfonamide, 4-amino- |
1714474 |
Benzenesulfonamide, 4-amino-N-(2,6-dimethoxy-4-pyrimidinyl)- |
76786 |
Benzenesulfonamide, 4-amino-N-(2,6-dimethoxy-4-pyrimidinyl)-, monosodium salt |
34371 |
Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)- |
2667 |
Benzenesulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)- |
34405 |
Benzenesulfonamide, 4-amino-N-(4-methyl-2-pyrimidinyl)- |
1714473 |
Benzenesulfonamide, 4-amino-N-(6-methoxy-4-pyrimidinyl)- |
2659 |
Benzenesulfonamide, 4-amino-N-(aminoiminomethyl)- |
39495 |
Benzenesulfonamide, 4-amino-N-2-pyridinyl- |
4457 |
Benzenesulfonamide, 4-amino-N-2-pyrimidinyl- |
3079 |
Benzenesulfonamide, 4-amino-N-2-quinoxalinyl- |
17153990 |
Benzenesulfonamide, 4-amino-N-2-quinoxalinyl-, monosodium salt |
4846 |
Benzenesulfonamide, 4-amino-N-2-thiazolyl- |
17273285 |
Benzenesulfonamide, 4-fluoro-N-phenyl- |
4671 |
Benzenesulfonamide, 4-methyl- |
4440 |
Benzenesulfonamide, 4-methyl-N-phenyl- |
17153966 |
Benzenesulfonamide, N,N'-1,2-ethanediylbis[3-nitro- |
17152240 |
Benzenesulfonamide, N,N-diethyl- |
604413 |
Benzenesulfonamide, N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]-2-(3,3,3-trifluoropropyl)- |
117432 |
Benzenesulfonamide, N-butyl- |
34298 |
Benzenesulfonamide, N-chloro-, sodium salt |
34348 |
Benzenesulfonamide, N-chloro-4-methyl-, sodium salt |
17798 |
Benzenesulfonic acid |
251439 |
Benzenesulfonic acid, [[4-[bis[4-[(sulfophenyl)amino]phenyl]methylene]-2,5-cyclohexadien-1-ylidene]amino]-, disodium salt |
245407 |
Benzenesulfonic acid, 2,2'-([1,1'-biphenyl]-4,4'-diyldi-2,1-ethenediyl)bis-, disodium salt |
108191 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[(4-ethoxyphenyl)azo]-, disodium salt |
110858 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[(4-hydroxyphenyl)azo]-, disodium salt |
203141 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-(4-morpholinyl)-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, disodium salt |
226365 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-(ethylamino)-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, disodium salt |
192096 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[(2-hydroxyethyl)methylamino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, disodium salt |
124362 |
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]- |
124347 |
Benzenesulfonic acid, 2,2'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[5-methyl-, disodium salt |
185736 |
Benzenesulfonic acid, 2,2'-thiobis[5-[(4-ethoxyphenyl)azo]-, disodium salt |
140590 |
Benzenesulfonic acid, 2,5-dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-[(4-sulfophenyl)azo]-1H-pyrazol-1-yl]-, disodium salt |
11791 |
Benzenesulfonic acid, 2-amino-5-methyl- |
130286 |
Benzenesulfonic acid, 2-methyl-5-nitro-, sodium salt |
17273152 |
Benzenesulfonic acid, 3,3'-(4,5,6,7-tetrabromo-3-oxo-1(3H)-isobenzofuranylidene)bis[6-hydroxy- |
56226 |
Benzenesulfonic acid, 3-[[4-(phenylamino)phenyl]azo]-, monosodium salt |
17996 |
Benzenesulfonic acid, 3-amino-4-hydroxy- |
34363 |
Benzenesulfonic acid, 3-nitro-, sodium salt |
31831 |
Benzenesulfonic acid, 4-(acetylamino)- |
31815 |
Benzenesulfonic acid, 4-(dimethylamino)- |
65375 |
Benzenesulfonic acid, 4-[(2-hydroxy-1-naphthalenyl)azo]-, monosodium salt |
50039 |
Benzenesulfonic acid, 4-[(4-hydroxy-1-naphthalenyl)azo]-, monosodium salt |
83592 |
Benzenesulfonic acid, 4-[[3-[(dimethylphenyl)azo]-2,4-dihydroxyphenyl]azo]-, monosodium salt |
31807 |
Benzenesulfonic acid, 4-amino- |
128892 |
Benzenesulfonic acid, 4-bromo-, sodium salt |
17154048 |
Benzenesulfonic acid, 4-chloro-, 2,4-dinitrophenyl ester |
960849 |
Benzenesulfonic acid, 4-chloro-, 4-chlorophenyl ester |
17152968 |
Benzenesulfonic acid, 4-chloro-, 4-methoxyphenyl ester |
129700 |
Benzenesulfonic acid, 4-chloro-, sodium salt |
17122227 |
Benzenesulfonic acid, 4-chlorophenyl ester |
98541 |
Benzenesulfonic acid, 4-dodecyl-, sodium salt |
71522 |
Benzenesulfonic acid, 4-hydroxy-, monosodium salt |
21931 |
Benzenesulfonic acid, 4-methyl- |
66787 |
Benzenesulfonic acid, 4-methyl-, sodium salt |
142216 |
Benzenesulfonic acid, 5-(2H-naphtho[1,2-d]triazol-2-yl)-2-(2-phenylethenyl)-, sodium salt |
30403 |
Benzenesulfonic acid, 5-amino-2-methyl- |
116855 |
Benzenesulfonic acid, 5-chloro-2-[4-chloro-2-[[[(3,4-dichlorophenyl)amino]carbonyl]amino]phenoxy]-, monosodium salt |
17153594 |
Benzenesulfonic acid, 5-chloro-3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-, monosodium salt |
285890 |
Benzenesulfonic acid, alkyl derivs. |
17121518 |
Benzenesulfonic acid, alkyl derivs., sodium salts |
250183 |
Benzenesulfonic acid, aminomethyl[[4-[(sulfophenyl)amino]phenyl][4-[(sulfophenyl)imino]-2,5-cyclohexadien-1-ylidene]methyl]-, disodium salt |
17272840 |
Benzenesulfonic acid, butyl ester |
17122110 |
Benzenesulfonic acid, C10-13-alkyl derivs. |
426197 |
Benzenesulfonic acid, C10-13-alkyl derivs., sodium salts |
458778 |
Benzenesulfonic acid, C10-16-alkyl derivs. |
83881 |
Benzenesulfonic acid, decyl-, sodium salt |
244327 |
Benzenesulfonic acid, dodecyl- |
93815 |
Benzenesulfonic acid, dodecyl ester |
238014 |
Benzenesulfonic acid, dodecyl-, calcium salt |
238006 |
Benzenesulfonic acid, dodecyl-, compd. with 2-propanamine (1:1) |
85043 |
Benzenesulfonic acid, dodecyl-, ion(1-) |
230425 |
Benzenesulfonic acid, dodecyl-, sodium salt |
712265 |
Benzenesulfonic acid, dodecyl-, sodium salt, mixt. with .alpha.-(nonylphenyl)-.omega.-hydroxypoly(oxy-1,2-ethanediyl) |
165910 |
Benzenesulfonic acid, ethenyl-, homopolymer, sodium salt |
17295437 |
Benzenesulfonic acid, ethyl ester |
8193 |
Benzenesulfonic acid, hydrazide |
8201 |
Benzenesulfonic acid, methyl ester |
8334 |
Benzenesulfonic acid, propyl ester |
49700 |
Benzenesulfonic acid, sodium salt |
17121567 |
Benzenesulfonic acid, tetrapropylene- |
17121575 |
Benzenesulfonic acid, tetrapropylene-, sodium salt |
237909 |
Benzenesulfonic acid, tridecyl-, sodium salt |
17152745 |
Benzenesulfonothioic acid, S,S'-[2-(dimethylamino)-1,3-propanediyl] ester |
1714462 |
Benzenesulfonothioic acid, S-phenyl ester |
17772 |
Benzenesulfonyl chloride |
31823 |
Benzenesulfonyl chloride, 4-(acetylamino)- |
25536 |
Benzenethiol |
25072 |
Benzenethiol, 3-methyl- |
1714441 |
Benzenethiol, 4-amino- |
23705 |
Benzenethiol, 4-chloro- |
23614 |
Benzenethiol, 4-methyl- |
17153222 |
Benzenethiol, 4-nitro- |
35899 |
Benzenethiol, pentachloro- |
1714569 |
Benzo[a]pyren-3-ol |
1115 |
Benzo[a]pyrene |
17119223 |
Benzo[b]fluorene |
17273079 |
Benzo[b]naphtho[1,2-d]thiophene |
15917 |
Benzo[b]thiophene |
1714673 |
Benzo[b]thiophene, 3-methyl- |
17152653 |
Benzo[b]thiophene, 3-nitro- |
1714652 |
Benzo[b]thiophene, 5-methyl- |
686626 |
Benzo[b]thiophene-4-ol, methylcarbamate |
685297 |
Benzo[b]triphenylene |
40618 |
Benzo[e]pyrene |
17002247 |
Benzo[f]quinoline |
40576 |
Benzo[ghi]perylene |
17155185 |
Benzo[h]quinoline |
40709 |
Benzo[k]fluoranthene |
40543 |
Benzo[rst]pentaphene |
40865 |
Benzofuran |
47902 |
Benzofuran, 2,3-dihydro- |
4044 |
Benzoic acid |
74815 |
Benzoic acid, 1-methylethyl ester |
964320 |
Benzoic acid, 2-(((((4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl)amino)carbonyl)amino)sulfonyl)-3-methyl-, methyl ester |
17295452 |
Benzoic acid, 2-(3,6-dihydroxy-9H-xanthen-9-yl)- |
10439 |
Benzoic acid, 2-(4-chlorobenzoyl)- |
17272923 |
Benzoic acid, 2-(4-hydroxybenzoyl)- |
12427 |
Benzoic acid, 2-(acetylamino)- |
1198 |
Benzoic acid, 2-(acetyloxy)- |
17121336 |
Benzoic acid, 2-(acetyloxy)-, 2-carboxyphenyl ester |
1714714 |
Benzoic acid, 2-(acetyloxy)-5-bromo- |
1714715 |
Benzoic acid, 2-(acetyloxy)-5-iodo- |
65540 |
Benzoic acid, 2-(carboxymethoxy)- |
10587 |
Benzoic acid, 2-(methylamino)-, methyl ester |
1714660 |
Benzoic acid, 2-(phenylmethoxy)- |
30890 |
Benzoic acid, 2,2'-dithiobis- |
17163502 |
Benzoic acid, 2,3,4-trichloro- |
960799 |
Benzoic acid, 2,3,5-trichloro- |
961623 |
Benzoic acid, 2,3,5-trichloro-6-methoxy- |
12021 |
Benzoic acid, 2,3,5-triiodo- |
650101 |
Benzoic acid, 2,3,6-trichloro- |
17124207 |
Benzoic acid, 2,3,6-trichloro-, compd. with N-methylmethanamine (1:1) |
17123514 |
Benzoic acid, 2,3,6-trichloro-, sodium salt |
17163460 |
Benzoic acid, 2,3-dichloro- |
17273202 |
Benzoic acid, 2,3-dihydroxy- |
17163510 |
Benzoic acid, 2,4,5-trichloro- |
17163452 |
Benzoic acid, 2,4,6-trichloro- |
9530 |
Benzoic acid, 2,4,6-trihydroxy- |
47118 |
Benzoic acid, 2,4,6-trimethyl- |
1222 |
Benzoic acid, 2,4-dichloro- |
12674 |
Benzoic acid, 2,4-dihydroxy- |
97576 |
Benzoic acid, 2,4-dihydroxy-, methyl ester |
1714591 |
Benzoic acid, 2,4-dihydroxy-5-nitro- |
1206 |
Benzoic acid, 2,5-dichloro- |
108621 |
Benzoic acid, 2,5-dichloro-, methyl ester |
17122292 |
Benzoic acid, 2,5-dichloro-3-nitro- |
47522 |
Benzoic acid, 2,5-dihydroxy- |
128520 |
Benzoic acid, 2,5-dihydroxy-, monosodium salt |
17156936 |
Benzoic acid, 2,6-dichloro- |
17273392 |
Benzoic acid, 2,6-difluoro- |
41624 |
Benzoic acid, 2,6-dihydroxy- |
87155 |
Benzoic acid, 2,6-dimethoxy- |
748921 |
Benzoic acid, 2-[(1-naphthalenylamino)carbonyl]- |
35725 |
Benzoic acid, 2-[(1-naphthalenylamino)carbonyl]-, monosodium salt |
17127226 |
Benzoic acid, 2-[(aminomethoxyphosphinothioyl)oxy]-, 1-methylethyl ester |
1714663 |
Benzoic acid, 2-[(chloroacetyl)amino]- |
17122250 |
Benzoic acid, 2-[[(3-methylphenyl)amino]carbonyl]- |
582718 |
Benzoic acid, 2-[[[[(4,6-dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, methyl ester |
602326 |
Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester |
582726 |
Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]-, methyl ester |
611475 |
Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]-, methyl ester |
17119207 |
Benzoic acid, 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]- |
595314 |
Benzoic acid, 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]-, methyl ester |
599522 |
Benzoic acid, 2-[[[[[4,6-bis(difluoromethoxy)-2-pyrimidinyl]amino]carbonyl]amino]sulfonyl]-, methyl ester |
698365 |
Benzoic acid, 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]-, methyl ester |
47746 |
Benzoic acid, 2-[[4-(dimethylamino)phenyl]azo]- |
231852 |
Benzoic acid, 2-[[ethoxy[(1-methylethyl)amino]phosphinothioyl]oxy]-, 1-methylethyl ester |
121434 |
Benzoic acid, 2-[3,6-bis(acetyloxy)-2,7-dichloro-9H-xanthen-9-yl]- |
592881 |
Benzoic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(or 5)-methyl-, methyl ester |
30445 |
Benzoic acid, 2-amino- |
11155 |
Benzoic acid, 2-amino-, ethyl ester |
36020 |
Benzoic acid, 2-amino-, methyl ester |
65490 |
Benzoic acid, 2-amino-5-chloro- |
130849 |
Benzoic acid, 2-amino-5-iodo- |
10405 |
Benzoic acid, 2-benzoyl- |
699587 |
Benzoic acid, 2-benzoyl-1-(1,1-dimethylethyl)hydrazide |
11924 |
Benzoic acid, 2-bromo- |
30437 |
Benzoic acid, 2-chloro- |
59782 |
Benzoic acid, 2-chloro-, methyl ester |
18796 |
Benzoic acid, 2-chloro-4-nitro- |
103697 |
Benzoic acid, 2-chloro-5-nitro- |
622985 |
Benzoic acid, 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]-, sodium salt |
45799 |
Benzoic acid, 2-fluoro- |
4523 |
Benzoic acid, 2-hydroxy- |
53397 |
Benzoic acid, 2-hydroxy-, 2-carboxyphenyl ester |
171694 |
Benzoic acid, 2-hydroxy-, 2-propenyl ester |
2634 |
Benzoic acid, 2-hydroxy-, compd. with (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-yl methylcarbamate (1:1) |
30296 |
Benzoic acid, 2-hydroxy-, ethyl ester |
138974 |
Benzoic acid, 2-hydroxy-, hexyl ester |
74666 |
Benzoic acid, 2-hydroxy-, hydrazide |
30635 |
Benzoic acid, 2-hydroxy-, methyl ester |
152009 |
Benzoic acid, 2-hydroxy-, methyl ester, sodium salt |
1743 |
Benzoic acid, 2-hydroxy-, monosodium salt |
30254 |
Benzoic acid, 2-hydroxy-, phenyl ester |
30270 |
Benzoic acid, 2-hydroxy-, phenylmethyl ester |
35964 |
Benzoic acid, 2-hydroxy-3,5-diiodo- |
59550 |
Benzoic acid, 2-hydroxy-3,5-dinitro- |
11940 |
Benzoic acid, 2-iodo- |
17273236 |
Benzoic acid, 2-iodosyl- |
55426 |
Benzoic acid, 2-methoxy- |
30429 |
Benzoic acid, 2-methyl- |
53280 |
Benzoic acid, 2-nitro- |
15461 |
Benzoic acid, 2-phenylethyl ester |
56176 |
Benzoic acid, 3-(acetylamino)- |
1714476 |
Benzoic acid, 3,3'-methylenebis[6-hydroxy- |
17163536 |
Benzoic acid, 3,4,5-trichloro- |
39966 |
Benzoic acid, 3,4,5-trihydroxy- |
18580 |
Benzoic acid, 3,4,5-trihydroxy-, methyl ester |
31930 |
Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
1347 |
Benzoic acid, 3,4-dichloro- |
116129 |
Benzoic acid, 3,4-dichloro-, 3-(2-methyl-1-piperidinyl)propyl ester |
17152778 |
Benzoic acid, 3,4-dichloro-, nickel salt |
685040 |
Benzoic acid, 3,4-dihydroxy- |
960807 |
Benzoic acid, 3,5-dichloro- |
18515 |
Benzoic acid, 3,5-dihydroxy- |
964239 |
Benzoic acid, 3,5-dimethyl-, 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide |
18663 |
Benzoic acid, 3,5-dinitro- |
94219 |
Benzoic acid, 3,6-dichloro-2-methoxy- |
1714755 |
Benzoic acid, 3,6-dichloro-2-methoxy-, (phenylimino)di-2,1-ethanediyl ester |
613646 |
Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with 2-(2-aminoethoxy)ethanol (1:1) |
99838 |
Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1) |
166215 |
Benzoic acid, 3,6-dichloro-2-methoxy-, potassium salt |
95117 |
Benzoic acid, 3,6-dichloro-2-methoxy-, sodium salt |
18465 |
Benzoic acid, 3-amino- |
55608 |
Benzoic acid, 3-amino-, ethyl ester |
73221 |
Benzoic acid, 3-amino-, ethyl ester, methanesulfonate |
1714632 |
Benzoic acid, 3-amino-, hydrazide |
35956 |
Benzoic acid, 3-amino-2,5-dichloro- |
148080 |
Benzoic acid, 3-amino-2,5-dichloro-, methyl ester |
77768 |
Benzoic acid, 3-amino-2,5-dichloro-, monoammonium salt |
94904 |
Benzoic acid, 3-amino-2,5-dichloro-, monosodium salt |
56010 |
Benzoic acid, 3-bromo- |
51185 |
Benzoic acid, 3-chloro- |
964544 |
Benzoic acid, 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]-, methyl ester |
46052 |
Benzoic acid, 3-fluoro- |
18473 |
Benzoic acid, 3-hydroxy- |
61390 |
Benzoic acid, 3-iodo- |
61481 |
Benzoic acid, 3-iodo-, methyl ester |
56069 |
Benzoic acid, 3-methoxy- |
964635 |
Benzoic acid, 3-methoxy-2-methyl-, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide |
18457 |
Benzoic acid, 3-methyl- |
32011 |
Benzoic acid, 3-nitro- |
1714370 |
Benzoic acid, 3-nitro-4-[(phenylsulfinyl)methyl]- |
1714314 |
Benzoic acid, 3-nitro-4-[(phenylsulfonyl)methyl]- |
1714307 |
Benzoic acid, 3-nitro-4-[(phenylthio)methyl]- |
1714375 |
Benzoic acid, 3-nitro-4-[[(4-nitrophenyl)sulfinyl]methyl]- |
1714319 |
Benzoic acid, 3-nitro-4-[[(4-nitrophenyl)sulfonyl]methyl]- |
1714313 |
Benzoic acid, 3-nitro-4-[[(4-nitrophenyl)thio]methyl]- |
31781 |
Benzoic acid, 3-sulfo- |
208850 |
Benzoic acid, 3-sulfo-, monosodium salt |
18259 |
Benzoic acid, 4-(1,1-dimethylethyl)- |
1714351 |
Benzoic acid, 4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-anthracenyl)- |
53835 |
Benzoic acid, 4-(acetylamino)- |
17163684 |
Benzoic acid, 4-(acetylamino)-2-ethoxy-, methyl ester |
1714453 |
Benzoic acid, 4-(acetyloxy)-3-nitro- |
17153743 |
Benzoic acid, 4-[(phenylsulfonyl)methyl]- |
1714373 |
Benzoic acid, 4-[[(4-aminophenyl)sulfinyl]methyl]-3-nitro- |
1714366 |
Benzoic acid, 4-[[(4-aminophenyl)sulfonyl]methyl]- |
1714317 |
Benzoic acid, 4-[[(4-aminophenyl)sulfonyl]methyl]-3-nitro- |
1714361 |
Benzoic acid, 4-[[(4-aminophenyl)thio]methyl]- |
1714310 |
Benzoic acid, 4-[[(4-aminophenyl)thio]methyl]-3-nitro- |
1714374 |
Benzoic acid, 4-[[(4-bromophenyl)sulfinyl]methyl]-3-nitro- |
1714368 |
Benzoic acid, 4-[[(4-bromophenyl)sulfonyl]methyl]- |
1714318 |
Benzoic acid, 4-[[(4-bromophenyl)sulfonyl]methyl]-3-nitro- |
1714362 |
Benzoic acid, 4-[[(4-bromophenyl)thio]methyl]- |
1714312 |
Benzoic acid, 4-[[(4-bromophenyl)thio]methyl]-3-nitro- |
1714367 |
Benzoic acid, 4-[[(4-chlorophenyl)sulfonyl]methyl]- |
1714311 |
Benzoic acid, 4-[[(4-chlorophenyl)thio]methyl]-3-nitro- |
1714372 |
Benzoic acid, 4-[[(4-methoxyphenyl)sulfinyl]methyl]-3-nitro- |
1714365 |
Benzoic acid, 4-[[(4-methoxyphenyl)sulfonyl]methyl]- |
1714316 |
Benzoic acid, 4-[[(4-methoxyphenyl)sulfonyl]methyl]-3-nitro- |
1714360 |
Benzoic acid, 4-[[(4-methoxyphenyl)thio]methyl]- |
1714309 |
Benzoic acid, 4-[[(4-methoxyphenyl)thio]methyl]-3-nitro- |
1714371 |
Benzoic acid, 4-[[(4-methylphenyl)sulfinyl]methyl]-3-nitro- |
1714364 |
Benzoic acid, 4-[[(4-methylphenyl)sulfonyl]methyl]- |
1714315 |
Benzoic acid, 4-[[(4-methylphenyl)sulfonyl]methyl]-3-nitro- |
1714308 |
Benzoic acid, 4-[[(4-methylphenyl)thio]methyl]-3-nitro- |
1714369 |
Benzoic acid, 4-[[(4-nitrophenyl)sulfonyl]methyl]- |
1714363 |
Benzoic acid, 4-[[(4-nitrophenyl)thio]methyl]- |
39974 |
Benzoic acid, 4-amino- |
1271 |
Benzoic acid, 4-amino-, 2-(diethylamino)ethyl ester, monohydrochloride |
15271 |
Benzoic acid, 4-amino-, ethyl ester |
4002 |
Benzoic acid, 4-amino-2-hydroxy- |
35824 |
Benzoic acid, 4-amino-2-hydroxy-, monosodium salt |
1714562 |
Benzoic acid, 4-amino-2-hydroxy-, phenyl ester |
56101 |
Benzoic acid, 4-bromo- |
5025 |
Benzoic acid, 4-chloro- |
17153461 |
Benzoic acid, 4-chloro-, (4-chlorophenyl)methyl ester |
617555 |
Benzoic acid, 4-chloro-, 2-benzoyl-2-(1,1-dimethylethyl)hydrazide |
79376 |
Benzoic acid, 4-chloro-, methyl ester |
17111 |
Benzoic acid, 4-chloro-3-nitro- |
1714408 |
Benzoic acid, 4-cyano-, methyl ester |
61804 |
Benzoic acid, 4-ethoxy- |
46086 |
Benzoic acid, 4-fluoro- |
19059 |
Benzoic acid, 4-hydroxy- |
15354 |
Benzoic acid, 4-hydroxy-, butyl ester |
18911 |
Benzoic acid, 4-hydroxy-, methyl ester |
15321 |
Benzoic acid, 4-hydroxy-, phenylmethyl ester |
61432 |
Benzoic acid, 4-hydroxy-3,5-diiodo- |
50567 |
Benzoic acid, 4-hydroxy-3,5-dimethoxy- |
31674 |
Benzoic acid, 4-hydroxy-3-methoxy- |
61713 |
Benzoic acid, 4-iodo- |
19174 |
Benzoic acid, 4-methoxy- |
12351 |
Benzoic acid, 4-methoxy-3-nitro- |
19042 |
Benzoic acid, 4-methyl- |
60426 |
Benzoic acid, 4-methylphenyl ester |
3558 |
Benzoic acid, 4-nitro- |
18929 |
Benzoic acid, 4-nitro-, ethyl ester |
61697 |
Benzoic acid, 4-nitro-, methyl ester |
285809 |
Benzoic acid, 5-(2,4-dichlorophenoxy)-2-nitro-, methyl ester |
288944 |
Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro- |
589374 |
Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester |
325225 |
Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, sodium salt |
12450 |
Benzoic acid, 5-amino-2-hydroxy- |
1714288 |
Benzoic acid, 5-bromo-2-hydroxy-3-nitro- |
42275 |
Benzoic acid, 5-chloro-2-hydroxy- |
17295478 |
Benzoic acid, 6-formyl-2,3-dimethoxy |
1714566 |
Benzoic acid, amino-, ethyl ester |
17127614 |
Benzoic acid, anhydride with 3-chloro-N-ethoxy-2,6-dimethoxybenzenecarboximidic acid |
15149 |
Benzoic acid, ethyl ester |
145235 |
Benzoic acid, hexyl ester |
1714571 |
Benzoic acid, methoxy- |
14969 |
Benzoic acid, methyl ester |
17152679 |
Benzoic acid, p-chloro-, nickel salt |
1714279 |
Benzoic acid, pentachloro- |
31237 |
Benzoic acid, phenylmethyl ester |
50773 |
Benzoic acid, sodium salt |
19455 |
Benzonitrile |
17294885 |
Benzonitrile, 2-(trifluoromethyl)- |
17153537 |
Benzonitrile, 2,3,5,6-tetrafluoro-4-hydroxy- |
690636 |
Benzonitrile, 2,3,5,6-tetrafluoro-4-nitro- |
80754 |
Benzonitrile, 2,6-dichloro- |
136176 |
Benzonitrile, 2-amino-5-chloro- |
17151937 |
Benzonitrile, 2-bromo-3,4,5,6-tetrafluoro- |
17273384 |
Benzonitrile, 3-(trifluoromethyl)- |
90837 |
Benzonitrile, 3,5-dibromo-4-hydroxy- |
17123415 |
Benzonitrile, 3,5-dichloro-4-hydroxy- |
61614 |
Benzonitrile, 3-nitro- |
17152869 |
Benzonitrile, 4-amino-2,3,5,6-tetrafluoro- |
62679 |
Benzonitrile, 4-chloro- |
80747 |
Benzonitrile, 4-fluoro- |
69856 |
Benzonitrile, 4-hydroxy- |
687103 |
Benzonitrile, 4-hydroxy-3,5-diiodo- |
17124017 |
Benzonitrile, 4-hydroxy-3,5-diiodo-, sodium salt |
17152125 |
Benzonitrile, 4-hydroxy-3-iodo-5-nitro- |
22392 |
Benzonitrile, 4-methyl- |
61754 |
Benzonitrile, 4-nitro- |
70227 |
Benzonitrile, pentafluoro- |
15925 |
Benzothiazole |
31401 |
Benzothiazole, 2,2'-dithiobis- |
122887 |
Benzothiazole, 2-[(2,4-dinitrophenyl)thio]- |
108118 |
Benzoxazole, 2,2'-(2,5-thiophenediyl)bis- |
18358 |
Benzoyl chloride |
32094 |
Benzoyl chloride, 4-nitro- |
17113580 |
Berberis trifoliolata, Moric |
17113598 |
Berberis x ottawensis |
1874908 |
Berosus |
1874916 |
Berosus exiguus |
1874924 |
Berosus infuscatus |
1874957 |
Berosus styliferus |
155440 |
Beryllium chloride (BeCl2) |
185363 |
Beryllium hydroxide (Be(OH)2) |
17109588 |
Beta vulgaris |
17108937 |
Beta vulgaris cicla |
17103219 |
Beta vulgaris vulgaris |
17081530 |
Betta splendens |
17103227 |
Betula alleghaniensis |
17103235 |
Betula papyrifera |
17103243 |
Betula pendula |
17110289 |
Betula sp. |
17153818 |
B-Free |
99069 |
Bi-2,4-cyclopentadien-1-yl, 1,1',2,2',3,3',4,4',5,5'-decachloro- |
48124 |
Bicyclo[2.2.1]hept-2-ene |
250407 |
Bicyclo[2.2.1]hept-2-ene, heptachloro- |
92254 |
Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, dibutyl ester |
92288 |
Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, dimethyl ester |
97790 |
Bicyclo[2.2.1]hept-5-ene-2,3-dimethanol, 1,4,5,6,7,7-hexachloro- |
31724 |
Bicyclo[2.2.1]hepta-2,5-diene |
115287 |
Bicyclo[2.2.1]hepta-2,5-diene, 1,2,3,4,7,7-hexachloro- |
48033 |
Bicyclo[2.2.1]heptan-2-ol, (1R,2R,4S)-rel- |
46565 |
Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1S,2R,4S)- |
6205 |
Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl- |
46581 |
Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, (1R,4R)- |
46573 |
Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, (1S,4S)- |
1714585 |
Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, oxime |
6239 |
Bicyclo[2.2.1]heptan-2-one, 3-bromo-1,7,7-trimethyl- |
17273137 |
Bicyclo[2.2.1]heptane |
8037 |
Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene- |
134932 |
Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene-, (1R,4S)- |
134940 |
Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene-, (1S,4R)- |
17121377 |
Bicyclo[2.2.1]heptane-2-carbonitrile, 5-chloro-6-[[[(methylamino)carbonyl]oxy]imino]-, (1R,2S,4S,5S)-rel- |
199067 |
Bicyclo[2.2.1]heptane-2-carbonitrile, 5-chloro-6-[[[(methylamino)carbonyl]oxy]imino]-, (1S,2R,4R,5R,6E)- |
79327 |
Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)- |
8425 |
Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl- |
34546 |
Bicyclo[3.1.1]hept-2-ene-2-ethanol, 6,6-dimethyl- |
213330 |
Bicyclo[3.1.1]hept-3-en-2-ol, 4,6,6-trimethyl-, (1S,2S,5S)- |
128488 |
Bicyclo[3.1.1]heptan-2-ol, 2,6,6-trimethyl-, (1R,2S,5S)-rel- |
46904 |
Bicyclo[3.1.1]heptane, 2,6,6-trimethyl- |
1714297 |
Bicyclo[3.1.1]heptane, 2,6,6-trimethyl-, (1S,2S,5S)- |
84962 |
Bicyclo[3.1.1]heptane, 2,6,6-trimethyl-, didehydro deriv. |
34421 |
Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene- |
210989 |
Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene-, (1S,5S)- |
17151689 |
Bicyclo[3.2.1]oct-6-ene-6-carboxaldehyde, 8-(hydroxymethyl)-1,7-dimethyl-4-(1-methylethyl)-, (1R,4R,5S,8S)- |
17151697 |
Bicyclo[3.2.1]oct-6-ene-6-carboxylic acid, 8-(hydroxymethyl)-1,7-dimethyl-4-(1-methylethyl)-, (1R,4R,5S,8S)- |
187211 |
Bicyclo[4.1.0]hept-3-ene, 3,7,7-trimethyl- |
17101353 |
Biddulphia mobiliensis |
17109042 |
Bidens bipinnata |
17103250 |
Bidens pilosa |
17080730 |
Bidessinae |
17086992 |
Bidyanus bidyanus |
17152398 |
Biocat 145 |
1908524 |
Biomphalaria |
17077116 |
Biomphalaria alexandrina |
1908532 |
Biomphalaria glabrata |
1908540 |
Biomphalaria havanensis |
17091174 |
Biomphalaria pfeifferi |
17091729 |
Biomphalaria straminea |
17091737 |
Biomphalaria tenagophila |
17152406 |
Bioorganic |
1714601 |
Biosolve |
1714602 |
Bioversal |
17097247 |
Biscirus sp. |
82222 |
Bismuth oxide (Bi2O3) |
181081 |
Bismuth sodium oxide (BiNaO3) |
219527 |
Bismuth, tris(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
58545 |
Bismuthine, triphenyl- |
1714493 |
Bisoflex L 79P |
17093311 |
Bithynia sp. |
1919901 |
Bithynia tentaculata |
17093923 |
Bitylenchus sp. |
1903426 |
Bivalvia |
17086596 |
Blarina brevicauda |
1714543 |
Blast (insecticide) |
17119116 |
Blasticidin |
17089954 |
Blatta orientalis |
17089962 |
Blattella germanica |
1898527 |
Blenniidae |
17077983 |
Blennius pholis |
17080623 |
Blepharisma |
17087917 |
Blepharisma americanum |
17086075 |
Blepharisma intermedium |
1866482 |
Boccardia |
17096611 |
Boeckella delicata |
17086083 |
Boeckosimus edwardsi |
17088212 |
Boleophthalmus dentatus |
17085192 |
Boleophthalmus dussumieri |
1919950 |
Bombycilla cedrorum |
1919968 |
Bonasa umbellus |
152132 |
Borane, trifluoro- |
17119108 |
Borate(2-), heptaoxotetra- |
82156 |
Borax (B4Na2O7.10H2O) |
173252 |
Boric acid |
167148 |
Boric acid (H3BO3) |
67587 |
Boric acid (H3BO3), tributyl ester |
189928 |
Boric acid (HBO2), barium salt |
153791 |
Boric acid (HBO2), sodium salt |
85548 |
Boric acid, sodium salt |
85241 |
Boric acid, zinc salt |
150011 |
Boron |
82149 |
Boron oxide (B2O3) |
85027 |
Boron sodium oxide (B4Na2O7) |
181677 |
Boron sodium oxide (B8Na2O13), tetrahydrate |
148528 |
Boron, trihydro(2-methyl-2-propanamine)-, (T-4)- |
18291 |
Boronic acid, phenyl- |
17089269 |
Bos taurus |
1868892 |
Bosmina |
1868900 |
Bosmina coregoni |
17090127 |
Bosmina fatalis |
1868918 |
Bosmina longirostris |
1868884 |
Bosminidae |
17103268 |
Bothriochloa ischaemum |
17091745 |
Bothromesostoma essenii |
17093329 |
Bothropolys multidentatus |
17100462 |
Botrydium becherianum |
17090135 |
Botrylloides leachi |
1920008 |
Botryllus schlosseri |
17103276 |
Bougainvillea spectabilis |
17103284 |
Bouteloua curtipendula |
17103292 |
Bouteloua gracilis |
1714397 |
BP 1002 |
17152414 |
BP 1100X-AB |
17103318 |
Brachiaria plantaginea |
17103326 |
Brachiaria platyphylla |
17103334 |
Brachiaria ramosa |
17080326 |
Brachidontes recurves |
17096645 |
Brachidontes striatulus |
17082553 |
Brachidontes variabilis |
17101254 |
Brachiomonas submarina |
1915149 |
Brachionus |
1920040 |
Brachionus angularis |
17081886 |
Brachionus bidentata |
1920057 |
Brachionus budapestinensis |
1920065 |
Brachionus calyciflorus |
17086091 |
Brachionus patulus |
1920099 |
Brachionus plicatilis |
1920107 |
Brachionus quadridentatus |
17085226 |
Brachionus rubens |
1920115 |
Brachionus urceolaris |
1897115 |
Brachiopoda |
1881861 |
Brachycentrus |
1881879 |
Brachycentrus americanus |
1881887 |
Brachycentrus numerosus |
1881895 |
Brachycentrus occidentalis |
17080268 |
Brachycentrus subnulis |
17097296 |
Brachychthonius berlesei |
17081241 |
Brachydeutra argentata |
17093691 |
Brachypylina |
17091778 |
Brachythermis contaminata |
763029 |
Braconidae |
17100256 |
Bracteacoccus cinnabarinus |
17091760 |
Branchinecta longiantenna |
17091059 |
Branchiopoda |
17084427 |
Branchiostoma belcheri |
1897917 |
Branchiostoma caribaeum |
1897891 |
Branchiostomidae |
1860154 |
Branchiura sowerbyi |
1920156 |
Branta canadensis |
17113606 |
Brassaia actinophylla |
17103342 |
Brassica alboglabra |
17103359 |
Brassica carinata |
17103367 |
Brassica chinensis |
17113614 |
Brassica hirta |
17103375 |
Brassica juncea |
17103383 |
Brassica napus |
17116229 |
Brassica napus . napus |
17103391 |
Brassica nigra |
17103409 |
Brassica oleracea |
17103417 |
Brassica oleracea botrytis |
17103425 |
Brassica oleracea capitata |
17103433 |
Brassica oleracea gemmifera |
17112012 |
Brassica oleracea italica |
17103441 |
Brassica rapa |
17111527 |
Brassica rapa rapa |
17109414 |
Brassica rapa sarson |
17109596 |
Brassica sp. |
1714603 |
Breaker 4 |
1920172 |
Brevoortia patronus |
17094665 |
Brevoortia sp. |
1899707 |
Brevoortia tyrannus |
17111667 |
Briza media |
1714670 |
Bromamide |
650705 |
Bromate |
153387 |
Bromic acid, potassium salt |
155804 |
Bromic acid, sodium salt |
153072 |
Bromine |
192104 |
Bromine chloride (BrCl) |
17153974 |
Bromocide |
17103458 |
Bromus arvensis |
17103524 |
Bromus catharticus |
17103466 |
Bromus commutatus |
17103490 |
Bromus hordeaceus |
17103474 |
Bromus inermis |
17103482 |
Bromus japonicus |
17112905 |
Bromus sp. |
17103508 |
Bromus sterilis |
17103516 |
Bromus tectorum |
17096447 |
Brotia sp. |
17110834 |
Brunnichia ovata |
17083072 |
Bryconamericus boops |
17115908 |
Bryophyta |
17116740 |
Bryopsis maxima |
17099540 |
Bryopsis plumosa |
299123 |
BTC 776 |
159913 |
BTC 927 |
1920230 |
Bubo virginianus |
1920248 |
Bubulcus ibis |
1967561 |
Buccinum undatum |
17103557 |
Buchloe dactyloides |
1885094 |
Buenoa |
17078155 |
Bufo americanus |
17090739 |
Bufo americanus americanus |
17079930 |
Bufo arenarum |
17080029 |
Bufo boreas |
17081258 |
Bufo boreas halophilus |
17079617 |
Bufo bufo |
17083601 |
Bufo bufo gargarizans |
17077819 |
Bufo bufo japonicus |
17094632 |
Bufo canorus |
17080458 |
Bufo marinus |
17079740 |
Bufo melanostictus |
17075920 |
Bufo quercicus |
17089798 |
Bufo terrestris |
17081910 |
Bufo vulgaris |
17079377 |
Bufo vulgaris formosus |
17090408 |
Bufo woodhousei |
17078148 |
Bufo woodhousei fowleri |
17088006 |
Bulinus globosus |
17095498 |
Bulinus nasutus |
17076134 |
Bulinus tropicus |
17077124 |
Bulinus truncatus |
17075599 |
Bullia digitalis |
17084492 |
Bullia rhodostoma |
17100421 |
Bumilleria exilis |
17100645 |
Bumilleriopsis filiformis |
1965771 |
Bunodactis stella |
17094368 |
Bunonema sp. |
17082801 |
Bursaria |
1908078 |
Bursatella leachii |
1967629 |
Busycotypus canaliculatus |
33134 |
Butanal |
16667 |
Butanal, 2-methyl- |
56705 |
Butanal, 3-methyl- |
52100 |
Butanamide |
133785 |
Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(4-chloro-2,5-dimethoxyphenyl)-3-oxo- |
121715 |
Butanamide, 2-chloro-N-methyl-3-oxo- |
20529 |
Butanamide, 3-oxo-N-phenyl- |
39099 |
Butane, 1,1'-oxybis- |
52688 |
Butane, 1,1'-oxybis[3-methyl- |
88120 |
Butane, 1,2,3,4-tetrabromo- |
65235 |
Butane, 1,2,3-tribromo- |
24612 |
Butane, 1,3-dibromo- |
26757 |
Butane, 1,4-dichloro- |
26013 |
Butane, 1-bromo- |
26054 |
Butane, 1-chloro- |
52076 |
Butane, 1-iodo-3-methyl- |
27466 |
Butane, 1-isocyanato- |
57257 |
Butane, 1-isothiocyanato- |
49510 |
Butane, 2-iodo- |
75663 |
Butane, 2-methoxy-2-methyl- |
7310 |
Butane, 2-methyl- |
17272733 |
Butanediamide, N'-[5-[[4-[[5-(acetylhydroxyamino)pentyl]amino]-1,4-dioxobutyl]hydroxyamino]pentyl]-N-(5-aminopentyl)-N-hydroxy- |
26435 |
Butanedioic acid |
687087 |
Butanedioic acid, ((dimethoxyphosphinyl)thio)-, diethyl ester |
265819 |
Butanedioic acid, (carboxymethoxy)-, trisodium salt |
31922 |
Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, diethyl ester |
699546 |
Butanedioic acid, 2-(1,2-dicarboxyethoxy)-3-hydroxy-, tetrasodium salt |
699553 |
Butanedioic acid, 2,3-bis(1,2-dicarboxyethoxy)-, hexasodium salt |
1714479 |
Butanedioic acid, 2,3-bis(1,2-dicarboxyethoxy)-, hexasodium salt, mixt. with 2-(1,2-dicarboxyethoxy)-3-hydroxybutanedioic acid tetrasodium salt |
11353 |
Butanedioic acid, 2,3-dihydroxy- (2R,3R)- |
70920 |
Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, copper(2+) salt (1:1) |
11486 |
Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, diethyl ester |
72454 |
Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, disodium salt |
650150 |
Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-rel- |
1714306 |
Butanedioic acid, bis(phenylmethyl) ester |
37994 |
Butanedioic acid, cadmium salt (1:1) |
38026 |
Butanedioic acid, dibutyl ester |
32854 |
Butanedioic acid, diethyl ester |
40147 |
Butanedioic acid, disodium salt |
145912 |
Butanedioic acid, hydroxy- |
17483 |
Butanedioic acid, hydroxy-, (2S)- |
1714598 |
Butanedioic acid, hydroxy-, disodium salt, (S)- |
4655 |
Butanedioic acid, mercapto- |
17475 |
Butanedioic acid, methylene- |
89227 |
Butanedioic acid, mono(2,2-dimethylhydrazide) |
123786 |
Butanedioic acid, mono[(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-yl] ester |
55251 |
Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt |
89979 |
Butanedioic acid, sulfo-, 1,4-dioctyl ester, sodium salt |
44552 |
Butanedioic acid, tetrafluoro- |
64287 |
Butanenitrile, 4-chloro- |
24729 |
Butanoic acid |
17122474 |
Butanoic acid, 2,2,2-trichloro-1-(dimethoxyphosphinyl)ethyl ester |
17124348 |
Butanoic acid, 2,6-dibromo-4-cyanophenyl ester |
107854 |
Butanoic acid, 2-amino- |
17119215 |
Butanoic acid, 2-amino-4-(hydroxymethylphosphinyl)- |
589234 |
Butanoic acid, 2-amino-4-(hydroxymethylphosphinyl)-, monoammonium salt |
1714684 |
Butanoic acid, 2-amino-4-(methylseleno)- |
11544 |
Butanoic acid, 2-ethyl- |
17273194 |
Butanoic acid, 2-hydroxy-2-[(1R)-1-methoxyethyl]-3-methyl-, [(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methyl ester, (2S)- |
29496 |
Butanoic acid, 2-methyl- |
1714596 |
Butanoic acid, 2-phenoxy- |
77339 |
Butanoic acid, 3,3-dimethyl- |
94888 |
Butanoic acid, 3-chloro- |
48611 |
Butanoic acid, 3-methyl- |
53868 |
Butanoic acid, 3-methyl-, methyl ester |
38588 |
Butanoic acid, 3-oxo-, ethyl ester |
960872 |
Butanoic acid, 4-(2,4,5-trichlorophenoxy)- |
15701 |
Butanoic acid, 4-(2,4-dichlorophenoxy)- |
107003 |
Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
15693 |
Butanoic acid, 4-(4-chloro-2-methylphenoxy)- |
1714325 |
Butanoic acid, 4-(4-chloro-2-methylphenoxy)-, ethyl ester |
137240 |
Butanoic acid, 4-(4-chloro-2-methylphenoxy)-, sodium salt |
1714429 |
Butanoic acid, 4-oxo-4-[[4-[(2-thiazolylamino)sulfonyl]phenyl]amino]- |
25718 |
Butanoic acid, butyl ester |
22863 |
Butanoic acid, ethyl ester |
44370 |
Butanoic acid, heptafluoro- |
62851 |
Butanoic acid, methyl ester |
22962 |
Butanoic acid, propyl ester |
40436 |
Butanoic acid, sodium salt |
711796 |
Butanol |
161455 |
Butene, homopolymer |
52466398 |
-Butenoic acid, 3-methyl-, 2-(1-methylpropyl)-4,6-dinitrophenyl ester |
1920313 |
Buteo jamaicensis |
17103565 |
Butia capitata |
17089806 |
Butorides virescens |
17103573 |
Buxus microphylla |
17103581 |
Buxus sempervirens |
134072 |
C.I. Acid Black 52 |
1714475 |
C.I. Acid Violet 66 |
157453 |
C.I. Acid Yellow 3 |
305235 |
C.I. Basic Blue 3 |
157438 |
C.I. Basic Violet 1 |
84244 |
C.I. Direct Yellow 11 |
157560 |
C.I. Direct Yellow 28 |
102962 |
C.I. Disperse Blue 3 |
84400 |
C.I. Pigment Blue 10 |
173666 |
C.I. Pigment Green 21 |
157461 |
C.I. Solvent Blue 7 |
157354 |
C.I. Solvent Yellow 33 |
84525 |
C.I. Sulphur Black 1 |
84814 |
C.I. Vat Blue 43 |
17095357 |
Caddo agilis |
195255 |
Cadmate(2-), tetrakis(cyano-.kappa.C)-, dipotassium, (T-4)- |
150029 |
Cadmium |
155846 |
Cadmium bromide (CdBr2) |
168096 |
Cadmium chloride (CdCl2) |
52464 |
Cadmium cyanide (Cd(CN)2) |
156323 |
Cadmium iodide (CdI2) |
82313 |
Cadmium oxide (CdO) |
82321 |
Cadmium sulfide (CdS) |
1895275 |
Caecidotea militaris |
1869932 |
Caenidae |
1869973 |
Caenis |
1870005 |
Caenis diminuta |
17088576 |
Caenis horaria |
17083171 |
Caenis luctuosa |
17080821 |
Caenis maxima |
17090572 |
Caenis moesta |
17080201 |
Caenis robusta |
1920412 |
Caenis tardata |
17087008 |
Caenorhabditis elegans |
17110701 |
Caesalpinia decapetala |
17089160 |
Caiman latirostris |
17103599 |
Cajanus cajan |
17096637 |
Calamoecia lucasi |
17096629 |
Calamoecia sp. |
1869403 |
Calanoida |
17076845 |
Calanus |
17081969 |
Calanus finmarchicus |
17082678 |
Calanus helgolandicus |
17076910 |
Calanus plumchrus |
17096116 |
Calathus fuscipes |
17096124 |
Calathus melanocephalus |
1714480 |
Calciate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, dihydrogen, (OC-6-21)- |
3574 |
Calciate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
179309 |
Calciate(3-), [N-[2-[bis[(carboxy-.kappa.O)methyl]amino-.kappa.N]ethyl]-N-[2-[[(carboxy-.kappa.O)methyl](carboxymethyl)amino-.kappa.N]ethyl]glycinato(5-)-.kappa.N]-, trisodium |
150268 |
Calcium |
155838 |
Calcium bromide (CaBr2) |
167155 |
Calcium chloride (CaCl2) |
156026 |
Calcium fluoride (CaF2) |
82255 |
Calcium hydroxide (Ca(OH)2) |
82263 |
Calcium oxide (CaO) |
86256 |
Calcium sulfide (Ca(Sx)) |
693440 |
Calcium, dichloro(5-chloro-2-methyl-3(2H)-isothiazolone-O)-, Mixt. with dichloro(2-methyl-3(2H)-isothiazolone-O)calcium |
17103607 |
Calendula officinalis |
17094392 |
Caligus elongatus |
1887975 |
Calineuria californica |
17118712 |
Callianassa australiensis |
17080748 |
Callianassa californiensis |
17087750 |
Callianassa tyrrhena |
1870583 |
Callibaetis |
1870609 |
Callibaetis ferrugineus |
17084146 |
Callibaetis skokianus |
17090143 |
Callichthys callichthys |
1890573 |
Callinectes ornatus |
1890581 |
Callinectes sapidus |
1890599 |
Callinectes similis |
17097502 |
Callinectes sp. |
17086604 |
Callipepla californica |
17113630 |
Callirhoe digitata |
17079047 |
Callista maculata |
17103615 |
Callistemon citrinus |
17099557 |
Callithamnion corymbosum |
17116450 |
Callitriche heterophylla |
17099854 |
Callitriche platycarpa |
17101445 |
Callitriche stagnalis |
17103623 |
Calluna vulgaris |
17096868 |
Callyspongia diffusa |
17103631 |
Calophyllum inophyllum |
17095803 |
Calopteryx atrata |
1888593 |
Calopteryx maculata |
17087925 |
Calopteryx splendens |
17097148 |
Calosoma sp. |
17111469 |
Calothrix |
17100355 |
Calothrix anomala |
17099862 |
Calothrix braunii |
17100819 |
Calothrix elenkinii |
17100736 |
Calothrix membranacea |
17100066 |
Calothrix parietina |
17111675 |
Caltha palustris |
17110487 |
Calystegia sepium |
1891621 |
Cambarellus |
1891613 |
Cambaridae |
1891647 |
Cambarus |
17079260 |
Cambarus acuminatus |
17086018 |
Cambarus bartoni |
17076415 |
Cambarus latimanus |
17080763 |
Cambarus robustus |
17103649 |
Camellia japonica |
17103656 |
Camellia sinensis |
17113648 |
Camellia sp. |
17094509 |
Camisia biurus |
17075367 |
Campanularis flexuosa |
1915792 |
Campeloma decisum |
1900166 |
Campostoma anomalum |
17103664 |
Campsis radicans |
1920644 |
Camptocercus rectirostris |
17117607 |
Campylospora chaetocladia |
17117730 |
Campylospora sp. |
17103672 |
Canavalia ensiformis |
1951367 |
Cancer anthonyi |
1920677 |
Cancer irroratus |
52452810 |
Cancer magister |
17082850 |
Cancer pagurus |
1951318 |
Cancer productus |
1714625 |
Candicidin A |
1714626 |
Candicidin B |
17089236 |
Canis familiaris |
17086612 |
Canis latrans |
17103680 |
Canna indica |
17103698 |
Cannabis sativa |
17095613 |
Cantharidae |
17118779 |
Canthocamptus |
17113655 |
Caperonia castaneifolia |
1861806 |
Capitella |
1861814 |
Capitella capitata |
1887074 |
Capnia |
17089517 |
Capra hincus |
17109422 |
Capsella bursa-pastoris |
1972900 |
Capsicum annuum |
1872274 |
Carabidae |
17103706 |
Caragana arborescens |
1900182 |
Carassius |
1900190 |
Carassius auratus |
17086034 |
Carassius auratus gibelio |
17088220 |
Carassius auratus langsdorfi |
17074451 |
Carassius carassius |
17094681 |
Carassius cuvieri |
749036 |
Carbamic acid, (1,1-dimethylethyl)-, 3-[[(dimethylamino)carbonyl]amino]phenyl ester |
17152018 |
Carbamic acid, (2,2,2-trichloroethylidene)-, ethyl ester |
748988 |
Carbamic acid, (3,4-dichlorophenyl)-, methyl ester |
961565 |
Carbamic acid, (3-chlorophenyl)-, 1-methyl-2-propynyl ester |
19984 |
Carbamic acid, (3-chlorophenyl)-, 1-methylethyl ester |
20016 |
Carbamic acid, (3-chlorophenyl)-, 4-chloro-2-butynyl ester |
189811 |
Carbamic acid, (3-methylphenyl)-, 3-[(methoxycarbonyl)amino]phenyl ester |
99234 |
Carbamic acid, (4-chlorophenyl)-, 1-methylethyl ester |
962985 |
Carbamic acid, (5-benzoyl-1H-benzimidazol-2-yl)-, methyl ester |
17004755 |
Carbamic acid, (5-butyl-1H-benzimidazol-2-yl)-, methyl ester |
114744 |
Carbamic acid, [(4-aminophenyl)sulfonyl]-, methyl ester |
17126210 |
Carbamic acid, [(4-aminophenyl)sulfonyl]-, methyl ester, monopotassium salt |
99846 |
Carbamic acid, [(4-aminophenyl)sulfonyl]-, methyl ester, monosodium salt |
303842 |
Carbamic acid, [(dibutylamino)thio]methyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
224279 |
Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, diethyl ester |
224261 |
Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis-, dimethyl ester |
209593 |
Carbamic acid, [1-[(butylamino)carbonyl]-1H-benzimidazol-2-yl]-, methyl ester |
563650 |
Carbamic acid, [2-(4-phenoxyphenoxy)ethyl]-, ethyl ester |
226381 |
Carbamic acid, [3-(dimethylamino)propyl]-, propyl ester |
233569 |
Carbamic acid, [3-(dimethylamino)propyl]-, propyl ester, monohydrochloride |
189803 |
Carbamic acid, [3-[[(phenylamino)carbonyl]oxy]phenyl]-, ethyl ester |
1714678 |
Carbamic acid, [5-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]-, methyl ester, mixt. with 1,4,5,6-tetrahydro-1-methyl-2-[(1E)-2-(2-thienyl)ethenyl]pyrimidine (2R,3R)-2,3-dihydroxybutanedioate (1:1) |
326652 |
Carbamic acid, 1H-benzimidazol-2-yl-, 2-(2-ethoxyethoxy)ethyl ester |
172767 |
Carbamic acid, 1H-benzimidazol-2-yl-, methyl ester |
294686 |
Carbamic acid, 1H-benzimidazol-2-yl-, methyl ester, phosphate (1:1) |
304113 |
Carbamic acid, butyl-, 3-iodo-2-propynyl ester |
1714530 |
Carbamic acid, cyclohexyl-, 2-hydroxyethyl ester |
66407 |
Carbamic acid, dimethyl-, 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl ester |
223123 |
Carbamic acid, dimethyl-, 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl ester |
30643 |
Carbamic acid, dimethyl-, 3-methyl-1-(1-methylethyl)-1H-pyrazol-5-yl ester |
17122284 |
Carbamic acid, dimethyl-, 3-methyl-1-phenyl-1H-pyrazol-5-yl ester |
960997 |
Carbamic acid, dimethyl-, 5,5-dimethyl-3-oxo-1-cyclohexen-1-yl ester |
17123712 |
Carbamic acid, dimethyl-, 6-methyl-2-propyl-4-pyrimidinyl ester |
1495 |
Carbamic acid, ethyl ester |
62984 |
Carbamic acid, ethyl-, ethyl ester |
709121 |
Carbamic acid, ethylnitroso-, ethyl ester |
58099 |
Carbamic acid, methyl ester |
120287 |
Carbamic acid, methyl-, 2-chlorophenyl ester |
79467 |
Carbamic acid, methyl-, 3-methylphenyl ester |
17123837 |
Carbamic acid, methyl-, 4-chlorophenyl ester |
60764 |
Carbamic acid, methylnitroso-, ethyl ester |
78162 |
Carbamic acid, monoammonium salt |
32276 |
Carbamic acid, phenyl-, 1-methylethyl ester |
20511 |
Carbamic acid, phenyl-, ethyl ester |
9456 |
Carbamic chloride, diphenyl- |
2030 |
Carbamimidothioic acid, 2-aminoethyl ester, dihydrobromide |
104174 |
Carbamimidothioic acid, 2-propenyl ester, monohydrochloride |
17152133 |
Carbamimidothioic acid, decyl ester, monohydriodide |
17152141 |
Carbamimidothioic acid, dodecyl ester, monohydriodide |
17152158 |
Carbamimidothioic acid, hexadecyl ester, monohydrobromide |
99481 |
Carbamimidothioic acid, methyl ester, sulfate |
1714671 |
Carbamimidothioic acid, methyl ester, sulfate (1:1) |
51532 |
Carbamimidothioic acid, phenylmethyl ester, monohydrochloride |
27631 |
Carbamodithioic acid, 1,2-ethanediylbis- |
116814 |
Carbamodithioic acid, 1,2-ethanediylbis-, diammonium salt |
38844 |
Carbamodithioic acid, 1,2-ethanediylbis-, disodium salt |
224725 |
Carbamodithioic acid, bis(2-hydroxyethyl)-, monopotassium salt |
17132887 |
Carbamodithioic acid, cyano-, disodium salt, mixt. with 1,2-ethanediamine and methylcarbamodithioic acid monopotassium salt |
36616 |
Carbamodithioic acid, dibutyl-, sodium salt |
39685 |
Carbamodithioic acid, diethyl- |
15867 |
Carbamodithioic acid, diethyl-, 2-chloro-2-propenyl ester |
39727 |
Carbamodithioic acid, diethyl-, sodium salt |
34454 |
Carbamodithioic acid, dimethyl-, potassium salt |
34462 |
Carbamodithioic acid, dimethyl-, sodium salt |
17121500 |
Carbamodithioic acid, dimethyl-, sodium salt, mixt. with 2(3H)-benzothiazolethione sodium salt |
39388 |
Carbamodithioic acid, dimethyl-, tetraanhydrosulfide with orthothioselenious acid |
36962 |
Carbamodithioic acid, methyl-, monopotassium salt |
36970 |
Carbamodithioic acid, methyl-, monosodium salt |
775916 |
Carbamodithioic acid, methyl-, monosodium salt, dihydrate |
99903 |
Carbamothioic acid, bis(1-methylethyl)-, S-(2,3,3-trichloro-2-propenyl) ester |
99895 |
Carbamothioic acid, bis(1-methylethyl)-, S-(2,3-dichloro-2-propenyl) ester |
17128026 |
Carbamothioic acid, bis(1-methylpropyl)-, S-(phenylmethyl) ester |
95398 |
Carbamothioic acid, bis(2-methylpropyl)-, S-ethyl ester |
78329 |
Carbamothioic acid, butylethyl-, S-propyl ester |
79624 |
Carbamothioic acid, cyclohexylethyl-, S-ethyl ester |
1714749 |
Carbamothioic acid, diethyl-, S-[(2-chlorophenyl)methyl] ester |
248542 |
Carbamothioic acid, diethyl-, S-[(4-chlorophenyl)methyl] ester |
69252 |
Carbamothioic acid, dipropyl-, S-ethyl ester |
17121864 |
Carbamothioic acid, dipropyl-, S-ethyl ester, mixt. with 2,2-dichloro-N,N-di-2-propenylacetamide |
94458 |
Carbamothioic acid, dipropyl-, S-propyl ester |
38596 |
Carbamothioic acid, ethyl-, O-(1-methylethyl) ester |
17126392 |
Carbamothioic acid, S,S'-(2-(dimethylamino)-1,3-propanediyl) ester, monohydrochloride |
1714735 |
Carbamothioic acid, S,S'-[2-(dimethylamino)-1,3-propanediyl] ester |
17272972 |
Carbamothioic chloride, diethyl- |
150037 |
Carbon |
33548 |
Carbon dioxide |
5348 |
Carbon disulfide |
65052 |
Carbon monoxide |
17294943 |
Carbonic acid |
46755 |
Carbonic acid calcium salt (1:1) |
48017 |
Carbonic acid disodium salt |
39438 |
Carbonic acid monosodium salt |
686519 |
Carbonic acid, 1-methylethyl 2-(1-methylpropyl)-4,6-dinitrophenyl ester |
170563 |
Carbonic acid, ammonium salt |
49551 |
Carbonic acid, barium salt (1:1) |
49569 |
Carbonic acid, cadmium salt (1:1) |
524671914 |
Carbonic acid, cobalt salt |
57513 |
Carbonic acid, compd. with guanidine (1:2) |
80184 |
Carbonic acid, copper(2+) salt (1:1) |
198226 |
Carbonic acid, di-2-propenyl ester |
49106 |
Carbonic acid, diammonium salt |
53553 |
Carbonic acid, dilithium salt |
17152067 |
Carbonic acid, dioctyl ester |
20586 |
Carbonic acid, diphenyl ester |
55863 |
Carbonic acid, dipotassium salt |
58123 |
Carbonic acid, lead(2+) salt (1:1) |
58115 |
Carbonic acid, manganese(2+) salt (1:1) |
76968 |
Carbonic acid, monoammonium salt |
114728 |
Carbonic acid, nickel(2+) salt (1:1) |
116202 |
Carbonic acid, zinc salt (1:1) |
148585 |
Carbono(dithioperoxo)dithioic acid, disodium salt |
137505 |
Carbonochloridic acid, hexyl ester |
23879 |
Carbonochloridic acid, oxydi-2,1-ethanediyl ester |
37952 |
Carbonodithioic acid, O-(1-methylethyl) ester, potassium salt |
37960 |
Carbonodithioic acid, O-(1-methylethyl) ester, sodium salt |
271726 |
Carbonodithioic acid, O-(1-methylpropyl) ester, sodium salt |
231811 |
Carbonodithioic acid, O-(2-methylpropyl) ester, sodium salt |
74104 |
Carbonodithioic acid, O-(3-methylbutyl) ester, potassium salt |
1714379 |
Carbonodithioic acid, O-butyl ester |
38299 |
Carbonodithioic acid, O-butyl ester, sodium salt |
40162 |
Carbonodithioic acid, O-ethyl ester |
37937 |
Carbonodithioic acid, O-ethyl ester, potassium salt |
37945 |
Carbonodithioic acid, O-ethyl ester, sodium salt |
106625 |
Carbonodithioic acid, O-pentyl ester, potassium salt |
1852110 |
Carbonothioic acid, O-(6-chloro-3-phenyl-4-pyridizinyl) S-octyl ester |
99101 |
Carbonothioic dihydrazide |
17095753 |
Carcinoscorpius rotundicauda |
17081035 |
Carcinus |
17096710 |
Carcinus aestuarii |
1920800 |
Carcinus maenas |
17075664 |
Carcinus mediterraneus |
65110 |
Card-20(22)-enolide, 3-[(6-deoxy-.alpha.-L-mannopyranosyl)oxy]-1,5,11,14,19-pentahydroxy-, (1.beta.,3.beta.,5.beta.,11.alpha.)- |
218727 |
Card-20(22)-enolide, 3-[(O-2,6-dideoxy-.beta.-D-ribo-hexopyranosyl-(1.fwdarw.4)-O-2,6-dideoxy-.beta.-D-ribo-hexopyranosyl-(1.fwdarw.4)-2,6-dideoxy-.beta.-D-ribo-hexopyranosyl)oxy]-12,14-dihydroxy-, (3.beta.,5.beta.,12.beta.)- |
17109448 |
Cardaria chalapensis |
17109430 |
Cardaria draba |
17113663 |
Cardaria pubescens |
1920818 |
Cardinalis cardinalis |
17089814 |
Cardinalis sinuatus |
52454592 |
Cardium |
17090432 |
Carduelis sinica |
17113671 |
Carex acutiformis |
17116765 |
Carex appropinquata |
17111683 |
Carex diandra |
17112079 |
Carex echinata |
17113689 |
Carex inops |
17112061 |
Carex lepidocarpa |
17112350 |
Carex pulicaris |
17113697 |
Carex sp. |
17113952 |
Carex vesicaria |
17080284 |
Caridina |
17076753 |
Caridina denticulata |
17088584 |
Caridina nilotica |
17078510 |
Caridina rajadhari |
17086109 |
Caridina weberi |
17103714 |
Carissa macrocarpa |
17113499 |
Carpinus caroliniana |
17113705 |
Carpobrotus edulis |
1920867 |
Carpodacus mexicanus |
1857036 |
Carteria |
17100181 |
Carteria eugametos |
17103722 |
Carthamus tinctorius |
17110735 |
Carya |
1640143 |
Carya illinoinensis |
17113713 |
Carya x lecontei |
517722 |
Caseins, reaction products with formaldehyde |
1920891 |
Casmerodius albus |
17103730 |
Cassia fistula |
17103748 |
Castanea sativa |
17113721 |
Castilleja sp. |
157032 |
Castor oil |
322479 |
Castor oil, ethoxylated |
320820 |
Castor oil, hydrogenated, ethoxylated |
17116062 |
Casuarina cunninghamiana |
17111360 |
Casuarina distyla |
17103755 |
Casuarina equisetifolia |
17117532 |
Catenaria anguillulae |
17079807 |
Catenula |
17108390 |
Catharanthus roseus |
17097569 |
Cathorops spixii |
17077314 |
Catla catla |
1899806 |
Catostomidae |
1899863 |
Catostomus catostomus |
1899871 |
Catostomus commersoni |
17084674 |
Catostomus latipinnis |
1899897 |
Catostomus platyrhynchus |
17087503 |
Caudiverbera caudiverbera |
17089525 |
Cavia porcellus |
17113739 |
Ceanothus cordulatus |
17113747 |
Ceanothus integerrimus |
17110750 |
Ceanothus velutinus |
1714515 |
Celanol PS 19 |
17103763 |
Celastrus scandens |
17081209 |
Celina angustata |
1886126 |
Celithemis |
161786 |
Cellulose, carboxymethyl ether, sodium salt |
161950 |
Cellulose, methyl ether |
161968 |
Cellulose, nitrate |
17113754 |
Celtis pallida |
17113093 |
Celtis sp. |
1714516 |
Cemulsol NPT 9 |
17103771 |
Cenchrus echinatus |
17108978 |
Cenchrus incertus |
17094756 |
Cenococcum geophilum |
17111378 |
Centaurea jacea |
17103789 |
Centella asiatica |
1853266 |
Centrales |
1898543 |
Centrarchidae |
1920982 |
Centropomus undecimalis |
1920990 |
Centropristis striata |
1870641 |
Centroptilum |
17075813 |
Cepaea nemoralis |
17103797 |
Cephalanthus occidentalis |
17083387 |
Cephalobus persegnis |
17093345 |
Cephalobus sp. |
17097650 |
Cephalopholis cruentata |
17089970 |
Cephus cintus |
17112798 |
Ceramium flabelligerum |
17112731 |
Ceramium pedicellatum |
17112053 |
Ceramium strictum |
17112921 |
Cerastium fontanum |
17113762 |
Cerastium glomeratum |
17074329 |
Cerastoderma edule |
17079112 |
Cerastoderma glaucum |
17111089 |
Cerataulina bergonii |
1858604 |
Ceratium |
1858612 |
Ceratium hirundinella |
17098518 |
Ceratophyllum demersum |
17112343 |
Ceratophyllum oryzetorum |
17110917 |
Ceratophyllum submersum |
1876127 |
Ceratopogonidae |
17096231 |
Ceratoppia bipilis |
1882141 |
Ceratopsyche bronta |
1882158 |
Ceratopsyche morosa |
1882166 |
Ceratopsyche morosa bifida |
1882174 |
Ceratopsyche slossonae |
17098773 |
Ceratopteris thalictroides |
17091786 |
Ceratothoa gaudichaudii |
17109604 |
Cercis canadensis |
17095621 |
Cercopidae |
1913706 |
Cerebratulus |
17084302 |
Cerebratulus fuscus |
17096983 |
Ceriagrion sp. |
764266 |
Ceriodaphnia |
52451895 |
Ceriodaphnia acanthina |
52451903 |
Ceriodaphnia affinis |
17085622 |
Ceriodaphnia cornuta |
1921063 |
Ceriodaphnia dubia |
1921071 |
Ceriodaphnia lacustris |
1921089 |
Ceriodaphnia pulchella |
52451937 |
Ceriodaphnia quadrangula |
1921097 |
Ceriodaphnia reticulata |
17076779 |
Cerithidea cingulata |
17088014 |
Cerithium scabridum |
156349 |
Cerium chloride (CeCl3) |
17093352 |
Cervidellus sp. |
150052 |
Cesium |
152272 |
Cesium chloride (CsCl) |
960823 |
Cevane-3,4,12,14,16,17,20-heptol, 4,9-epoxy-, 3-[(2Z)-2-methyl-2-butenoate], (3.beta.,4.alpha.,16.beta.)- |
17080052 |
Chaenogobius annularis |
1853332 |
Chaetoceros |
17101536 |
Chaetoceros affinis |
17116849 |
Chaetoceros calcitrans |
17101049 |
Chaetoceros compressus |
17101072 |
Chaetoceros curvisetus |
17100496 |
Chaetoceros decipiens |
17100504 |
Chaetoceros didymus |
17100629 |
Chaetoceros galvestonensis |
17112244 |
Chaetoceros gracilis |
17116658 |
Chaetoceros minimus |
17111188 |
Chaetoceros muelleri |
17100975 |
Chaetoceros neogracile |
17116641 |
Chaetoceros protuberans |
17100942 |
Chaetoceros simplex |
17098419 |
Chaetoceros socialis |
17076464 |
Chaetogammarus marinus |
1859388 |
Chaetogaster diaphanus |
17102112 |
Chaetomorpha linum |
17088238 |
Chalcalburnus chalcoides |
17113770 |
Chamaebatia foliolosa |
17113788 |
Chamaecyparis obtusa |
17103805 |
Chamaecyparis pisifera |
17103813 |
Chamaedaphne calyculata |
17103821 |
Chamaedorea elegans |
17115783 |
Chamaesyce humistrata |
17114364 |
Chamaesyce maculata |
17101601 |
Champia parvula |
17152505 |
Champion JS 10-232 |
17152513 |
Champion JS 10-242 |
17085390 |
Chanda commersonii |
17097510 |
Channa argus |
17081415 |
Channa marulius |
17077348 |
Channa orientalis |
17076852 |
Channa punctata |
17096835 |
Channa stewartii |
17077231 |
Channa striata |
17076712 |
Chanos chanos |
1876333 |
Chaoboridae |
1876341 |
Chaoborus |
1921170 |
Chaoborus americanus |
17081498 |
Chaoborus astictopus |
17118332 |
Chaoborus crystallinus |
1921188 |
Chaoborus flavicans |
17086117 |
Chaoborus obscuripes |
1876366 |
Chaoborus punctipennis |
17080680 |
Chaos |
17099003 |
Chara |
17112780 |
Chara contraria |
17111923 |
Chara corallina |
17100199 |
Chara globularis |
17117342 |
Chara hispida |
17099250 |
Chara vulgaris |
17099102 |
Chara zeylanica |
17076555 |
Characinidae |
17100298 |
Characiopsis |
1921204 |
Charadrius vociferus |
203661 |
Charcoal |
17084542 |
Charybdis feriatus |
17088477 |
Chasmagnathus granulata |
17076951 |
Chasmichthys dolichognathus |
17088246 |
Chasmichthys gulosus |
17118134 |
Chasmistes brevirostris |
17117367 |
Chattonella marina |
1881598 |
Chauliodes |
17091794 |
Chela atpar |
17082967 |
Chela phulo |
1875632 |
Chelifera |
17077470 |
Chelon engeli |
17075482 |
Chelon labrosus |
17092701 |
Chelonus inanitus |
17085317 |
Chelura terebrans |
17151473 |
Chem-Trol |
17110826 |
Chenopodium |
17103839 |
Chenopodium album |
17103847 |
Chenopodium ambrosioides |
17103854 |
Chenopodium leptophyllum |
17110412 |
Chenopodium murale |
17110420 |
Chenopodium rubrum |
17091810 |
Cherax albidus |
17087784 |
Cherax destructor |
17091828 |
Cherax quadricarinatus |
1882190 |
Cheumatopsyche |
17091844 |
Cheumatopsyche brevilineata |
1915834 |
Cheumatopsyche campyla |
17082454 |
Cheumatopsyche oxa |
17086356 |
Cheumatopsyche pettiti |
17094822 |
Chilo partellus |
17090747 |
Chilodonella uncinata |
1857937 |
Chilomonas |
17098112 |
Chilomonas paramecium |
17093360 |
Chiloplacus sp. |
1915842 |
Chilopoda |
1883511 |
Chimarra |
1883529 |
Chimarra aterrima |
17087016 |
Chimarra marginata |
1883552 |
Chimarra obscura |
17113796 |
Chionachne hubbardiana |
17091877 |
Chione stutchburyi |
1896034 |
Chiridotea almyra |
1876374 |
Chironomidae |
1921253 |
Chironominae |
1921261 |
Chironomini |
1877901 |
Chironomus |
17096702 |
Chironomus alternans |
1877919 |
Chironomus anthracinus |
1877927 |
Chironomus attenuatus |
1877950 |
Chironomus crassicaudatus |
1877968 |
Chironomus decorus |
17080185 |
Chironomus gripekoveni |
17094954 |
Chironomus luridus |
17091893 |
Chironomus ninevah |
1877992 |
Chironomus plumosus |
1878008 |
Chironomus riparius |
17085549 |
Chironomus salinarius |
17091851 |
Chironomus samoensis |
1878016 |
Chironomus staegeri |
1878024 |
Chironomus stigmaterus |
1915859 |
Chironomus tentans |
17092198 |
Chironomus tepperi |
17075896 |
Chironomus thummi |
17079856 |
Chironomus utahensis |
17080797 |
Chironomus yoshimatsui |
17095811 |
Chironomus zealandicus |
163220 |
Chitosan |
1857077 |
Chlamydomonas |
1857085 |
Chlamydomonas angulosa |
17111964 |
Chlamydomonas bullosa |
17099441 |
Chlamydomonas eugametos |
17100603 |
Chlamydomonas geitleri |
1857093 |
Chlamydomonas globosa |
17099490 |
Chlamydomonas moewusii |
17098914 |
Chlamydomonas nivalis |
17111279 |
Chlamydomonas noctigama |
17098161 |
Chlamydomonas reinhardtii |
17101114 |
Chlamydomonas segnis |
17099482 |
Chlamydomonas variabilis |
17079203 |
Chlamydotheca arcuata |
17078361 |
Chlamys asperrima |
17079104 |
Chlamys opercularis |
17087610 |
Chlamys varia |
172726 |
Chloramide |
650655 |
Chlorate |
183160 |
Chlordane, technical |
1855980 |
Chlorella |
17098385 |
Chlorella autotrophica |
17098930 |
Chlorella emersonii |
17098898 |
Chlorella fusca |
17116823 |
Chlorella fusca fusca |
17111170 |
Chlorella fusca vacuolata |
17099813 |
Chlorella kessleri |
17116260 |
Chlorella luteoviridis |
17116278 |
Chlorella minutissima |
17098021 |
Chlorella ovalis |
17101585 |
Chlorella protothecoides |
17098336 |
Chlorella pyrenoidosa |
17112376 |
Chlorella rubescens |
1855998 |
Chlorella saccharophila |
1856004 |
Chlorella saccharophila ellipsoidea |
17098641 |
Chlorella salina |
17098609 |
Chlorella sorokiniana |
17100694 |
Chlorella stigmatophora |
17099672 |
Chlorella variegata |
1856012 |
Chlorella vulgaris |
17116757 |
Chlorella vulgaris tertia |
17111246 |
Chlorella vulgaris vulgaris |
17101007 |
Chlorella zofingiensis |
170225 |
Chloric acid, magnesium salt |
119354 |
Chloric acid, potassium salt |
153767 |
Chloric acid, sodium salt |
295865 |
Chloric acid, sodium salt, mixt. with boric acid (HBO2) sodium salt |
17098948 |
Chloridella |
17026659 |
Chlorimide |
154328 |
Chlorine |
167296 |
Chlorine oxide (ClO2) |
17103862 |
Chloris submutica |
17099896 |
Chlorobotrys regularis |
1855451 |
Chlorococcales |
1855527 |
Chlorococcum |
17099904 |
Chlorococcum humicola |
17099201 |
Chlorococcum hypnosporum |
17112590 |
Chlorococcum macrostigmatum |
17112608 |
Chlorococcum vacuolatum |
17092958 |
Chlorococcus |
17101239 |
Chlorogloea fritschii |
1857101 |
Chlorogonium |
17076423 |
Chlorohydra viridissima |
1887652 |
Chloroperlidae |
1855402 |
Chlorophyceae |
1855394 |
Chlorophycota |
17103870 |
Chlorophytum comosum |
17095639 |
Chloropidae |
156380 |
Chlorosulfuric acid |
153445 |
Chlorous acid, sodium salt |
41616 |
Cholan-24-oic acid, 3,12-dihydroxy-, monosodium salt, (3.alpha.,5.beta.,12.alpha.)- |
8698 |
Cholan-24-oic acid, 3,7,12-trihydroxy-, (3.alpha.,5.beta.,7.alpha.,12.alpha.)- |
2717 |
Cholest-5-en-3-ol (3.beta.)- |
58420 |
Cholest-5-en-3-ol (3.beta.)-, hexadecanoate |
17103888 |
Chondrilla juncea |
17099060 |
Chondrus crispus |
17099052 |
Chorda filum |
1897875 |
Chordata |
17083742 |
Choromytilus chorus |
17080367 |
Choromytilus meridionalis |
17092412 |
Chrissia halyi |
17078528 |
Chromadora nudicapitata |
17079989 |
Chromadorina germanica |
17077769 |
Chromadorita |
710905 |
Chromate (Cr2O7 2-) |
188128 |
Chromic acid (H2Cr2O7) |
153916 |
Chromic acid (H2Cr2O7), dipotassium salt |
172593 |
Chromic acid (H2Cr2O7), disodium salt |
650457 |
Chromic acid (H2Cr2O7), disodium salt, dihydrate |
153213 |
Chromic acid (H2CrO4) |
155622 |
Chromic acid (H2CrO4), diammonium salt |
155630 |
Chromic acid (H2CrO4), dipotassium salt |
153775 |
Chromic acid (H2CrO4), disodium salt |
1960491 |
Chromis punctipinnis |
150060 |
Chromium |
166421 |
Chromium chloride (CrCl3) |
85571 |
Chromium oxide (CrO3) |
17121633 |
Chromium sodium oxide |
220327 |
Chromium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- |
1714683 |
Chromium, tris(2-pyridinecarboxylato-.kappa.N1,.kappa.O2)- |
1857614 |
Chromulina |
1857945 |
Chroomonas |
17098260 |
Chroomonas salina |
17075136 |
Chrysanthemum cinerariifolium |
17103896 |
Chrysanthemum indicum |
17103904 |
Chrysanthemum segetum |
17109612 |
Chrysanthemum sp. |
40733 |
Chrysene |
17092651 |
Chrysichthyes auratus |
17088485 |
Chrysichthys nigrodigitatus |
17079633 |
Chrysiptera cyanea |
1858190 |
Chrysochromulina |
1857630 |
Chrysococcus |
1873777 |
Chrysomelidae |
17083395 |
Chrysopa carnea |
17079963 |
Chrysophrys major |
1857572 |
Chrysophyta |
17095647 |
Chrysopidae |
17077538 |
Chrysops carbonarus |
17102120 |
Chrysosplenium americanum |
17109067 |
Chrysothamnus viscidiflorus |
1868926 |
Chydoridae |
17084781 |
Chydorus ovalis |
1868959 |
Chydorus sphaericus |
161778 |
Chymotrypsin |
1885359 |
Cicadellidae |
17103912 |
Cicer arietinum |
17083957 |
Cichla ocellaris |
17076514 |
Cichlasoma bimaculatum |
17088378 |
Cichlasoma citrinellum |
17084575 |
Cichlasoma facetum |
17082876 |
Cichlasoma managuense |
17080383 |
Cichlasoma nigrofasciatum |
17085853 |
Cichlasoma urophthalmus |
17093097 |
Cichlidae |
17103920 |
Cichorium endivia |
17103938 |
Cichorium intybus |
17095316 |
Cicurina brevis |
17095381 |
Cicurina pallida |
17093378 |
Cicurina robusta |
1901404 |
Ciliatea |
1901396 |
Ciliophora |
47258 |
Cinchonan-9-ol, (8.alpha.,9R)- |
53165 |
Cinchonan-9-ol, 6'-methoxy-, (8.alpha.,9R)-, sulfate (1:1) (salt) |
70581 |
Cinchonan-9-ol, 6'-methoxy-, (8.alpha.,9R)-, sulfate (2:1) (salt) |
69054 |
Cinchonan-9-ol, 6'-methoxy-, (9S)-, sulfate (1:1) (salt) |
151423 |
Cinchonan-9-ol, 6'-methoxy-, hydrochloride, (8.alpha.,9R)- |
35253 |
Cinchonan-9-ol, 6'-methoxy-, monohydrochloride, (8.alpha.,9R)- |
17116617 |
Cinclidotus aquaticus |
17113812 |
Cineraria sp. |
1954163 |
Ciona intestinalis |
17076233 |
Cipangopaludina chinensis |
17077843 |
Cipangopaludina japonica |
17118464 |
Cipangopaludina malleata |
1969351 |
Cirolana borealis |
1938927 |
Cirratulus cirratus |
17088253 |
Cirrhinus molitorella |
17076878 |
Cirrhinus mrigala |
17092966 |
Cirriformia spirabranchia |
1938992 |
Cirriformia tentaculata |
1921352 |
Cirripedia |
17108622 |
Cirsium arvense |
17113820 |
Cirsium horridulum |
17109075 |
Cirsium vulgare |
1958487 |
Citharichthys stigmaeus |
17152422 |
Citrikleen 1850 |
1714604 |
Citrikleen 1855 |
1714605 |
Citrikleen FC 1160 |
1714606 |
Citrikleen XPC |
17103946 |
Citrullus colocynthis |
17103953 |
Citrullus lanatus |
17113838 |
Citrus aurantifolia |
17103961 |
Citrus aurantium |
17113846 |
Citrus aurantium bergamia |
17116047 |
Citrus hybrid |
17103979 |
Citrus jambhiri |
17103987 |
Citrus limon |
17113853 |
Citrus maxima |
17113879 |
Citrus nobilis |
17104019 |
Citrus reticulata |
17104027 |
Citrus sinensis |
17110610 |
Citrus sp. |
17113861 |
Citrus x limonia |
17103995 |
Citrus x nobilis |
17104001 |
Citrus x paradisi |
1911791 |
Claassenia |
1887991 |
Claassenia sabulosa |
1868876 |
Cladocera |
1856723 |
Cladophora |
17099300 |
Cladophora glomerata |
966127 |
Clam-Trol CT 1 |
17095449 |
Clarias albopunctatus |
17088261 |
Clarias anguillaris |
17075326 |
Clarias batrachus |
17082694 |
Clarias gariepinus |
17084799 |
Clarias lazera |
17088279 |
Clarias macrocephalus |
17082686 |
Clarias ngamensis |
17093980 |
Clarkus sp. |
17113887 |
Cleome rutidosperma |
17113895 |
Cleome sp. |
17110362 |
Cleome viscosa |
17102203 |
Clerodendrum thompsoniae |
17086620 |
Clethrionomys gapperi |
17089533 |
Clethrionomys glareolus |
1958198 |
Clevelandia ios |
17077447 |
Clibanaris misanthropus |
17081001 |
Clibanaris vittatus |
17092099 |
Clibanarius humilis |
17091968 |
Clibanarius olivaceus |
1944735 |
Clinocardium nuttallii |
1876556 |
Clinotanypus pinguis |
1888163 |
Clioperla clio |
17118738 |
Clistoronia magnifica |
17097098 |
Clivina bipustulatus |
17097106 |
Clivina impressefrons |
1870682 |
Cloeon |
17075524 |
Cloeon dipterum |
17086364 |
Cloeon triangulifer |
1714381 |
Clophen A 60 |
1857358 |
Closterium |
17101981 |
Closterium acerosum |
17110925 |
Closterium ehrenbergii |
17111287 |
Closterium juncidium |
17101890 |
Closterium lanceolatum |
17100751 |
Closterium littorale |
17110933 |
Closterium moniliferum |
17094194 |
Clubiona canadensis |
1921469 |
Clupea harengus |
17078643 |
Clupea pallasi |
1899657 |
Clupeidae |
17083403 |
Cnesterodon decemmaculatus |
1901446 |
Cnidaria |
17085333 |
Cnidoglanis macrocephalus |
150078 |
Cobalt |
152207 |
Cobalt chloride (CoCl2) |
169649 |
Cobalt chloride (CoCl3) |
182907 |
Cobaltate(2-), bis[2-[[5-(aminosulfonyl)-2-(hydroxy-.kappa.O)phenyl]azo-.kappa.N1]-3-(oxo-.kappa.O)-N-phenylbutanamidato(2-)]-, dihydrogen |
17083445 |
Cobitidae |
17077850 |
Cobitis taenia |
17090291 |
Coccinella septempunctata |
17090309 |
Coccinellidae |
17101742 |
Coccochloris |
17100348 |
Coccochloris cedrorum |
17099128 |
Coccochloris halophytica |
17098922 |
Coccochloris lividus |
17100090 |
Coccochloris peniocystis |
17094848 |
Coccoidea |
17098187 |
Coccolithus huxleyi |
17104035 |
Coccoloba uvifera |
17112442 |
Coccomyxa minor |
17099912 |
Coccomyxa simplex |
1853878 |
Cocconeis |
1853894 |
Cocconeis pediculus |
1853902 |
Cocconeis placentula |
17116930 |
Cocconeis placentula euglypta |
1921535 |
Coccyzus americanus |
17088592 |
Cochliopodium |
17083494 |
Cochliopodium bilimbosum |
156901 |
Coconut oil |
17104043 |
Cocos nucifera |
17113903 |
Codiaeum variegatum |
17100157 |
Codium fragile |
156984 |
Cod-liver oil |
17083882 |
Coelambus novemlineatus |
1855691 |
Coelastrum microporum |
17110941 |
Coelastrum morus |
17099920 |
Coelastrum proboscideum |
1876564 |
Coelotanypus |
1888809 |
Coenagrion |
17092842 |
Coenagrion puella |
17118233 |
Coenagrion pulchellum |
1888635 |
Coenagrionidae |
17109620 |
Coffea arabica |
17094046 |
Cognettia sphagnetorum |
1872241 |
Coleoptera |
17108408 |
Coleus scutellarioides |
17113911 |
Coleus sp. |
1921584 |
Colinus virginianus |
17081522 |
Colisa fasciata |
17076266 |
Colisa lalia |
1869676 |
Collembola |
17091232 |
Colpidium |
17076837 |
Colpidium campylum |
17082793 |
Colpidium colpoda |
17094723 |
Colpoda cucullus |
17094541 |
Colpoda inflata |
17094244 |
Colpoda steinii |
17089988 |
Coluber constrictor priapus |
17092024 |
Colubotelson chiltoni minor |
17110305 |
Colubrina texensis |
1921626 |
Columba livia |
17096736 |
Columba sp. |
17094988 |
Colurostylis lemurum |
17110453 |
Commelina communis |
17110461 |
Commelina diffusa |
17113929 |
Commelina nudiflora |
17113937 |
Comocladia dentata |
17084716 |
Conchostraca |
1714377 |
Conco K(K) |
17113945 |
Condalia sp. |
1906288 |
Congeria leucophaeta |
1714607 |
Con-Lei |
17093386 |
Conochilus sp. |
17114158 |
Consolida ajacis |
17109398 |
Consolida ambigua |
17078833 |
Convoluta |
17104050 |
Convolvulus arvensis |
17111386 |
Conyza bonariensis |
17109083 |
Conyza canadensis |
1972025 |
Copepoda |
17095258 |
Copidosoma truncatellus |
150086 |
Copper |
86231 |
Copper chloride |
153494 |
Copper chloride (CuCl) |
150508 |
Copper chloride (CuCl2) |
85332 |
Copper chloride hydroxide (Cu2Cl(OH)3) |
158279 |
Copper chloride hydroxide (Cu2Cl(OH)3), mixt. with copper hydroxide sulfate (Cu4(OH)6(SO4)) |
85316 |
Copper chloride oxide, hydrate |
217554 |
Copper hydroxide (Cu(OH)2) |
85423 |
Copper hydroxide sulfate (Cu4(OH)6(SO4)) |
83378 |
Copper oxide (Cu2O) |
83360 |
Copper oxide (CuO) |
1714514 |
Copper silver oxide |
303420 |
Copper zinc hydroxide sulfate |
1714634 |
Copper(2+), bis(1,2-ethanediamine-.kappa.N,.kappa.N')-, sulfate (1:1) |
178947 |
Copper, [.mu.-[carbonato(2-)-.kappa.O:.kappa.O']]dihydroxydi- |
593731 |
Copper, [[2,2',2''-(nitrilo-.kappa.N)tris[ethanol-.kappa.O]](2-)]- |
170894 |
Copper, bis(8-quinolinolato-.kappa.N1,.kappa.O8)- |
36921 |
Copper, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (SP-4-1)- |
17101270 |
Corallina officinalis |
17095290 |
Coras montanus |
1906080 |
Corbicula |
17092461 |
Corbicula fluviatilis |
17084849 |
Corbicula japonica |
17077967 |
Corbicula leana |
1906098 |
Corbicula manilensis |
17081852 |
Corbicula regularis |
17085168 |
Corbiculina australis |
17104068 |
Corchorus capsularis |
17089657 |
Cordylophora caspia |
17118746 |
Coregonus artedii |
17085903 |
Coregonus autumnalis migratori |
1921774 |
Coregonus clupeaformis |
17078783 |
Coregonus fera |
1921782 |
Coregonus hoyi |
17075789 |
Coregonus lavaretus |
17097478 |
Coregonus lavaretus pallasi |
17084823 |
Coregonus muksun |
17075797 |
Coregonus peled |
17095522 |
Corethra plumicornis |
17084989 |
Coretus corneus |
712042 |
Corexit |
1714513 |
Corexit 7664 |
1714283 |
Corexit 9550 |
17152323 |
Corexit 9554 |
1714608 |
Corexit 9580 |
1714503 |
Corexit CRX 8 |
17104076 |
Coriandrum sativum |
1884295 |
Corisella |
1884303 |
Corisella decolor |
17104084 |
Corispermum papillosum |
1884311 |
Corixa |
17078486 |
Corixa punctata |
1884246 |
Corixidae |
156893 |
Corn oil |
17109638 |
Cornus |
17104092 |
Cornus amomum |
17104100 |
Cornus canadensis |
17104118 |
Cornus florida |
17112988 |
Cornus racemosa |
17108911 |
Cornus sericea |
17113960 |
Cornus tatarica |
17117649 |
Corollospora maritima |
40568 |
Coronene |
17104126 |
Coronilla varia |
17113978 |
Coronopus didymus |
1892785 |
Corophium acherusicum |
1892819 |
Corophium insidiosum |
52452893 |
Corophium salmonis |
17094335 |
Corophium sp. |
17093394 |
Corophium spinicorne |
1892868 |
Corophium volutator |
1881614 |
Corydalus |
1881630 |
Corydalus cornutus |
17109307 |
Corylus americana |
17104134 |
Corylus avellana |
17104142 |
Corylus cornuta |
17113986 |
Corynocarpus laevigatus |
17101023 |
Coscinodiscus gigas |
17101015 |
Coscinodiscus grani |
1857366 |
Cosmarium |
17098542 |
Cosmarium botrytis |
17116963 |
Cosmarium granatum |
17101908 |
Cosmarium obtusatum |
17116971 |
Cosmarium subprotumidum |
17109646 |
Cosmos |
17104159 |
Cotoneaster apiculata |
17113994 |
Cotoneaster divaricatus |
17114000 |
Cotoneaster pannosus |
156885 |
Cottonseed oil |
1899350 |
Cottus |
17118753 |
Cottus bairdi |
1921899 |
Cottus cognatus |
17086372 |
Cottus gobio |
17088287 |
Cottus japonicus |
17092917 |
Coturnix coturnix |
17086554 |
Coturnix japonica |
17090440 |
Coturnix sp. |
17104167 |
Crambe maritima |
1950211 |
Crangon |
17082306 |
Crangon allmanni |
17074311 |
Crangon crangon |
52452927 |
Crangon franciscorum |
1950229 |
Crangon nigricauda |
1921931 |
Crangon septemspinosa |
1893007 |
Crangonyx |
17092677 |
Crangonyx laurentianus |
1893031 |
Crangonyx pseudogracilis |
17077546 |
Crangonyx richmondensis lauren |
17088568 |
Crangonyx richomdensis |
1903947 |
Crassostrea |
17081977 |
Crassostrea angulata |
17075649 |
Crassostrea cucullata |
1903954 |
Crassostrea gigas |
17097692 |
Crassostrea iredalei |
17082033 |
Crassostrea madrasensis |
17088600 |
Crassostrea margaritacea |
1903962 |
Crassostrea rhizophorae |
1903970 |
Crassostrea virginica |
17109653 |
Crataegus |
17104175 |
Crataegus crus-galli |
17114018 |
Crataegus marshallii |
17114026 |
Crataegus mollis |
17091976 |
Craterocephalus stercusmuscaru |
17117052 |
Craticula accomoda |
17080334 |
Crenobia alpina |
17092057 |
Crenomytilus grayanus |
156950 |
Creosote |
321166 |
Creosote oil |
159038 |
Creosote, wood |
1910264 |
Crepidula fornicata |
1879659 |
Cricotopus |
17092305 |
Cricotopus tamapullus |
1879824 |
Cricotopus trifasciatus |
17095407 |
Crinia insignifera |
17080896 |
Cristigera |
17081019 |
Crithidia fasciculata |
17084898 |
Crocothemis erythraea |
17104183 |
Crotalaria juncea |
17109315 |
Croton capitatus |
1856434 |
Crucigenia |
1856491 |
Crucigenia tetrapedia |
1868868 |
Crustacea |
198465 |
Cryolite (Na3(AlF6)) |
17118308 |
Cryophila lapponica |
17097239 |
Cryphoeca montana |
17101841 |
Crypthecodinium cohnii |
1878073 |
Cryptochironomus |
1878099 |
Cryptochironomus digitatus |
17095837 |
Cryptochironomus griseidorsum |
17101692 |
Cryptochrysis |
1852334 |
Cryptomonas |
1852359 |
Cryptomonas erosa |
17112806 |
Cryptomonas marssonii |
1852375 |
Cryptomonas ovata |
17111105 |
Cryptomonas ozolini |
17116344 |
Cryptomonas pyrenoidifera |
17117235 |
Cryptomonas tetrapyrenoidosa |
1857903 |
Cryptophyceae |
1857895 |
Cryptophycophyta |
17096207 |
Cryptopygus sp. |
1862465 |
Ctenodrilus serratus |
17083197 |
Ctenolabrus rupestris |
1961093 |
Ctenopharyngodon idella |
17113051 |
Cucumis anguria |
17104191 |
Cucumis melo |
17104209 |
Cucumis sativus |
17104217 |
Cucurbita maxima |
17104225 |
Cucurbita moschata |
17104233 |
Cucurbita pepo |
17113200 |
Cucurbita sp. |
1898493 |
Culaea inconstans |
1877448 |
Culex |
17079450 |
Culex alpicalis |
17095829 |
Culex antennatus |
17085374 |
Culex fatigans |
17087461 |
Culex gelidus |
17083023 |
Culex melanurus |
17081738 |
Culex nigripalpus |
17075821 |
Culex peus |
1877471 |
Culex pipiens |
17088618 |
Culex pipiens fatigans |
17080078 |
Culex pipiens molestus |
17082215 |
Culex pipiens pallens |
17079583 |
Culex pipiens pipiens |
17079385 |
Culex pipiens quinquefasciata |
1877489 |
Culex quinquefasciatus |
1877497 |
Culex restuans |
1877505 |
Culex salinarius |
1877513 |
Culex tarsalis |
17081365 |
Culex tritaeniorhynchus |
1877356 |
Culicidae |
1876176 |
Culicoides |
17091091 |
Culicoides schultzei |
17084633 |
Culicoides variipennis |
17080086 |
Culiseta annulata |
17080813 |
Culiseta inornata |
17094913 |
Culiseta longiareolata |
17110594 |
Cullen corylifolia |
760215 |
Cuprate(2-), ((N,N'-1,2-ethanediylbis(N-(carboxymethyl)glycinato))(4-)-N,N',O,O',ON,ON')-, disodium, dihydrate, (OC-6-21)- |
301911 |
Cuprate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, dihydrogen, (OC-6-21)- |
193219 |
Cuprate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
84996 |
Cuprate(2-), [29H,31H-phthalocyanine-C,C-disulfonato(4-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, disodium |
203083 |
Cuprate(2-), [5-[[4'-[[2-(hydroxy-.kappa.O)-6-hydroxy-3-[[2-(hydroxy-.kappa.O)-5-sulfophenyl]azo-.kappa.N1]phenyl]azo][1,1'-biphenyl]-4-yl]azo]-2-hydroxybenzoato(4-)]-, disodium |
199125 |
Cuprate(3-), tetrakis(cyano-.kappa.C)-, trisodium, (T-4)- |
249102 |
Cuprate(4-), [.mu.-[[3,3'-[[3,3'-di(hydroxy-.kappa.O)[1,1'-biphenyl]-4,4'-diyl]bis(azo-.kappa.N1)]bis[5-amino-4-(hydroxy-.kappa.O)-2,7-naphthalenedisulfonato]](8-)]]di-, tetrasodium |
17104241 |
Cupressus arizonica |
17114034 |
Cuscuta indecora |
17110495 |
Cuscuta pentagona |
1714512 |
Cutrine |
17104258 |
Cyamopsis tetragonoloba |
45070 |
Cyanamide |
40477 |
Cyanamide, calcium salt (1:1) |
48769 |
Cyanamide, cyano- |
51490 |
Cyanamide, di-2-propenyl- |
207746 |
Cyanamide, monosodium salt |
66902 |
Cyanate |
56622 |
Cyanic acid, potassium salt |
2444 |
Cyanide |
1922061 |
Cyanocitta cristata |
49064 |
Cyanogen bromide ((CN)Br) |
49072 |
Cyanogen chloride ((CN)Cl) |
1852649 |
Cyanophycota |
17114042 |
Cyanotis axillaris |
17080037 |
Cyatholaimus |
1872613 |
Cybister |
17112962 |
Cyclamen sp. |
17081761 |
Cyclaspis usitata |
17094616 |
Cyclidium glaucoma |
17294968 |
Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl- |
17152182 |
Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-, hexyl ester |
17294976 |
Cyclobutaneacetic acid, 3-carboxy-2,2-dimethyl-, (1R,3S)-rel-(+)- |
17093014 |
Cyclocypris |
41137 |
Cyclododecane |
233882 |
Cyclododecane, hexabromo- |
775700 |
Cycloheptane |
48397 |
Cycloheptanone |
17154022 |
Cycloheptanone, 2-(phenylmethylene)-, O-[2-[bis(1-methylethyl)amino]ethyl]oxime, (1E,2E)-, (2E)-2-butenedioate (1:1) |
1714771 |
Cycloheptene |
25486 |
Cyclohexanamine |
13607 |
Cyclohexanamine, N,N-diethyl- |
20396 |
Cyclohexanamine, N-cyclohexyl- |
27003 |
Cyclohexane |
17151895 |
Cyclohexane, (2-bromoethyl)- |
17000738 |
Cyclohexane, 1,1-dimethyl- |
59220 |
Cyclohexane, 1,2,3,4,5,6-hexachloro- |
42200 |
Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
2923 |
Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- |
42184 |
Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
42192 |
Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.beta.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
17152901 |
Cyclohexane, 1,2,3,4,5,6-hexamethyl- |
17155102 |
Cyclohexane, 1,2,4,5-tetramethyl- |
131748 |
Cyclohexane, 1,2-dibromo- |
686675 |
Cyclohexane, 1,2-dichloro- |
71324 |
Cyclohexane, 1,2-dichloro-, (1R,2R)-rel- |
709014 |
Cyclohexane, 1,2-dimethyl- |
145797 |
Cyclohexane, 1,2-dimethyl-, (1R,2R)-rel- |
98434 |
Cyclohexane, 1,2-dimethyl-, (1R,2S)-rel- |
17157165 |
Cyclohexane, 1,4-dimethyl- |
25429 |
Cyclohexane, bromo- |
90647 |
Cyclohexane, butyl- |
52324 |
Cyclohexane, chloro- |
17155771 |
Cyclohexane, dodecafluoro- |
92551 |
Cyclohexane, dodecyl- |
90639 |
Cyclohexane, ethyl- |
63826 |
Cyclohexane, iodo- |
25445 |
Cyclohexane, methyl- |
17273269 |
Cyclohexane, undecafluoro- |
43638 |
Cyclohexane, undecafluoro(trifluoromethyl)- |
130633 |
Cyclohexaneacetic acid |
124891 |
Cyclohexanebutanoic acid |
120048 |
Cyclohexanebutanoic acid, nickel(2+) salt |
17131368 |
Cyclohexanecarboxamide, N-(2,3-dichloro-4-hydroxyphenyl)-1-methyl- |
18366 |
Cyclohexanecarboxylic acid |
17272816 |
Cyclohexanecarboxylic acid, 1,3,4,5-tetrahydroxy-, (1.alpha.,3R,4.alpha.,5R)- |
693986 |
Cyclohexanecarboxylic acid, 2,2-dimethyl-4,6-dioxo-5-[1-[(2-propenyloxy)imino]butyl]-, methyl ester, ion(1-), sodium |
17273327 |
Cyclohexanecarboxylic acid, 3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxy-, (1S,3R,4R,5R)- |
605329 |
Cyclohexanecarboxylic acid, 4-(cyclopropylhydroxymethylene)-3,5-dioxo-, ethyl ester |
173708 |
Cyclohexanecarboxylic acid, 4(or 5)-chloro-2-methyl-, 1,1-dimethylethyl ester |
8391 |
Cyclohexanemethanamine, 4-amino-.alpha.,.alpha.,4-trimethyl- |
108035 |
Cyclohexanemethanamine, 5-amino-1,3,3-trimethyl- |
8409 |
Cyclohexanemethanol, 4-hydroxy-.alpha.,.alpha.,4-trimethyl- |
25494 |
Cyclohexanol |
7005 |
Cyclohexanol, 1-ethynyl- |
17151341 |
Cyclohexanol, 1-ethynyl-2-methyl- |
17151705 |
Cyclohexanol, 2-phenyl-, (1R,2R)-rel- |
12617 |
Cyclohexanol, 5-methyl-2-(1-methylethenyl)-, (1R,2S,5R)- |
98707 |
Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)- |
12609 |
Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-rel- |
25502 |
Cyclohexanone |
17153271 |
Cyclohexanone, 2-(2-chlorophenyl)-2-(methylamino)-, hydrochloride |
17151325 |
Cyclohexanone, 2-(3-methoxyphenyl)- |
17152687 |
Cyclohexanone, 2-(acetyloxy)- |
17153446 |
Cyclohexanone, 2,6-bis[(4-chlorophenyl)methylene]- |
55764 |
Cyclohexanone, 2-methyl- |
18101 |
Cyclohexanone, 4-(1,1-dimethylethyl)- |
1714326 |
Cyclohexanone, 5-methyl-2-(1-methylethyl)- |
193482 |
Cyclohexanone, 5-methyl-2-(1-methylethyl)-, (2S,5R)- |
12641 |
Cyclohexanone, 5-methyl-2-(1-methylethylidene)-, (5R)- |
19604 |
Cyclohexanone, oxime |
27011 |
Cyclohexene |
37267 |
Cyclohexene, 1-methyl-4-(1-methylethenyl)- |
136648 |
Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- |
759654 |
Cyclohexene, 1-methyl-4-(1-methylethyl)-, dimer |
17273145 |
Cyclooctane |
17088022 |
Cyclope neritea |
17003518 |
Cyclopenta(c)furo(3',2':4,5)furo(2,3-h)(1)benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-methoxy-, (6aR,9aS)- |
1714421 |
Cyclopenta[c][1]benzopyran-3,4-dione, 1,2-dihydro-7,9-dimethoxy- |
1714713 |
Cyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-11(1H)-one, 2,3,6a,8,9,9a-hexahydro-4-methoxy-, (6aR,9aS)- |
41020 |
Cyclopentane |
17151879 |
Cyclopentane, ethyl- |
16824 |
Cyclopentane, methyl- |
105486 |
Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- |
16832 |
Cyclopentanol |
31484 |
Cyclopentanone |
80614 |
Cyclopentanone, oxime |
38745 |
Cyclopentene |
68528 |
Cyclopentene, octachloro- |
1869478 |
Cyclopidae |
1869460 |
Cyclopoida |
5389 |
Cyclopropane |
107029 |
Cyclopropanecarboxamide, N-(3,4-dichlorophenyl)- |
618017 |
Cyclopropanecarboxylic acid, 1-[[(2,4-dichlorophenyl)amino]carbonyl]- |
279604 |
Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester |
357483 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)-, cyano(3-phenoxyphenyl)methyl ester |
152678 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester |
285734 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1R)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1S,3S)-rel- |
249318 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1S)-2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester, (1R,3R)- |
52466364 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (2,4-dimethylphenyl)methyl ester |
236513 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (3-phenoxyphenyl)methyl ester |
1852136 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [2,5-dioxo-3-(2-propynyl)-1-imidazolidinyl]methyl ester |
171413 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester |
249326 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester, (1R,3R)- |
17127986 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester, (1R,3S)- |
1714398 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester, mixt. with 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl-1,3-benzodioxole |
55921 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, 2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester |
962712 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, 2-methyl-4-oxo-3-(2-propynyl)-2-cyclopenten-1-yl ester |
960898 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, 3-(2-cyclopenten-1-yl)-2-methyl-4-oxo-2-cyclopenten-1-yl ester |
279596 |
Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, cyano(3-phenoxyphenyl)methyl ester |
297093 |
Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)- |
304881 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl- |
296012 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester |
17164278 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3R)- |
294827 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3R)-rel- |
777318 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
17154089 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, mixt. with N-(3,4-dichlorophenyl)hexahydro-1,3-dimethyl-2,4,6-trioxo-5-pyrimidinecarboxamide |
696195 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (pentafluorophenyl)methyl ester, (1R,3S)- |
695338 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel- |
294660 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
420992 |
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(4-fluoro-3-phenoxyphenyl)methyl ester |
1714273 |
Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, (3-phenoxyphenyl)methyl ester, (1R,3S)-rel- |
392688 |
Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
31633 |
Cyclopropanecarboxylic acid, 3-[(1E)-3-methoxy-2-methyl-3-oxo-1-propenyl]-2,2-dimethyl-, (1S)-2-methyl-4-oxo-3-(2Z)-2,4-pentadienyl-2-cyclopenten-1-yl ester, (1R,3R)- |
591271 |
Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2,3,5,6-tetrafluoro-4-methylphenyl)methyl ester, (1R,3R)-rel- |
594945 |
Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel- |
602565 |
Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel- |
1869486 |
Cyclops |
17077942 |
Cyclops abyssorum prealpinus |
17079799 |
Cyclops bicuspidatus |
17090960 |
Cyclops bicuspidatus thomasi |
17081068 |
Cyclops bohater |
17093402 |
Cyclops furcifer |
17079815 |
Cyclops strenuus |
17087032 |
Cyclops varicans |
1869494 |
Cyclops vernalis |
17077249 |
Cyclops vicinus |
17081084 |
Cyclops vicinus kikuchii |
17081076 |
Cyclops vicinus vicinus |
1916139 |
Cyclops viridis |
17084047 |
Cyclopterus lumpus |
1853480 |
Cyclotella |
17098245 |
Cyclotella cryptica |
17116583 |
Cyclotella gamma |
1853530 |
Cyclotella meneghiniana |
53975 |
Cyclotetrasiloxane, octamethyl- |
17100454 |
Cylindrocapsa involuta |
17094871 |
Cylindroiulus britannicus |
1853001 |
Cylindrospermopsis |
1853019 |
Cylindrospermum |
17099664 |
Cylindrospermum licheniforme |
17100827 |
Cylindrospermum musciola |
17117987 |
Cylindrospermum stagnale |
1855089 |
Cylindrotheca |
17098633 |
Cylindrotheca closterium |
17115981 |
Cylindrotheca fusiformis |
1957570 |
Cymatogaster aggregata |
17111972 |
Cymatosira belgica |
1853993 |
Cymbella minuta |
17114059 |
Cymopterus acaulis |
17104266 |
Cynara scolymus |
17109661 |
Cynodon |
17114067 |
Cynodon bradleyi |
17104274 |
Cynodon dactylon |
17114075 |
Cynodon magennisii |
17104282 |
Cynodon transvaalensis |
17088923 |
Cynoglossus joyneri |
1922376 |
Cynoscion nebulosus |
17116161 |
Cynosurus cristatus |
17112269 |
Cyperaceae |
17109679 |
Cyperus |
17114083 |
Cyperus dentatus |
17114091 |
Cyperus difformis |
17114109 |
Cyperus erythrorhizos |
17104290 |
Cyperus esculentus |
17114117 |
Cyperus iria |
17114125 |
Cyperus odoratus |
17111535 |
Cyperus rotundus |
17114133 |
Cyperus serotinus |
17078577 |
Cypretta kawatai |
1962786 |
Cypria |
17078700 |
Cypria ophthalmica |
1962802 |
Cypricercus |
1962828 |
Cypridopsis |
17074352 |
Cypridopsis vidua |
1900216 |
Cyprinella lutrensis |
1900224 |
Cyprinella spiloptera |
1900240 |
Cyprinella whipplei |
1900125 |
Cyprinidae |
17097593 |
Cyprinion watsoni |
17083890 |
Cyprinodon dearborni |
17075425 |
Cyprinodon macularius |
1899517 |
Cyprinodon variegatus |
1899491 |
Cyprinodontidae |
1962836 |
Cyprinotus |
17090416 |
Cyprinotus incongruens |
1900257 |
Cyprinus |
1900265 |
Cyprinus carpio |
17086125 |
Cyprinus carpio carpio |
17081118 |
Cyprinus carpio communis |
17082223 |
Cypris |
17084260 |
Cypris subglobosa |
17114141 |
Cyrilla racemiflora |
17091463 |
Cyrtonaias tampicoensis |
17111204 |
Cystoseira barbata |
17104308 |
Dactylis glomerata |
17112970 |
Dahlia sp. |
524942 |
D-Alanine, N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-, methyl ester |
17127168 |
D-Allaric acid, O-5'-deoxyadenosin-5'-yl-(5'.fwdarw.4)-O-.alpha.-D-glucopyranosyl-(1.fwdarw.2)-, 4-(dihydrogen phosphate) |
17076985 |
Danio |
17096900 |
Danio aequipinnatus |
17090580 |
Danio devario |
17076902 |
Danio malabaricus |
17090150 |
Danio rerio |
1869015 |
Daphnia |
1922434 |
Daphnia ambigua |
17118688 |
Daphnia carinata |
1922442 |
Daphnia catawba |
17091018 |
Daphnia cephalata |
17078403 |
Daphnia cucullata |
17080243 |
Daphnia galeata |
1922467 |
Daphnia galeata mendotae |
17074428 |
Daphnia hyalina |
1922475 |
Daphnia laevis |
1922483 |
Daphnia longiremis |
17118274 |
Daphnia longispina |
17076571 |
Daphnia lumholzi |
17074303 |
Daphnia magna |
17083312 |
Daphnia obtusa |
1922491 |
Daphnia parvula |
1922509 |
Daphnia pulex |
1922517 |
Daphnia pulicaria |
1922525 |
Daphnia retrocurva |
1869023 |
Daphnia rosea |
17080417 |
Daphnia schodleri |
17082603 |
Daphnia similis |
17091943 |
Daphnia spinulata |
1868991 |
Daphnidae |
40493 |
D-Arginine |
17121559 |
D-Ascorbic acid |
1922558 |
Dasyatis sabina |
17097973 |
Dasycorixa hybrida |
17096009 |
Dasyhelea sp. |
17089822 |
Dasypus novemcinctus |
17104316 |
Datura innoxia |
17104324 |
Datura stramonium |
17109687 |
Daucus carota |
17108358 |
Daucus carota sativus |
689315 |
D-chiro-Inositol, 3-O-[2-amino-4-[(carboxyiminomethyl)amino]-2,3,4,6-tetradeoxy-.alpha.-D-arabino-hexopyranosyl]- |
1714298 |
D-chiro-Inositol, 3-O-methyl- |
33456 |
Decane |
121517 |
Decane, 1,10-dibromo- |
67926 |
Decane, 1,1'-thiobis- |
28290 |
Decane, 1-bromo- |
112128 |
Decanedioic acid, di-2-propenyl ester |
25858 |
Decanedioic acid, dibutyl ester |
26625 |
Decanedioic acid, diethyl ester |
95067 |
Decanenitrile |
42739 |
Decanoic acid |
1714726 |
Decanoic acid, 2-chloroethyl ester |
26609 |
Decanoic acid, ethyl ester |
17152265 |
Decanoic acid, nickel salt |
76174 |
Decanoic acid, sodium salt |
28142 |
Decanoyl chloride |
1889195 |
Decapoda |
713537 |
Dechlorane 604 |
17083734 |
Deleatidium |
17104332 |
Delonix regia |
17114166 |
Delphinium barbeyi |
17104340 |
Delphinium cardinale |
17104357 |
Delphinium exaltatum |
17114174 |
Delphinium geyeri |
17104365 |
Delphinium x occidentale |
17118142 |
Deltistes luxatus |
17083155 |
Demonax microphthalma |
17113804 |
Dendranthema x grandiflorum |
1953546 |
Dendraster excentricus |
17094780 |
Dendrobaena octaedra |
17094012 |
Dendrobaena rubida |
17104373 |
Dendrocalamus asper |
17104381 |
Dendrocalamus strictus |
17085465 |
Dendrocoelum lacteum |
17086638 |
Dendrocygna bicolor |
17075763 |
Dendrodea grossularia |
17093717 |
Dendrodrilus rubidus |
17151739 |
Deodorase |
17125964 |
Deriphat 151 |
17094350 |
Dermaptera |
1859404 |
Dero |
1859420 |
Dero digitata |
17079831 |
Dero limosa |
1859487 |
Dero obtusa |
17091299 |
Deroceras reticulatum |
17104399 |
Derris elliptica |
17106907 |
Derris indica |
1714744 |
D-erythro-.alpha.-D-galacto-Octopyranoside, methyl 6,8-dideoxy-6-[[[(2S,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio- |
12534 |
D-erythro-Hex-2-enonic acid, .gamma.-lactone |
17104407 |
Descurainia sophia |
17104415 |
Desmodium tortuosum |
1714387 |
Destruxin |
17100538 |
Detonula confervacea |
17110438 |
Deutzia gracilis |
17096801 |
Dexiostoma campyla |
161869 |
Dextrin |
2550 |
D-Fructose |
3038 |
D-Galactose |
1172 |
D-Glucitol |
139352 |
D-Glucitol, 1-deoxy-1-(methylamino)- |
1714572 |
D-Glucitol, 1-deoxy-1-(methylamino)-, trioxoantimonate(1-) |
13110 |
D-Gluconic acid, .delta.-lactone |
212159 |
D-Gluconic acid, compd. with N,N''-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) |
1255 |
D-Glucose |
3749 |
D-Glucose, 4-O-.beta.-D-galactopyranosyl- |
50385 |
D-Glucose, 4-O-.beta.-D-glucopyranosyl- |
1922772 |
Diacyclops thomasi |
17091257 |
Diadema setosum |
17104423 |
Dianella intermedia |
17104431 |
Dianthus caryophyllus |
1869080 |
Diaphanosoma |
1922806 |
Diaphanosoma birgei |
17085614 |
Diaphanosoma excisum |
17087768 |
Diaphanosoma leuchtenbergianum |
1869411 |
Diaptomidae |
1869429 |
Diaptomus |
17084229 |
Diaptomus clavipes |
17084286 |
Diaptomus forbesi |
17087818 |
Diaptomus gracilis |
17084211 |
Diaptomus leptopus |
17086331 |
Diaptomus minutus |
17081878 |
Diaptomus pallidus |
17090168 |
Diaptomus sicilis |
17083106 |
Diastlyis sculpta |
17099185 |
Diatoma |
17112574 |
Diatoma elongatum |
17099615 |
Diatoma vulgare |
17123605 |
Diazene, [(4-chlorophenyl)thio](2,4,5-trichlorophenyl)- |
690214 |
Diazene, bis(3,4-dichlorophenyl)- |
1714466 |
Diazene, bis(4-bromophenyl)-, 1-oxide |
686089 |
Diazene, bis(4-chlorophenyl)-, 1-oxide |
21337 |
Diazene, diphenyl- |
47837 |
Diazene, diphenyl-, 1-oxide |
17002551 |
Diazenesulfonic acid, [4-(dimethylamino)phenyl]-, sodium salt |
40774 |
Dibenz[a,h]acridine |
1685 |
Dibenz[a,h]anthracene |
17273095 |
Dibenz[a,i]acridine |
40741 |
Dibenz[a,j]acridine |
693382 |
Dibenzo(b,e)(1,4)dioxin, 2,3,7,8-tetrabromo- |
84012 |
Dibenzo[b,def]chrysene-7,14-dione, dibromo- |
270140 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,8-heptachloro- |
699488 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexabromo- |
711986 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7,8-hexachloro- |
711994 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,4,7-pentachloro- |
694281 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,6,7,8-hexachloro- |
699314 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentabromo- |
650911 |
Dibenzo[b,e][1,4]dioxin, 1,2,3,7,8-pentachloro- |
692392 |
Dibenzo[b,e][1,4]dioxin, 1,2,7,8-tetrachloro- |
692277 |
Dibenzo[b,e][1,4]dioxin, 1,3,6,8-tetrachloro- |
1714356 |
Dibenzo[b,e][1,4]dioxin, 1,3,7,8-tetrabromo- |
91918 |
Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro- |
17005265 |
Dibenzo[b,e][1,4]dioxin, 2,3,7-trichloro- |
692335 |
Dibenzo[b,e][1,4]dioxin, 2,7-dichloro- |
1714357 |
Dibenzo[b,e][1,4]dioxin, 2-bromo-3,7,8-trichloro- |
275438 |
Dibenzo[b,e][1,4]dioxin, heptachloro- |
266965 |
Dibenzo[b,e][1,4]dioxin, hexachloro- |
113837 |
Dibenzo[b,e][1,4]dioxin, octachloro- |
270520 |
Dibenzo[b,e][1,4]dioxin, pentachloro- |
284596 |
Dibenzo[b,e][1,4]dioxin, tetrachloro- |
35709 |
Dibenzofuran |
358382 |
Dibenzofuran, 1,2,3,4,6,7,8-heptachloro- |
304782 |
Dibenzofuran, 1,2,3,4,7,8,9-heptachloro- |
700666 |
Dibenzofuran, 1,2,3,4,7,8-hexabromo- |
525212 |
Dibenzofuran, 1,2,3,4,7,8-hexachloro- |
308825 |
Dibenzofuran, 1,2,3,6,7,8-hexachloro- |
570150 |
Dibenzofuran, 1,2,3,7,8,9-hexachloro- |
699231 |
Dibenzofuran, 1,2,3,7,8-pentabromo- |
308817 |
Dibenzofuran, 1,2,3,7,8-pentachloro- |
317966 |
Dibenzofuran, 2,3,4,6,7,8-hexachloro- |
700781 |
Dibenzofuran, 2,3,4,7,8-pentabromo- |
308809 |
Dibenzofuran, 2,3,4,7,8-pentachloro- |
291005 |
Dibenzofuran, 2,3,7,8-tetrachloro- |
688796 |
Dibenzofuran, 2,8-dichloro- |
278200 |
Dibenzofuran, heptachloro- |
304824 |
Dibenzofuran, hexachloro- |
278218 |
Dibenzofuran, octachloro- |
256289 |
Dibenzofuran, pentachloro- |
256271 |
Dibenzofuran, tetrachloro- |
214783 |
Dibenzo-p-dioxin, 1,2,3,7,8,9-hexachloro- |
35717 |
Dibenzothiophene |
1714285 |
Dibenzothiophene, 5,5-dioxide |
1714282 |
Dibenzothiophene, 5-oxide |
52451473 |
Dicentrarchus labrax |
17087701 |
Dichocoenia stokesi |
17110503 |
Dichondra micrantha |
17108606 |
Dichrostachys cinerea |
17114182 |
Dicranopteris linearis |
1881242 |
Dicranota |
17101163 |
Dicrateria inornata |
17116534 |
Dicrateria sp. |
17088758 |
Dicrotendipes californicus |
1875780 |
Dictya |
1855741 |
Dictyosphaerium ehrenbergianum |
1855758 |
Dictyosphaerium pulchellum |
17087909 |
Dictyostelium discoideum |
17117557 |
Dictyuchus sterile |
1714501 |
Dicyclopenta[a,d]cyclooctene-1,5-diol, 1,2,3,3a,4,5,6,8,9,9a-decahydro-1-(methoxymethyl)-4-methyl-7-(1-methylethyl)-6-[[(2S,3S,4aS,5R,7S,8R,8aR)-tetrahydro-8-hydroxy-5-(methoxymethyl)-3-methyl-3-[(2S)-oxiranyl]-7H-2,4a-epoxy-5H-pyrano[3,4-b]-1,4-dioxin-7- |
17089996 |
Didelphis marsupialis |
17087040 |
Didinium nasutum |
1886175 |
Didymops |
17114190 |
Dieffenbachia picta, Schott |
17108879 |
Dieffenbachia seguine |
17115825 |
Dieffenbachia sp. |
17104449 |
Diervilla lonicera |
17096025 |
Difflugia sp. |
17110214 |
Digitaria |
17104456 |
Digitaria horizontalis |
17104464 |
Digitaria ischaemum |
17104472 |
Digitaria longiflora |
17104480 |
Digitaria sanguinalis |
17095266 |
Diglyphus intermedius |
1714436 |
Diklosal |
17096934 |
Dineutes sp. |
17077009 |
Dineutus americanus |
1857697 |
Dinobryon |
1857713 |
Dinobryon bavaricum |
1857739 |
Dinobryon sertularia |
1857747 |
Dinobryon sociale |
17080714 |
Dinocras cephalotes |
17079500 |
Dinocras megacephala |
17080839 |
Dinophilus gyrociliatus |
1858554 |
Dinophyceae |
17114208 |
Dioscorea oppositifolia |
17114216 |
Diospyros texana, Scheele |
17104498 |
Diospyros virginiana |
1714622 |
Diphosphate |
17295411 |
Diphosphoramide, N,N',N'',N'''-tetrakis(1-methylethyl)- |
40287 |
Diphosphoramide, octamethyl- |
17121526 |
Diphosphoric acid, sodium salt |
1714693 |
Diphosphoric acid, tetrabutyl ester |
24422 |
Diphosphoric acid, tetraethyl ester |
148296 |
Diphosphoric acid, tetrapotassium salt |
153031 |
Diphosphoric acid, tetrasodium salt |
17093741 |
Diphtherophora sp. |
17092297 |
Diplectanum aequans |
1882216 |
Diplectrona modesta |
17088295 |
Diplodus bermudensis |
17079344 |
Diplodus sargus |
17083205 |
Diplogasteritus |
17077785 |
Diplolaimella |
17078759 |
Diplolaimelloides |
17096322 |
Diplonychus sp. |
1869650 |
Diplopoda |
17087305 |
Diploria labyrinthiformis |
17087313 |
Diploria strigosa |
112003 |
Diplumbane, hexaphenyl- |
17083353 |
Dipodidae |
17097858 |
Dipodomys heermanni |
17089830 |
Dipodomys merriami |
17097809 |
Dipodomys sp. |
17088626 |
Diporeia |
1875533 |
Diptera |
107094 |
Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro- |
10181 |
Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide |
17273319 |
D-Isoleucine |
1714410 |
Dispersol SD |
1714427 |
Dispolene 32S |
1714343 |
Distannane, hexaphenyl- |
127746 |
Distannathiane, hexabutyl- |
17272808 |
Distannathiane, hexaphenyl- |
2113 |
Distannoxane, hexabutyl- |
185488 |
Distannoxane, hexakis(2-methyl-2-phenylpropyl)- |
1714491 |
Distannoxane, hexaphenyl- |
77065 |
Distannoxane, hexapropyl- |
17098963 |
Distichlis spicata |
440057 |
Distillates (petroleum), catalytic reformer fractionator residue low-boiling |
341743 |
Distillates (petroleum), hydrotreated light |
98798 |
Disulfide, bis(2,4-dinitrophenyl) |
79939 |
Disulfide, bis(2-nitrophenyl) |
51466 |
Disulfide, bis(3-nitrophenyl) |
96107 |
Disulfide, bis(4-chloro-2-nitrophenyl) |
79798 |
Disulfide, bis(4-chlorophenyl) |
21212 |
Disulfide, bis(4-methylphenyl) |
19356 |
Disulfide, bis(4-nitrophenyl) |
40055 |
Disulfide, bis(phenylmethyl) |
26997 |
Disulfide, diethyl |
73098 |
Disulfide, diphenyl |
64667 |
Disulfide, dipropyl |
153783 |
Dithionous acid, disodium salt |
17093410 |
Ditylenchus sp. |
17098617 |
Ditylum brightwellii |
1877661 |
Dixa |
1877653 |
Dixidae |
42432 |
D-Leucine |
17121971 |
D-Lysine |
17153644 |
D-lyxo-Hexose, 2-deoxy- |
115980 |
D-Mannose |
64998 |
Docosane |
130989 |
Docosanoic acid, sodium salt |
1938976 |
Dodecaceria concharum |
78881 |
Dodecanamide |
38950 |
Dodecanamide, N-(2-hydroxyethyl)- |
21832 |
Dodecanamide, N-(4-hydroxyphenyl)- |
28407 |
Dodecane |
28498 |
Dodecane, 1-chloro- |
17157710 |
Dodecane, 1-ethoxy- |
39156 |
Dodecanoic acid |
41517 |
Dodecanoic acid, 2-thiocyanatoethyl ester |
244608 |
Dodecanoic acid, monoester with 1,2,3-propanetriol |
119081 |
Dodecanoic acid, pentachlorophenyl ester |
64683 |
Dodecanoic acid, sodium salt |
17078957 |
Dolichodasys carolinensis |
1875558 |
Dolichopodidae |
17086521 |
Dolophilodes distincta |
17153792 |
Dominion Rigwash |
17088030 |
Donacilla cornea |
17079914 |
Donax cuneatus |
17081712 |
Donax faba |
17092495 |
Donax incarnatus |
17092891 |
Donax rugosus |
17080391 |
Donax serra |
17082561 |
Donax trunculus |
43141 |
D-Ornithine |
1899723 |
Dorosoma cepedianum |
17083213 |
Dorylaimus stagnalis |
17104506 |
Dovyalis abyssinica |
17104514 |
Dovyalis hebecarpa |
17154055 |
Dowell F 75N |
1714492 |
Dowfax 2A1 |
1714618 |
DP 70 |
17101320 |
Draparnaldia |
17101593 |
Draparnaldia glomerata |
17100413 |
Draparnaldia plumosa |
17096090 |
Drawida willsi |
1906304 |
Dreissena polymorpha |
17086471 |
Drepanocladus aduncus |
17117276 |
Drepanomonas revoluta |
17093865 |
Drilocephalobus sp. |
1871623 |
Drunella |
1871649 |
Drunella doddsi |
1871664 |
Drunella grandis |
1714494 |
D-Streptamine, O-2-amino-2-deoxy-.alpha.-D-glucopyranosyl-(1.fwdarw.4)-O-[O-2,6-diamino-2,6-dideoxy-.beta.-L-idopyranosyl-(1.fwdarw.3)-.beta.-D-ribofuranosyl-(1.fwdarw.5)]-2-deoxy-, sulfate (salt) |
2725 |
D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N,N'-bis(aminoiminomethyl)- |
119347 |
D-Streptamine, O-2-deoxy-2-(methylamino)-.alpha.-L-glucopyranosyl-(1.fwdarw.2)-O-5-deoxy-3-C-formyl-.alpha.-L-lyxofuranosyl-(1.fwdarw.4)-N,N'-bis(aminoiminomethyl)-, sulfate (2:3) (salt) |
1914464 |
Dugesia |
17087024 |
Dugesia bengalensis |
1914472 |
Dugesia dorotocephala |
17096546 |
Dugesia etrusca |
17080516 |
Dugesia gonocephala |
17088410 |
Dugesia japonica |
17082595 |
Dugesia lugubris |
1914480 |
Dugesia tigrina |
1857143 |
Dunaliella |
17111501 |
Dunaliella bardawil |
17099649 |
Dunaliella bioculata |
17099995 |
Dunaliella euchlora |
17101288 |
Dunaliella minuta |
17101817 |
Dunaliella parva |
17098393 |
Dunaliella primolecta |
17101122 |
Dunaliella salina |
17098096 |
Dunaliella tertiolecta |
17111253 |
Dunaliella viridis |
17000464 |
D-Valine, 3-mercapto- |
1923077 |
Dyspanopeus sayi |
166439 |
Dysprosium chloride (DyCl3) |
1872282 |
Dytiscidae |
1872712 |
Dytiscus |
17075573 |
Dytiscus marginalis |
17097817 |
Ecdyonurus venosus |
1902303 |
Echinarachnius parma |
17085606 |
Echinisca triserialis |
17095431 |
Echinocardium cordatum |
17104522 |
Echinochloa colona |
17099326 |
Echinochloa crus-galli |
17112533 |
Echinochloa crusgalli zelayens |
17114240 |
Echinochloa esculenta |
17114232 |
Echinochloa frumentacea |
17114224 |
Echinochloa oryzicola |
1902162 |
Echinodermata |
17102013 |
Echinodorus |
17117391 |
Echinodorus grandiflorus |
17085556 |
Echinogammarus berilloni |
17097411 |
Echinogammarus echinosetosus |
17081688 |
Echinogammarus olivii |
17087826 |
Echinogammarus pirloti |
17085572 |
Echinogammarus stammeri |
17079278 |
Echinogammarus stocki |
17092248 |
Echinogammarus tibaldii |
17095902 |
Echinometra lucunter |
17118514 |
Echinometra mathaei |
17116542 |
Echinoshpaerium sp. |
17116294 |
Eclipta prostrata |
17152539 |
Ecologic 10M10B10 |
17152547 |
Ecologic 5M10MB10 |
17152521 |
Ecologic 5M5B4 |
17152364 |
Ecologic BF 102 |
17152372 |
Ecologic BF 103 |
17152380 |
Ecologic BF 104 |
17082140 |
Economus omiensis |
17116351 |
Ectocarpus confervoides |
17099789 |
Ectocarpus siliculosus |
17117466 |
Ectocarpus variabilis |
1897172 |
Ectoprocta |
1965748 |
Edwardsia elegans |
17098658 |
Egeria densa |
17088634 |
Egeria radiata |
1923093 |
Egretta caerulea |
1923101 |
Egretta thula |
17089848 |
Egretta tricolor |
17098732 |
Eichhornia |
17098674 |
Eichhornia crassipes |
1878289 |
Einfeldia natchitocheae |
17076472 |
Eirene viridula |
17093915 |
Eisenia andrei |
17089541 |
Eisenia fetida |
17093907 |
Eisenia fetida andrei |
17095092 |
Eisenia hortensis |
17096330 |
Eisenia veneta |
17104530 |
Elaeagnus umbellata |
17104548 |
Elaeis guineensis |
1856848 |
Elakatothrix gelatinosa |
17097056 |
Elaphropus anceps |
17087834 |
Elasmopus bampo |
17118902 |
Elasmopus pectinicrus |
1893205 |
Elasmopus rapax |
1874817 |
Elateridae |
17097775 |
Eleginus navaga |
17112087 |
Eleocharis acicularis |
17101379 |
Eleocharis macrostachya |
17104555 |
Eleusine coracana |
17104563 |
Eleusine indica |
17079666 |
Eleutherolaimus stenosoma |
17090754 |
Elgenmannia virescens |
17078098 |
Elimia catenaria |
17085721 |
Elimia clavaeformis |
17077132 |
Elimia livescens |
1916287 |
Elimia virginica |
1905041 |
Elliptio |
1905058 |
Elliptio buckleyi |
1905066 |
Elliptio complanata |
1905082 |
Elliptio crassidens |
1905090 |
Elliptio dilatata |
1905108 |
Elliptio icterina |
1874072 |
Elmidae |
17118977 |
Elminius modestus |
17098666 |
Elodea |
17098807 |
Elodea canadensis |
17100587 |
Elodea densa |
17111329 |
Elodea ernstae |
17101577 |
Elodea nuttalli |
17116096 |
Elymus lanceolatus lanceolatus |
17113085 |
Elymus repens |
17108804 |
Elytrigia repens |
17095191 |
Emberizidae |
1950872 |
Emerita analoga |
17092263 |
Emerita asiatica |
17104589 |
Emilia sonchifolia |
17091364 |
Empoasca fabae |
1888817 |
Enallagma |
1888825 |
Enallagma antennatum |
17087057 |
Enallagma aspersum |
17085424 |
Enallagma cyathigerum |
1859255 |
Enchytraeidae |
1967165 |
Enchytraeus albidus |
17083502 |
Enchytraeus buchholzi |
17093899 |
Enchytraeus crypticus |
17092289 |
Enchytraeus variatus |
17077215 |
Encrasicholina purpurea |
17152430 |
Enersperse 1037 |
1714504 |
Enersperse 700 |
1899749 |
Engraulidae |
17088956 |
Engraulis japonicus |
1955277 |
Engraulis mordax |
17116369 |
Enhalus acoroides |
1923200 |
Enneacanthus chaetodon |
1923218 |
Enneacanthus gloriosus |
1875087 |
Enochrus |
1875095 |
Enochrus blatchleyi |
1899400 |
Enophrys bison |
17085234 |
Enoplus brevis |
17085242 |
Enoplus communis |
1907104 |
Ensis minor |
17114257 |
Enterolobium saman |
17099292 |
Enteromorpha |
17099078 |
Enteromorpha compressa |
17100553 |
Enteromorpha crinata |
17116377 |
Enteromorpha flexuosa |
17099086 |
Enteromorpha intestinalis |
17100132 |
Enteromorpha linza |
17111550 |
Enteromorpha prolifera |
1714384 |
Entobacterins |
17099458 |
Entosiphon sulcatum |
17152448 |
Envirobond 403 |
17152455 |
Envirosperse OSD |
1852599 |
Eohaustorius estuarius |
52453073 |
Eohaustorius washingtonianus |
763847 |
Epeorus |
17083718 |
Epeorus latifolium |
1870864 |
Epeorus longimanus |
17086380 |
Epeorus vitrea |
1870104 |
Ephemera |
17076696 |
Ephemera danica |
17081126 |
Ephemera japonica |
1870112 |
Ephemera simulans |
1871680 |
Ephemerella |
1923275 |
Ephemerella catawba |
1923283 |
Ephemerella cornuta |
17075359 |
Ephemerella grandis grandis |
17085366 |
Ephemerella ignita |
1871771 |
Ephemerella infrequens |
1916311 |
Ephemerella invaria |
1962422 |
Ephemerella lata |
1871805 |
Ephemerella subvaria |
1871813 |
Ephemerella walkeri |
1871532 |
Ephemerellidae |
1870096 |
Ephemeridae |
1869924 |
Ephemeroptera |
1870260 |
Ephoron album |
1916352 |
Ephydatia fluviatilis |
17097684 |
Ephydatia mulleri |
17083114 |
Ephydra gracilis |
1875673 |
Ephydridae |
17106501 |
Epilobium angustifolium |
17111691 |
Epilobium hirsutum |
17111709 |
Epilobium palustre |
17088303 |
Epinephelus |
17096942 |
Epinephelus adscensionis |
17090762 |
Epinephelus akaara |
17081902 |
Epiphanes brachionus |
17107541 |
Epipremnum pinnatum |
17091430 |
Epischura baikalensis |
17094715 |
Epitheca sp. |
1854348 |
Epithemia turgida |
17086646 |
Eptesicus fuscus |
17097940 |
Equus caballus |
17110230 |
Eragrostis minor |
168658 |
Erbium chloride (ErCl3) |
17104597 |
Eremochloa ophiuroides |
17089558 |
Eremophila alpestris |
17118894 |
Eretes sticticus |
17089368 |
Erethizon dorsatum |
17086489 |
Ergasilus |
17156944 |
Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl-, (8.beta.)- |
17109059 |
Ericameria nauseosa nauseosa |
17112954 |
Erichloa sp. |
17109091 |
Erigeron annuus |
17092719 |
Erigonidae |
1899954 |
Erimyzon sucetta |
17104605 |
Eriobotrya japonica |
17111949 |
Eriocaulon septangulare |
17087628 |
Eriocheir sinensis |
17104613 |
Eriochloa villosa |
17114273 |
Eriogonum effusum |
17112913 |
Eriogonum sp. |
17111717 |
Eriophorum angustifolium |
17111576 |
Eriophorum latifolium |
17080904 |
Eriphia spinifrons |
1875814 |
Eristalis |
17097825 |
Eristalis arbustorum |
17080151 |
Eristalis tenax |
17090002 |
Erithacus rubecula |
17080177 |
Erpobdella octoculata |
1860774 |
Erpobdella punctata |
1860725 |
Erpobdellidae |
1714415 |
Erythromycin |
17104621 |
Escallonia floribunda |
1901248 |
Esocidae |
17082165 |
Esomus danrica |
1901255 |
Esox |
17084658 |
Esox americanus vermiculatus |
1901271 |
Esox lucius |
1901289 |
Esox masquinongy |
1644 |
Estra-1,3,5(10)-trien-17-one, 3-hydroxy- |
17163445 |
Estra-1,3,5(10)-triene-3,16,17-triol, (16.alpha.,17.beta.)- |
1099 |
Estra-1,3,5(10)-triene-3,17-diol (17.beta.)- |
1865054 |
Eteone heteropoda |
5264 |
Ethanamine |
271171 |
Ethanamine, 2-(decylthio)-, hydrochloride |
17002585 |
Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, hydrochloride |
1714335 |
Ethanamine, 2-[4-[(1Z)-1,2-diphenyl-1-butenyl]phenoxy]-N,N-dimethyl- |
104679 |
Ethanamine, 2-bromo-, hydrobromide |
1461 |
Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl- |
684829 |
Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl-, hydrochloride |
72538 |
Ethanamine, 2-chloro-N,N-diethyl-, hydrochloride |
26203 |
Ethanamine, 2-methoxy- |
31708 |
Ethanamine, N,N-diethyl- |
17157074 |
Ethanamine, N,N-dimethyl-2-[(2-methylphenyl)phenylmethoxy]-, hydrochloride |
26245 |
Ethanamine, N-ethyl- |
66878 |
Ethanamine, N-ethyl-, hydrochloride |
1875 |
Ethanamine, N-ethyl-N-nitroso- |
17163577 |
Ethanaminium, 2-(acetyloxy)-N,N,N-trimethyl- |
3343 |
Ethanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, chloride |
1529 |
Ethanaminium, 2-[(aminocarbonyl)oxy]-N,N,N-trimethyl-, chloride |
569954 |
Ethanaminium, 2-[ethyl[4-[(3-phenyl-1,2,4-thiadiazol-5-yl)azo]phenyl]amino]-N,N,N-trimethyl-, methyl sulfate |
76034 |
Ethanaminium, 2-chloro-N,N,N-trimethyl-, chloride |
3608 |
Ethanaminium, 2-hydroxy-N,N,N-trimethyl- |
4259 |
Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, chloride |
2105 |
Ethanaminium, N,N,N-triethyl-, chloride |
101063 |
Ethanaminium, N-[4-[bis[4-(diethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, chloride |
5082 |
Ethane |
65102 |
Ethane, 1,1,1,2-tetrachloro- |
4796 |
Ethane, 1,1,1-trichloro- |
7773 |
Ethane, 1,1,2,2-tetrachloro- |
7518 |
Ethane, 1,1,2-trichloro- |
27987 |
Ethane, 1,1'-[methylenebis(oxy)]bis[2-chloro- |
54379 |
Ethane, 1,1-dibromo- |
5520 |
Ethane, 1,1-dichloro- |
3335 |
Ethane, 1,1'-oxybis- |
131995 |
Ethane, 1,1'-oxybis[2-bromo- |
27532 |
Ethane, 1,1'-oxybis[2-chloro- |
28365 |
Ethane, 1,1'-oxybis[2-ethoxy- |
1714699 |
Ethane, 1,1'-sulfinylbis[1,2,2-trichloro- |
48850 |
Ethane, 1,1'-thiobis[2-chloro- |
23986 |
Ethane, 1,2-dibromo- |
24117 |
Ethane, 1,2-dichloro- |
62877 |
Ethane, 1,2-dichloro-1-ethoxy- |
24091 |
Ethane, 1-bromo-2-chloro- |
143255 |
Ethane, 1-bromo-2-methoxy- |
708511 |
Ethane, 2,2-dichloro-1,1-difluoro-1-methoxy- |
685255 |
Ethane, 2-bromo-2-chloro-1,1,1-trifluoro- |
5181 |
Ethane, bromo- |
5223 |
Ethane, chloro- |
81786 |
Ethane, dichloro- |
4341 |
Ethane, hexachloro- |
52480 |
Ethane, isothiocyanato- |
7708 |
Ethane, nitro- |
6056 |
Ethane, pentachloro- |
231951 |
Ethane, tetrachloro- |
232058 |
Ethane, trichloro- |
24265 |
Ethanedial |
39446 |
Ethanedioic acid |
78261 |
Ethanedioic acid, diammonium salt |
16485 |
Ethanedioic acid, diethyl ester |
17125055 |
Ethanedioic acid, dihydrate |
55715 |
Ethanedioic acid, dipotassium salt |
3715 |
Ethanedioic acid, disodium salt |
81455 |
Ethanedione, bis(4-methoxyphenyl)- |
36178 |
Ethanedione, diphenyl- |
7823 |
Ethanedithioamide |
31468 |
Ethanedithioamide, N,N'-bis(2-hydroxyethyl)- |
32417 |
Ethanedithioamide, N,N'-bis(phenylmethyl)- |
32235 |
Ethanedithioamide, N,N'-dicyclohexyl- |
1714452 |
Ethanedithioamide, N,N'-didodecyl- |
7682 |
Ethaneperoxoic acid |
17273178 |
Ethanesulfinic acid, 2-amino- |
17541 |
Ethanesulfonic acid, 2-[methyl[(9Z)-1-oxo-9-octadecenyl]amino]- |
36905 |
Ethanesulfonic acid, 2-[methyl[(9Z)-1-oxo-9-octadecenyl]amino]-, sodium salt |
24315 |
Ethanesulfonic acid, 2-amino- |
24323 |
Ethanesulfonic acid, 2-hydroxy- |
94144 |
Ethanesulfonic acid, methyl ester |
3657 |
Ethanethioamide |
65219 |
Ethanethioamide, N,N-dimethyl- |
17127333 |
Ethanethioic acid, (4-chloro-2-methylphenoxy)-, S-ethyl ester |
5298 |
Ethanethiol |
1714266 |
Ethanethiol, 2-(diethylamino)- |
708487 |
Ethanethiol, 2-amino- |
40444 |
Ethanethiol, 2-amino-, hydrochloride |
98467 |
Ethanimidic acid, ethyl ester, hydrochloride |
223180 |
Ethanimidothioic acid, 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxo-, methyl ester |
315127 |
Ethanimidothioic acid, N,N'-[thiobis[(methylimino)carbonyloxy]]bis-, dimethyl ester |
17152174 |
Ethanimidothioic acid, N-[(aminocarbonyl)oxy]-, methyl ester |
17127283 |
Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, 2-cyanoethyl ester |
17127622 |
Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, 2-cyanoethyl ester, (1Z)- |
205609 |
Ethanimidothioic acid, N-[[(methylamino)carbonyl]oxy]-, methyl ester |
3822 |
Ethanol |
1714761 |
Ethanol, 1-amino- |
17295395 |
Ethanol, 1-amino-2,2,2-trichloro- |
25965 |
Ethanol, 2-(1-methylethoxy)- |
17002528 |
Ethanol, 2-(2,4-dichlorophenoxy)-, hydrogen sulfate, sodium salt |
960880 |
Ethanol, 2-(2,4-dichlorophenoxy)-, phosphite (3:1) |
28340 |
Ethanol, 2-(2-butoxyethoxy)- |
33449 |
Ethanol, 2-(2-butoxyethoxy)-, acetate |
27979 |
Ethanol, 2-(2-ethoxyethoxy)- |
27854 |
Ethanol, 2-(2-methoxyethoxy)- |
93930 |
Ethanol, 2-(4-chlorophenoxy)- |
203810 |
Ethanol, 2-(4-nitrophenoxy)- |
20982 |
Ethanol, 2-(dibutylamino)- |
19372 |
Ethanol, 2-(diethylamino)- |
24802 |
Ethanol, 2-(dimethylamino)- |
26922 |
Ethanol, 2-(ethylamino)- |
14167 |
Ethanol, 2-(ethylphenylamino)- |
26963 |
Ethanol, 2-(ethylthio)- |
266569 |
Ethanol, 2-(hydroxymethylamino)- |
247510 |
Ethanol, 2-(nonylphenoxy)- |
116632 |
Ethanol, 2-(octylthio)- |
37515 |
Ethanol, 2,2'-(ethylimino)bis- |
78451 |
Ethanol, 2,2'-(nitrosoimino)bis- |
30999 |
Ethanol, 2,2'-(phenylimino)bis- |
20917 |
Ethanol, 2,2',2''-nitrilotris- |
37564 |
Ethanol, 2,2',2''-nitrilotris-, dodecyl sulfate (salt) |
109876 |
Ethanol, 2,2',2''-nitrilotris-, triacetate (ester) |
29066 |
Ethanol, 2,2,2-trichloro- |
41830 |
Ethanol, 2,2,2-trichloro-, dihydrogen phosphate |
5975 |
Ethanol, 2,2,2-trifluoro- |
28282 |
Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis- |
20743 |
Ethanol, 2,2'-[1,3-phenylenebis(oxy)]bis- |
287094 |
Ethanol, 2,2'-[methylenebis(thio)]bis- |
28571 |
Ethanol, 2,2'-[oxybis(2,1-ethanediyloxy)]bis- |
27516 |
Ethanol, 2,2'-iminobis- |
27557 |
Ethanol, 2,2'-oxybis- |
136325 |
Ethanol, 2,2'-oxybis-, dicarbamate |
67819 |
Ethanol, 2,2'-oxybis-, dinitrate |
104729 |
Ethanol, 2,2'-sulfonylbis- |
688804 |
Ethanol, 2-[2-(1-methylethoxy)ethoxy]- |
28480 |
Ethanol, 2-[2-(2-ethoxyethoxy)ethoxy]- |
217562 |
Ethanol, 2-[2-(4-nonylphenoxy)ethoxy]- |
184366 |
Ethanol, 2-[2-[2-(dodecyloxy)ethoxy]ethoxy]-, hydrogen sulfate, sodium salt |
17061 |
Ethanol, 2-[bis(1-methylethyl)amino]- |
13714 |
Ethanol, 2-[ethyl(3-methylphenyl)amino]- |
38315 |
Ethanol, 2-amino- |
73908 |
Ethanol, 2-amino-, hydrogen sulfate (ester) |
51888 |
Ethanol, 2-bromo- |
27847 |
Ethanol, 2-butoxy- |
7161 |
Ethanol, 2-butoxy-, phosphate (3:1) |
24125 |
Ethanol, 2-chloro- |
29322 |
Ethanol, 2-chloro-, phosphate (3:1) |
26989 |
Ethanol, 2-ethoxy- |
27284 |
Ethanol, 2-ethoxy-, acetate |
17152299 |
Ethanol, 2-ethoxy-, benzenesulfonate |
26195 |
Ethanol, 2-hydrazino- |
3301 |
Ethanol, 2-mercapto- |
26211 |
Ethanol, 2-methoxy- |
26708 |
Ethanol, 2-methoxy-, acetate |
32664 |
Ethanol, 2-phenoxy- |
74435 |
Ethanone, 1-(1-methyl-1H-pyrrol-2-yl)- |
74906 |
Ethanone, 1-(1-naphthalenyl)- |
1714588 |
Ethanone, 1-(2,3,4-trichlorophenyl)- |
50336 |
Ethanone, 1-(2,3,4-trihydroxyphenyl)- |
1714615 |
Ethanone, 1-(2,3,4-trimethoxyphenyl)- |
90449 |
Ethanone, 1-(2,4,6-trimethylphenyl)- |
99143 |
Ethanone, 1-(2,4-dichlorophenyl)- |
102970 |
Ethanone, 1-(2,5-dichlorophenyl)- |
1714341 |
Ethanone, 1-(2,5-dimethyl-3-furanyl)- |
80655 |
Ethanone, 1-(2-furanyl)- |
30452 |
Ethanone, 1-(2-hydroxyphenyl)- |
14654 |
Ethanone, 1-(2-naphthalenyl)- |
18440 |
Ethanone, 1-(3-aminophenyl)- |
11700 |
Ethanone, 1-(3-ethyl-5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)- |
31898 |
Ethanone, 1-(3-hydroxyphenyl)- |
43190 |
Ethanone, 1-(3-pyridinyl)- |
19026 |
Ethanone, 1-(4-aminophenyl)- |
19000 |
Ethanone, 1-(4-bromophenyl)- |
19018 |
Ethanone, 1-(4-chlorophenyl)- |
90589 |
Ethanone, 1-(4-ethoxyphenyl)- |
44941 |
Ethanone, 1-(4-fluorophenyl)- |
19034 |
Ethanone, 1-(4-hydroxyphenyl)- |
19158 |
Ethanone, 1-(4-methoxyphenyl)- |
79152 |
Ethanone, 1-(4-pyridinyl)- |
1714449 |
Ethanone, 1,2-bis(4-methoxyphenyl)- |
36509 |
Ethanone, 1-[1,1'-biphenyl]-4-yl-2-bromo- |
1714447 |
Ethanone, 1-[2-methyl-5-(1-methylethyl)phenyl]- |
8615 |
Ethanone, 1-[4-(1,1-dimethylethyl)-2,6-dimethyl-3,5-dinitrophenyl]- |
1714305 |
Ethanone, 1-[4-(1-piperidinyl)phenyl]- |
17152836 |
Ethanone, 1-[4-(methylthio)phenyl]- |
1714407 |
Ethanone, 1-benzo[b]thien-3-yl- |
18333 |
Ethanone, 1-phenyl- |
105734 |
Ethanone, 2,2-dichloro-1-phenyl- |
1714760 |
Ethanone, 2-[[4-(2,4-dichloro-3-methylbenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy]-1-(4-methylphenyl)- |
1714757 |
Ethanone, 2-[[4-(2,4-dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy]-1-phenyl- |
1714448 |
Ethanone, 2-bromo-1-(2,5-dimethoxyphenyl)- |
18895 |
Ethanone, 2-bromo-1-(4-bromophenyl)- |
103184 |
Ethanone, 2-bromo-1-(4-hydroxyphenyl)- |
18937 |
Ethanone, 2-bromo-1-(4-nitrophenyl)- |
4572 |
Ethanone, 2-bromo-1-phenyl- |
45849 |
Ethanone, 2-chloro-1,2-diphenyl- |
50740 |
Ethanone, 2-chloro-1-phenyl- |
30726 |
Ethanone, 2-hydroxy-1,2-diphenyl- |
17153404 |
Ethanone, 2-phenyl-1-(2,4,6-trimethylphenyl)- |
5090 |
Ethene |
26948 |
Ethene, (2-chloroethoxy)- |
5240353 |
Ethene, (methylsulfonyl)- |
650192 |
Ethene, 1,1-dibromo- |
5538 |
Ethene, 1,1-dichloro- |
51904 |
Ethene, 1,2-dichloro- |
40469 |
Ethene, 1,2-dichloro-, (1E)- |
5231 |
Ethene, chloro- |
7724 |
Ethene, tetrabromo- |
34157 |
Ethene, tetrachloro- |
57992 |
Ethene, tribromo- |
7526 |
Ethene, trichloro- |
161190 |
Ethenol, homopolymer |
1898881 |
Etheostoma caeruleum |
1898915 |
Etheostoma exile |
1898923 |
Etheostoma flabellare |
17097353 |
Etheostoma fonticola |
1898956 |
Etheostoma nigrum |
1898980 |
Etheostoma spectabile |
17085754 |
Etroplus maculatus |
17082363 |
Etroplus suratensis |
1949981 |
Eualus |
17085739 |
Eualus suckleyi |
17110982 |
Euastrum verrucosum |
17079005 |
Eubostrichus dianeae |
17085838 |
Eucalanus |
17092974 |
Eucalanus elongatus |
17104639 |
Eucalyptus bicostata |
17114281 |
Eucalyptus blakelyi |
17104647 |
Eucalyptus camaldulensis |
17104654 |
Eucalyptus citriodora |
17104662 |
Eucalyptus delegatensis |
17114299 |
Eucalyptus dumosa |
17111394 |
Eucalyptus eximia |
17114307 |
Eucalyptus fastigata |
17104670 |
Eucalyptus glaucescens |
17104688 |
Eucalyptus globulus |
17117458 |
Eucalyptus maculata |
17104696 |
Eucalyptus microtheca |
17104704 |
Eucalyptus nitens |
17104712 |
Eucalyptus obliqua |
17104720 |
Eucalyptus pauciflora |
17114315 |
Eucalyptus pilularus |
17104738 |
Eucalyptus polyanthemos |
17104746 |
Eucalyptus populnea |
17104753 |
Eucalyptus regnans |
17104761 |
Eucalyptus rubida |
17110628 |
Eucalyptus sp. |
17104779 |
Eucalyptus viminalis |
17093428 |
Eucephalobus sp. |
17088766 |
Euchaeta marina |
1923788 |
Eucinostomus argenteus |
1923796 |
Eucinostomus gula |
1869502 |
Eucyclops |
1869510 |
Eucyclops agilis |
17095910 |
Eucyclops serrulatus |
17097486 |
Eucyclops speratus |
17094582 |
Eucypris sp. |
17090598 |
Eudiaptomus |
17077256 |
Eudiaptomus gracilis |
17081050 |
Eudiaptomus graciloides |
17077934 |
Eudiaptomus padanus padanus |
1940121 |
Eudistylia vancouveri |
1857234 |
Eudorina |
1857242 |
Eudorina elegans |
17094459 |
Eudrilus eugeniae |
17094749 |
Eudrilus sp. |
17114323 |
Eugenia dombeyi, Skeels |
17114331 |
Eugenia jambolana |
1858018 |
Euglena |
17099417 |
Euglena acus |
17098351 |
Euglena gracilis |
17101759 |
Euglena spirogyra |
17099847 |
Euglena viridis |
1879881 |
Eukiefferiella |
1879923 |
Eukiefferiella coerulescens |
1865070 |
Eulalia (Phylum Annelida) |
17081134 |
Eulimnadia |
17089855 |
Eumeces fasciatus |
1865120 |
Eumida sanguinea |
1854421 |
Eunotia exigua |
1854546 |
Eunotia sudetica incisa |
17104787 |
Euonymus fortunei |
17104795 |
Euonymus fortunei radicans |
17104803 |
Euonymus japonica |
17111725 |
Eupatorium cannabinum |
17109109 |
Eupatorium capillifolium |
17087321 |
Eupera singleyi |
17097908 |
Euphagus cyanocephalus |
17076936 |
Euphausia pacifica |
17104811 |
Euphorbia esula |
17104829 |
Euphorbia heterophylla |
17104837 |
Euphorbia pulcherrima |
17090770 |
Euplotes |
17091331 |
Euplotes aediculatus |
17086497 |
Euplotes affinis |
17086505 |
Euplotes patella |
17078551 |
Euplotes vannus |
17092131 |
Eupomatis gibbosus |
150102 |
Europium |
166447 |
Europium chloride (EuCl3) |
1868975 |
Eurycercus lamellatus |
17118498 |
Eurydice longicornis |
17095928 |
Eurydice pulchra |
1890706 |
Eurypanopeus depressus |
17080706 |
Eurystomia |
1869452 |
Eurytemora affinis |
17090176 |
Eurythoe complanata |
17096397 |
Excirolana sp. |
17084336 |
Exosphaeroma truncatitelson |
17099466 |
Exuviella baltica |
17118563 |
Eylais hamata |
17095126 |
Eyprepocnemis plorans |
1858372 |
Fabaceae |
17092883 |
Fabrea salina |
17104845 |
Fagopyrum esculentum |
17114372 |
Fagopyrum tataricum |
17104852 |
Fagus sylvatica |
1924257 |
Falco sparverius |
17090523 |
Falco tinnunculus |
1714724 |
Fastusol C Blue 77P |
158691 |
Fats and Glyceridic oils, fish |
962035 |
Fats and Glyceridic oils, margosa |
509810 |
Fats and Glyceridic oils, salmon |
158154 |
Fats and Glyceridic oils, sesame |
502294 |
Fats and Glyceridic oils, vegetable |
363028 |
Fatty acids, C6-12, Me esters |
320739 |
Fatty acids, tall-oil, epoxidized, octyl esters |
17086398 |
Favia fragum |
17088964 |
Favites chinensis |
17118704 |
Faxonella clypeata |
17089277 |
Felis catus |
17088881 |
Ferosagitta hispida |
204206 |
Ferrate(1-), [[.alpha.,.alpha.'-[1,2-ethanediyldi(imino-.kappa.N)]bis[2-(hydroxy-.kappa.O)benzeneacetato-.kappa.O]](4-)]-, sodium |
1714736 |
Ferrate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, (OC-6-21)- |
201038 |
Ferrate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, sodium, (OC-6-21)- |
204396 |
Ferrate(1-), [N-[2-[bis[(carboxy-.kappa.O)methyl]amino-.kappa.N]ethyl]-N-[2-(hydroxy-.kappa.O)ethyl]glycinato(3-)-.kappa.N,.kappa.O]-, sodium |
182030 |
Ferrate(2-), [rel-[N(R)]-N-[2-[bis[(carboxy-.kappa.O)methyl]amino-.kappa.N]ethyl]-N-[2-[(S)-[(carboxy-.kappa.O)methyl](carboxymethyl)amino-.kappa.N]ethyl]glycinato(5-)-.kappa.N,.kappa.O]-, sodium hydrogen, (PB-7-13-12564)- |
195271 |
Ferrate(2-), pentakis(cyano-.kappa.C)nitrosyl-, disodium, (OC-6-22)- |
190439 |
Ferrate(3-), hexakis(cyano-.kappa.C)-, tripotassium, (OC-6-11)- |
214692 |
Ferrate(3-), tris[5,6-dihydro-5-(hydroxyimino-.kappa.N)-6-(oxo-.kappa.O)-2-naphthalenesulfonato(2-)]-, trisodium |
192591 |
Ferrate(4-), hexakis(cyano-.kappa.C)-, tetrapotassium, (OC-6-11)- |
189258 |
Ferrate(4-), hexakis(cyano-.kappa.C)-, tetrasodium, (OC-6-11)- |
1908136 |
Ferrissia |
162677 |
Ferritin |
17109703 |
Festuca |
17114380 |
Festuca arizonica |
17104878 |
Festuca ovina |
17104894 |
Festuca rubra |
17109695 |
Festuca rubra rubra |
17104902 |
Ficus carica |
17112996 |
Ficus sp. |
17093832 |
Filenchus sp. |
1915065 |
Filinia |
1924323 |
Filinia terminalis |
17111733 |
Filipendula ulmaria |
17096314 |
Filopaludina sp. |
650945 |
FireMaster BP 6 |
363770 |
FireMaster FF 1 |
17152463 |
Firezyme |
17100363 |
Fischerella musicola |
17116625 |
Fissidens polyphyllus |
17117763 |
Flabellospora sp. |
17104910 |
Flacourtia indica |
17117565 |
Flagellospora penicillioides |
17109117 |
Flourensia cernua |
17153800 |
FLR 100 |
1910066 |
Fluminicola virens |
40691 |
Fluoranthene |
206706 |
Fluoride |
154286 |
Fluorine |
17093162 |
Folsomia candida |
17093725 |
Folsomia fimetaria |
17095571 |
Folsomia manolachei |
17094301 |
Folsomia quadrioculata |
17094269 |
Folsomides parvulus |
17099193 |
Fontinalis antipyretica |
17112095 |
Fontinalis dalecarlica |
17111113 |
Fontinalis hypnoides |
17102088 |
Fontinalis squamosa |
17082769 |
Foraminiferida |
17103045 |
Forestiera acuminata |
17097023 |
Forficula auricularia |
1008 |
Formaldehyde |
962654 |
Formamide, N-(2,2,2-trichloro-1-((3,4-dichlorophenyl)amino)ethyl)- |
240960 |
Formamide, N,N'-[1,4-piperazinediylbis(2,2,2-trichloroethylidene)]bis- |
69385 |
Formamide, N,N-dibutyl- |
4416 |
Formamide, N,N-dimethyl- |
59006 |
Formamide, N,N-diphenyl- |
694513 |
Formamide, N-[2,2,2-trichloro-1-(4-morpholinyl)ethyl]- |
3830 |
Formic acid |
63537 |
Formic acid, 1-methylethyl ester |
93286 |
Formic acid, 2-propenyl ester |
52753 |
Formic acid, cobalt(2+) salt |
26278 |
Formic acid, ethyl ester |
38349 |
Formic acid, sodium salt |
17083288 |
Formicidae |
17113010 |
Forsythia sp. |
17102211 |
Forsythia x intermedia |
17114406 |
Fortunella hindsii |
17114398 |
Fortunella x crassifolia |
1908292 |
Fossaria |
1908318 |
Fossaria cubensis |
1908326 |
Fossaria humilis |
17109711 |
Fragaria |
17102229 |
Fragaria chiloensis |
17102237 |
Fragaria virginiana |
1854082 |
Fragilaria |
1854108 |
Fragilaria capucina |
17116914 |
Fragilaria construens subsalina |
1854124 |
Fragilaria crotonensis |
1854140 |
Fragilaria pinnata |
1924562 |
Fragilaria virescens |
1856061 |
Franceia |
17109729 |
Fraxinus |
17114430 |
Fraxinus americana |
17102245 |
Fraxinus excelsior |
17114448 |
Fraxinus oxycarpa Willd |
17102252 |
Fraxinus pennsylvanica |
17102260 |
Fraxinus uhdei |
17102278 |
Fraxinus velutina |
17113036 |
Freesia sp. |
17113044 |
Fuchsia sp. |
17112186 |
Fucus |
17099433 |
Fucus distichus |
17116005 |
Fucus evanescens |
17099011 |
Fucus serratus |
17101551 |
Fucus spiralis |
17099029 |
Fucus vesiculosus |
17117250 |
Fucus virsoides |
439166 |
Fuel gases, crude oil distillates |
439174 |
Fuel oil, no. 2 |
420257 |
Fuels, diesel |
439216 |
Fuels, diesel, no. 2 |
17081837 |
Fugo niphobles |
17095746 |
Fulgoridae |
17108499 |
Fumaria vaillantii |
1899525 |
Fundulus |
17078460 |
Fundulus confluentus |
1899533 |
Fundulus diaphanus |
1924620 |
Fundulus grandis |
1899541 |
Fundulus heteroclitus |
1899558 |
Fundulus majalis |
1899566 |
Fundulus notatus |
17082504 |
Fundulus ocellaris |
17085481 |
Fundulus parvipinnis |
17076829 |
Fundulus similis |
763920 |
Fungi |
17096876 |
Fungia scutaria |
26328 |
Furan |
91090 |
Furan, 2,5-dihydro- |
63578 |
Furan, 2,5-dimethyl- |
75218 |
Furan, 2,5-diphenyl- |
17151838 |
Furan, 2-[(phenylmethoxy)methyl]- |
51086 |
Furan, 2-methyl- |
17122045 |
Furan, methyl- |
26310 |
Furan, tetrahydro- |
1714716 |
Furan, tetrahydro-2,2,5,5-tetramethyl- |
16865 |
Furan, tetrahydro-2-methyl- |
239574 |
Furancarboxylic acid |
17295080 |
Furo[3,4-e]-1,3-benzodioxol-8(6H)-one, 6-[(5S)-5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-, (6R)- |
17117508 |
Fusarium oxysporum |
17117714 |
Fusarium udum |
168666 |
Gadolinium chloride (GdCl3) |
178533 |
Gadolinium oxide (Gd2O3) |
17077694 |
Gadus morhua |
17097742 |
Gadus ogac |
17083510 |
Gafrarium divaricatum |
17079302 |
Gaidropsarus capensis |
17108507 |
Gaillardia pulchella |
50211 |
Galactaric acid |
17101858 |
Galaxaura marginata |
17085077 |
Galaxias auratus |
17118100 |
Galaxias fasciatus |
17084609 |
Galaxias maculatus |
17085986 |
Galaxias truttaceous |
17085895 |
Galba truncatula |
17079955 |
Galeicthys felis |
17109125 |
Galinsoga parviflora |
17109133 |
Galinsoga quadriradiata |
17114455 |
Galinsoga sp. |
17108952 |
Galium aparine |
17111741 |
Galium palustre |
150128 |
Gallium |
186445 |
Gallium chloride (GaCl3) |
17089566 |
Gallus domesticus |
17090457 |
Gallus gallus |
17090465 |
Gallus sp. |
17092727 |
Gamasina |
1899616 |
Gambusia |
1899624 |
Gambusia affinis |
17076365 |
Gambusia affinis affinis |
1924661 |
Gambusia holbrooki |
1714382 |
Gamlen OSR |
1893122 |
Gammaridae |
1893213 |
Gammarus |
17076886 |
Gammarus aequicauda |
1924695 |
Gammarus annulatus |
1969625 |
Gammarus duebeni |
1893221 |
Gammarus fasciatus |
17076183 |
Gammarus fossarum |
17087842 |
Gammarus italicus |
17085945 |
Gammarus kischineffensis |
17079484 |
Gammarus komareki |
1893239 |
Gammarus lacustris |
17077017 |
Gammarus limnaeus |
1969609 |
Gammarus locusta |
17084484 |
Gammarus minus |
1893247 |
Gammarus mucronatus |
1924711 |
Gammarus oceanicus |
1893262 |
Gammarus pseudolimnaeus |
17076662 |
Gammarus pulex |
17088642 |
Gammarus pulex pulex |
17075854 |
Gammarus roeseli |
17076340 |
Gammarus salinus |
1969617 |
Gammarus setosus |
1893270 |
Gammarus tigrinus |
17092479 |
Gammarus zaddachi |
17108416 |
Gardenia angusta |
17083759 |
Garra gotyla gotyla |
17083981 |
Garra mullya |
340752 |
Gas oils (petroleum), straight-run |
157628 |
Gasoline, natural |
1924729 |
Gasterosteus aculeatus |
17089863 |
Gastrophryne carolinensis |
1908029 |
Gastropoda |
17078072 |
Gastrosaccus psammodytes |
17114463 |
Gaura coccinea |
17102286 |
Gazania rigens |
160481 |
Gelatins |
17117151 |
Gelidium pusillum |
961466 |
Gentamicin |
17090317 |
Geocoris |
17079070 |
Geodia cydonium |
17089442 |
Geopelia striata |
17085820 |
Geophagus brasiliensis |
17097338 |
Geophilomorpha |
372128 |
Geotrichum candidum |
17083015 |
Gephyroglanis velifer |
17102294 |
Geranium carolinianum |
17151770 |
Geranol |
166983 |
Germane, tetrachloro- |
150136 |
Germanium |
82602 |
Germanium oxide (GeO2) |
17088972 |
Gerres cinereus |
1884535 |
Gerridae |
1884543 |
Gerris |
17118357 |
Gerris lacustris |
1884576 |
Gerris remigis |
1903756 |
Geukensia demissa |
17114471 |
Geum rossii |
17153180 |
Gibb-2-ene-1,10-dicarboxylic acid, 4a,7-dihydroxy-1-(hydroxymethyl)-8-methylene-, 1,4a-lactone, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
6437 |
Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
961144 |
Gibb-3-ene-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
17153172 |
Gibbane-1,1,10-tricarboxylic acid, 4a,7-dihydroxy-8-methylene-, 1,4a-lactone, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
1714430 |
Gibbane-1,10-dicarboxylic acid, 1,4a-dimethyl-8-methylene-, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
17153511 |
Gibbane-1,10-dicarboxylic acid, 2,3-epoxy-4a,7-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,3.beta.,4a.alpha.,4b.beta.,10.beta.)- |
17153529 |
Gibbane-1,10-dicarboxylic acid, 2,3-epoxy-4a-hydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,3.beta.,4a.alpha.,4b.beta.,10.beta.)- |
961102 |
Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)- |
1714593 |
Gibbane-1,10-dicarboxylic acid, 4a-(hydroxymethyl)-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
17153495 |
Gibbane-1,10-dicarboxylic acid, 4a,7-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
17153610 |
Gibbane-1,10-dicarboxylic acid, 4a-formyl-1-methyl-8-methylene-, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
17294851 |
Gibbane-1,10-dicarboxylic acid, 4a-hydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,4a.alpha.,4b.beta.,10.beta.)- |
17075748 |
Gibbula cineraria |
17077421 |
Gibbula umbilicalis |
17104928 |
Gigantochloa apus |
1961333 |
Gila atraria |
17076449 |
Gila copei |
1961408 |
Gila elegans |
1916493 |
Gillia altilis |
17081613 |
Gillichthys mirabilis |
689810 |
Gilsonite |
17075631 |
Ginglymostoma cirratum |
17078536 |
Girella punctata |
17113069 |
Gladiolus sp. |
17115676 |
Glandularia bipinnatifida |
17111295 |
Glaucocystis nostochinearum |
17089574 |
Glaucomys sabrinus |
17078288 |
Glebula rotundata |
17104936 |
Gleditsia triacanthos |
1858638 |
Glenodinium |
17101627 |
Glenodinium halli |
17093931 |
Globodera rostochiensis |
17112285 |
Gloeocystis ampla |
17099938 |
Gloeocystis grevillei |
17100389 |
Gloeocystis vesiculosa |
17101635 |
Gloeotaenium loitlesbergerianu |
17100041 |
Gloeotrichia echinulata |
17118076 |
Gloeotrichia sp. |
17093550 |
Glomeris conspersa |
1860964 |
Glossiphonia complanata |
1881986 |
Glossosoma |
17272766 |
Glutamic acid, 2-methyl- |
1862853 |
Glycera dibranchiata |
17112103 |
Glyceria borealis |
2154 |
Glycine |
17104944 |
Glycine max |
53892 |
Glycine, glycyl- |
147116 |
Glycine, hydriodide (4:1), compd. with iodine (4:5) |
4580 |
Glycine, L-.gamma.-glutamyl-L-cysteinyl- |
1714463 |
Glycine, L-.gamma.-glutamyl-L-cysteinyl-, bimol. (2.fwdarw.2')-disulfide |
32581 |
Glycine, N-(4-hydroxyphenyl)- |
17273368 |
Glycine, N-(aminoiminomethyl)- |
2378 |
Glycine, N-(aminoiminomethyl)-N-methyl- |
650416 |
Glycine, N-(carboxymethyl)-N-(phosphonomethyl)- |
277590 |
Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, ethyl ester |
77438 |
Glycine, N-(phosphonomethyl)- |
277277 |
Glycine, N-(phosphonomethyl)-, compd. with 2-propanamine (1:1) |
1714748 |
Glycine, N-(phosphonomethyl)-, compd. with N-methylmethanamine (1:1) |
593202 |
Glycine, N-(phosphonomethyl)-, ion(1-), trimethylsulfonium |
16535 |
Glycine, N,N'-(1,2-dithioxo-1,2-ethanediyl)bis- |
3228 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)- |
218701 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, diammonium salt |
37408 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, disodium salt |
17125121 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, disodium salt, dihydrate |
208249 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, monosodium salt |
221960 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetraammonium salt |
3798 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrasodium salt |
1714553 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrasodium salt, tetrahydrate |
40014 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, trisodium salt |
1714428 |
Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, trisodium salt, mixt. with dodecanamide |
37374 |
Glycine, N,N-bis(carboxymethyl)- |
199802 |
Glycine, N,N-bis(carboxymethyl)-, disodium salt |
167080 |
Glycine, N,N-bis(carboxymethyl)-, sodium salt |
129148 |
Glycine, N,N-bis(carboxymethyl)-, trisodium salt |
102293 |
Glycine, N,N-bis(phosphonomethyl)- |
4226 |
Glycine, N,N-bis[2-[bis(carboxymethyl)amino]ethyl]- |
37598 |
Glycine, N,N-bis[2-[bis(carboxymethyl)amino]ethyl]-, pentasodium salt |
40022 |
Glycine, N-[2-[bis(carboxymethyl)amino]ethyl]-N-(2-hydroxyethyl)- |
47860 |
Glycine, N-benzoyl- |
24760 |
Glycine, N-methyl- |
36871 |
Glycine, N-methyl-N-(1-oxododecyl)-, sodium salt |
17076241 |
Glycymeris yessoensis |
1878339 |
Glyptotendipes barbipes |
17085515 |
Glyptotendipes pallens |
1878362 |
Glyptotendipes paripes |
17084153 |
Gnathonemus petersi |
17087073 |
Gnathonemus tamandua |
17084963 |
Gnathopogon coerulescens |
17078973 |
Gnathostomula microstyle |
17078965 |
Gnathostomula tuckeri |
17080300 |
Gnorimosphaeroma oregonensis |
1898535 |
Gobiidae |
17079898 |
Gobio gobio |
17097957 |
Gobiocypris rarus |
17098013 |
Gobiomorphus cotidianus |
17098005 |
Gobiomorphus huttoni |
17081654 |
Gobiosoma bosc |
17090606 |
Gobius |
17085689 |
Gobius niger |
17075771 |
Gobiusculus flavescens |
1878438 |
Goeldichironomus holoprasinus |
150144 |
Gold |
1855865 |
Golenkinia |
17100116 |
Golenkinia minutissima |
1855881 |
Golenkinia radiata |
1885599 |
Gomphidae |
1854595 |
Gomphonema |
1854629 |
Gomphonema olivaceum |
1854637 |
Gomphonema parvulum |
17112665 |
Gomphonema tenellum |
17078262 |
Gomphurus vastus |
1857515 |
Gonatozygon |
17100249 |
Gongrosira |
17095068 |
Goniada emerita |
1911247 |
Goniobasis |
17096017 |
Goniobasis clavaeformis |
17116385 |
Goniotrichum alsidii |
1857259 |
Gonium |
1857267 |
Gonium pectorale |
17098054 |
Gonyaulax |
17101510 |
Gonyaulax polyedra |
17100678 |
Gonyaulax tamarensis |
17089871 |
Gopherus polyphemus |
17104951 |
Gossypium barbadense |
17104969 |
Gossypium hirsutum |
17109737 |
Gossypium sp. |
1714485 |
Gossypol acetic acid |
17152471 |
Grabber A |
17116807 |
Gracilaria changii |
17116393 |
Gracilaria edulis |
17116815 |
Gracilaria salicornia |
17116831 |
Gracilaria sp. |
17117441 |
Gracilaria tenuistipitata |
17117110 |
Gracilaria tikvahiae |
17101775 |
Gracilaria verrucosa |
17116401 |
Grammatophora sp. |
17092735 |
Grammonota inornata |
1714609 |
Gran Control |
1892918 |
Grandidierella |
1948298 |
Grandidierella japonica |
17075714 |
Grantia compressa |
1924968 |
Graptoleberis testudinaria |
17111121 |
Grateloupia doryphora |
17098823 |
Groenlandia densa |
17156324 |
Grotan |
17086653 |
Grus canadensis |
17083304 |
Gryllidae |
17093766 |
Gryllus pennsylvanicus |
1714409 |
Guanidine |
17273251 |
Guanidine, (4-aminobutyl)- |
102251 |
Guanidine, dodecyl-, monoacetate |
188847 |
Guanidine, dodecyl-, monohydrochloride |
214304 |
Guanidine, monohydrobromide |
1016 |
Guanidine, monohydrochloride |
17121674 |
Guanidine, N,N'''-(iminodi-8,1-octanediyl)bis- |
17273186 |
Guanidine, N,N'''-1,10-decanediylbis-, dihydrochloride |
20552 |
Guanidine, N,N'-diphenyl- |
1714529 |
Guanidine, N-butyl-N'-nitro-N-nitroso- |
54056 |
Guanidine, nitro- |
4606 |
Guanidine, N-methyl-N'-nitro-N-nitroso- |
1714528 |
Guanidine, N'-nitro-N-nitroso-N-propyl- |
160390 |
Guar gum |
964148 |
Guazatine |
160291 |
Gum arabic |
17115742 |
Gutierrezia sarothrae |
17104977 |
Guzmania lingulata |
17078684 |
Gymnocephalus cernua |
17077025 |
Gymnocorymbus ternetzi |
1858679 |
Gymnodinium |
17098047 |
Gymnodinium breve |
17098716 |
Gymnodinium splendens |
1908557 |
Gyraulus |
1916543 |
Gyraulus circumstriatus |
1873165 |
Gyrinidae |
1873298 |
Gyrinus |
17118415 |
Gyrinus marinus |
17076209 |
Gyrinus natator |
17080573 |
Gyrinus punctellus |
17090788 |
Gyrodactylus |
17092339 |
Gyrodactylus salaris |
17100611 |
Gyrodinium |
17116310 |
Gyrodinium fissum |
17100934 |
Gyrosigma spencerii |
1857168 |
Haematococcus |
17101098 |
Haematococcus capensis |
17100447 |
Haematococcus droebakensis |
17099961 |
Haematococcus lacustris |
17101643 |
Haematococcus pluvialis |
1916568 |
Haemopis marmorata |
17081316 |
Haemopis sanguisuga |
17088998 |
Haemulon |
17086133 |
Haemulon flavolineatum |
17086141 |
Haemulon sciurus |
17093436 |
Hahnia cinerea |
17114489 |
Hakea eriantha |
1925031 |
Haliaeetus leucocephalus |
17076258 |
Halichoeres poecilopterus |
1964576 |
Halichondria panicea |
1970425 |
Halicryptus spinulosus |
17112756 |
Halimione portulacoides |
17090184 |
Haliotis |
17081589 |
Haliotis cracherodii |
17088048 |
Haliotis discus |
17090796 |
Haliotis fulgens |
17079674 |
Haliotis gigantea |
17081332 |
Haliotis rufescens |
1873397 |
Haliplidae |
17118399 |
Haliplus flavicollis |
17097551 |
Haliplus sp. |
17085705 |
Halobatrachus didactylus |
17101676 |
Halochlorococcum saccatum |
17102138 |
Halodule uninervis |
17102146 |
Halophila ovalis |
17111030 |
Halophila stipulacea |
17097262 |
Halotydeus destructor |
17005414 |
Halowax 1000 |
17005422 |
Halowax 1001 |
1714489 |
Halowax 1013 |
1714490 |
Halowax 1014 |
712067 |
Halowax 1099 |
17091497 |
Halteria |
17114497 |
Hamamelis virginiana |
17148214 |
HAN |
17112483 |
Hantzschia amphioxys pusilla |
17101718 |
Hapalosiphon fontinalis |
17118068 |
Hapalosiphon sp. |
17101734 |
Hapalosiphon welwitschii |
17085267 |
Haplochromis burtoni |
1864420 |
Haploscoloplos foliosus |
1859156 |
Haplotaxida |
1925098 |
Harengula jaguana |
1869544 |
Harpacticoida |
17097155 |
Harpalus caliginosus |
17090325 |
Harpalus pensylvanicus |
17094764 |
Harpalus rufipes |
17097163 |
Harpalus somnulentus |
17097171 |
Harpalus sp. |
17116500 |
Haslea sp. |
17104985 |
Hebe sp. |
17104993 |
Hedera canariensis |
17109745 |
Hedera helix |
17114513 |
Hedera helix baltica |
17113119 |
Hedera sp. |
17087081 |
Hediste diversicolor |
17106519 |
Helianthus annuus |
17109141 |
Helianthus ciliaris |
17106527 |
Helianthus tuberosus |
17078247 |
Helichus striatus |
1882018 |
Helicopsyche |
1882026 |
Helicopsyche borealis |
17117623 |
Helicosporium |
17075847 |
Heliocidaris erythrogramma |
17081472 |
Heliodiaptomus viduus |
1908573 |
Helisoma |
1908581 |
Helisoma anceps |
17089889 |
Helix aspersa |
1861020 |
Helobdella stagnalis |
17091661 |
Heloecius cordiformis |
1875210 |
Helophorus |
17096587 |
Hemibagrus nemurus |
17088931 |
Hemibarbus barbus |
17088659 |
Hemicentrotus pulcherrimus |
1903343 |
Hemichordata |
17082231 |
Hemichromis fasciatus |
17089780 |
Hemifusus tuba |
1951615 |
Hemigrapsus |
1951623 |
Hemigrapsus nudus |
1951631 |
Hemigrapsus oregonensis |
763185 |
Hemiptera |
17101262 |
Hemiselmis virescens |
17076274 |
Hepsetus odoe |
52455300 |
Heptacarpus pictus |
64915 |
Heptadecane |
1870872 |
Heptagenia |
1870898 |
Heptagenia flavescens |
17091125 |
Heptagenia sulphurea |
1870799 |
Heptageniidae |
27805 |
Heptanal |
64709 |
Heptanal, oxime |
38984 |
Heptane |
64576 |
Heptane, 1-bromo- |
187443 |
Heptane, 2,2,4,6,6-pentamethyl- |
17152075 |
Heptanedinitrile, 4-acetyl-4-methyl- |
1714419 |
Heptanedinitrile, 4-acetyl-4-phenyl- |
27292 |
Heptanedioic acid |
27276 |
Heptanoic acid |
307553 |
Heptanoic acid, 2,6-dibromo-4-cyanophenyl ester |
299255 |
Heptanol |
232199 |
Heptene |
17114521 |
Heracleum sphondylium |
1943679 |
Hermissenda crassicornis |
17097783 |
Heros severus |
17077728 |
Herotilapia multispinosa |
17083627 |
Herpobdella octoculata |
1888031 |
Hesperoperla |
1888049 |
Hesperoperla pacifica |
1883198 |
Hesperophylax |
17081142 |
Heterandria formosa |
17100843 |
Heteranthera |
17115791 |
Heteranthera limosa |
17111261 |
Heterocapsa pygmaea |
17117375 |
Heterocephalobus pauciannulatus |
17093949 |
Heterocephalobus sp. |
17077140 |
Heterocypris incongruens |
1861913 |
Heteromastus filiformis |
17094103 |
Heteromurus nitidus |
17079328 |
Heteromycteris capensis |
1896372 |
Heteromysis formosa |
17096306 |
Heteropanope sp. |
17118944 |
Heteropneustes fossilis |
17112392 |
Heterosigma akashiwo |
17114539 |
Heterotheca subaxillaris |
17116773 |
Heterozostera tasmanica |
17105008 |
Hevea brasiliensis |
52852 |
Hexadecane |
128033 |
Hexadecane, 1-chloro- |
52860 |
Hexadecane, 1-iodo- |
2428 |
Hexadecanoic acid |
211235 |
Hexadecanoic acid, 2-bromo- |
1870120 |
Hexagenia |
1870146 |
Hexagenia bilineata |
1870153 |
Hexagenia limbata |
1870195 |
Hexagenia munda orlando |
1870203 |
Hexagenia rigida |
4085 |
Hexanal |
26740 |
Hexane |
139535 |
Hexane, 1,1'-thiobis- |
27375 |
Hexane, 1-bromo- |
688309 |
Hexane, 2,2,5-trimethyl- |
27789 |
Hexanedinitrile |
33340 |
Hexanedioic acid |
21238 |
Hexanedioic acid, bis(2-ethylhexyl) ester |
109785 |
Hexanedioic acid, di-2-propenyl ester |
23192 |
Hexanedioic acid, dibutyl ester |
38265 |
Hexanedioic acid, diethyl ester |
64220 |
Hexanedioic acid, dimethyl ester |
42945 |
Hexanedioic acid, octafluoro- |
64436 |
Hexanenitrile |
38877 |
Hexanoic acid |
39925 |
Hexanoic acid, 2-ethyl- |
114322 |
Hexanoic acid, 3,5,5-trimethyl- |
3350 |
Hexanoic acid, 6-amino- |
33084 |
Hexanoic acid, ethyl ester |
23820 |
Hexanoic acid, methyl ester |
167387 |
Hexanoic acid, sodium salt |
235812 |
Hexanol |
1925262 |
Hexarthra |
1925270 |
Hexarthra intermedia |
1925288 |
Hexarthra mira |
1714517 |
Hexaryl L 30 |
1881150 |
Hexatoma |
1925304 |
Hiatella arctica |
17105016 |
Hibiscus cannabinus |
17114547 |
Hibiscus ficulneus |
17111659 |
Hibiscus palustris |
17105024 |
Hibiscus rosa-sinensis |
17112319 |
Hijikia fusiforme |
1901107 |
Hiodon alosoides |
17090333 |
Hippodamia convergens |
17084054 |
Hippoglossoides platessoides |
17082884 |
Hippoglossus hippoglossus |
1925346 |
Hirudinea |
17085952 |
Hirudo medicinalis |
17079641 |
Hirudo nipponia |
128751 |
Histidine |
17105032 |
Holcus lanatus |
17105040 |
Holcus mollis |
168674 |
Holmium chloride (HoCl3) |
17079732 |
Holocentropus dubius |
17086158 |
Holocentrus rufus |
1869056 |
Holopedium |
1869064 |
Holopedium gibberum |
1881275 |
Holorusia |
17096553 |
Holothuria edulis |
17084476 |
Holothuria forskali |
1925379 |
Homarus americanus |
17077371 |
Homarus gammarus |
17078007 |
Homarus vulgaris |
4200 |
Homocysteine, S-ethyl- |
17153560 |
Homoserine |
17105057 |
Hordeum jubatum |
17108895 |
Hordeum murinum leporinum |
17111543 |
Hordeum pusillum |
17109752 |
Hordeum sp. |
17105065 |
Hordeum vulgare |
1714523 |
Houghto-Safe 1120 |
17153958 |
Houghto-Safe 520 |
17108945 |
Hoya carnosa |
17105073 |
Humulus lupulus |
17079864 |
Huso huso |
17105081 |
Hyacinthus orientalis |
1893650 |
Hyalella |
1893668 |
Hyalella azteca |
17092230 |
Hyalella curvispina |
1961978 |
Hyalinella punctata |
1900356 |
Hybognathus placitus |
1925411 |
Hybognathus regius |
1883230 |
Hydatophylax argus |
1901982 |
Hydra |
1901990 |
Hydra americana |
17080136 |
Hydra attenuata |
17082405 |
Hydra littoralis |
17076456 |
Hydra oligactis |
17083031 |
Hydra viridis |
17087560 |
Hydra viridissima |
17085085 |
Hydra vulgaris |
17080722 |
Hydracarina |
1868363 |
Hydrachna |
17118456 |
Hydrachna marita |
17091117 |
Hydrachnellae |
17110883 |
Hydrangea |
17105099 |
Hydrangea macrophylla |
41541 |
Hydrazine |
30577 |
Hydrazine, (2,4-dinitrophenyl)- |
19232 |
Hydrazine, (4-nitrophenyl)- |
2469 |
Hydrazine, 1,1-dimethyl- |
50559 |
Hydrazine, 1,1-diphenyl- |
70425 |
Hydrazine, 1,2-bis(2-chlorophenyl)- |
51946 |
Hydrazine, 1,2-dimethyl- |
32425 |
Hydrazine, 1,2-diphenyl- |
1714691 |
Hydrazine, compd. with copper sulfate (CuH2(SO4)2) (2:1) |
3376 |
Hydrazine, methyl- |
689570 |
Hydrazine, monohydrate |
19596 |
Hydrazine, phenyl- |
3186 |
Hydrazine, phenyl-, monohydrochloride |
166959 |
Hydrazine, sulfate (1:1) |
7666 |
Hydrazinecarbothioamide |
2592 |
Hydrazinecarboxamide |
3178 |
Hydrazinecarboxamide, 2-[(5-nitro-2-furanyl)methylene]- |
17151523 |
Hydrazinecarboxamide, 2-cyclohexylidene- |
54601 |
Hydrazinecarboxamide, monohydrochloride |
964577 |
Hydrazinecarboxylic acid, 2-(4-methoxy[1,1'-biphenyl]-3-yl)-, 1-methylethyl ester |
17099409 |
Hydrilla |
17099177 |
Hydrilla verticillata |
1910769 |
Hydrobia |
17094400 |
Hydrobia neglecta |
1925437 |
Hydrobia truncata |
17076142 |
Hydrobia ulvae |
17088055 |
Hydrobia ventrosa |
17118407 |
Hydrobius fuscipes |
1873587 |
Hydrocanthus |
710475 |
Hydrocarbon oils |
152231 |
Hydrochloric acid |
17117185 |
Hydrocotyle leucocephala |
5140 |
Hydrocyanic acid |
17100207 |
Hydrodictyon |
17099607 |
Hydrodictyon reticulatum |
17118886 |
Hydrodroma despiciens |
153015 |
Hydrogen peroxide (H2O2) |
154518 |
Hydrogen sulfide (H2S) |
1866128 |
Hydroides dianthus |
17083452 |
Hydroides elegans |
17095845 |
Hydroperla crosbyi |
17157249 |
Hydroperoxide, 1,2,3,4-tetrahydro-1-naphthalenyl |
8185 |
Hydroperoxide, 1-methyl-1-phenylethyl |
248898 |
Hydroperoxide, 2,6,6-trimethylbicyclo[3.1.1]heptyl |
1874874 |
Hydrophilidae |
1875327 |
Hydrophilus |
1875343 |
Hydrophilus triangularis |
1872753 |
Hydroporus |
1882224 |
Hydropsyche |
17090614 |
Hydropsyche alternans |
17079419 |
Hydropsyche angustipennis |
1882257 |
Hydropsyche betteni |
1882265 |
Hydropsyche bidens |
17087594 |
Hydropsyche bulbifera |
17075300 |
Hydropsyche californica |
52452133 |
Hydropsyche confusa |
17092438 |
Hydropsyche contubernalis |
1882315 |
Hydropsyche elissoma |
17087255 |
Hydropsyche exocellata |
17087248 |
Hydropsyche instabilis |
17087693 |
Hydropsyche lobata |
1882356 |
Hydropsyche occidentalis |
17118589 |
Hydropsyche pellucidulla |
1882398 |
Hydropsyche placoda |
17079518 |
Hydropsyche recurvata |
17087933 |
Hydropsyche siltalai |
1882430 |
Hydropsyche sparna |
1882067 |
Hydropsychidae |
17090622 |
Hydroptila ajax |
17078809 |
Hydroptila angusta |
1882562 |
Hydroptilidae |
355842 |
Hydrothol 191 |
17082470 |
Hydrous atterimus |
1872886 |
Hydrovatus |
17080292 |
Hydrovatus cuspidatus |
156570 |
Hydroxylamine |
133306 |
Hydroxylamine, hydrochloride |
57430 |
Hydroxylamine, O-methyl-, hydrochloride |
313346 |
Hydroxylamine, phosphate (salt) |
167015 |
Hydroxylamine, sulfate (2:1) (salt) |
17083874 |
Hydrozetes lacustris |
1901792 |
Hydrozoa |
17118845 |
Hydryphantes ruber |
17118449 |
Hygrobates longipalpis |
17100660 |
Hygrophila lacustris |
17117219 |
Hygrophila polysperma |
17116559 |
Hygrophila sp. |
1872928 |
Hygrotus |
17118423 |
Hygrotus novemlineatus |
17083296 |
Hygrotus versicolor |
17079625 |
Hyla chrysoscelis |
17080946 |
Hyla crucifer |
17080466 |
Hyla ewingi |
17077033 |
Hyla versicolor |
17075706 |
Hymeniacidon perleve |
17110636 |
Hymenocallis |
17101528 |
Hymenomonas carterae |
17101247 |
Hymenomonas elongata |
762989 |
Hymenoptera |
17079559 |
Hynobius retardatus |
17105107 |
Hypericum androsaemum |
17105115 |
Hypericum calycinum |
17096082 |
Hyperiodrilus sp. |
17086406 |
Hyphessobrycon bifasciatus |
17095761 |
Hyphessobrycon herbertaxelrodi |
17081464 |
Hyphessobrycon serpae |
17097585 |
Hyphessobrycon sovichthys |
17111477 |
Hypnea musciformis |
17116898 |
Hypnomonas sp. |
1714600 |
Hypobromous acid, sodium salt |
650614 |
Hypochlorite |
156364 |
Hypochlorous acid |
153932 |
Hypochlorous acid, calcium salt |
191908 |
Hypochlorous acid, lithium salt |
152512 |
Hypochlorous acid, sodium salt |
17094319 |
Hypogastrura succinea |
17086166 |
Hypomesus olidus |
1961531 |
Hypophthalmichthys molitrix |
1961549 |
Hypophthalmichthys nobilis |
17093444 |
Hypostomus plecostomus |
17093873 |
Hypozetes sp. |
17081621 |
Hypseleotris galii |
17088063 |
Hyriopsis cumingii |
17105123 |
Iberis amara |
17272915 |
Ibogamine, 12-methoxy- |
1898253 |
Ichthyomyzon |
17091182 |
Ichthyophthirius multifilis |
1714505 |
Icoshine |
1900950 |
Ictalurus |
1900968 |
Ictalurus furcatus |
1900976 |
Ictalurus punctatus |
17092347 |
Icthyobodo necator |
1900000 |
Ictiobus cyprinellus |
1896174 |
Idotea |
1925544 |
Idotea balthica |
17078445 |
Idotea balthica basteri |
17087636 |
Idotea emarginata |
17087644 |
Idotea neglecta |
17152489 |
IDX 20 |
17105131 |
Ilex aquifolium |
17105149 |
Ilex cornuta |
17105156 |
Ilex crenata |
17108861 |
Ilex glabra |
17105164 |
Ilex opaca |
17105172 |
Ilex vomitoria |
17075565 |
Illybius augustior |
17118381 |
Ilyocoris cimicoides |
1962034 |
Ilyocryptus |
17085648 |
Ilyodrilus frantzi |
17092594 |
Ilyoplax gangetica |
17131582 |
Imidazo[1,2-a]pyridine-3-sulfonamide, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-2-(ethylsulfonyl)- |
129015 |
Imidazo[2,1-b]thiazole, 2,3,5,6-tetrahydro-6-phenyl- |
1714697 |
Imidazo[2,1-b]thiazole, 2,3,5,6-tetrahydro-6-phenyl-, (6S)- |
17151960 |
Imidazo[2,1-b]thiazole, 2,3,5,6-tetrahydro-6-phenyl-, monohydrochloride, (6S)- |
31476 |
Imidazolidinetrione |
24927 |
Imidodicarbonic diamide |
17105180 |
Impatiens balsamina |
17114554 |
Impatiens glandulifera |
17105198 |
Imperata cylindrica |
40626 |
Indeno[1,2,3-cd]pyrene |
1714723 |
Indiara |
17105206 |
Indigofera suffruticosa |
166462 |
Indium chloride (InCl3) |
17079922 |
Indonaia caerulea |
17077801 |
Indoplanorbis exustus |
1714577 |
Inipol EAP 22 |
17297649 |
Inorganic phosphorus |
1714549 |
Inosine 5'-(tetrahydrogen triphosphate) |
145920 |
Inositol |
1869668 |
Insecta |
17077082 |
Invertebrates |
152538 |
Iodic acid (HIO3), sodium salt |
151456 |
Iodine |
1714721 |
Iodonium, bis(4-fluorophenyl)-, iodide |
17109760 |
Ipomoea |
17111980 |
Ipomoea aquatica |
17105214 |
Ipomoea batatas |
17110479 |
Ipomoea carnea fistulosa |
17105222 |
Ipomoea hederacea |
17105230 |
Ipomoea lacunosa |
17115031 |
Ipomoea nil |
17110552 |
Ipomoea pandurata |
17105248 |
Ipomoea purpurea |
17114562 |
Ipomoea quamoclit |
17114570 |
Ipomoea wrightii |
17108739 |
Iresine diffusa |
17151440 |
Iridate(3-), hexachloro-, trisodium, (OC-6-11)- |
17109778 |
Iris |
17111758 |
Iris pseudacorus |
149559 |
Iron |
17121591 |
Iron chloride |
153502 |
Iron chloride (FeCl2) |
152793 |
Iron chloride (FeCl3) |
1714388 |
Iron hydroxide |
212522 |
Iron hydroxide (Fe(OH)2) |
82479 |
Iron hydroxide (Fe(OH)3) |
82495 |
Iron oxide (Fe2O3) |
86355 |
Iron oxide (FeO) |
83352 |
Iron sulfide (FeS) |
195750 |
Iron, tris(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (OC-6-11)- |
17090192 |
Ironodes lepidus |
1903772 |
Ischadium recurvum |
17092040 |
Ischnochiton hakodadensis |
1888999 |
Ischnura |
17084344 |
Ischnura elegans |
17081720 |
Ischnura heterosticta |
1889047 |
Ischnura verticalis |
17114588 |
Iseilema sp. |
17100322 |
Isochrysis |
17098195 |
Isochrysis galbana |
17114596 |
Isocoma coronopifolia |
232181 |
Isodecanol |
17117326 |
Isoetes lacustris |
1888296 |
Isogenoides |
17077751 |
Isogenus sp. |
17088071 |
Isognomon californicum |
1871425 |
Isonychia |
1916782 |
Isonychia bicolor |
1871466 |
Isonychia sicca |
245837 |
Isooctadecanol |
240796 |
Isooctane |
243089 |
Isooctanol |
1888338 |
Isoperla |
1888346 |
Isoperla bilineata |
17085812 |
Isoperla grammatica |
52452182 |
Isoperla longiseta |
17078213 |
Isoperla signata |
17077504 |
Isoperla slossonae |
1916824 |
Isoperla transmarina |
17087339 |
Isophyllia sinuosa |
1894914 |
Isopoda |
30791 |
Isoquinoline |
3475 |
Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride |
14761 |
Isoquinolinium, 2-dodecyl-, bromide |
17094293 |
Isotoma notabilis |
17094111 |
Isotoma viridis |
1869759 |
Isotomidae |
17094491 |
Isotomiella minor |
1869783 |
Isotomurus palustris |
17121823 |
Isoundecane |
1969427 |
Jaera albifrons |
17087651 |
Jaera nordmanni |
1895382 |
Jaeropsis |
17090341 |
Jalysus spinosus |
1714506 |
Jansolve |
17094699 |
Jappa kutera |
17105255 |
Jasminum fruticans |
17080409 |
Jasus lalandii |
17152497 |
Jet Gell |
17075284 |
Jordanella floridae |
1911254 |
Juga |
17084237 |
Juga plicifera |
17105263 |
Juglans nigra |
17093584 |
Julus scandinavius |
1925650 |
Junco hyemalis |
17099805 |
Juncus |
17112475 |
Juncus acutiflorus |
17111766 |
Juncus articulatus |
17117284 |
Juncus bulbosus |
17116468 |
Juncus diffusissimus |
17111774 |
Juncus effusus |
17105271 |
Juncus gerardii |
17111782 |
Juncus inflexus |
17098625 |
Juncus roemerianus |
17111956 |
Juncus subnodulosus |
17111485 |
Jungermannia |
17105289 |
Juniperus ashei |
17109786 |
Juniperus chinensis |
17105297 |
Juniperus communis |
17105305 |
Juniperus horizontalis |
17114604 |
Juniperus pinchotii |
17105313 |
Juniperus sabina |
17105321 |
Juniperus virginiana |
17105339 |
Kalanchoe blossfeldiana |
17113622 |
Kalanchoe daigremontiana |
17103540 |
Kalanchoe delagoensis |
17103532 |
Kalanchoe pinnata |
1714507 |
Kanechlor 400 |
83501 |
Kaolinite (Al2(OH)4(Si2O5)) |
17079906 |
Katelysia opima |
17115007 |
Keckiella antirrhinoides |
1915172 |
Keratella |
17077561 |
Keratella americana |
1915180 |
Keratella cochlearis |
1915198 |
Keratella quadrata |
17090200 |
Keratella valga |
158055 |
Kerosine (petroleum) |
17095852 |
Kiefferulus sp. |
17089897 |
Kinosternon subrubrum |
1856087 |
Kirchneriella |
17101312 |
Klebsormidium mucosum |
17101478 |
Klebsormidium sp. |
1714354 |
Klofos |
17105347 |
Kochia scoparia |
17109794 |
Koeleria |
17077207 |
Kuhlia sandvicensis |
17078494 |
Labeo bata |
17077363 |
Labeo boga |
17087347 |
Labeo calbasu |
17080227 |
Labeo fimbriatus |
17118480 |
Labeo rohita |
17077744 |
Labeo umbratus |
1899483 |
Labidesthes sicculus |
17088774 |
Labidocera scotti |
17078981 |
Labidognathia longicolis |
17110792 |
Lablab purpureus |
1872977 |
Laccophilus |
17078437 |
Laccophilus decipiens |
1872985 |
Laccophilus fasciatus |
1873009 |
Laccophilus proximus |
17084864 |
Laccotrephes griseus |
17096561 |
Laccotrephes sp. |
17151390 |
Lactamide, acetate (ester) |
17109802 |
Lactuca |
17105354 |
Lactuca sativa |
17105362 |
Lactuca serriola |
1863802 |
Laeonereis culveri |
1905900 |
Laevicardium mortoni |
17105370 |
Lagenaria siceraria |
1925833 |
Lagodon rhomboides |
2162 |
L-Alanine |
17295296 |
L-Alanine, 3-sulfo- |
711721 |
L-Alanine, N-benzoyl-N-(3,4-dichlorophenyl)-, ethyl ester |
17081860 |
Lamellidens corrianus |
17077595 |
Lamellidens marginalis |
17100793 |
Laminaria digitata |
17101296 |
Laminaria hyperborea |
17115882 |
Laminaria japonica |
17099037 |
Laminaria saccharina |
17105388 |
Lamium amplexicaule |
17114612 |
Lamium sp. |
1898287 |
Lampetra |
1925858 |
Lampetra appendix |
17091380 |
Lampetra fluviatilis |
1905231 |
Lampsilis fasciola |
1905249 |
Lampsilis ovata |
1925866 |
Lampsilis radiata |
1905256 |
Lampsilis siliquoidea |
17091315 |
Lampsilis straminea claibornen |
17091323 |
Lampsilis subangulata |
1905280 |
Lampsilis teres |
1940006 |
Lanice conchilega |
17084922 |
Lanistes carinatus |
17089905 |
Lanius ludovicianus |
17110347 |
Lantana camara |
149575 |
Lanthanum |
167627 |
Lanthanum chloride (LaCl3) |
195875 |
Lanthanum hydroxide (La(OH)3) |
17081795 |
Laomedea loveni |
11361 |
L-Arabinopyranose |
5058 |
L-Arginine |
17114620 |
Larix decidua |
17105396 |
Larix kaempferi |
17105404 |
Larrea tridentata |
1925890 |
Larus argentatus |
1925916 |
Larus delawarensis |
17089426 |
Larus fuscus |
17095217 |
Larus sp. |
1214 |
L-Ascorbic acid |
4648 |
L-Asparagine |
2295 |
L-Aspartic acid |
17090630 |
Lates calcarifer |
17105412 |
Lathyrus odoratus |
17110784 |
Lathyrus polymorphus |
17105420 |
Lathyrus sylvestris |
1891134 |
Latreutes fucorum |
1628 |
L-Cysteine |
1610 |
L-Cysteine, hydrochloride |
61135 |
L-Cysteine, N-acetyl- |
2337 |
L-Cystine |
149583 |
Lead |
153510 |
Lead chloride (PbCl2) |
167783 |
Lead iodide (PbI2) |
83345 |
Lead oxide (PbO) |
82537 |
Lead oxide (PbO2) |
83162 |
Lead sulfide (PbS) |
213702 |
Lead, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
17087099 |
Leander squilla |
1915255 |
Lecane |
157198 |
Lecithins |
17114638 |
Ledum groenlandicum |
17105438 |
Ledum palustre |
17105446 |
Leersia oryzoides |
17097312 |
Leiobunum sp. |
17095340 |
Leiobunum ventricosum |
17087107 |
Leiopotherapon unicolor |
1899194 |
Leiostomus xanthurus |
17100124 |
Lemna gibba |
17112038 |
Lemna minima |
17098500 |
Lemna minor |
17101569 |
Lemna paucicostata |
17099706 |
Lemna perpusilla |
17099359 |
Lemna sp. |
17110958 |
Lemna trisulca |
17101957 |
Lemna valdiviana |
17112111 |
Lemnaceae |
17105453 |
Lens culinaris |
17115809 |
Lens sp. |
1714518 |
Lensex LE 40 |
1714519 |
Lensex TA 01 |
1926138 |
Lepadella |
17083080 |
Lepeophtheirus salmonis |
1893510 |
Lepidactylus dytiscus |
17110693 |
Lepidium |
17114646 |
Lepidium densiflorum |
17105461 |
Lepidium sativum |
17105479 |
Lepidium virginicum |
17084831 |
Lepidocephalichthyes guntea |
17077058 |
Lepidocephalichthys thermalis |
17076969 |
Lepidochitona cinerea |
17094277 |
Lepidocyrtus cyaneus |
17092800 |
Lepidodermella squamatum |
1961614 |
Lepidomeda vittata |
1865500 |
Lepidonotus squamatus |
1881333 |
Lepidoptera |
1882745 |
Lepidostoma |
17078197 |
Lepidostoma griseum |
17092032 |
Lepidozona albrechti |
1898436 |
Lepisosteus oculatus |
1898444 |
Lepisosteus osseus |
1898451 |
Lepisosteus platostomus |
1898618 |
Lepomis |
1926211 |
Lepomis auritus |
1898626 |
Lepomis cyanellus |
1898634 |
Lepomis gibbosus |
1898592 |
Lepomis gulosus |
1898642 |
Lepomis humilis |
1898659 |
Lepomis macrochirus |
17084641 |
Lepomis marginatus |
1898667 |
Lepomis megalotis |
1898675 |
Lepomis microlophus |
17087198 |
Lepomis symnetricus |
17088667 |
Lepsiella vinosa |
17085143 |
Leptasterias polaris |
17076407 |
Leptestheria compleximanus |
17081480 |
Leptocella albida |
1882760 |
Leptoceridae |
17075490 |
Leptocerus aterrimus |
1852623 |
Leptocheirus plumulosus |
17105487 |
Leptochloa dubia |
17114653 |
Leptochloa fusca |
17108424 |
Leptochloa panicea |
1853381 |
Leptocylindrus |
17097643 |
Leptodiaptomus ashlandi |
17079138 |
Leptodius floridanus |
1926245 |
Leptodora kindtii |
1853050 |
Leptolyngbya |
1853068 |
Leptolyngbya tenuis |
17086174 |
Leptomysis lingvura |
17118605 |
Leptomysis mediterranea |
1872001 |
Leptophlebia |
17078239 |
Leptophlebia cupida |
17087941 |
Leptophlebia marginata |
1871920 |
Leptophlebiidae |
17105495 |
Leptospermum scoparium |
1902410 |
Leptosynapta inhaerens |
1926260 |
Leptoxis carinata |
1926278 |
Leptoxis praerosa |
17089327 |
Lepus americanus |
17114661 |
Lesquerella macrocarpa |
17078742 |
Lestes congener |
17118241 |
Lestes dryas |
17095860 |
Lestes sp. |
17088337 |
Lestes unquiculatus |
1884212 |
Lethocerus |
17114679 |
Leucaena glauca |
17111402 |
Leucanthemum vulgare |
17077892 |
Leucaspius delineatus |
42440 |
Leucine |
17079237 |
Leuciscus cephalus |
17090952 |
Leuciscus cephalus orientalis |
17082959 |
Leuciscus hakonensis |
1926286 |
Leuciscus idus |
17088311 |
Leuciscus idus melanotus |
17074402 |
Leuciscus leuciscus |
17105503 |
Leucocrinum montanum |
1931401 |
Leucoraja erinacea |
1931419 |
Leucoraja ocellata |
1886399 |
Leucorrhinia |
1870963 |
Leucrocuta |
1870971 |
Leucrocuta hebe |
1870989 |
Leucrocuta maculipennis |
1887165 |
Leuctra |
17091026 |
Leuctra inermis |
17084914 |
Leuctra moselyi |
1916899 |
Leuctra tenuis |
52455474 |
Leuresthes tenuis |
1926294 |
Leydigia quadrangularis |
2311 |
L-Glutamic acid |
38794 |
L-Glutamic acid, monosodium salt |
3012 |
L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]- |
2303 |
L-Glutamine |
4705 |
L-Histidine |
183814 |
L-Homocysteine, S-ethyl- |
17115940 |
Liatris spicata |
1886407 |
Libellula |
17082744 |
Libellula depressa |
17087115 |
Libellula quadrimaculata |
1886076 |
Libellulidae |
160226 |
Lignosulfonic acid |
160200 |
Lignosulfonic acid, ammonium salt |
160192 |
Lignosulfonic acid, calcium salt |
160283 |
Lignosulfonic acid, chromium iron salt |
160184 |
Lignosulfonic acid, sodium salt |
1905355 |
Ligumia |
17105511 |
Ligustrum amurense |
17105529 |
Ligustrum japonicum |
17105537 |
Ligustrum lucidum |
17105545 |
Ligustrum ovalifolium |
17105552 |
Ligustrum quihoui |
17105560 |
Ligustrum vulgare |
1934504 |
Liliopsida |
17109810 |
Lilium |
17110677 |
Lilium formosanum |
17105578 |
Lilium longiflorum |
17114687 |
Lilium philippinense formosanum |
17105586 |
Lilium regale |
17082280 |
Limanda ferruginea |
17075409 |
Limanda limanda |
17089194 |
Limax maximus |
1883057 |
Limnephilidae |
1883271 |
Limnephilus |
17090481 |
Limnephilus bipunctatus |
17118928 |
Limnephilus flavicornis |
17092578 |
Limnephilus lunatus |
17075516 |
Limnephilus stigma |
17118431 |
Limnesia maculata |
17118472 |
Limnesia undulata |
17077777 |
Limnius |
17081423 |
Limnocalanus macrurus |
17118852 |
Limnochares aquatica |
17092149 |
Limnodriloides verrucosus |
1860246 |
Limnodrilus |
1860287 |
Limnodrilus hoffmeisteri |
1860311 |
Limnodrilus udekemianus |
17080441 |
Limnodynastes peroni |
17080474 |
Limnodynastes tasmaniensis |
1881168 |
Limnophila |
17114695 |
Limnophila chinensis Merr |
1895713 |
Limnoria lignorum |
17085184 |
Limnoria tripunctata |
1896935 |
Limulus polyphemus |
17113002 |
Linum sp. |
17105594 |
Linum usitatissimum |
17094178 |
Liocranidae |
1873066 |
Liodessus affinis |
17097767 |
Liopsetta glacialis |
17105602 |
Liquidambar styraciflua |
17086414 |
Lirceus alabamale |
1895317 |
Lirceus fontinalis |
17095027 |
Lirceus garmani |
17105610 |
Liriodendron tulipifera |
17114703 |
Liriope muscari |
4994 |
L-Isoleucine |
1916956 |
Lispe |
17081159 |
Lissorhoptrus |
17091356 |
Lissorhoptrus oryzophilus |
17081217 |
Listronotus appendiculatus |
17105628 |
Litchi chinensis |
149591 |
Lithium |
150524 |
Lithium chloride (LiCl) |
17093337 |
Lithobiidae |
17096140 |
Lithobius forficatus |
17094889 |
Lithobius mutabilis |
17091901 |
Lithodes antarcticus |
17079336 |
Lithognathus mormyrus |
17118183 |
Litopenaeus vannamei |
17118167 |
Litoria adelaidensis |
1910975 |
Littorina irrorata |
1910983 |
Littorina littorea |
17086182 |
Littorina meleagris |
17085879 |
Littorina neritoides |
1967322 |
Littorina obtusata |
1926393 |
Littorina saxatilis |
17081167 |
Lixellus |
17085697 |
Liza aurata |
17087354 |
Liza macrolepis |
17090218 |
Liza parsia |
17085713 |
Liza ramada |
17090226 |
Liza vaigiensis |
3541 |
L-Leucine |
2329 |
L-Lysine |
3756 |
L-Methionine |
42408 |
L-Norleucine |
17111022 |
Lobelia dortmanna |
1945831 |
Loligo opalescens |
1968908 |
Loligo pealeii |
17087123 |
Loligo vulgaris |
17104860 |
Lolium arundinaceum |
17105636 |
Lolium perenne |
17116864 |
Lolium perenne multiflorum |
17104886 |
Lolium pratense |
17105644 |
Lolium rigidum |
17109828 |
Lolium sp. |
17114711 |
Lomatium grayi |
17105651 |
Lonchocarpus utilis |
17114729 |
Lonicera canadensis |
17105669 |
Lonicera dioica |
17105677 |
Lonicera tatarica |
17094673 |
Lophiosilurus alexandri |
17076977 |
Lophopodella carteri |
4614 |
L-Ornithine |
44214 |
L-Ornithine, N5-(aminocarbonyl)- |
1926450 |
Lota lota |
17109836 |
Lotus corniculatus |
17105685 |
Lotus pedunculatus |
17111931 |
Lotus uliginosus |
1714272 |
L-Phenylalaninamide, L-tyrosyl-D-alanylglycyl-N-(2-hydroxyethyl)-N.alpha.-methyl-, monoacetate (salt) |
3772 |
L-Phenylalanine |
17153156 |
L-Phenylalanine, N-[[(3R)-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]-, ethyl ester |
39693 |
L-Proline |
1321 |
L-Proline, 4-hydroxy-, (4R)- |
2170 |
L-Serine |
28993 |
L-Serine, diazoacetate (ester) |
11387 |
L-Sorbose |
4879 |
L-Threonine |
4978 |
L-Tryptophan |
713842 |
LTX |
3285 |
L-Tyrosine |
41392 |
L-Tyrosine, 3,5-diiodo- |
3202 |
L-Tyrosine, 3-hydroxy- |
17272741 |
L-Tyrosine, 3-iodo- |
1370 |
L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo- |
1859 |
L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-, monosodium salt |
1972751 |
Lucania parva |
1889450 |
Lucifer |
17092743 |
Lucilia cuprina |
17100165 |
Ludwigia |
17101387 |
Ludwigia palustris |
17112020 |
Ludwigia repens |
17105693 |
Luffa acutangula |
1859214 |
Lumbricidae |
1861285 |
Lumbriculus inconstans |
1861301 |
Lumbriculus variegatus |
17089582 |
Lumbricus rubellus |
17089590 |
Lumbricus terrestris |
17117573 |
Lunulospora curvula |
17117748 |
Lunulospora sp. |
17105701 |
Lupinus albus |
17105719 |
Lupinus angustifolius |
17105727 |
Lupinus luteus |
164244 |
Luteinizing hormone-releasing factor |
167650 |
Lutetium chloride (LuCl3) |
17094384 |
Lutjanus argentimaculatus |
1900372 |
Luxilus chrysocephalus |
1900380 |
Luxilus cornutus |
4861 |
L-Valine |
17111790 |
Lychnis flos-cuculi |
17114737 |
Lycium berlandieri |
17109844 |
Lycopersicon |
17105735 |
Lycopersicon esculentum |
17083270 |
Lycosidae |
17094442 |
Lyctus brunneus |
17091448 |
Lygus lineolaris |
1908359 |
Lymnaea |
17081571 |
Lymnaea acuminata |
17075839 |
Lymnaea emarginata |
17077926 |
Lymnaea emarginata angulata |
17076795 |
Lymnaea luteola |
17076159 |
Lymnaea natalensis |
17077272 |
Lymnaea ovata |
17118662 |
Lymnaea palustris |
17080169 |
Lymnaea peregra |
17088089 |
Lymnaea peregra ovata |
1908367 |
Lymnaea stagnalis |
17079716 |
Lymnaea trunculata |
1908284 |
Lymnaeidae |
17077173 |
Lynceus |
17118282 |
Lynceus brachyurus |
1853076 |
Lyngbya |
1853084 |
Lyngbya birgei |
17111642 |
Lysimachia nummularia |
17112129 |
Lysimachia terrestris |
17111808 |
Lysimachia vulgaris |
17079229 |
Lysmata seticaudata |
1953447 |
Lytechinus pictus |
1902253 |
Lytechinus variegatus |
17111816 |
Lythrum salicaria |
1900414 |
Lythrurus umbratilis |
17089319 |
Macaca fascicularis |
17089152 |
Macaca mulatta |
17105743 |
Macadamia integrifolia |
17114505 |
Machaeranthera gracilis |
1971688 |
Macoma balthica |
52453412 |
Macoma inquinata |
1944875 |
Macoma nasuta |
17085994 |
Macquaria ambigua |
17096496 |
Macquaria novemaculeata |
1891274 |
Macrobrachium |
1891290 |
Macrobrachium carcinus |
17084070 |
Macrobrachium dayanum |
17084500 |
Macrobrachium hendersodayanus |
17087131 |
Macrobrachium idae |
17092636 |
Macrobrachium idella idella |
17082298 |
Macrobrachium kistnensis |
17083973 |
Macrobrachium lamarrei |
17090804 |
Macrobrachium malcolmsonii |
17084062 |
Macrobrachium naso |
17093154 |
Macrobrachium nipponense |
17091703 |
Macrobrachium potiuna |
17077660 |
Macrobrachium rosenbergii |
17095779 |
Macrobrachium rude |
1869536 |
Macrocyclops albidus |
17101205 |
Macrocystis pyrifera |
17078932 |
Macrodasys |
17076043 |
Macrognathus aculeatus |
17090093 |
Macrogyrodactylus clarii |
1886498 |
Macromia |
17110644 |
Macropiper excelsum majus |
17076290 |
Macropodus cupanus |
17081043 |
Macropodus opercularis |
17118191 |
Macropsobrycon uruguayanae |
1882463 |
Macrostemum |
1962992 |
Macrostomum |
17090812 |
Macrothrix |
17105750 |
Madhuca indica |
17087362 |
Madracis decactis |
17087370 |
Madracis mirabilis |
149617 |
Magnesium |
155291 |
Magnesium chloride (MgCl2) |
1858299 |
Magnoliophyta |
1858307 |
Magnoliopsida |
17109372 |
Mahonia trifoliolata |
17078015 |
Maia squinado |
17092008 |
Maja crispata |
17081381 |
Mallotus villosus |
1640069 |
Malus |
17109273 |
Malus domestica |
17105768 |
Malus pumila |
17105776 |
Malus sylvestris |
17109471 |
Malva rotundifolia |
17105784 |
Malvastrum coromandelianum |
17097379 |
Mamestra brassicae |
17121765 |
Manganate(1-), trichloro- |
199471 |
Manganate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
149625 |
Manganese |
17121583 |
Manganese chloride |
153643 |
Manganese chloride (MnCl2) |
82784 |
Manganese oxide (MnO2) |
182170 |
Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
158972 |
Manganese, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']-, mixt. with [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']zinc |
17105792 |
Mangifera indica |
17114745 |
Manihot esculenta |
17113465 |
Manilkara zapota |
11379 |
Mannitol |
1900463 |
Margariscus margarita |
17086547 |
Margaritifera margaritifera |
17075607 |
Marinogammarus obtusatus |
1911841 |
Marisa cornuarietis |
17095878 |
Marisa sp. |
17152224 |
Marlon A 390 |
17089343 |
Marmota monax |
17105800 |
Marrubium vulgare |
17101783 |
Marsilea minuta |
17084310 |
Marthasterias glacialis |
17088790 |
Mastacembelus pancalus |
17101155 |
Mastigocladus laminosus |
17109166 |
Matricaria discoidea |
17109174 |
Matricaria recutita |
17114760 |
Matricaria sp. |
17105818 |
Matthiola incana |
1714728 |
MBC 120 |
17087388 |
Meandrina meandrites |
17105826 |
Medicago lupulina |
17116088 |
Medicago polymorpha |
17105834 |
Medicago sativa |
17109851 |
Medicago sativa sativa |
17114778 |
Medicago sp. |
1861970 |
Mediomastus ambiseta |
17093089 |
Medionidus conradicus |
17096777 |
Medioppia subpectinata |
17095175 |
Megachile rotundata |
17082116 |
Megacyclops viridis |
17084773 |
Megalocottus platycephalus |
17079849 |
Megalonaias boykiniana |
1905405 |
Megalonaias nervosa |
17093196 |
Megalops atlanticus |
1881572 |
Megaloptera |
1970060 |
Meganyctiphanes norvegica |
1908276 |
Melampus bidentatus |
1926773 |
Melanerpes carolinus |
1926781 |
Melanerpes erythrocephalus |
1911551 |
Melanoides tuberculata |
17085093 |
Melanopsis dufouri |
17083791 |
Melanotaenia duboulayi |
17082942 |
Melanotaenia fluviatilis |
17088808 |
Melanotaenia nigrans |
17085978 |
Melanotaenia splendida inornat |
17085960 |
Melanotaenia splendida splendi |
17105842 |
Melastoma malabathricum |
17111428 |
Melilotus indica |
17113226 |
Melilotus sp. |
1893387 |
Melita nitida |
17095654 |
Meloidae |
17096058 |
Meloidogyne incognita |
17094863 |
Meloidogyne javanica |
17090473 |
Melopsittacus undulatus |
1853399 |
Melosira |
1853423 |
Melosira granulata |
17098369 |
Melosira granulata angust |
17116013 |
Melosira nummuloides |
1853431 |
Melosira varians |
17095662 |
Membracidae |
1972785 |
Menidia beryllina |
1926930 |
Menidia menidia |
17075656 |
Menidia peninsulae |
1890748 |
Menippe mercenaria |
17110719 |
Mentha |
17105867 |
Mentha aquatica |
17105859 |
Mentha arvensis |
17089087 |
Mephitis mephitis |
1907708 |
Mercenaria mercenaria |
17085762 |
Mercenaria stimpsoni |
3160 |
Mercurate(1-), (4-carboxylatophenyl)chloro-, hydrogen |
17295163 |
Mercurate(1-), [3-[[2-(carboxylatomethoxy)benzoyl-.kappa.O]amino]-2-methoxypropyl-.kappa.C]hydroxy-, sodium |
1800 |
Mercurate(1-), ethyl[2-(mercapto-.kappa.S)benzoato(2-)-.kappa.O]-, sodium |
1714301 |
Mercurate(2-), [orthoborato(3-)-.kappa.O]phenyl-, dihydrogen |
99184 |
Mercurate(2-), ethyl[phosphato(3-)-.kappa.O]-, dihydrogen |
17157173 |
Mercurate(2-), tetrakis(cyano-.kappa.C)-, dipotassium, (T-4)- |
149633 |
Mercury |
168336 |
Mercury amide chloride (Hg(NH2)Cl) |
168146 |
Mercury chloride (Hg2Cl2) |
150789 |
Mercury chloride (HgCl2) |
57075 |
Mercury cyanide (Hg(CN)2) |
153676 |
Mercury iodide (HgI2) |
220715 |
Mercury oxide (HgO) |
86181 |
Mercury sulfide (HgS) |
222877 |
Mercury(1+), methyl- |
17122466 |
Mercury, (2-hydroxypropanoato)phenyl- |
17124918 |
Mercury, (4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro-4,7-methano-1H-isoindole-1,3(2H)-dionato-.kappa.N2)methyl- |
17122128 |
Mercury, (acetato-.kappa.O)(methylphenyl)- |
3582 |
Mercury, (acetato-.kappa.O)phenyl- |
17121286 |
Mercury, (acetato-O)-3-pyridinyl- |
17119140 |
Mercury, (acetato-O)pyridinyl- |
48389 |
Mercury, (cyanoguanidinato-.kappa.N')methyl- |
1958 |
Mercury, (nitrato-.kappa.O)phenyl- |
1714327 |
Mercury, (octadecanoato-O)phenyl- |
1714645 |
Mercury, [.mu.-[[3,3'-methylenebis[2-naphthalenesulfonato-.kappa.O]](2-)]]diphenyldi- |
17295361 |
Mercury, bromomethyl- |
1714439 |
Mercury, bromophenyl- |
12807 |
Mercury, chloro(2-hydroxyphenyl)- |
17002437 |
Mercury, chloro(2-methoxyethyl)- |
17152828 |
Mercury, chloro(3-methylbutyl)- |
62687 |
Mercury, chloro(4-hydroxyphenyl)- |
17122375 |
Mercury, chloroethyl- |
17002403 |
Mercury, chloromethyl- |
17122342 |
Mercury, chlorophenyl- |
64113 |
Mercury, diethyl- |
57471 |
Mercury, dimethyl- |
56200 |
Mercury, diphenyl- |
244764 |
Mercury, diphenyl[.mu.-[(tetrapropenyl)butanedioato(2-)-.kappa.O1:.kappa.O4]]di- |
17122748 |
Mercury, ethyl(4-methyl-N-phenylbenzenesulfonamidato-.kappa.N)- |
17003526 |
Mercury, hydroxymethyl- |
19547 |
Mercury, hydroxyphenyl- |
1714654 |
Mercury, iodomethyl- |
17082058 |
Meretrix casta |
17082074 |
Meretrix lusoria |
17088097 |
Meretrix meretrix |
17089608 |
Meriones hurrianae |
17089616 |
Meriones unguiculatus |
17110990 |
Merismopedia tenuissima |
17093840 |
Merlinius sp. |
17105875 |
Merremia aegyptia |
17114786 |
Mertensia lanceolata |
17095589 |
Mesaphorura macrochaeta |
17092321 |
Mesocyclops aspericornis |
1927052 |
Mesocyclops edax |
17084112 |
Mesocyclops hyalinus |
17076522 |
Mesocyclops leuckarti |
17092354 |
Mesocyclops longisetus |
17095936 |
Mesocyclops sp. |
17087149 |
Mesocyclops thermocyclopoides |
17093816 |
Mesorhabditis sp. |
17093667 |
Mesostigmata |
17081308 |
Mesostoma ehrenbergi |
17099946 |
Mesotaenium caldariorum |
1884873 |
Mesovelia |
1884907 |
Mesovelia mulsanti |
1946979 |
Metamysidopsis elongata |
17079088 |
Metapenaeopsis barbata |
17087156 |
Metapenaeus dobsoni |
17087164 |
Metapenaeus ensis |
17086190 |
Metapenaeus macleayi |
17076720 |
Metapenaeus monoceros |
1714576 |
Metaphosphoric acid (H4P4O12), tetrasodium salt |
168385 |
Metaphosphoric acid (H6P6O18), hexasodium salt |
5132 |
Methanamine |
57406 |
Methanamine, hydrochloride |
5629 |
Methanamine, N,N-dimethyl- |
57497 |
Methanamine, N,N-dimethyl-, hydrochloride |
33555 |
Methanamine, N-methyl- |
3707 |
Methanamine, N-methyl-N-nitroso- |
56671 |
Methanaminium, 1-carboxy-N,N,N-trimethyl-, chloride |
5678 |
Methanaminium, N,N,N-trimethyl-, chloride |
116368 |
Methanaminium, N-[4-[(2-chlorophenyl)[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride |
54932 |
Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride |
687632 |
Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, ethanedioate (2:2:1) |
53132 |
Methanaminium, N-[4-[bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride |
5074 |
Methane, bromo- |
5199 |
Methane, bromochloro- |
5462 |
Methane, bromodichloro- |
5116 |
Methane, chloro- |
5173 |
Methane, dibromo- |
33597 |
Methane, dibromochloro- |
686022 |
Methane, dibromonitro- |
5306 |
Methane, dichloro- |
26229 |
Methane, dimethoxy- |
5124 |
Methane, iodo- |
53934 |
Methane, isothiocyanato- |
5637 |
Methane, nitro- |
4325 |
Methane, sulfinylbis- |
111070 |
Methane, sulfonylbis[trichloro- |
54411 |
Methane, tetrabromo- |
2071 |
Methane, tetrachloro- |
5371 |
Methane, thiobis- |
5447 |
Methane, tribromo- |
4317 |
Methane, trichloro- |
6106 |
Methane, trichloronitro- |
5611 |
Methane, triiodo- |
711192 |
Methanediamine, N,N,N',N'-tetrabutyl- |
686634 |
Methanesulfenamide, 1,1-dichloro-N-[(dimethylamino)sulfonyl]-1-fluoro-N-phenyl- |
39909 |
Methanesulfinic acid, hydroxy-, monosodium salt |
275537 |
Methanesulfonamide, 1,1,1-trifluoro-N-[2-methyl-4-(phenylsulfonyl)phenyl]- |
622704 |
Methanesulfonamide, N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]- |
234047 |
Methanesulfonamide, N-[2-[(4-amino-3-methylphenyl)ethylamino]ethyl]-, sulfate (2:3) |
1714444 |
Methanesulfonic acid, [[5-[bis[[[4-hydroxy-3-[(sulfomethyl)amino]phenyl]arsinidene]bismuthino]arsino]-2-hydroxyphenyl]amino]-, trisodium salt |
73882 |
Methanesulfonic acid, 1-methylethyl ester |
3616 |
Methanesulfonic acid, ethyl ester |
4093 |
Methanesulfonic acid, methyl ester |
256123 |
Methanesulfonothioic acid, S-(2-hydroxypropyl) ester |
963058 |
Methanesulfonothioic acid, S-(2-hydroxypropyl) ester, mixt. with (2-benzothiazolylthio)methyl thiocyanate |
33605 |
Methanesulfonyl chloride |
5157 |
Methanethiol |
268136 |
Methanethiol, lead(2+) salt |
263822 |
Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl- |
138040 |
Methanimidamide, N'-(4-chloro-2-methylphenyl)-N,N-dimethyl- |
690826 |
Methanimidamide, N'-(4-chloro-2-methylphenyl)-N,N-dimethyl-, monohydrochloride |
223883 |
Methanimidamide, N,N-dimethyl-N'-[3-[[(methylamino)carbonyl]oxy]phenyl]-, monohydrochloride |
62406 |
Methanimidamide, N,N'-diphenyl- |
4283 |
Methanol |
17003104 |
Methanol, (methyl-ONN-azoxy)-, acetate (ester) |
608521 |
Methanol, [[[1-methyl-2-(5-methyl-3-oxazolidinyl)ethoxy]methoxy]methoxy]- |
710160 |
Methanol, chloro-, benzoate |
10280 |
Methanone, (2-chlorophenyl)(4-chlorophenyl)- |
17273350 |
Methanone, (2-fluorophenyl)phenyl- |
35451 |
Methanone, (2-methylphenyl)phenyl- |
1714287 |
Methanone, (3-chlorophenyl)pheny- |
1714672 |
Methanone, (4-bromophenyl)-3-pyridinyl- |
17273012 |
Methanone, (4-bromophenyl)phenyl- |
36202 |
Methanone, (4-chlorophenyl)phenyl- |
36194 |
Methanone, (4-methylphenyl)phenyl- |
964460 |
Methanone, (5-cyclopropyl-4-isoxazolyl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]- |
97311 |
Methanone, [1,1'-biphenyl]-4-ylphenyl- |
1714700 |
Methanone, [4-(2-hydroxyethoxy)phenyl]phenyl- |
109652 |
Methanone, [4-(dodecyloxy)-2-hydroxyphenyl]phenyl- |
961920 |
Methanone, bis(2-chlorophenyl)- |
13185 |
Methanone, bis(4-chlorophenyl)- |
17152273 |
Methanone, bis(4-chlorophenyl)-, oxime |
30767 |
Methanone, diphenyl- |
196022 |
Methanone, phenyl-4-pyridinyl- |
3111 |
Methionine |
162537 |
Metiram |
17076928 |
Metridia pacifica |
1936293 |
Metridium senile |
17114794 |
Metrosideros polymorpha |
17153826 |
Metso-Beads |
17151382 |
Mexel 432 |
17084039 |
Miamiensis avidus |
1714511 |
Micoluteina destacina |
17114802 |
Miconia prasina |
1855907 |
Micractinium pusillum |
1881911 |
Micrasema rusticum |
1857424 |
Micrasterias |
17111139 |
Micrasterias denticulata |
17101973 |
Micrasterias thomasiana |
17074287 |
Microbial Community |
17095308 |
Microbisium sp. |
17089004 |
Microcanthus strigatus |
1914852 |
Microciona prolifera |
17098435 |
Microcoleus vaginatus |
1714275 |
Microcystin LR |
1852862 |
Microcystis |
1852870 |
Microcystis aeruginosa |
1927086 |
Microgadus tomcod |
17076621 |
Microhyla ornata |
17080342 |
Microlaimus |
17078767 |
Microlaophonte trisetosa |
17097189 |
Microlestes linearis |
1957752 |
Micrometrus minimus |
17096579 |
Micronecta sp. |
17092750 |
Microplitis rufiventris |
1927144 |
Micropogonias undulatus |
1898691 |
Micropterus |
1898709 |
Micropterus dolomieu |
1898717 |
Micropterus punctulatus |
1898725 |
Micropterus salmoides |
17079476 |
Micropterus treculi |
17096793 |
Microregma sp. |
1856871 |
Microspora |
17091166 |
Microstomus kitt |
1878545 |
Microtendipes |
17089624 |
Microtus agrestis |
17086679 |
Microtus montanus |
17086687 |
Microtus ochrogaster |
17086695 |
Microtus pennsylvanicus |
17086703 |
Microtus pinetorum |
17090507 |
Microtus sp. |
17087859 |
Mictyris longicarpus |
17092511 |
Micura |
17118860 |
Mideopsis orbicularis |
17109182 |
Mikania scandens |
17090234 |
Millipora alcicornis |
17105883 |
Mimosa pudica |
17115437 |
Mimosa sp. |
1927185 |
Mimus polyglottos |
17094434 |
Minthea rugicollis |
17105891 |
Mirabilis jalapa |
17113028 |
Mirabilis sp. |
1951730 |
Miridae |
17079096 |
Misgurnus anguillicaudatus |
17076993 |
Misgurnus fossilis |
1714629 |
Mitomycin |
17088105 |
Mizuhopecten yessoensis |
17088816 |
Mnemiopsis mccradyi |
17118316 |
Mochlonyx culiciformis |
17094921 |
Modiolus auriculatus |
1903822 |
Modiolus demissus |
17082348 |
Modiolus demissus granosissima |
1903830 |
Modiolus modiolus |
17088329 |
Mogurnda mogurnda |
17090820 |
Moina australiensis |
17085630 |
Moina brachiata |
17085101 |
Moina dubia |
17092669 |
Moina irrasa |
17078692 |
Moina macrocopa |
17080524 |
Moina micrura |
17087396 |
Moina mongolica |
17080599 |
Moina rectirostris |
17095944 |
Moina sp. |
17084740 |
Moinodaphnia macleayi |
1883479 |
Molanna uniophila |
1898105 |
Molgula |
1898113 |
Molgula manhattensis |
17111824 |
Molinia caerulea |
17108689 |
Mollugo verticillata |
1903418 |
Mollusca |
17093147 |
Molophilus sp |
1927227 |
Molothrus ater |
17095225 |
Molothrus sp. |
17108614 |
Moluccella laevis |
175877 |
Molybdate (Mo7O246-), hexaammonium |
184101 |
Molybdate (MoO42-), diammonium, (T-4)- |
152017 |
Molybdate (MoO42-), disodium, (T-4)- |
17125675 |
Molybdate (MoO42-), disodium, dihydrate, (T-4)- |
17153396 |
Molybdate(3-), tetrahydroxynitrosyloxo-, (OC-6-11)- |
149641 |
Molybdenum |
213280 |
Molybdenum oxide (MoO2) |
82800 |
Molybdenum oxide (MoO3) |
17105909 |
Momordica balsamina |
1927235 |
Monacanthus hispidus |
17115965 |
Monarda fistulosa |
17105917 |
Monarda punctata |
17152232 |
Monensin |
1913508 |
Monhystera |
17086208 |
Monhystera disjuncta |
17089012 |
Monhystera microphthalma |
17114810 |
Monochoria vaginalis |
1894005 |
Monoculodes edwardsi |
17091513 |
Monodonta turbiformis |
17079120 |
Monodonta turbinata |
17089020 |
Monopterus albus |
17082512 |
Monopylephorus cuticulatus |
17111238 |
Monoraphidium griffithii |
17117136 |
Monoraphidium minutum |
17116567 |
Monoraphidium sp. |
1915271 |
Monostyla |
1927383 |
Monostyla quadridentata |
17096512 |
Montastraea faveolata |
17087578 |
Montastrea annularis |
17088675 |
Montastrea cavernosa |
17092065 |
Montipora verrucosa |
1898774 |
Morone |
1898782 |
Morone americana |
1898790 |
Morone chrysops |
1898808 |
Morone mississippiensis |
1898816 |
Morone saxatilis |
52451515 |
Morone saxatilis x |
17151952 |
Morphinan-6-one, 17-(cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxy-, (5.alpha.)- |
17294950 |
Morphinan-6-one, 4,5-epoxy-3,14-dihydroxy-17-(2-propenyl)-, (5.alpha.)- |
27086 |
Morpholine |
38539 |
Morpholine, 2,6-dimethyl- |
1714674 |
Morpholine, 2,6-dimethyl-4-nitroso- |
962720 |
Morpholine, 2,6-dimethyl-4-tridecyl- |
964189 |
Morpholine, 3-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl)- |
1714580 |
Morpholine, 3-methyl-2-phenyl- |
17152729 |
Morpholine, 4-(1-oxohexyl)- |
20941 |
Morpholine, 4-(2-benzothiazolylthio)- |
17123282 |
Morpholine, 4-(triphenylmethyl)- |
692699 |
Morpholine, 4,4'-(2-ethyl-2-nitro-1,3-propanediyl)bis-, mixt. with 4-(2-nitrobutyl)morpholine |
68924 |
Morpholine, 4,4'-(dithiodicarbonothioyl)bis- |
1714688 |
Morpholine, 4-benzoyl- |
3194 |
Morpholine, 4-nitroso- |
1714535 |
Morpholine, 4-octyl- |
14191 |
Morpholine, 4-phenyl- |
17151572 |
Mortal |
17097965 |
Morula granulata |
1857549 |
Mougeotia |
17115585 |
Mucuna pruriens |
17075672 |
Mugil |
17076050 |
Mugil auratus |
17089079 |
Mugil carinatus |
1927482 |
Mugil cephalus |
1927490 |
Mugil curema |
17083593 |
Mugil ramada |
17078080 |
Mugil saliens |
17112566 |
Mugil so-iuy |
17077603 |
Mugilidae |
17113101 |
Muhlenbergia capillaris |
17114828 |
Muhlenbergia frondosa |
17105925 |
Muhlenbergia schreberi |
1906619 |
Mulinia lateralis |
17118795 |
Murex brandaris |
17085887 |
Murex trunculus |
17083411 |
Muridae |
17089186 |
Mus musculus |
17096728 |
Mus sp. |
17110651 |
Musa |
17089145 |
Musca domestica |
1875723 |
Muscidae |
1906858 |
Musculium transversum |
17090101 |
Mustela |
17089384 |
Mustela erminea |
17089632 |
Mustela putorius |
17086562 |
Mustela vison |
1904473 |
Mya arenaria |
1968718 |
Mya truncata |
17085523 |
Mylio macrocephalus |
17095001 |
Mylonchulus sp. |
11460 |
myo-Inositol |
17078890 |
Myopea crassula |
17105933 |
Myosotis arvensis |
17086711 |
Myotis lucifugus |
1927573 |
Myoxocephalus aenaeus |
17118761 |
Myoxocephalus quadricornis |
17075961 |
Myoxocephalus scorpius |
17105941 |
Myrciaria cauliflora |
17091422 |
Myriapoda |
17098476 |
Myriophyllum |
17098880 |
Myriophyllum alterniflorum |
17098906 |
Myriophyllum aquaticum |
17116476 |
Myriophyllum heterophyllum |
17117334 |
Myriophyllum pinnatum |
17117300 |
Myriophyllum quitense |
17117094 |
Myriophyllum sibiricum |
17098989 |
Myriophyllum spicatum |
17116039 |
Myriophyllum verticillatum |
17113135 |
Myrtus sp. |
1896182 |
Mysidacea |
1896414 |
Mysidopsis almyra |
1896430 |
Mysidopsis bigelowi |
1946870 |
Mysidopsis intii |
17087867 |
Mysidopsis juniae |
17088824 |
Mysis oculata |
1927607 |
Mysis relicta |
1882836 |
Mystacides |
17083999 |
Mystus bleekeri |
17076084 |
Mystus cavasius |
17083908 |
Mystus gulio |
17084815 |
Mystus keletius |
17077876 |
Mystus seenghala |
17085747 |
Mystus tengara |
17118803 |
Mystus vittatus |
17077397 |
Mystus vittatus vittatus |
17090838 |
Mytilopsis sallei |
1944131 |
Mytilus |
1944149 |
Mytilus californianus |
17091992 |
Mytilus coruscus |
1927649 |
Mytilus edulis |
17082728 |
Mytilus edulis planulatus |
1944156 |
Mytilus galloprovincialis |
17083676 |
Mytilus trossulus |
17088113 |
Mytilus viridis |
1927656 |
Myxicola infundibulum |
17097437 |
Myxine glutinosa |
17097577 |
Myxocyprinus asiaticus |
17099334 |
Myxosarcina spectabilis |
17095209 |
Nabidae |
17097700 |
Nabis americoferus |
1859271 |
Naididae |
1859578 |
Nais |
1859628 |
Nais communis |
1859677 |
Nais variabilis |
17101361 |
Najas |
17099375 |
Najas flexilis |
17117292 |
Najas graminea |
17099284 |
Najas guadalupensis |
17082157 |
Nandus nandus |
17094517 |
Nanhermannia sellnicki |
17100314 |
Nannochloris |
17116153 |
Nannochloris atomus |
17095035 |
Nannochloropsis gaditana |
17098211 |
Nannochloropsis oculata |
17095043 |
Nannochloropsis sp. |
1880129 |
Nanocladius |
17096298 |
Nanosesarma sp. |
159715 |
Naphtha |
13987 |
Naphthacene |
13326 |
Naphthalene |
1714555 |
Naphthalene, 1-(2-bromoethoxy)- |
30783 |
Naphthalene, 1,2,3,4-tetrahydro- |
17294877 |
Naphthalene, 1,2-dihydro- |
55053 |
Naphthalene, 1,2-dimethyl- |
55160 |
Naphthalene, 1,3-dimethyl- |
54973 |
Naphthalene, 1,4-dimethyl- |
54999 |
Naphthalene, 1,5-dimethyl- |
99366 |
Naphthalene, 1,6,7-trimethyl- |
55178 |
Naphthalene, 1,6-dimethyl- |
54908 |
Naphthalene, 1,8-dimethyl- |
12856 |
Naphthalene, 1-chloro- |
53231 |
Naphthalene, 1-isothiocyanato- |
12849 |
Naphthalene, 1-methyl- |
10827 |
Naphthalene, 1-nitro- |
71704 |
Naphthalene, 2,3,6-trimethyl- |
55517 |
Naphthalene, 2,3-dimethyl- |
55525 |
Naphthalene, 2,6-dimethyl- |
13532 |
Naphthalene, 2-chloro- |
14738 |
Naphthalene, 2-ethoxy- |
14621 |
Naphthalene, 2-methoxy- |
13524 |
Naphthalene, 2-methyl- |
277244 |
Naphthalene, bis(1-methylethyl)- |
233544 |
Naphthalene, chloro- |
528521 |
Naphthalene, chloro derivs. |
13300 |
Naphthalene, decahydro- |
1714269 |
Naphthalene, decahydro-2,3-dimethyl- |
250811 |
Naphthalene, dimethyl- |
83782 |
Naphthalene, methyl- |
99135 |
Naphthalene, octachloro- |
691758 |
Naphthalene, trimethyl- |
1714548 |
Naphthalenecarboxylic acid |
1714499 |
Naphthalenedion |
232637 |
Naphthalenesulfonic acid, dibutyl-, sodium salt |
686790 |
Naphthalenol |
85977 |
Naphthenic acids |
321232 |
Naphthenic acids, calcium salts |
85936 |
Naphthenic acids, copper salts |
17123217 |
Naphthenic acids, mercury salts |
321752 |
Naphthenic acids, sodium salts |
173633 |
Naphthenic acids, zinc salts |
960856 |
Naphtho(2,3-d)(1,3)dioxole-5,6-dicarboxylic acid, 5,6,7,8-tetrahydro-7-methyl-, dipropyl ester |
17124173 |
Naphtho[2,3-b]-1,4-dithiin-2,3-dicarbonitrile, 5,10-dihydro-5,10-dioxo- |
17004920 |
Napthalene, 1,2,3,4-tetrachloro- |
17105958 |
Narcissus poeticus |
17105966 |
Narcissus pseudonarcissus |
17096660 |
Nassarius festivus |
17092560 |
Nassarius gibbolosa |
1912609 |
Nassarius obsoletus |
17090911 |
Nassarius reticulatus |
1912658 |
Nassarius vibex |
17107848 |
Nassella leucotricha |
17116419 |
Nasturtium sp. |
1876663 |
Natarsia |
1854769 |
Navicula |
17116245 |
Navicula acceptata |
17112673 |
Navicula angulata |
17100884 |
Navicula arenaria |
17117029 |
Navicula atomus permitis |
17112194 |
Navicula confervacea |
1854801 |
Navicula cryptocephala |
17100876 |
Navicula cryptocephala veneta |
17098856 |
Navicula gracilis |
17098146 |
Navicula incerta |
17111303 |
Navicula luzonensis |
1854835 |
Navicula minima |
17098559 |
Navicula pelliculosa |
17112251 |
Navicula ramosissima |
1854892 |
Navicula salinarum |
17116997 |
Navicula secreta apiculata |
1928134 |
Navicula seminulum |
17117102 |
Navicula seminulum hustedtii |
17117037 |
Navicula tripunctata schizonemoides |
17110966 |
Navicula variostraita |
17082934 |
Navodon modestus |
17076324 |
Neanthes grubei |
1863877 |
Neanthes succinea |
17082710 |
Neanthes vaali |
1928241 |
Neanthes virens |
17096389 |
Nebria brevicollis |
17076092 |
Negaprion brevirostris |
17099268 |
Nelumbo lutea |
17116427 |
Nelumbo nucifera |
17085507 |
Nemacheilus barbatulus |
17083098 |
Nemacheilus botia |
1913466 |
Nemata |
17090242 |
Nematolosa erebi |
1913664 |
Nemertea |
17092156 |
Nemertinea |
1887298 |
Nemoura |
17084351 |
Nemoura cinerea |
17075540 |
Nemoura marginata |
1917129 |
Nemoura trispinosa |
1887223 |
Nemouridae |
17095282 |
Neoantistea riparia |
17096066 |
Neobisium muscorum |
17092826 |
Neocaridina denticulata |
17092768 |
Neochetina eichhornae |
17098138 |
Neochloris |
17078924 |
Neodasys |
964114 |
Neodecanamide, N-methyl- |
357384 |
Neodecanoic acid, phenylmethyl ester |
17092172 |
Neodiaptomus kamakhiae |
166371 |
Neodymium chloride (NdCl3) |
17078171 |
Neogobius fluviatilus |
17078163 |
Neogobius melanostomus |
17123258 |
Neomycin |
86462 |
Neomycin, sulfate (salt) |
1896471 |
Neomysis |
1896489 |
Neomysis americana |
17078023 |
Neomysis awatschensis |
17081340 |
Neomysis integer |
52453479 |
Neomysis mercedis |
17092016 |
Neoniphargus |
1890821 |
Neopanope texana |
1888056 |
Neoperla |
1883297 |
Neophylax |
17078189 |
Neophylax concinnus |
1885185 |
Neoplea striola |
17085473 |
Neosilurus |
17097874 |
Neotoma lepida |
17082736 |
Neotrigonia margaritacea |
1884998 |
Nepa |
17083528 |
Nepa cinerea |
1860840 |
Nephelopsis obscura |
17105982 |
Nephrolepis exaltata |
17090846 |
Nephrops norvegicus |
1863653 |
Nephtys caeca |
1863661 |
Nephtys incisa |
1863687 |
Nephtys picta |
17096959 |
Nephtys sp. |
17078379 |
Nepthys cirrosa |
17078387 |
Nepthys hombergi |
17001017 |
Neptunium |
1863885 |
Nereis |
17118597 |
Nereis arenaceodentata |
1966449 |
Nereis diversicolor |
17076761 |
Nereis glandicincta |
1971548 |
Nerilla antennata |
17096694 |
Nerita albicilla |
17096686 |
Nerita chamaeleon |
17105990 |
Nerium oleander |
17090028 |
Nerodia erthyrogaster flavigaster |
17090036 |
Nerodia rhombifera |
17116336 |
Netrium digitus |
17117243 |
Netrium oblongum |
17083338 |
Neurobosis |
1886654 |
Neurocordulia molesta |
1881804 |
Neuroptera |
17117474 |
Neurospora crassa |
17084088 |
Nibea albiflora |
17083049 |
Nibea japonica |
149674 |
Nickel |
152868 |
Nickel chloride (NiCl2) |
689562 |
Nickel chloride (NiCl2), hexahydrate |
82891 |
Nickel oxide (NiO) |
193839 |
Nickel tungsten oxide (NiWO4) |
192484 |
Nickel, bis(dibutylcarbamodithioato-.kappa.S,.kappa.S')-, (SP-4-1)- |
194076 |
Nickelate(2-), tetrakis(cyano-.kappa.C)-, dipotassium, (SP-4-1)- |
17110222 |
Nicotiana |
17114836 |
Nicotiana affinis |
17106006 |
Nicotiana glauca |
17106014 |
Nicotiana glutinosa |
17114844 |
Nicotiana longiflora |
17109869 |
Nicotiana rustica |
17106022 |
Nicotiana tabacum |
17106030 |
Nigella damascena |
1881663 |
Nigronia serricornis |
166603 |
Niobium chloride (NbCl5) |
17083809 |
Niphargus aquilex |
17101403 |
Nitella |
17101999 |
Nitella flexilis |
17111006 |
Nitella furcata |
17112772 |
Nitella tenuissima |
17112293 |
Nitellopsis obtusa |
17095738 |
Nitidulidae |
17118530 |
Nitocra spinipes |
197186 |
Nitrate |
152686 |
Nitric acid |
143297 |
Nitric acid ammonium salt |
153312 |
Nitric acid potassium salt |
153593 |
Nitric acid silver(1+) salt |
152041 |
Nitric acid sodium salt |
187427 |
Nitric acid, aluminum salt |
166314 |
Nitric acid, barium salt |
189100 |
Nitric acid, beryllium salt |
776047 |
Nitric acid, beryllium salt, tetrahydrate |
155473 |
Nitric acid, beryllium salt, trihydrate |
170613 |
Nitric acid, bismuth(3+) salt |
170217 |
Nitric acid, cadmium salt |
1714263 |
Nitric acid, cadmium salt, tetrahydrate |
168302 |
Nitric acid, calcium salt |
168104 |
Nitric acid, cerium(3+) salt |
155689 |
Nitric acid, cesium salt |
188359 |
Nitric acid, chromium(3+) salt |
168773 |
Nitric acid, cobalt(2+) salt |
17121435 |
Nitric acid, copper(1+) salt |
113621 |
Nitric acid, copper(2+) salt |
168948 |
Nitric acid, gadolinium(3+) salt |
187807 |
Nitric acid, gallium salt |
171215 |
Nitric acid, iron(3+) salt |
167635 |
Nitric acid, lanthanum(3+) salt |
167692 |
Nitric acid, lead(2+) salt |
156281 |
Nitric acid, lithium salt |
170803 |
Nitric acid, magnesium salt |
170811 |
Nitric acid, manganese(2+) salt |
167239 |
Nitric acid, mercury(2+) salt |
184259 |
Nitric acid, nickel(2+) salt |
1714704 |
Nitric acid, plutonium salt |
167072 |
Nitric acid, strontium salt |
167932 |
Nitric acid, thallium(1+) salt |
191650 |
Nitric acid, thorium(4+) salt |
170712 |
Nitric acid, yttrium(3+) salt |
154195 |
Nitric acid, zinc salt |
321364 |
Nitriles, coco |
197194 |
Nitrite |
167924 |
Nitrogen oxide (NO2) |
191759 |
Nitrous acid, lead(2+) salt |
153411 |
Nitrous acid, potassium salt |
152058 |
Nitrous acid, sodium salt |
1855105 |
Nitzschia |
1855113 |
Nitzschia acicularis |
1855121 |
Nitzschia actinastroides |
1855139 |
Nitzschia amphibia |
17098120 |
Nitzschia angularis |
17100918 |
Nitzschia angularis affinis |
17116948 |
Nitzschia capitellata |
1855147 |
Nitzschia closterium |
17100009 |
Nitzschia delicatissima |
1855170 |
Nitzschia dissipata |
17100892 |
Nitzschia dubiformis |
1855204 |
Nitzschia fonticola |
1855212 |
Nitzschia frustulum |
1928522 |
Nitzschia frustulum perminuta |
17116286 |
Nitzschia frustulum perpusilla |
1855220 |
Nitzschia gracilis |
17115924 |
Nitzschia incrustans |
17098849 |
Nitzschia kuetzingianum |
1855253 |
Nitzschia linearis |
1855261 |
Nitzschia longissima |
17098971 |
Nitzschia minutula |
1855279 |
Nitzschia obtusa |
1855287 |
Nitzschia palea |
1928548 |
Nitzschia sigma |
17100900 |
Nitzschia thermalis |
1881366 |
Noctuidae |
17077702 |
Noemacheilus barbatulus |
17084005 |
Noemacheilus denisonii |
17084930 |
Noemacheilus montanus |
17090358 |
Nomia melanderi |
33464 |
Nonanal |
27920 |
Nonane |
67892 |
Nonane, 1-bromo- |
33316 |
Nonanedioic acid |
99242 |
Nonanenitrile |
28084 |
Nonanoic acid |
91587 |
Nonanoic acid, methyl ester |
193334 |
Nonanoic acid, sodium salt |
249508 |
Nonanol |
1714482 |
Nopco 1535 |
1853027 |
Nostoc |
17099797 |
Nostoc calcicola |
17100074 |
Nostoc commune |
17099748 |
Nostoc fritschii |
17112426 |
Nostoc kihlmani |
17101064 |
Nostoc linckia |
17099474 |
Nostoc muscorum |
17100744 |
Nostoc punctiforme |
1900505 |
Notemigonus crysoleucas |
1873553 |
Noteridae |
17084104 |
Nothobranchius guentheri |
17084591 |
Nothobranchius rachovi |
17106048 |
Nothoscordum bivalve |
17093857 |
Nothotylenchus sp. |
17096223 |
Nothrus silvestris |
17094137 |
Notiophilus biguttatus |
17096991 |
Notiophilus palustris |
1875707 |
Notiphila |
17081779 |
Notocallista |
1885102 |
Notonecta |
17118373 |
Notonecta glauca |
1885136 |
Notonecta undulata |
17079765 |
Notonecta unifasciata |
1885086 |
Notonectidae |
17077835 |
Notophthalmus viridescens |
17076811 |
Notopterus notopterus |
17084708 |
Notostraca |
1900513 |
Notropis |
1928738 |
Notropis anogenus |
1900521 |
Notropis atherinoides |
1900539 |
Notropis blennius |
1900554 |
Notropis buccatus |
17083858 |
Notropis chrysoleucas |
1900612 |
Notropis hudsonius |
17096843 |
Notropis ludibundis |
1900638 |
Notropis rubellus |
1900653 |
Notropis stramineus |
1901032 |
Noturus miurus |
1714342 |
Novan |
17081936 |
Nucella lapillus |
17094962 |
Nucula hartvigiana |
1908011 |
Nucula proxima |
17089251 |
Numida meleagris |
17084419 |
Nuria danrica |
17108820 |
Nuttallanthus texanus |
1928902 |
Nycticorax nycticorax |
17116203 |
Nymphaea alba |
17112657 |
Nymphoides cristatum |
17112236 |
Nymphoides pelatum |
17082496 |
Nymphula nymphaeata |
17083866 |
Nymphula responsalis |
17106055 |
Nyssa sylvatica |
17121906 |
OB (biphenyl) |
1905421 |
Obliquaria reflexa |
17087404 |
Ocenebra erinacea |
1857762 |
Ochromonas |
17111196 |
Ochromonas danica |
17098377 |
Ochromonas vallesiaca |
17106063 |
Ocimum basilicum |
21840 |
Octadecanamide, N-(4-hydroxyphenyl)- |
114991 |
Octadecanamide, N-(hydroxymethyl)- |
17151291 |
Octadecanamide, N,N'-1,3-phenylenebis- |
57372 |
Octadecane |
66142 |
Octadecanenitrile |
2436 |
Octadecanoic acid |
23317 |
Octadecanoic acid, 12-hydroxy- |
37440 |
Octadecanoic acid, 12-hydroxy-, 1,2,3-propanetriyl ester |
38216 |
Octadecanoic acid, 12-hydroxy-, methyl ester |
1714400 |
Octadecanoic acid, 2-chloroethyl ester |
17074568 |
Octadecanoic acid, 9,10-dichloro- |
98954 |
Octadecanoic acid, cadmium salt |
28589 |
Octadecanoic acid, methyl ester |
259994 |
Octadecanoic acid, monoester with 1,2,3-propanetriol |
71241 |
Octadecanoic acid, sodium salt |
33423 |
Octanal |
27748 |
Octane |
106286 |
Octane, 1,1'-thiobis- |
27912 |
Octane, 1-bromo- |
64758 |
Octanedinitrile |
48819 |
Octanedioic acid |
33415 |
Octanenitrile |
33373 |
Octanoic acid |
90845 |
Octanoic acid, 2,6-dibromo-4-cyanophenyl ester |
17124355 |
Octanoic acid, 4-cyano-2,6-diiodophenyl ester |
17153693 |
Octanoic acid, 4-nitrophenyl ester |
217844 |
Octanoic acid, copper salt |
27243 |
Octanoic acid, methyl ester |
128736 |
Octanoic acid, nickel(2+) salt |
95166 |
Octanoic acid, sodium salt |
27730 |
Octanoyl chloride |
17116906 |
Octochaetus pattoni |
17096108 |
Octolasion complanatum |
17089640 |
Octolasion cyaneum |
17096470 |
Octopus pallidus |
17090259 |
Oculina |
17097031 |
Ocypus olens |
17093204 |
Ocyurus chrysurus |
17083619 |
Odagmia ornata |
17095324 |
Odiellus pictus |
17086729 |
Odocoileus hemionus |
17086737 |
Odocoileus virginianus |
1885375 |
Odonata |
17078320 |
Odontamblyopus rubicundus |
17091984 |
Odontesthes argentinensis |
1882935 |
Oecetis |
1856905 |
Oedogonium |
17102153 |
Oedogonium areolatum |
17098328 |
Oedogonium cardiacum |
17100405 |
Oedogonium foveolatum |
17114851 |
Oenothera coronopifolia |
17114869 |
Oenothera laciniata |
17114877 |
Oenothera sp. |
1714610 |
Oil Bond 100 |
17152554 |
Oil Dissolver |
17152562 |
Oil Gon |
1714510 |
Oil Herder |
17152570 |
Oil Spill Eater |
1714611 |
Oil Sponge |
156703 |
Oils, citronella |
158063 |
Oils, lime |
157099 |
Oils, pine |
17114885 |
Oldenlandia corymbosa |
17106071 |
Olea europaea |
17113143 |
Olea sp. |
1859040 |
Oligochaeta |
52453537 |
Oligocottus maculosus |
17091133 |
Oligostomis pardalis |
17100991 |
Olisthodiscus |
17098567 |
Olisthodiscus luteus |
156851 |
Olive oil |
17082843 |
Onchidoris fusca |
17079708 |
Oncholaimus |
17082421 |
Oncholaimus macramphida |
17077686 |
Oncomelania nosophora |
17077405 |
Oncorhynchus aguabonita |
17097601 |
Oncorhynchus clarki henshawi |
17095787 |
Oncorhynchus clarki lewisi |
1901347 |
Oncorhynchus clarkii |
17097668 |
Oncorhynchus gilae apache |
1929009 |
Oncorhynchus gorbuscha |
17078031 |
Oncorhynchus keta |
1929017 |
Oncorhynchus kisutch |
17079401 |
Oncorhynchus masou |
1901354 |
Oncorhynchus mykiss |
1929025 |
Oncorhynchus nerka |
17091398 |
Oncorhynchus nerka kennerlyi |
1929033 |
Oncorhynchus tshawytscha |
1917194 |
Oniscus asellus |
17088832 |
Onisimus |
17086216 |
Onisimus litoralis |
17106089 |
Onobrychis viciifolia |
17094251 |
Onychiurus armatus |
17094855 |
Onychiurus folsomi |
17094095 |
Onychiurus sp. |
17081183 |
Onychylis nigrirostris |
1856178 |
Oocystis |
1856210 |
Oocystis lacustris |
17099953 |
Oocystis marssonii |
1856236 |
Oocystis pusilla |
1854199 |
Opephora |
17076399 |
Opercularia |
17092370 |
Opercularia coarctata |
17092362 |
Opercularia minima |
17092396 |
Ophicardelus quoyi |
17083536 |
Ophidia |
17088683 |
Ophiocephalus punctatus |
17085598 |
Ophioderma brevispina |
17114893 |
Ophioglossum petiolatum |
1885920 |
Ophiogomphus |
17086430 |
Ophiogomphus carolus |
1953421 |
Ophiothrix spiculata |
17079591 |
Ophiura albida |
17077678 |
Ophryotrocha diadema |
17081324 |
Ophryotrocha labronica |
1945963 |
Opiliones |
17091034 |
Opisthocentrus ocellatus |
17093139 |
Opius bruneipus |
17075623 |
Oplegnathus fasciatus |
17094525 |
Oppiella nova |
17094533 |
Oppiidae |
17093683 |
Oppioidea |
1929132 |
Opsanus beta |
1929140 |
Opsanus tau |
17085408 |
Opsariichthys uncirostris |
1900695 |
Opsopoeodus emiliae |
52452273 |
Optioservus divergens |
1874403 |
Optioservus fastiditus |
17109877 |
Opuntia |
17106097 |
Opuntia leptocaulis |
17114901 |
Opuntia lindheimeri |
17110776 |
Opuntia polyacantha |
17096413 |
Orbinia sp. |
17093121 |
Orchesella cincta |
1969971 |
Orchestia gammarella |
17085218 |
Orchestia mediterranea |
17083460 |
Orchestia traskiana |
1891662 |
Orconectes |
1891704 |
Orconectes immunis |
1917228 |
Orconectes limosus |
1891712 |
Orconectes nais |
17090424 |
Orconectes neglectus |
1891720 |
Orconectes propinquus |
17081555 |
Orconectes propinquus propinqu |
1929207 |
Orconectes rusticus |
1891746 |
Orconectes virilis |
17081266 |
Oribatei |
17093642 |
Oribatida |
1881135 |
Ormosia |
17115916 |
Ornithopus compressus |
1886688 |
Orthemis |
17076944 |
Orthetrum albistylum speciosum |
1877687 |
Orthocladiinae |
1880251 |
Orthocladius |
52451150 |
Orthodon microlepidotus |
1929272 |
Orthopristis chrysoptera |
17090929 |
Orthopristis ruber |
1886993 |
Orthoptera |
1882687 |
Orthotrichia |
17086745 |
Oryctolagus cuniculus |
1640150 |
Oryza |
17106105 |
Oryza sativa |
17075318 |
Oryzias latipes |
17091802 |
Oryzias melanostigma |
17095464 |
Oryzias sp. |
1853126 |
Oscillatoria |
17101932 |
Oscillatoria agardhii |
17100710 |
Oscillatoria amphibia |
17117995 |
Oscillatoria chalybea |
17098062 |
Oscillatoria limnetica |
17112418 |
Oscillatoria redekei |
17101882 |
Oscillatoria rubescens |
1853142 |
Oscillatoria tenuis |
17101031 |
Oscillatoria terebreviformis |
17112335 |
Oscillatoria woronichinii |
1929280 |
Osmerus mordax |
218685 |
Osmium oxide (OsO4), (T-4)- |
1898352 |
Osteichthyes |
17114919 |
Osteospermum fruticosum |
1929306 |
Ostracoda |
17078346 |
Ostrea angasi |
1968460 |
Ostrea edulis |
17078205 |
Ostrea gigas |
17096405 |
Ostrea sp. |
17109380 |
Ostrya virginiana |
17106121 |
Ottochloa nodosa |
17086752 |
Otus asio |
17090044 |
Ourebia ourebia |
1855667 |
Ourococcus |
17089665 |
Ovis aries |
1864685 |
Owenia fusiformis |
33118 |
Oxacycloheptadec-8-en-2-one, (8Z)- |
17106139 |
Oxalis corniculata |
17114927 |
Oxalis latifolia |
17108432 |
Oxalis pes-caprae |
17114935 |
Oxalis priceae Small |
17106147 |
Oxalis stricta |
1714520 |
Oxane Z |
1714323 |
Oxazole, 4,5-dihydro-2-undecyl- |
290957 |
Oxazolidine, 4,4-dimethyl- |
5405 |
Oxirane |
23945 |
Oxirane, (chloromethyl)- |
32383 |
Oxirane, (phenoxymethyl)- |
23978 |
Oxirane, [(2-propenyloxy)methyl]- |
102624 |
Oxirane, [[(2-ethylhexyl)oxy]methyl]- |
311514 |
Oxirane, 2-(3,5-dichlorophenyl)-2-(2,2,2-trichloroethyl)- |
1714661 |
Oxirane, 2,3-diphenyl-, (2R,3R)-rel- |
254565 |
Oxirane, 2-decyl-3-(5-methylhexyl)-, (2R,3S)-rel- |
5660 |
Oxirane, methyl- |
161356 |
Oxirane, methyl-, polymer with oxirane |
699116 |
Oxirane, methyl-, polymer with oxirane, block |
16584 |
Oxirane, phenyl- |
110643 |
Oxiranemethanaminium, N,N,N-trimethyl-, chloride |
53900 |
Oxiranemethanol |
961664 |
Oxiraneoctanoic acid, 3-octyl- |
17110545 |
Oxydendrum arboreum |
1714385 |
Oxyphos |
17092446 |
Oxytricha granulifera |
17077579 |
Oziotelphusa senex senex |
17092602 |
Ozius rugulosus |
166678 |
Ozone |
1714694 |
P,P-Diamidodiphosphoric acid, N,N,N',N'-tetramethyl-, diethyl ester |
1886704 |
Pachydiplax |
1886712 |
Pachydiplax longipennis |
1951649 |
Pachygrapsus crassipes |
17091927 |
Pachygrapsus laevimanus |
17079351 |
Pachymetopon blochii |
17106154 |
Pachysandra terminalis |
17089038 |
Pacifastacus trowbridgi |
17083221 |
Pacifasticus leniusculus |
17112541 |
Padina gymnospora |
17116575 |
Padina sp. |
17089681 |
Pagophilus groenlandicus |
17091455 |
Pagothenia bernacchii |
17080771 |
Pagrus auratus |
17088345 |
Pagrus major |
1889757 |
Pagurus |
17082777 |
Pagurus bernhardus |
1889799 |
Pagurus longicarpus |
1891324 |
Palaemon |
17086042 |
Palaemon adspersus |
17077991 |
Palaemon elegans |
17076480 |
Palaemon japonicus |
52455987 |
Palaemon macrodactylus |
17084179 |
Palaemon pacificus |
17084880 |
Palaemon paucidens |
17077975 |
Palaemon serratus |
17082835 |
Palaemon squilla |
1891340 |
Palaemonetes |
1891365 |
Palaemonetes kadiakensis |
1891373 |
Palaemonetes paludosus |
1891381 |
Palaemonetes pugio |
17077884 |
Palaemonetes varians |
1891399 |
Palaemonetes vulgaris |
166512 |
Palladate(2-), tetrachloro-, dipotassium, (SP-4-1)- |
152249 |
Palladium chloride (PdCl2) |
180323 |
Palygorskite ([Mg(Al0.5-1Fe0-0.5)]Si4(OH)O10.4H2O) |
17087719 |
Palythoa mammillosa |
17094236 |
Panagrellus redivivus |
17093451 |
Panagrolaimus sp. |
17106162 |
Panax pseudoginseng |
17116302 |
Panax quinquefolius |
159970 |
Pancreatin |
1970185 |
Pandalus borealis |
1950161 |
Pandalus danae |
17118571 |
Pandalus goniurus |
1970193 |
Pandalus montagui |
1950153 |
Pandalus platyceros |
1857283 |
Pandorina |
17100439 |
Pandorina mora |
1857291 |
Pandorina morum |
17099169 |
Panicum |
17106170 |
Panicum capillare |
17106188 |
Panicum coloratum |
17106196 |
Panicum dichotomiflorum |
17106204 |
Panicum miliaceum |
17114950 |
Panicum nodosum |
17106212 |
Panicum repens |
1890854 |
Panopeus herbstii |
17080532 |
Pantala flavescens |
17093055 |
Pantala hymenaea |
17081373 |
Panulirus argus |
17092222 |
Panulirus cygnus |
17106238 |
Papaver rhoeas |
17106246 |
Papaver somniferum |
17115841 |
Papaveraceae |
17088691 |
Paphia laterisulca |
17083544 |
Paphia textile |
17077645 |
Paracalanus parvus |
17080854 |
Paracalliope fluviatilis |
1887561 |
Paracapnia |
1917335 |
Paracapnia angulata |
1917343 |
Paracapnia opis |
17078502 |
Paracentrotus lividus |
1959238 |
Paracerceis sculpta |
17093212 |
Paracheirodon axelrodi |
17095423 |
Paracheirodon innesi |
158295 |
Paraffin oils |
331603 |
Paraffin waxes and Hydrocarbon waxes, chloro |
17154063 |
Paraffins (petroleum), normal C>10, chloro |
256545 |
Paraformaldehyde |
1888072 |
Paragnetina |
1888114 |
Paragnetina media |
17082447 |
Paragrapsus gaimardii |
17082082 |
Paragrapsus quadridentatus |
17078908 |
Parahaploposthia thiophilus |
1957182 |
Paralabrax clathratus |
1957190 |
Paralabrax nebulifer |
1872027 |
Paraleptophlebia |
1872076 |
Paraleptophlebia memorialis |
17083965 |
Paraleptophlebia praepedita |
17079492 |
Paraleptophlebia submarginata |
1958529 |
Paralichthys californicus |
1929587 |
Paralichthys dentatus |
1929595 |
Paralichthys lethostigma |
17082272 |
Paralichthys olivaceus |
17092404 |
Paralichthys orbignyanus |
17081027 |
Paramecium |
17079880 |
Paramecium aurelia |
17076894 |
Paramecium bursaria |
17095514 |
Paramecium calkinsi |
17079823 |
Paramecium caudatum |
17080615 |
Paramecium multimicronucleatum |
17087792 |
Paramecium primaurelia |
17079369 |
Paramecium putrinum |
17087800 |
Paramecium tetraurelia |
17088444 |
Paranophrys |
17091471 |
Parapristipoma trilineatum |
17092271 |
Pararotalia spinigera |
17092073 |
Parastenocaris germanica |
1879451 |
Paratanytarsus |
17076225 |
Paratanytarsus parthenogenetic |
17095415 |
Paratanytarsus sp. |
17087875 |
Paratelphusa hydrodromus |
17118548 |
Paratelphusa jacquemontii |
17076357 |
Paratelphusa masoniana |
17091950 |
Paratelphusa spinigera |
17095456 |
Paratenuisentis ambiguus |
17091869 |
Paratrichocladius rufiventris |
17080862 |
Paratya australiensis |
17084203 |
Paratya compressa compressa |
17090937 |
Paratya compressa improvisa |
17092206 |
Paratya curvirostris |
17093469 |
Pardosa mackenziana |
17097007 |
Pardosa prativaga |
17082645 |
Parechinus angulosus |
17075474 |
Parhyale hawaiensis |
17111832 |
Parnassia palustris |
17092107 |
Parreysia favidens |
17083650 |
Parreysia rugosa |
17096454 |
Parreysia sp. |
17110842 |
Parthenium hysterophorus |
17112947 |
Parthenocissus quinquefolia |
17110354 |
Parthenocissus tricuspidata |
17097924 |
Parus inornatus |
17108770 |
Pascopyrum smithii |
17106253 |
Paspalum conjugatum |
17106261 |
Paspalum dilatatum |
17106279 |
Paspalum distichum |
17106287 |
Paspalum fasciculatum |
17106295 |
Paspalum notatum |
17106303 |
Paspalum paniculatum |
17114968 |
Paspalum plicatulum |
17106311 |
Paspalum scrobiculatum |
17114976 |
Paspalum sp. |
17106329 |
Paspalum urvillei |
17106337 |
Paspalum virgatum |
1929751 |
Passer domesticus |
17094038 |
Passeriformes |
17109885 |
Passiflora |
17106345 |
Passiflora incarnata |
17106352 |
Pastinaca sativa |
17082538 |
Patella |
17075730 |
Patella vulgata |
17088121 |
Patinopecten yessoensis |
17082702 |
Patiriella exigua |
17095183 |
Pauridia peregrina |
17094061 |
Pauropoda |
17100330 |
Pavlova |
17098401 |
Pavlova lutheri |
17102047 |
Pavlova salina |
298950 |
PCB 1242 |
182766 |
PCB 1248 |
173047 |
PCB 1254 |
173021 |
PCB 1260 |
157073 |
Peanut oil |
17079062 |
Pecten maximus |
17079682 |
Pecten yessoensis |
1939586 |
Pectinaria californiensis |
1864933 |
Pectinaria gouldi |
17078395 |
Pectinaria koreni |
17092818 |
Pectinatella gelatinosa |
1897784 |
Pectinatella magnifica |
1855790 |
Pediastrum |
17098583 |
Pediastrum biradiatum |
1855816 |
Pediastrum duplex |
1855832 |
Pediastrum simplex |
1855840 |
Pediastrum tetras |
1881259 |
Pedicia |
17112178 |
Pedicularis palustris |
17114992 |
Pelargonium sp. |
17114984 |
Pelargonium x hortorum |
17086760 |
Pelecanus erythrorhynchos |
17091521 |
Pellioditis marina |
1860386 |
Peloscolex ferox |
1860394 |
Peloscolex gabriellae |
17096827 |
Pelsartia humeralis |
1873470 |
Peltodytes |
1887421 |
Peltoperla |
17088865 |
Peltoperla arcuata |
17106360 |
Peltophorum pterocarpum |
17101502 |
Pelvetia canaliculata |
1889203 |
Penaeidae |
1889237 |
Penaeus |
1889252 |
Penaeus aztecus |
1949643 |
Penaeus californiensis |
17086224 |
Penaeus chinensis |
1889260 |
Penaeus duorarum |
17079179 |
Penaeus indicus |
17076738 |
Penaeus japonicus |
17077223 |
Penaeus kerathurus |
17079187 |
Penaeus merguiensis |
17118720 |
Penaeus monodon |
17079146 |
Penaeus occidentalis |
17083130 |
Penaeus paulensis |
17086232 |
Penaeus penicillatus |
17092487 |
Penaeus plebejus |
17079153 |
Penaeus schmitti |
17079161 |
Penaeus semisulcatus |
1889278 |
Penaeus setiferus |
17081449 |
Penaeus stylirostris |
17090853 |
Penaeus vannamei |
17117797 |
Penicillium verrucosum |
17111014 |
Penium margaritaceum |
1714612 |
Penmul R 740 |
1853720 |
Pennales |
17106378 |
Pennisetum clandestinum |
17106386 |
Pennisetum glaucum |
64824 |
Pentadecane |
94300 |
Pentadecane, 2,6,10,14-tetramethyl- |
147215 |
Pentadecanoic acid, methyl ester |
26815 |
Pentanal |
32805 |
Pentanal, 2-methyl- |
17123639 |
Pentanamide, N-(3-chloro-4-methylphenyl)-2-methyl- |
26021 |
Pentane |
67900 |
Pentane, 1,1'-oxybis- |
64444 |
Pentane, 1,5-dichloro- |
51961 |
Pentane, 2,2,4-trimethyl- |
27425 |
Pentanedial |
269886 |
Pentanedinitrile, 2-bromo-2-(bromomethyl)- |
27102 |
Pentanedioic acid |
42465 |
Pentanedioic acid, 2-oxo- |
127886 |
Pentanedioic acid, 3,3-dimethyl- |
145409 |
Pentanedioic acid, 3-methyl-, diethyl ester |
22830 |
Pentanedioic acid, 3-oxo-, diethyl ester |
1877083 |
Pentaneura |
1877117 |
Pentaneura monilis |
25908 |
Pentanoic acid |
17434 |
Pentanoic acid, 2-methyl- |
685057 |
Pentanoic acid, 2-propyl- |
22780 |
Pentanoic acid, 3-methyl- |
66613 |
Pentanoic acid, 4-methyl- |
33167 |
Pentanoic acid, 4-oxo- |
1714349 |
Pentanoic acid, 4-oxo-, 2-propenyl ester |
23747 |
Pentanoic acid, 5-amino-4-oxo- |
63149 |
Pentanoic acid, methyl ester |
17095670 |
Pentatomidae |
232454 |
Pentene |
17106394 |
Peperomia obtusifolia |
17080607 |
Peranema trichophorum |
152066 |
Perboric acid (HBO(O2)), sodium salt |
689711 |
Perboric acid (HBO(O2)), sodium salt, tetrahydrate |
173542 |
Perboric acid, sodium salt |
1899012 |
Perca |
1899020 |
Perca flavescens |
17074394 |
Perca fluviatilis |
151761 |
Perchloric acid |
156398 |
Perchloric acid, ammonium salt |
190835 |
Perchloric acid, copper(2+) salt |
153973 |
Perchloric acid, potassium salt |
151753 |
Perchloric acid, sodium salt |
1898824 |
Percidae |
1901222 |
Percopsis omiscomaycus |
17089137 |
Perdix perdix |
1880962 |
Pericoma |
1858711 |
Peridinium |
17112582 |
Peridinium gatunense |
17116526 |
Peridinopsis sp. |
17095506 |
Peridroma saucia |
17106402 |
Perilla nankinensis |
156083 |
Periodic acid (HIO4), potassium salt |
17094467 |
Perionyx excavatus |
17097676 |
Periophthalmus dipus |
17082983 |
Periplaneta americana |
17083635 |
Perkinsus marinus |
1888098 |
Perla immarginata |
17082520 |
Perla maxima |
17097833 |
Perla sp. |
1887736 |
Perlesta placida |
152975 |
Permanganic acid (HMnO4), potassium salt |
17087545 |
Perna indica |
17084187 |
Perna perna |
17077389 |
Perna viridis |
17097866 |
Perognathus longimembris |
17089699 |
Peromyscus |
17086778 |
Peromyscus leucopus |
17089095 |
Peromyscus maniculatus |
17086786 |
Peromyscus polionotus |
17082637 |
Peronella japonica |
17087891 |
Peronidia venulosa |
99630 |
Peroxide, acetyl nitro |
8342 |
Peroxide, bis(1-methyl-1-phenylethyl) |
15420 |
Peroxide, dibenzoyl |
153148 |
Peroxydisulfuric acid ([(HO)S(O)2]2O2), diammonium salt |
153106 |
Peroxydisulfuric acid ([(HO)S(O)2]2O2), dipotassium salt |
153809 |
Peroxydisulfuric acid ([(HO)S(O)2]2O2), disodium salt |
17106410 |
Persea americana |
17106428 |
Persea borbonia |
40642 |
Perylene |
157081 |
Petroleum |
1889898 |
Petrolisthes armatus |
17090267 |
Petromyzon |
1930015 |
Petromyzon marinus |
17106436 |
Petroselinum hortense |
17108853 |
Petunia axillaris |
17115023 |
Petunia sp. |
17115015 |
Petunia x hybrida |
1878883 |
Phaenopsectra |
17099839 |
Phaeodactylum |
17098229 |
Phaeodactylum tricornutum |
1963016 |
Phagocata gracilis |
1930031 |
Phalacrocorax auritus |
17095332 |
Phalangiidae |
17117789 |
Phalangispora constricta |
17108960 |
Phalaris aquatica |
17106444 |
Phalaris arundinacea |
17106451 |
Phalaris brachystachys |
17117672 |
Phanerochaete chrysosporium |
1915461 |
Phascolion strombi |
17109893 |
Phaseolus |
17106469 |
Phaseolus coccineus |
17106477 |
Phaseolus lunatus |
17106485 |
Phaseolus vulgaris |
1930049 |
Phasianus colchicus |
10199 |
Phenanthrene |
71852 |
Phenanthrene, 1-methyl- |
708917 |
Phenanthrene, 1-methyl-7-(1-methylethyl)- |
88963 |
Phenanthrene, 3,6-dimethyl- |
961045 |
Phenanthridine |
1714483 |
Phenanthridinium, 3,8-diamino-5-ethyl-6-phenyl-, bromide |
17000720 |
Phenarsazine, 10-chloro-5,10-dihydro- |
14449 |
Phenazine |
46995 |
Phenazinium, 3,7-diamino-2,8-dimethyl-5-phenyl-, chloride |
1714380 |
Phenoclor DP 6 |
25510 |
Phenol |
244442 |
Phenol, (1,1,3,3-tetramethylbutyl)- |
227876 |
Phenol, (1,1-dimethylethyl)-4-methoxy- |
11619 |
Phenol, 2-(1,1-dimethylethyl)- |
86595 |
Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro- |
1714557 |
Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro-, carbamate (ester) |
689323 |
Phenol, 2-(1,3-dioxolan-2-yl)-, methylcarbamate |
17124405 |
Phenol, 2-(1-methylbutyl)-4,6-dinitro- |
28928 |
Phenol, 2-(1-methylethoxy)-, methylcarbamate |
11965 |
Phenol, 2-(1-methylethyl)- |
105502 |
Phenol, 2-(1-methylethyl)-, methylcarbamate |
1714437 |
Phenol, 2-(1-methylethyl)-4,6-dinitro- |
12575 |
Phenol, 2-(1-methylpropyl)- |
118943 |
Phenol, 2-(1-methylpropyl)-, methylcarbamate |
12047 |
Phenol, 2-(1-methylpropyl)-4,6-dinitro- |
5240296 |
Phenol, 2-(1-methylpropyl)-4,6-dinitro-, acetate (ester) |
91884 |
Phenol, 2-(2-propenyl)- |
17124116 |
Phenol, 2-(2-propynyloxy)-, methylcarbamate |
251504 |
Phenol, 2-(phenylmethyl)- |
4622 |
Phenol, 2,2'-methylenebis[3,4,6-trichloro- |
748996 |
Phenol, 2,2'-methylenebis[4,6-dichloro- |
17228 |
Phenol, 2,2'-methylenebis[4-chloro- |
169029 |
Phenol, 2,2'-methylenebis[4-chloro-, monosodium salt |
17125139 |
Phenol, 2,2'-thiobis(4,6-dichloro-, disodium salt |
114264 |
Phenol, 2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)- |
17210 |
Phenol, 2,2'-thiobis[4,6-dichloro- |
55236 |
Phenol, 2,3,4,5-tetrabromo-6-methyl- |
128272 |
Phenol, 2,3,4,5-tetrachloro- |
104083 |
Phenol, 2,3,4,5-tetrachloro-6-methoxy- |
2931 |
Phenol, 2,3,4,6-tetrachloro- |
202390 |
Phenol, 2,3,4-trichloro- |
687897 |
Phenol, 2,3,4-trichloro-6-methoxy- |
182105 |
Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate |
74658 |
Phenol, 2,3,5,6-tetrachloro- |
74526 |
Phenol, 2,3,5-trichloro- |
68155 |
Phenol, 2,3,5-trimethyl- |
74518 |
Phenol, 2,3,6-trichloro- |
101592 |
Phenol, 2,3,6-trimethyl- |
55210 |
Phenol, 2,3-dichloro- |
50161 |
Phenol, 2,3-dimethyl- |
16519 |
Phenol, 2,4,5-trichloro- |
36624 |
Phenol, 2,4,5-trichloro-, sodium salt |
30379 |
Phenol, 2,4,6-tribromo- |
11536 |
Phenol, 2,4,6-trichloro- |
59394 |
Phenol, 2,4,6-triiodo- |
50278 |
Phenol, 2,4,6-trimethyl- |
12070 |
Phenol, 2,4,6-trinitro- |
114546 |
Phenol, 2,4,6-trinitro-, sodium salt |
68965 |
Phenol, 2,4,6-tris(1,1-dimethylethyl)- |
758672 |
Phenol, 2,4,6-tris(1-methylethyl)- |
17038 |
Phenol, 2,4-bis(1,1-dimethylethyl)- |
36863 |
Phenol, 2,4-diamino-, dihydrochloride |
60798 |
Phenol, 2,4-dibromo- |
31443 |
Phenol, 2,4-dichloro- |
17074519 |
Phenol, 2,4-dichloro-, benzenesulfonate |
118851 |
Phenol, 2,4-dichloro-, sodium salt |
17153719 |
Phenol, 2,4-dichloro-6-(phenylmethyl)- |
88807 |
Phenol, 2,4-dichloro-6-methyl- |
22970 |
Phenol, 2,4-dimethyl- |
119685 |
Phenol, 2,4-dimethyl-, phosphate (3:1) |
1313 |
Phenol, 2,4-dinitro- |
1714597 |
Phenol, 2,4-dipentyl- |
55822 |
Phenol, 2,5-dichloro- |
16469 |
Phenol, 2,5-dimethyl- |
42564 |
Phenol, 2,5-dinitro- |
34504 |
Phenol, 2,6-bis(1,1-dimethylethyl)- |
34496 |
Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl- |
17123456 |
Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl-, methylcarbamate |
59170 |
Phenol, 2,6-dibromo- |
18614 |
Phenol, 2,6-dibromo-4-nitro- |
11312 |
Phenol, 2,6-dichloro- |
102038 |
Phenol, 2,6-dichloro-4-methyl- |
13268 |
Phenol, 2,6-dimethoxy- |
55228 |
Phenol, 2,6-dimethyl- |
55020 |
Phenol, 2,6-dinitro- |
131680 |
Phenol, 2-[(4-hydroxyphenyl)sulfonyl]- |
17127655 |
Phenol, 2-[(ethylthio)methyl]-, methylcarbamate |
16212 |
Phenol, 2-amino- |
1714468 |
Phenol, 2-amino-, 4-methylbenzenesulfonate |
144097 |
Phenol, 2-amino-4,5-dimethyl- |
17002353 |
Phenol, 2-amino-4,6-dinitro- |
16444 |
Phenol, 2-amino-4-methyl- |
18770 |
Phenol, 2-amino-4-nitro- |
16220 |
Phenol, 2-bromo- |
17152315 |
Phenol, 2-bromo-4-(1,1-dimethylethyl)-6-nitro- |
1714536 |
Phenol, 2-bromo-6-nitro- |
17152307 |
Phenol, 2-bromo-6-nitro-4-(1,1,3,3-tetramethylbutyl)- |
112862 |
Phenol, 2-butyl- |
16238 |
Phenol, 2-chloro- |
207472 |
Phenol, 2-chloro-4-(1,1,3,3-tetramethylbutyl)- |
17905 |
Phenol, 2-chloro-4-(1,1-dimethylethyl)- |
1714676 |
Phenol, 2-chloro-4-(1,1-dimethylethyl)-6-nitro- |
961235 |
Phenol, 2-chloro-4,5-dimethyl-, methylcarbamate |
61556 |
Phenol, 2-chloro-4-nitro- |
316000 |
Phenol, 2-chloro-4-nonyl- |
17153040 |
Phenol, 2-chloro-6-methoxy-4-methyl- |
17272956 |
Phenol, 2-chloro-6-methyl- |
58651 |
Phenol, 2-chloro-6-nitro- |
30676 |
Phenol, 2-cyclohexyl- |
35519 |
Phenol, 2-cyclohexyl-4,6-dinitro- |
17122557 |
Phenol, 2-cyclohexyl-4,6-dinitro-, compd. with N-cyclohexylcyclohexanamine (1:1) |
12773 |
Phenol, 2-ethyl- |
17273434 |
Phenol, 2-fluoro-4-nitro- |
50906 |
Phenol, 2-iodo- |
12823 |
Phenol, 2-methoxy- |
17384 |
Phenol, 2-methoxy-4-(2-propenyl)- |
14910 |
Phenol, 2-methoxy-4-methyl- |
113639 |
Phenol, 2-methoxy-4-nitro- |
16147 |
Phenol, 2-methyl- |
17295262 |
Phenol, 2-methyl-3,5-dinitro- |
51102 |
Phenol, 2-methyl-4,6-dinitro- |
17153198 |
Phenol, 2-methyl-4,6-dinitro-, acetate (ester) |
100099 |
Phenol, 2-methyl-4,6-dinitro-, sodium salt |
48207 |
Phenol, 2-methyl-5-(1-methylethyl)- |
1714537 |
Phenol, 2-methyl-6-nitro- |
17121799 |
Phenol, 2-methyldinitro-, sodium salt |
12005 |
Phenol, 2-nitro- |
71415 |
Phenol, 2-nitro-, sodium salt |
36749 |
Phenol, 2-pentyl- |
66399 |
Phenol, 2-propyl- |
55970 |
Phenol, 3-(1,1-dimethylethyl)- |
70383 |
Phenol, 3-(1,1-dimethylethyl)-, methylcarbamate |
962118 |
Phenol, 3-(1-ethylpropyl)-, methylcarbamate, mixt. with 3-(1-methylbutyl)phenyl methylcarbamate |
961615 |
Phenol, 3-(1-methylbutyl)-, methylcarbamate |
61374 |
Phenol, 3-(1-methylethyl)- |
3780 |
Phenol, 3-(1-methylethyl)-, methylcarbamate |
1714274 |
Phenol, 3-(diethylamino)-, hydrochloride |
17848 |
Phenol, 3-(trifluoromethyl)- |
59352 |
Phenol, 3,4,5-trichloro- |
749002 |
Phenol, 3,4,5-trichloro-2,6-dimethoxy- |
308627 |
Phenol, 3,4,5-trichloro-2-methoxy- |
106187 |
Phenol, 3,4,5-trimethyl-, methylcarbamate |
708545 |
Phenol, 3,4,6-trichloro-2-nitro- |
16386 |
Phenol, 3,4-dichloro- |
16287 |
Phenol, 3,4-dimethyl- |
101824 |
Phenol, 3,4-dimethyl-, methylcarbamate |
79731 |
Phenol, 3,5-bis(1,1-dimethylethyl)- |
17123878 |
Phenol, 3,5-bis(1,1-dimethylethyl)-, methylcarbamate |
56895 |
Phenol, 3,5-dichloro- |
17127671 |
Phenol, 3,5-diethyl-, methylcarbamate |
17295312 |
Phenol, 3,5-dimethoxy- |
25270 |
Phenol, 3,5-dimethyl- |
95679 |
Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
56861 |
Phenol, 3-amino- |
56820 |
Phenol, 3-bromo- |
25106 |
Phenol, 3-chloro- |
17295155 |
Phenol, 3-chloro-4-nitro- |
63636 |
Phenol, 3-iodo- |
39982 |
Phenol, 3-methoxy- |
25064 |
Phenol, 3-methyl- |
17121542 |
Phenol, 3-methyl-4-(methylamino)-, methylcarbamate (ester) |
104752 |
Phenol, 3-methyl-4-nitro- |
105494 |
Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
41632 |
Phenol, 3-methyl-6-(1-methylethyl)-2,4-dinitro- |
53603 |
Phenol, 3-nitro- |
37820 |
Phenol, 4-(1,1,3,3-tetramethylbutyl)- |
18119 |
Phenol, 4-(1,1-dimethylethyl)- |
110940 |
Phenol, 4-(1,1-dimethylethyl)-, acetate |
8359 |
Phenol, 4-(1,1-dimethylpropyl)- |
18994 |
Phenol, 4-(1-methylethyl)- |
18879 |
Phenol, 4-(1-methylpropyl)- |
17163569 |
Phenol, 4-(2-aminoethyl)- |
1714532 |
Phenol, 4-(2-butenyl)- |
14878 |
Phenol, 4-(2-naphthalenylamino)- |
708628 |
Phenol, 4-(butylamino)- |
17121484 |
Phenol, 4-(di-2-propenylamino)-3,5-dimethyl-, methylcarbamate (ester) |
137729 |
Phenol, 4-(dimethylamino)-3,5-dimethyl- |
42135 |
Phenol, 4-(dimethylamino)-3,5-dimethyl-, methylcarbamate (ester) |
95661 |
Phenol, 4-(dimethylamino)-3-methyl-, methylcarbamate (ester) |
1714720 |
Phenol, 4-(methylamino)- |
1925 |
Phenol, 4-(methylamino)-, sulfate (2:1) (salt) |
90829 |
Phenol, 4-(phenylazo)- |
21196 |
Phenol, 4-(phenylmethoxy)- |
20156 |
Phenol, 4-(phenylmethyl)- |
17273426 |
Phenol, 4-(trifluoromethyl)- |
17154071 |
Phenol, 4-(triphenylmethyl)- |
39339 |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis- |
29165 |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo- |
6320 |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methyl- |
6312 |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-3-methyl-6-(1-methylethyl)- |
17002239 |
Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis- |
8110 |
Phenol, 4,4'-(1-methylethylidene)bis- |
8045 |
Phenol, 4,4'-(1-methylethylidene)bis[2,6-dibromo- |
8052 |
Phenol, 4,4'-(1-methylethylidene)bis[2,6-dichloro- |
109488 |
Phenol, 4,4'-(2,2,2-trichloroethylidene)bis- |
1714527 |
Phenol, 4,4'-(2,2-dichloroethylidene)bis- |
2196 |
Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis- |
17002502 |
Phenol, 4,4'-[(1E)-1,2-diethyl-1,2-ethenediyl]bis-, dipropanoate |
94953 |
Phenol, 4,4'-oxybis- |
92296 |
Phenol, 4,4'-sulfinylbis- |
105932 |
Phenol, 4,4'-thiobis- |
687673 |
Phenol, 4,5-dichloro-2-methoxy- |
30528 |
Phenol, 4-[(2,4-dinitrophenyl)amino]- |
86702 |
Phenol, 4-[(4-nitrophenyl)azo]- |
1714320 |
Phenol, 4-[(7-chloro-4-quinolinyl)amino]-2-(1-pyrrolidinylmethyl)-, dihydrochloride |
21188 |
Phenol, 4-[(phenylmethyl)amino]- |
32896 |
Phenol, 4-amino- |
192203 |
Phenol, 4-amino-, acetate (ester) |
1487 |
Phenol, 4-amino-, hydrochloride |
59378 |
Phenol, 4-amino-2,6-dibromo- |
30627 |
Phenol, 4-amino-2-nitro- |
107888 |
Phenol, 4-amino-3-methyl- |
23572 |
Phenol, 4-bromo- |
89920 |
Phenol, 4-butyl- |
23648 |
Phenol, 4-chloro- |
1714621 |
Phenol, 4-chloro-2-(2-propenyl)- |
31120 |
Phenol, 4-chloro-2-(phenylmethyl)- |
17151457 |
Phenol, 4-chloro-2,3-dimethyl- |
12054 |
Phenol, 4-chloro-2,6-dinitro- |
88799 |
Phenol, 4-chloro-2-methyl- |
12526 |
Phenol, 4-chloro-2-nitro- |
11510 |
Phenol, 4-chloro-3,5-dimethyl- |
3103 |
Phenol, 4-chloro-3-methyl- |
12542 |
Phenol, 4-chloro-5-methyl-2-(1-methylethyl)- |
79558 |
Phenol, 4-cyclohexyl- |
22079 |
Phenol, 4-dodecyl- |
62570 |
Phenol, 4-ethoxy- |
32748 |
Phenol, 4-ethyl- |
44123 |
Phenol, 4-fluoro- |
95232 |
Phenol, 4-heptyl- |
102418 |
Phenol, 4-hexyl- |
51854 |
Phenol, 4-iodo- |
40089 |
Phenol, 4-methoxy- |
1714734 |
Phenol, 4-methoxy-, benzoate |
23606 |
Phenol, 4-methyl- |
30619 |
Phenol, 4-methyl-2-nitro- |
19117 |
Phenol, 4-nitro- |
11718 |
Phenol, 4-nitro-3-(trifluoromethyl)- |
17121351 |
Phenol, 4-nitro-3-(trifluoromethyl)-, sodium salt |
22046 |
Phenol, 4-nonyl- |
597278 |
Phenol, 4-nonyl-, branched |
92684 |
Phenol, 4-octyl- |
197780 |
Phenol, 4-pentyl- |
71829 |
Phenol, 4-phenoxy- |
66530 |
Phenol, 4-propyl- |
115139 |
Phenol, 5-chloro-2-(2,4-dichlorophenoxy)- |
59824 |
Phenol, 5-chloro-2-nitro- |
12658 |
Phenol, 5-methyl-2-(1-methylethyl)- |
709139 |
Phenol, 5-methyl-2,4-dinitro- |
230516 |
Phenol, dichloro- |
81836 |
Phenol, dimethyl- |
230391 |
Phenol, dimethyl-, phosphate (3:1) |
233304 |
Phenol, dinitro- |
83550 |
Phenol, methyl- |
230334 |
Phenol, nitro- |
230318 |
Phenol, nonyl- |
240176 |
Phenol, nonyl-, phosphate (3:1) |
59212 |
Phenol, pentabromo- |
11437 |
Phenol, pentachloro- |
1714662 |
Phenol, pentachloro-, acetate |
151068 |
Phenol, pentachloro-, carbonate (2:1) |
17126442 |
Phenol, pentachloro-, copper salt |
17153453 |
Phenol, pentachloro-, copper(1+) salt |
153965 |
Phenol, pentachloro-, potassium salt |
35394 |
Phenol, pentachloro-, sodium salt |
70128 |
Phenol, pentafluoro- |
161505 |
Phenol, polymer with formaldehyde |
230532 |
Phenol, tetrachloro- |
230524 |
Phenol, trichloro- |
17074741 |
Phenol, trichloro-2-methoxy- |
3509 |
Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride |
55541 |
Phenothiazin-5-ium, 3,7-diamino-, chloride |
14043 |
Phenothiazin-5-ium, 3-amino-7-(dimethylamino)-2-methyl-, chloride |
40857 |
Phenoxathiin |
40006 |
Phenylalanine |
149385 |
Phenylalanine, 4-chloro- |
1438 |
Phenylalanine, 4-fluoro- |
17089707 |
Pheretima posthuma |
1965144 |
Phialidium |
17106493 |
Philadelphus inodorus |
17084856 |
Philarctus quaeris |
17115049 |
Philodendron hederaceum |
17081225 |
Philodina |
17075334 |
Philodina acuticornis |
17118639 |
Philodina roseola |
17089400 |
Philohela minor |
1883503 |
Philopotamidae |
17106535 |
Phleum pratense |
17109901 |
Phlox |
17089715 |
Phoenicurus phoenicurus |
17106543 |
Phoenix canariensis |
1853159 |
Phormidium |
17118050 |
Phormidium formosum |
17098955 |
Phormidium foveolarum |
17101874 |
Phormidium fragile |
17118043 |
Phormidium inundatum |
17111147 |
Phormidium uncinatum |
1914050 |
Phoronida |
17152802 |
Phos-Chek WD 881 |
694968 |
Phosflex 300 |
694976 |
Phosflex 400 |
194464 |
Phosphate |
70532 |
Phosphine oxide, triphenyl- |
127209 |
Phosphine, trioctyl- |
189134 |
Phosphonic acid |
1586 |
Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, dimethyl ester |
205187 |
Phosphonic acid, (2-chloroethyl)- |
17119306 |
Phosphonic acid, (aminocarbonyl)-, monoethyl ester |
236042 |
Phosphonic acid, (aminocarbonyl)-, monoethyl ester, monoammonium salt |
77941 |
Phosphonic acid, (phenylmethyl)-, diethyl ester |
216432 |
Phosphonic acid, [3-[(hydroxymethyl)amino]-3-oxopropyl]-, dimethyl ester |
72520 |
Phosphonic acid, dimethyl ester |
17152943 |
Phosphonic acid, dipentyl ester |
17152950 |
Phosphonic acid, dipropyl ester |
282848 |
Phosphonic acid, ethenyl-, bis(2-chloroethyl) ester, polymer with dimethyl methylphosphonate |
7088 |
Phosphonic acid, ethyl-, diethyl ester |
86819 |
Phosphonic acid, methyl-, bis(1-methylethyl) ester |
278374 |
Phosphonic acid, monoethyl ester, aluminum salt |
1714347 |
Phosphonic acid, octyl-, diethyl ester |
92015 |
Phosphonic acid, phenyl-, dioctyl ester |
17126962 |
Phosphonic acid, propyl-, monoethyl ester |
17295403 |
Phosphonium, tetrakis(hydroxymethyl)-, hydroxide |
304550 |
Phosphonium, tetrakis(hydroxymethyl)-, sulfate (2:1) (salt) |
17122409 |
Phosphonium, tributyl[(2,4-dichlorophenyl)methyl]-, chloride |
17122615 |
Phosphonodithioic acid, ethyl-, O-ethyl S-(4-methylphenyl) ester |
74971 |
Phosphonodithioic acid, ethyl-, O-ethyl S-phenyl ester |
17153982 |
Phosphonofluoridic acid, methyl-, 1,2,2-trimethylpropyl ester |
24380 |
Phosphonofluoridic acid, methyl-, 1-methylethyl ester |
17122573 |
Phosphonothioic acid, ethyl-, O-(2-chloro-4-nitrophenyl) O-(1-methylethyl) ester |
42424 |
Phosphonothioic acid, ethyl-, O-ethyl O-(2,4,5-trichlorophenyl) ester |
17121716 |
Phosphonothioic acid, methyl-, O,S-dibutyl ester |
106427 |
Phosphonothioic acid, methyl-, O-ethyl O-[4-(methylthio)phenyl] ester |
220087 |
Phosphonothioic acid, phenyl-, O-(4-bromo-2,5-dichlorophenyl) O-methyl ester |
17125980 |
Phosphonothioic acid, phenyl-, O-(4-cyanophenyl) O-ethyl ester |
96982 |
Phosphonothioic acid, phenyl-, O-ethyl O-(4-nitrophenyl) ester |
221358 |
Phosphoramidic acid, (1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester |
75101 |
Phosphoramidic acid, (4-methyl-1,3-dithiolan-2-ylidene)-, diethyl ester |
75002 |
Phosphoramidic acid, 1,3-dithiolan-2-ylidene-, diethyl ester |
5240130 |
Phosphoramidic acid, methyl-, 2-chloro-4-(1,1-dimethylethyl)phenyl methyl ester |
121533 |
Phosphoramidothioic acid, (1-iminoethyl)-, O,O-bis(4-chlorophenyl) ester |
41376 |
Phosphoramidothioic acid, (1-methylethyl)-, O-(2,4-dichlorophenyl) O-methyl ester |
692541 |
Phosphoramidothioic acid, (1-methylethyl)-, O-methyl O-(4-methyl-2-nitrophenyl) ester |
1714750 |
Phosphoramidothioic acid, (1-methylpropyl)-, O-ethyl O-(5-methyl-2-nitrophenyl) ester |
17273335 |
Phosphoramidothioic acid, 1,3-dithiolan-2-ylidene-, O,O-diethyl ester |
256677 |
Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester |
17123936 |
Phosphoramidothioic acid, methyl-, O-[2-chloro-4-(1,1-dimethylethyl)phenyl] O-methyl ester |
17124231 |
Phosphoramidothioic acid, methyl-, O-ethyl O-[3-methyl-4-(methylthio)phenyl] ester |
169813 |
Phosphoramidothioic acid, O,S-dimethyl ester |
152363 |
Phosphoric acid |
33977 |
Phosphoric acid tributyl ester |
307934 |
Phosphoric acid, (1,1-dimethylethyl)phenyl diphenyl ester |
38406 |
Phosphoric acid, (1E)-3-(dimethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
266478 |
Phosphoric acid, (1-methyl-1-phenylethyl)phenyl diphenyl ester |
247908 |
Phosphoric acid, (1-methylethyl)phenyl diphenyl ester |
221416 |
Phosphoric acid, (1Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
41426 |
Phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester |
698316 |
Phosphoric acid, 2-(1-methylethyl)phenyl diphenyl ester, Mixt. with triphenyl phosphate |
354662 |
Phosphoric acid, 2,2-bis(bromomethyl)-3-chloropropyl bis[2-chloro-1-(chloromethyl)ethyl] ester |
17121492 |
Phosphoric acid, 2,2-dichloroethenyl 2-(ethylsulfinyl)ethyl methyl ester |
17153784 |
Phosphoric acid, 2,2-dichloroethenyl diethyl ester |
3681 |
Phosphoric acid, 2,2-dichloroethenyl dimethyl ester |
17153750 |
Phosphoric acid, 2,2-dichloroethenyl dipropyl ester |
1714540 |
Phosphoric acid, 2-bromo-1-(2,4-dichlorophenyl)ethenyl dimethyl ester |
75366 |
Phosphoric acid, 2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester |
46706 |
Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester |
17123910 |
Phosphoric acid, 2-chloro-1-(2,5-dichlorophenyl)ethenyl diethyl ester |
184523 |
Phosphoric acid, 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
17273277 |
Phosphoric acid, 2-chloroethenyl diethyl ester |
81539 |
Phosphoric acid, 2-ethylhexyl diphenyl ester |
698308 |
Phosphoric acid, 4-(1,1-dimethylethyl)phenyl diphenyl ester, mixt. with triphenyl phosphate |
698688 |
Phosphoric acid, bis(1,1-dimethylethyl)phenyl diphenyl ester, mixt. with (1,1-dimethylethyl)phenyl diphenyl phosphate and triphenyl phosphate |
41236 |
Phosphoric acid, bis(2-ethylhexyl) ester |
685123 |
Phosphoric acid, bis(4-(1,1-dimethylethyl)phenyl) phenyl ester |
168013 |
Phosphoric acid, calcium salt |
153379 |
Phosphoric acid, calcium salt (1:1) |
153452 |
Phosphoric acid, calcium salt (2:1) |
153478 |
Phosphoric acid, calcium salt (2:3) |
154583 |
Phosphoric acid, diammonium salt |
24554 |
Phosphoric acid, dibutyl ester |
103887 |
Phosphoric acid, dibutyl phenyl ester |
17153107 |
Phosphoric acid, diethyl 2,2,2-trichloro-1-ethoxyethyl ester |
42028 |
Phosphoric acid, diethyl 4-nitrophenyl ester |
17026626 |
Phosphoric acid, diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester |
57935 |
Phosphoric acid, diethyl ester |
145995 |
Phosphoric acid, dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester |
134007 |
Phosphoric acid, dimethyl 3,5,6-trichloro-2-pyridinyl ester |
113704 |
Phosphoric acid, dimethyl 4-(methylthio)phenyl ester |
70698 |
Phosphoric acid, dimethyl ester |
686493 |
Phosphoric acid, dimethyl-4-nitrophenyl ester |
153429 |
Phosphoric acid, dipotassium salt |
151480 |
Phosphoric acid, disodium salt |
254391 |
Phosphoric acid, isodecyl diphenyl ester |
698290 |
Phosphoric acid, isodecyl diphenyl ester, mixt. with triphenyl phosphate |
239442 |
Phosphoric acid, methylphenyl diphenyl ester |
153007 |
Phosphoric acid, monoammonium salt |
17151556 |
Phosphoric acid, monomethyl mono(3-methyl-4-nitrophenyl) ester |
114025 |
Phosphoric acid, monophenyl ester, disodium salt |
153981 |
Phosphoric acid, monopotassium salt |
151498 |
Phosphoric acid, monosodium salt |
277202 |
Phosphoric acid, nonylphenyl diphenyl ester |
279232 |
Phosphoric acid, octyl ester |
152074 |
Phosphoric acid, sodium salt |
7104 |
Phosphoric acid, triethyl ester |
49403 |
Phosphoric acid, trimethyl ester |
29272 |
Phosphoric acid, triphenyl ester |
153924 |
Phosphoric acid, tripotassium salt |
7112 |
Phosphoric acid, tris(2-ethylhexyl) ester |
7013 |
Phosphoric acid, tris(2-methylphenyl) ester |
33951 |
Phosphoric acid, tris(2-methylpropyl) ester |
54569 |
Phosphoric acid, tris(3-methylphenyl) ester |
7021 |
Phosphoric acid, tris(4-methylphenyl) ester |
85076 |
Phosphoric acid, tris(methylphenyl) ester |
1714753 |
Phosphoric acid, tris[2-(diethylamino)ethyl] ester, trihydrochloride |
151746 |
Phosphoric acid, trisodium salt |
154203 |
Phosphoric acid, zinc salt (2:3) |
67314 |
Phosphoric triamide, hexamethyl- |
17152216 |
Phosphorodiamidic acid, N,N'-dimethyl-, 3-methyl-4-(methylthio)phenyl ester |
92023 |
Phosphorodiamidic acid, N,N'-dimethyl-, phenyl ester |
17151606 |
Phosphorodiamidic chloride, tetramethyl- |
17151374 |
Phosphorodifluoridic acid, sodium salt |
267278 |
Phosphorodithioic acid, O-(2,4-dichlorophenyl) O-ethyl S-propyl ester |
687756 |
Phosphorodithioic acid, O,O,S-triethyl ester |
24497 |
Phosphorodithioic acid, O,O-bis(1-methylethyl) ester |
69021 |
Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester |
41228 |
Phosphorodithioic acid, O,O-diethyl ester |
1714289 |
Phosphorodithioic acid, O,O-diethyl S-[(2-methyl-1,3-dithiolan-2-yl)methyl] ester |
105676 |
Phosphorodithioic acid, O,O-diethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
41202 |
Phosphorodithioic acid, O,O-diethyl S-[(ethylthio)methyl] ester |
17272832 |
Phosphorodithioic acid, O,O-diethyl S-[[(1-methylethyl)thio]methyl] ester |
103358 |
Phosphorodithioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester |
52450129 |
Phosphorodithioic acid, O,O-diethyl S-[2-(ethylsulfonyl)ethyl] ester |
41210 |
Phosphorodithioic acid, O,O-diethyl S-[2-(ethylthio)ethyl] ester |
69161 |
Phosphorodithioic acid, O,O-dimethyl ester |
1714292 |
Phosphorodithioic acid, O,O-dimethyl S-[(4-nitropyrazol-1-yl)methyl] ester |
10777 |
Phosphorodithioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
3400 |
Phosphorodithioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
961011 |
Phosphorodithioic acid, O,O-dimethyl S-2-(4-morpholinyl)-2-oxoethyl ester |
269266 |
Phosphorodithioic acid, O-ethyl O-[4-(methylthio)phenyl] S-propyl ester |
17126533 |
Phosphorodithioic acid, O-ethyl S,S-diphenyl ester |
184630 |
Phosphorodithioic acid, O-ethyl S,S-dipropyl ester |
17152984 |
Phosphorodithioic acid, S-(4-chloro-3-methylphenyl) O,O-diethyl ester |
961714 |
Phosphorodithioic acid, S-(5-ethoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl O,O-dimethyl ester |
227306 |
Phosphorodithioic acid, S-(chloromethyl) O,O-diethyl ester |
17123928 |
Phosphorodithioic acid, S,S'-(phenylmethylene) O,O,O',O'-tetramethyl ester |
7047 |
Phosphorodithioic acid, S,S'-1,4-dioxane-2,3-diyl O,O,O',O'-tetraethyl ester |
54577 |
Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester |
68957 |
Phosphorodithioic acid, S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-dimethyl ester |
17122201 |
Phosphorodithioic acid, S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl ester |
1714353 |
Phosphorodithioic acid, S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl ester, mixt. with (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)-1,2,3,4,5,6-hexachlorocyclohexane |
75127 |
Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
100057 |
Phosphorodithioic acid, S-[(6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl] O,O-diethyl ester |
183806 |
Phosphorodithioic acid, S-[[(1,1-dimethylethyl)thio]methyl] O,O-diethyl ester |
961607 |
Phosphorodithioic acid, S-[[(2,5-dichlorophenyl)thio]methyl] O,O-diethyl ester |
118588 |
Phosphorodithioic acid, S-[[(2,5-dichlorophenyl)thio]methyl] O,O-dimethyl ester |
70458 |
Phosphorodithioic acid, S-[[(4-chlorophenyl)thio]methyl] O,O-diethyl ester |
961326 |
Phosphorodithioic acid, S-[[(4-chlorophenyl)thio]methyl] O,O-dimethyl ester |
691246 |
Phosphorodithioic acid, S-[2-(2-methyl-1-piperidinyl)-2-oxoethyl] O,O-dipropyl ester |
66209 |
Phosphorodithioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
104125 |
Phosphorodithioic acid, S-[2-(formylmethylamino)-2-oxoethyl] O,O-dimethyl ester |
170134 |
Phosphorodithioic acid, S-[2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl] O,O-diethyl ester |
1982 |
Phosphorofluoridic acid, bis(1-methylethyl) ester |
17119066 |
Phosphorothioic acid |
17122441 |
Phosphorothioic acid, O-(1,6-dihydro-6-oxo-1-phenyl-3-pyridazinyl) O,O-diethyl ester |
960906 |
Phosphorothioic acid, O-(2,4-dichlorophenyl) O,O-diethyl ester |
690669 |
Phosphorothioic acid, O-(2,5-dichloro-4-iodophenyl) O,O-dimethyl ester |
17129628 |
Phosphorothioic acid, O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl ester |
102699 |
Phosphorothioic acid, O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester |
2246 |
Phosphorothioic acid, O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester |
961110 |
Phosphorothioic acid, O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester |
1714561 |
Phosphorothioic acid, O-(4-amino-3-methylphenyl) O,O-dimethyl ester |
710129 |
Phosphorothioic acid, O-(4-bromo-2,5-dichlorophenyl) O,O-diethyl ester |
709691 |
Phosphorothioic acid, O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl ester |
282798 |
Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
1714413 |
Phosphorothioic acid, O-(4-chloro-2-isocyanophenyl) O,O-dimethyl ester |
105577 |
Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester |
1714433 |
Phosphorothioic acid, O,O'-(sulfonyldi-4,1-phenylene) O,O,O',O'-tetramethyl ester |
115162 |
Phosphorothioic acid, O,O'-(thiodi-4,1-phenylene) O,O,O',O'-tetramethyl ester |
33944 |
Phosphorothioic acid, O,O,O-triethyl ester |
17272782 |
Phosphorothioic acid, O,O-bis(1-methylethyl) O-(4-nitrophenyl) ester |
302257 |
Phosphorothioic acid, O,O-diethyl O-(1,2,2,2-tetrachloroethyl) ester |
225201 |
Phosphorothioic acid, O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) ester |
108852 |
Phosphorothioic acid, O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
2147 |
Phosphorothioic acid, O,O-diethyl O-(4-nitrophenyl) ester |
17126780 |
Phosphorothioic acid, O,O-diethyl O-(5-phenyl-3-isoxazolyl) ester |
748939 |
Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester |
160234 |
Phosphorothioic acid, O,O-diethyl O-[2-(ethylthio)ethyl] ester, mixt. with O,O-diethyl S-[2-(ethylthio)ethyl] phosphorothioate |
17152281 |
Phosphorothioic acid, O,O-diethyl O-[3-methyl-4-(methylthio)phenyl] ester |
29298 |
Phosphorothioic acid, O,O-diethyl O-[4-(methylsulfinyl)phenyl] ester |
42705 |
Phosphorothioic acid, O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester |
188854 |
Phosphorothioic acid, O,O-diethyl O-2-quinoxalinyl ester |
41186 |
Phosphorothioic acid, O,O-diethyl O-pyrazinyl ester |
1714558 |
Phosphorothioic acid, O,O-diethyl S-(phenylmethyl) ester |
1714395 |
Phosphorothioic acid, O,O-dimethyl ester |
41368 |
Phosphorothioic acid, O,O-dimethyl O-(2,4,5-trichlorophenyl) ester |
133991 |
Phosphorothioic acid, O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester |
32144 |
Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester |
41194 |
Phosphorothioic acid, O,O-dimethyl O-(4-nitrophenyl) ester |
963074 |
Phosphorothioic acid, O,O-dimethyl O-(6-ethoxy-2-ethyl-4-pyrimidinyl) ester |
1909 |
Phosphorothioic acid, O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] ester |
17121302 |
Phosphorothioic acid, O,O-dimethyl O-[4-(methylsulfinyl)phenyl] ester |
17153933 |
Phosphorothioic acid, O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] ester |
686642 |
Phosphorothioic acid, O,O-dimethyl S-[2-(methylamino)-2-oxoethyl] ester |
17123613 |
Phosphorothioic acid, O,O-dimethyl S-[2-[[1-methyl-2-(methylamino)-2-oxoethyl]thio]ethyl] ester |
1714469 |
Phosphorothioic acid, O-[1-(4-bromo-2-chlorophenyl)-2-chlorovinyl] O,O-dimethyl ester |
1714759 |
Phosphorothioic acid, O-[1-(4-chlorophenyl)-1H-pyrazol-4-yl] O-ethyl S-propyl ester |
606400 |
Phosphorothioic acid, O-[2-(1,1-dimethylethyl)-5-pyrimidinyl] O-ethyl O-(1-methylethyl) ester |
252296 |
Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester |
775957 |
Phosphorothioic acid, O-[2-(ethylthio)ethyl] O,O-dimethyl ester, mixt. with S-[2-(ethylthio)ethyl] O,O-dimethyl phosphorothioate |
220723 |
Phosphorothioic acid, O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl ester |
1714478 |
Phosphorothioic acid, O-[2-chloro-1-(2,4-dichlorophenyl)ethenyl] O,O-diethyl ester |
1714470 |
Phosphorothioic acid, O-[2-chloro-1-(2,4-dichlorophenyl)ethenyl] O,O-dimethyl ester |
17123340 |
Phosphorothioic acid, O-[2-chloro-1-(2,5-dichlorophenyl)ethenyl] O,O-diethyl ester |
17163593 |
Phosphorothioic acid, O-[3,5-dimethyl-4-(methylthio)phenyl] O,O-diethyl ester |
17163627 |
Phosphorothioic acid, O-[3,5-dimethyl-4-(methylthio)phenyl] O,O-dimethyl ester |
694430 |
Phosphorothioic acid, O-[4-[(4-chlorophenyl)thio]phenyl] O-ethyl S-propyl ester |
1594 |
Phosphorothioic acid, O-[4-[(dimethylamino)sulfonyl]phenyl] O,O-dimethyl ester |
285650 |
Phosphorothioic acid, O-[5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl] O,O-diethyl ester |
118570 |
Phosphorothioic acid, S-(2-(diethylamino)ethyl) O,O-diethyl ester, ethanedioate (1:1) |
17153388 |
Phosphorothioic acid, S-(2,2-dichlorovinyl) O,O-diethyl ester |
17124157 |
Phosphorothioic acid, S-(4-chlorophenyl) O,O-dimethyl ester |
107227 |
Phosphorothioic acid, S-[(5-methoxy-4-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl ester |
692483 |
Phosphorothioic acid, S-[(6-chloro-2-oxooxazolo[4,5-b]pyridin-3(2H)-yl)methyl] O,O-dimethyl ester |
17028119 |
Phosphorothioic acid, S-[2-(ethylsulfinyl)-1-methylethyl] O,O-dimethyl ester |
41525 |
Phosphorothioic acid, S-[2-(ethylsulfinyl)ethyl] O,O-dimethyl ester |
73551 |
Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-dimethyl ester |
7146 |
Phosphorotrithioic acid, S,S,S-tributyl ester |
40048 |
Phosphorotrithious acid, tributyl ester |
19877 |
Phosphorous acid, triphenyl ester |
41533 |
Phosphorous acid, tris(2-ethylhexyl) ester |
153049 |
Phosphorus |
83089 |
Phosphorus oxide (P2O5) |
180398 |
Phosphorus, mol. (P4) |
17115056 |
Photinia x fraseri |
1900737 |
Phoxinus eos |
17083056 |
Phoxinus lagowski |
1900752 |
Phoxinus neogaeus |
17076704 |
Phoxinus phoxinus |
17085457 |
Phragmatopoma lapidosa |
17111840 |
Phragmites australis |
17099730 |
Phragmites communis |
1883651 |
Phryganea |
17075508 |
Phryganea striata |
40790 |
Phthalazine |
17115064 |
Phyllanthus amarus |
17106550 |
Phyllanthus niruri |
17086000 |
Phyllodoce laminosa |
17112384 |
Phyllospora comosa |
17106568 |
Phyllostachys bambusoides |
17115072 |
Phyllostachys meyeri |
17092164 |
Phylocentropus hansoni |
17079872 |
Phymactis cavernata |
1908417 |
Physa |
17077264 |
Physa fontinalis |
17075342 |
Physa gyrina |
1908425 |
Physa heterostropha |
1908433 |
Physa integra |
1908441 |
Physa pumilia |
17080672 |
Physa virgata |
17092123 |
Physastra gibbosa |
17112681 |
Physcomitrella patens |
1908466 |
Physella acuta |
1908474 |
Physella cubensis |
17082371 |
Physella elliptica |
1917467 |
Physella gyrina |
1908482 |
Physella hendersoni |
1908490 |
Physella heterostropha |
17118209 |
Physella virgata |
1908409 |
Physidae |
17106576 |
Physocarpus opulifolius |
17099987 |
Phytoconis |
17117482 |
Phytophthora erythroseptica |
17095233 |
Pica nuttalli |
17089285 |
Pica pica |
17106584 |
Picea abies |
17106592 |
Picea glauca |
17106600 |
Picea mariana |
17112871 |
Picea rubens |
17106618 |
Picea sitchensis |
17113192 |
Picea sp. |
6361 |
Picrasa-2,12-diene-1,11,16-trione, 2,12-dimethoxy- |
17095548 |
Pieridae |
17097387 |
Pieris brassicae |
17106626 |
Pieris japonica |
17095530 |
Pieris rapae |
17077587 |
Pila globosa |
17085150 |
Pila virens |
17076019 |
Pilumnus hirtellus |
17081290 |
Pimelodus maculatus |
1900760 |
Pimephales notatus |
1900778 |
Pimephales promelas |
17090986 |
Pinctada albina albina |
17090366 |
Pinna carnea |
17096595 |
Pinna muricata |
17109919 |
Pinus |
17115080 |
Pinus australis |
17106634 |
Pinus banksiana |
17106642 |
Pinus echinata |
17106659 |
Pinus elliottii |
17106667 |
Pinus halepensis |
17115098 |
Pinus jefferyi |
17106675 |
Pinus lambertiana |
17113150 |
Pinus monticola |
17106683 |
Pinus mugo |
17106691 |
Pinus palustris |
17106709 |
Pinus ponderosa |
17115106 |
Pinus pungens |
17106717 |
Pinus radiata |
17115114 |
Pinus resinosa |
17106725 |
Pinus rigida |
17106733 |
Pinus strobus |
17106741 |
Pinus sylvestris |
17106758 |
Pinus taeda |
17106766 |
Pinus thunbergiana |
17106774 |
Pinus virginiana |
17080995 |
Piona carnea |
17118837 |
Piona coccinea |
17118811 |
Piona nodata |
17112939 |
Piper sp. |
27029 |
Piperazine |
107011 |
Piperazine, 1-(phenylmethyl)- |
37895 |
Piperazine, 1,4-dinitroso- |
25569 |
Piperazine, 1-methyl- |
25619 |
Piperazine, 2-methyl- |
27060 |
Piperidine |
17153917 |
Piperidine, 1-(1-phenylcyclohexyl)-, hydrochloride |
17121914 |
Piperidine, 1,3,3,5,5-pentanitro- |
15552 |
Piperidine, 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]- |
17129602 |
Piperidinium, 1-(3,7-dimethyloctyl)-1-(2-propenyl)-, bromide |
225821 |
Piperidinium, 1,1-dimethyl-, chloride |
1861194 |
Piscicola |
17084435 |
Piscicola salmositica |
1906882 |
Pisidium casertanum |
1906890 |
Pisidium compressum |
17077454 |
Pisidium sp. |
1930569 |
Pisione remota |
17101221 |
Pistia stratiotes |
17110271 |
Pisum |
17109927 |
Pisum sativum |
17100280 |
Pithophora |
17099599 |
Pithophora oedogonia |
17106782 |
Pittosporum tobira |
1968452 |
Placopecten magellanicus |
1914514 |
Planaria |
17093048 |
Planaria gonocephala |
1914456 |
Planariidae |
764324 |
Plankton |
17079468 |
Planorbarius |
1908599 |
Planorbella campanulata |
1908680 |
Planorbella duryi |
17080664 |
Planorbella tenuis |
1908607 |
Planorbella trivolvis |
1908508 |
Planorbidae |
17078726 |
Planorbis corneus |
17077298 |
Planorbis planorbis |
17090648 |
Planorbula campestris |
1853233 |
Plantae |
17106790 |
Plantago aristata |
17106808 |
Plantago lanceolata |
17106816 |
Plantago major |
17115122 |
Plantago media |
17115130 |
Plantago rugelii |
17106824 |
Platanus occidentalis |
17075391 |
Platichthys flesus |
17082827 |
Platichthys flesus flesus |
1958644 |
Platichthys stellatus |
206177 |
Platinate(2-), hexachloro-, diammonium, (OC-6-11)- |
206441 |
Platinate(2-), hexachloro-, dihydrogen, (OC-6-11)- |
166520 |
Platinate(2-), tetrachloro-, dipotassium, (SP-4-1)- |
186726 |
Platinum chloride (PtCl4), (SP-4-1)- |
17152208 |
Platinum(2+), tetraamminedichloro-, (OC-6-12)- |
1714705 |
Platinum, diamminedichloro-, (SP-4-1)- |
200808 |
Platinum, diamminedichloro-, (SP-4-2)- |
17095951 |
Platorchestia platensis |
17083478 |
Platycephalus bassensis |
17075581 |
Platycnemis pennipes |
1900802 |
Platygobio gracilis |
1914092 |
Platyhelminthes |
17098088 |
Platyhypnidium riparoides |
17080540 |
Platyias quadricornis |
17100306 |
Platymonas |
17098534 |
Platymonas subcordiformis |
17101056 |
Platymonas tetrathele |
1864032 |
Platynereis dumerilii |
17094053 |
Platynothrus peltifer |
17080144 |
Plea atomaria |
17091372 |
Plea minutissima |
17079211 |
Plecoglossus altivelis |
1887033 |
Plecoptera |
17089103 |
Plecostomus commersoni |
17081951 |
Plectomerus |
17099565 |
Plectonema boryanum |
17099870 |
Plectonema nostocorum |
17083239 |
Plectus communis |
17095019 |
Plectus parietinus |
17093477 |
Plectus sp. |
1714630 |
Pleocidin |
17098575 |
Pleodorina californica |
17089913 |
Plethodon glutinosus |
1965862 |
Pleurobrachia pileus |
1911270 |
Pleurocera |
17087776 |
Pleurodele |
17076217 |
Pleurodeles waltl |
1899269 |
Pleuronectes americanus |
17075383 |
Pleuronectes platessa |
1958669 |
Pleuronectes vetulus |
1899236 |
Pleuronectiformes |
1958677 |
Pleuronichthys ritteri |
1930635 |
Pleuroxus denticulatus |
17087727 |
Plexaura flexosa |
17090689 |
Plotosus anguillaris |
17109208 |
Pluchea carolinensis |
17112715 |
Plumaria elegans |
1961986 |
Plumatella casmiana |
17078593 |
Plumatella emarginata |
17123126 |
Plumbane, (acetyloxy)triphenyl- |
77040 |
Plumbane, chlorotriethyl- |
1714730 |
Plumbane, chlorotrimethyl- |
1714426 |
Plumbane, chlorotriphenyl- |
1714552 |
Plumbane, dichlorodiethyl- |
1714729 |
Plumbane, dichlorodimethyl- |
6825 |
Plumbane, tetraethyl- |
5835 |
Plumbane, tetramethyl- |
1714737 |
Plumbane, triethylhydroxy- |
712026 |
Plurafac RA 30 |
17097395 |
Plutella xylostella |
149724 |
Plutonium |
17106832 |
Poa annua |
17106840 |
Poa pratensis |
17106857 |
Poa secunda |
17115148 |
Poa sp. |
17106865 |
Poa trivialis |
1934520 |
Poaceae |
17087172 |
Pocillopora damicornis |
1863174 |
Podarke obscura |
685735 |
Podocarp-8(14)-en-15-oic acid, 13.beta.-methyl-13-vinyl- |
17115155 |
Podocarpus macrophyllus |
17087511 |
Podocerus fulanus |
1869593 |
Podocopa |
17090655 |
Podon intermedius |
17081985 |
Poecilia |
17086026 |
Poecilia formosa |
17074469 |
Poecilia latipinna |
17078734 |
Poecilia mexicana |
17074360 |
Poecilia reticulata |
17079724 |
Poecilia sphenops |
17076589 |
Poecilia vivipara |
17084955 |
Poeciliopsis |
17085036 |
Poeciliopsis lucida |
17085044 |
Poeciliopsis monacha |
17097205 |
Poecilus lucublanda |
17089723 |
Poephila guttata |
17094483 |
Pogonognathellus flavescens |
17085796 |
Polinices incei |
1911148 |
Polinices lacteus |
17083783 |
Polinices sordidus |
1930775 |
Pollachius virens |
17088493 |
Pollimyrus isidori |
149732 |
Polonium |
261719 |
Poly(iminocarbonimidoyliminocarbonimidoylimino-1,6-hexanediyl), hydrochloride |
162024 |
Poly(oxy-1,2-ethanediyl), .alpha.-(1-oxododecyl)-.omega.-hydroxy- |
162156 |
Poly(oxy-1,2-ethanediyl), .alpha.-(1-oxooctadecyl)-.omega.-hydroxy- |
236778 |
Poly(oxy-1,2-ethanediyl), .alpha.-(4-nonylphenyl)-.omega.-hydroxy- |
162149 |
Poly(oxy-1,2-ethanediyl), .alpha.-(9Z)-9-octadecenyl-.omega.-hydroxy- |
320358 |
Poly(oxy-1,2-ethanediyl), .alpha.-(carboxymethyl)-.omega.-(tridecyloxy)-, sodium salt |
163451 |
Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy- |
292540 |
Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy-, phosphate |
240820 |
Poly(oxy-1,2-ethanediyl), .alpha.,.alpha.'-[(octadecylimino)di-2,1-ethanediyl]bis[.omega.-hydroxy- |
164319 |
Poly(oxy-1,2-ethanediyl), .alpha.-[(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
162040 |
Poly(oxy-1,2-ethanediyl), .alpha.-[2-(tert-dodecylthio)ethyl]-.omega.-hydroxy- |
317933 |
Poly(oxy-1,2-ethanediyl), .alpha.-[3,5-dimethyl-1-(2-methylpropyl)hexyl]-.omega.-hydroxy- |
161224 |
Poly(oxy-1,2-ethanediyl), .alpha.-[4-(1,1,3,3-tetramethylbutyl)phenyl]-.omega.-hydroxy- |
237693 |
Poly(oxy-1,2-ethanediyl), .alpha.-decyl-.omega.-hydroxy- |
161216 |
Poly(oxy-1,2-ethanediyl), .alpha.-dodecyl-.omega.-hydroxy- |
162115 |
Poly(oxy-1,2-ethanediyl), .alpha.-hexadecyl-.omega.-hydroxy- |
231977 |
Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- |
291104 |
Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, ether with 1,2,3-propanetriol monododecanoate (2:1) |
290825 |
Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, ether with 1,2,3-propanetriol monooctadecanoate (2:1) |
294488 |
Poly(oxy-1,2-ethanediyl), .alpha.-isooctadecyl-.omega.-hydroxy- |
162164 |
Poly(oxy-1,2-ethanediyl), .alpha.-octadecyl-.omega.-hydroxy- |
262618 |
Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-(dodecyloxy)-, ammonium salt |
162032 |
Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-(dodecyloxy)-, sodium salt |
459792 |
Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-hydroxy-, C10-16-alkyl ethers, sodium salts |
227470 |
Poly(oxy-1,2-ethanediyl), .alpha.-tridecyl-.omega.-hydroxy- |
266684 |
Poly(oxy-1,2-ethanediyl), .alpha.-undecyl-.omega.-hydroxy- |
691543 |
Poly[imino(1,2-ethanediyl)] |
163428 |
Poly[oxy(dimethylsilylene)] |
17132739 |
Poly[oxy(dimethylsilylene)], .alpha.-(trimethylsilyl)-.omega.-[(trimethylsilyl)oxy]- |
161364 |
Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-butyl-.omega.-hydroxy- |
231985 |
Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy- |
259739 |
Poly[oxy-1,2-ethanediyl(dimethyliminio)-1,2-ethanediyl(dimethyliminio)-1,2-ethanediyl dichloride] |
17115163 |
Polyalthia longifolia |
1915321 |
Polyarthra |
17081894 |
Polyarthra trigla |
17082462 |
Polycelis felina |
17076605 |
Polycelis nigra |
17084443 |
Polycelis tenuis |
1883768 |
Polycentropus cinereus |
1861335 |
Polychaeta |
1867910 |
Polycirrus |
627059 |
Polycyclic aromatic hydrocarbons |
17112822 |
Polydesmus denticulatus |
1866649 |
Polydora |
1866664 |
Polydora caulleryi |
1866714 |
Polydora ligni |
1866722 |
Polydora socialis |
1866748 |
Polydora websteri |
17109935 |
Polygonum |
17106873 |
Polygonum aviculare |
17106881 |
Polygonum convolvulus |
17112830 |
Polygonum convolvulus convolvulus |
17115171 |
Polygonum cuspidatum |
17115189 |
Polygonum lapathifolium |
17099581 |
Polygonum muhlenbergii |
17112202 |
Polygonum natans |
17115197 |
Polygonum pensylvanicum |
17106899 |
Polygonum persicaria |
17111998 |
Polykrikos schwartzii |
17083643 |
Polylabroides multispinosus |
17123274 |
Polymyxin |
1714631 |
Polymyxin B, sulfate |
1960822 |
Polyodon spathula |
1714389 |
Polyoxin |
1878925 |
Polypedilum |
17091836 |
Polypedilum cultellatum |
17084021 |
Polypedilum nubeculosum |
17080805 |
Polypedilum nubifer |
1930940 |
Polyphemus pediculus |
419754 |
Polyphosphoric acids, ammonium salts |
488197 |
Polyphosphoric acids, sodium salts |
17112749 |
Polysiphonia lanosa |
963264 |
Polystream |
17111154 |
Polytoma uvella |
17111071 |
Polytomella papillata |
17088139 |
Pomacea canaliculata |
1911866 |
Pomacea paludosa |
17090861 |
Pomacentrus coelestis |
17088899 |
Pomacentrus leucostictus |
17076373 |
Pomatoschistus microps |
17076316 |
Pomatoschistus minutus |
1898741 |
Pomoxis annularis |
1898758 |
Pomoxis nigromaculatus |
17095688 |
Pompilidae |
17077512 |
Pontastacus leptodactylus lept |
17111634 |
Pontederia cordata |
17111857 |
Pontentilla palustris |
17087552 |
Pontodrilus littoralis |
17084450 |
Pontogammarus crassus |
17084971 |
Pontogammarus maeoticus |
17084328 |
Pontogeloides latipes |
17081662 |
Pontogeneia |
1969682 |
Pontoporeia |
17077157 |
Pontoporeia affinis |
17084666 |
Pontoporeia hoyi |
17089293 |
Pontoscolex corethrurus |
17078114 |
Popenaias buckleyi |
17096074 |
Popillia japonica |
17110388 |
Populus |
17106915 |
Populus balsamifera |
17106923 |
Populus deltoides |
17108929 |
Populus grandidentata |
17115205 |
Populus hybrida |
17106931 |
Populus nigra |
17106949 |
Populus tremula |
17106956 |
Populus tremuloides |
17075938 |
Porcellana longicornis |
17081563 |
Porcellana platycheles |
17093113 |
Porcellio scaber |
17087735 |
Porites astreoides |
17096751 |
Porites compressa |
17118159 |
Porites lutea |
17087412 |
Porites porites |
17099110 |
Porphyra leucostricta |
17101544 |
Porphyra tenera |
17100017 |
Porphyra yezoensis |
17100579 |
Porphyridium |
17100470 |
Porphyridium aerugineum |
17098153 |
Porphyridium cruentum |
17116872 |
Porphyridium purpureum |
17106964 |
Portulaca oleracea |
17113176 |
Portulaca sp. |
17084526 |
Portunus pelagicus |
17084534 |
Portunus sanguinolentus |
17075698 |
Portunus trituberculatus |
17101429 |
Posidonia oceania |
17097528 |
Posthodiplostomum minimum |
1930999 |
Potamanthus myops |
1905496 |
Potamilus alatus |
17092685 |
Potamocorbula amurensis |
17100835 |
Potamogeton |
17100264 |
Potamogeton alpinus |
17098757 |
Potamogeton coloratus |
17098450 |
Potamogeton crispus |
17098468 |
Potamogeton foliosus |
17098815 |
Potamogeton illinoensis |
17117177 |
Potamogeton malaianus |
17101395 |
Potamogeton natans |
17099243 |
Potamogeton nodosus |
17098443 |
Potamogeton pectinatus |
17099227 |
Potamogeton perfoliatus |
17115874 |
Potamogeton praelongus |
17116435 |
Potamogeton pusillus tenuissimus |
17115866 |
Potamogeton robbinsii |
17098997 |
Potamogeton zosteriformis |
17112137 |
Potamogetonaceae |
17080128 |
Potamonautes |
52453669 |
Potamopyrgus antipodarum |
17084252 |
Potamopyrgus jenkinsi |
1882513 |
Potamyia flava |
149740 |
Potassium |
218495 |
Potassium azide (K(N3)) |
153395 |
Potassium bromide (KBr) |
150516 |
Potassium chloride (KCl) |
40261 |
Potassium cyanide (K(CN)) |
155721 |
Potassium fluoride (KF) |
82610 |
Potassium hydroxide (K(OH)) |
152488 |
Potassium iodide (KI) |
179630 |
Potassium oxide (K2O) |
176032 |
Potassium tantalum oxide (KTaO3) |
17101171 |
Poteriochromonas malhamensis |
17083148 |
Potomilla neglecta |
170639 |
Praseodymium chloride (PrCl3) |
17100983 |
Prasinocladus marinus |
17116518 |
Prasinocladus sp. |
1858406 |
Prasinophyta |
17093774 |
Pratylenchus sp. |
1969187 |
Praunus flexuosus |
17151986 |
Pregn-4-en-3-one, 17,20-dihydroxy-, (20R)- |
17163411 |
Pregn-4-ene-3,11,20-trione, 21-(acetyloxy)-17-hydroxy- |
1073 |
Pregn-4-ene-3,20-dione, 11,17,21-trihydroxy-, (11.beta.)- |
17163437 |
Pregn-4-ene-3,20-dione, 11,21-dihydroxy-, (11.beta.)- |
17272691 |
Pregn-4-ene-3,20-dione, 21-hydroxy- |
1714658 |
Pregn-5-ene-16-carbonitrile, 3-hydroxy-20-oxo-, (3.beta.,16.alpha.)- |
1024 |
Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.alpha.)- |
101121 |
Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17-dihydroxy-16-methyl-21-(phosphonooxy)-, disodium salt, (11.beta.,16.alpha.)- |
17153727 |
Pregna-4,6-diene-3,20-dione, 6-chloro-17-hydroxy- |
17112046 |
Primula laurentiana |
17091588 |
Prionchulus punctatus |
17093972 |
Prismatolaimus sp. |
1859735 |
Pristina |
1859743 |
Pristina aequiseta |
1859792 |
Pristina longiseta |
17093758 |
Pristionchus sp. |
17084997 |
Proasellus coxalis |
17091752 |
Proasellus meridianus |
1891753 |
Procambarus |
17076803 |
Procambarus acutus acutus |
1891761 |
Procambarus alleni |
17074410 |
Procambarus blandingii |
17075292 |
Procambarus clarkii |
17074444 |
Procambarus hayi |
1891787 |
Procambarus paeninsulanus |
17093022 |
Procambarus simulans |
17077181 |
Procambarus simulans simulans |
17082355 |
Prochromadorella |
1877216 |
Procladius |
17085937 |
Procladius paludicola |
17086794 |
Procyon lotor |
1917616 |
Prodiamesa olivacea |
17078858 |
Prognathorhynchus |
59428 |
Proline |
17152596 |
Pronatur |
17152604 |
Pronatur Extra |
32953 |
Propanal |
17151358 |
Propanal, 2,2'-dithiobis[2-methyl- |
7369 |
Propanal, 2-methyl- |
90084 |
Propanal, 2-methyl-2-(methylsulfinyl)-, O-[(methylamino)carbonyl]oxime |
90092 |
Propanal, 2-methyl-2-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
29363 |
Propanal, 2-methyl-2-(methylthio)-, O-[(methylamino)carbonyl]oxime |
52466513 |
Propanamide, 2,2-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)- |
54775 |
Propanamide, 2-methyl- |
68619 |
Propanamide, N-(3,4-dichlorophenyl)- |
1714616 |
Propanamide, N-(5-chloro-4-methyl-2-thiazolyl)- |
199182 |
Propanamide, N,N-diethyl-2-(1-naphthalenyloxy)- |
61994 |
Propanamide, N-phenyl- |
78246 |
Propane, 1,1'-[(1E)-1,2-ethenediylbis(sulfonyl)]bis- |
7500 |
Propane, 1,1-dichloro- |
27565 |
Propane, 1,1'-thiobis- |
16600 |
Propane, 1,2,3-tribromo- |
16675 |
Propane, 1,2,3-trichloro- |
16618 |
Propane, 1,2-dibromo-3-chloro- |
7393 |
Propane, 1,2-dichloro- |
26005 |
Propane, 1,3-dibromo- |
38737 |
Propane, 1,3-dichloro- |
23994 |
Propane, 1-bromo- |
26062 |
Propane, 1-bromo-3-chloro- |
17123696 |
Propane, 1-chloro-2-nitro- |
357236 |
Propane, 2-(2-methoxyethoxy)-2-methyl- |
57604 |
Propane, 2,2-dichloro- |
24935 |
Propane, 2,2'-oxybis- |
25213 |
Propane, 2,2'-oxybis[1-chloro- |
24414 |
Propane, 2,2'-thiobis[2-methyl- |
17295346 |
Propane, 2-chloro-1-nitro- |
49189 |
Propane, 2-chloro-2-methyl- |
54429 |
Propane, 2-iodo-2-methyl- |
89870 |
Propane, 2-methoxy-2-methyl- |
7872 |
Propane, 2-nitro- |
17295239 |
Propanedial, hydroxy- |
26120 |
Propanedinitrile |
106377 |
Propanedinitrile, [(2-chlorophenyl)methylene]- |
53777 |
Propanedinitrile, [(3-chlorophenyl)hydrazono]- |
17153263 |
Propanedinitrile, [(4-chlorophenyl)methylene]- |
38471 |
Propanedioic acid |
77206 |
Propanedioic acid, (acetylamino)-, diethyl ester |
11080 |
Propanedioic acid, (ethoxymethylene)-, diethyl ester |
59055 |
Propanedioic acid, (phenylmethyl)-, diethyl ester |
1714754 |
Propanedioic acid, 1,3-dithiolan-2-ylidene-, bis(1-methylethyl) ester |
67496 |
Propanedioic acid, bromo-, diethyl ester |
17153651 |
Propanedioic acid, chloro-, bis(1-methylethyl) ester |
193433 |
Propanedioic acid, chloro-, diethyl ester |
17152661 |
Propanedioic acid, dichloro-, bis(1-methylethyl) ester |
22855 |
Propanedioic acid, diethyl ester |
38570 |
Propanedioic acid, disodium salt |
17272790 |
Propanedioic acid, ethyl(1-methylbutyl)-, diethyl ester |
1714681 |
Propanedioic acid, ethylidene-, diethyl ester |
6353 |
Propanedioic acid, ethylphenyl-, diethyl ester |
17272857 |
Propanedioic acid, hydroxy- |
105171 |
Propanedioic acid, phenyl- |
9480 |
Propanedioic acid, phenyl-, diethyl ester |
24174 |
Propanenitrile |
690966 |
Propanenitrile, 2-[[4-(ethylamino)-6-(methylthio)-1,3,5-triazin-2-yl]amino]-2-methyl- |
692202 |
Propanenitrile, 2-[[4-chloro-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]-2-methyl- |
220400 |
Propanenitrile, 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methyl- |
7484 |
Propanenitrile, 2-hydroxy- |
5942 |
Propanenitrile, 2-hydroxy-2-methyl- |
26690 |
Propanenitrile, 3-(1-methylethoxy)- |
205534 |
Propanenitrile, 3-(decyloxy)- |
205526 |
Propanenitrile, 3-(octyloxy)- |
17295429 |
Propanenitrile, 3,3,3-trichloro-2-hydroxy- |
28001 |
Propanenitrile, 3,3'-iminobis- |
90266 |
Propanenitrile, 3,3'-oxybis- |
28035 |
Propanenitrile, 3,3'-thiobis- |
40204 |
Propanenitrile, 3-amino- |
146266 |
Propanenitrile, 3-butoxy- |
17153420 |
Propanethioic acid |
7609 |
Propanoic acid |
15057 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)- |
17126814 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 2-butoxyethyl ester |
17121690 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, 2-butoxypropyl ester |
17126616 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |
262402 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, isooctyl ester |
961722 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, potassium salt |
17128133 |
Propanoic acid, 2-(2,4,5-trichlorophenoxy)-, sodium salt |
31146 |
Propanoic acid, 2-(2,4-dichlorophenoxy)- |
964098 |
Propanoic acid, 2-(2,4-dichlorophenoxy)-, (R)-, compd. with N-methylmethanamine (1:1) |
298554 |
Propanoic acid, 2-(2,4-dichlorophenoxy)-, 2-butoxyethyl ester |
963744 |
Propanoic acid, 2-(2,4-dichlorophenoxy)-, 2-ethylhexyl ester |
298562 |
Propanoic acid, 2-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) |
250159 |
Propanoic acid, 2-(2,4-dichlorophenoxy)-, isooctyl ester |
230136 |
Propanoic acid, 2-(2-chlorophenoxy)- |
298521 |
Propanoic acid, 2-(3-chlorophenoxy)-, sodium salt |
15008 |
Propanoic acid, 2-(4-chloro-2-methylphenoxy)- |
963587 |
Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, (R)-, compd. with N-methylmethanamine (1:1) |
261859 |
Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, compd. with N-methylmethanamine (1:1) |
249490 |
Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, isooctyl ester |
94474 |
Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, potassium salt |
17003278 |
Propanoic acid, 2-(4-chlorophenoxy)-2-methyl-, ethyl ester |
222737 |
Propanoic acid, 2,2,3,3-tetrafluoro-, sodium salt |
961755 |
Propanoic acid, 2,2,3-trichloro- |
6049 |
Propanoic acid, 2,2-dichloro- |
52466372 |
Propanoic acid, 2,2-dichloro-, 2-(2,4,5-trichlorophenoxy)ethyl ester |
34173 |
Propanoic acid, 2,2-dichloro-, sodium salt |
6031 |
Propanoic acid, 2,2-dimethyl- |
58370 |
Propanoic acid, 2,3-dibromo- |
17127481 |
Propanoic acid, 2,3-dibromo-, 2-cyanoethyl ester |
1714745 |
Propanoic acid, 2,3-dichloro-2-methyl-, sodium salt |
52466554 |
Propanoic acid, 2-[4-(2,4-dichlorophenoxy)phenoxy]- |
291435 |
Propanoic acid, 2-[4-(2,4-dichlorophenoxy)phenoxy]-, methyl ester |
17128448 |
Propanoic acid, 2-[4-(4-chlorophenoxy)phenoxy]-, 2-methylpropyl ester |
17154147 |
Propanoic acid, 2-[4-(4-chlorophenoxy)phenoxy]-, methyl ester |
17121948 |
Propanoic acid, 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]-, 2-propynyl ester, (2R)- |
17075250 |
Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]- |
356030 |
Propanoic acid, 2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]-, ethyl ester |
588327 |
Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, ethyl ester |
516757 |
Propanoic acid, 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, methyl ester |
516765 |
Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, butyl ester |
1065 |
Propanoic acid, 2-hydroxy- |
7765 |
Propanoic acid, 2-hydroxy-, (2S)- |
61218 |
Propanoic acid, 2-hydroxy-, 1-methylethyl ester |
55962 |
Propanoic acid, 2-hydroxy-, 2-methylpropyl ester |
214551 |
Propanoic acid, 2-hydroxy-, 3-methylbutyl ester |
37143 |
Propanoic acid, 2-hydroxy-, butyl ester |
93245 |
Propanoic acid, 2-hydroxy-, compd. with 7-ethoxy-3,9-acridinediamine (1:1) |
139345 |
Propanoic acid, 2-hydroxy-, dodecyl ester |
17467 |
Propanoic acid, 2-hydroxy-, ethyl ester |
17121856 |
Propanoic acid, 2-hydroxy-, manganese salt |
53082 |
Propanoic acid, 2-hydroxy-, methyl ester |
4853 |
Propanoic acid, 2-hydroxy-, monosodium salt |
133165 |
Propanoic acid, 2-hydroxy-, octyl ester |
141374 |
Propanoic acid, 2-hydroxy-, pentyl ester |
60947 |
Propanoic acid, 2-hydroxy-, propyl ester |
57695 |
Propanoic acid, 2-hydroxy-2-methyl- |
7849 |
Propanoic acid, 2-mercapto- |
7757 |
Propanoic acid, 2-methyl- |
34140 |
Propanoic acid, 2-oxo- |
74831 |
Propanoic acid, 2-phenoxy- |
188151 |
Propanoic acid, 3-(methylthio)-, methyl ester |
67082 |
Propanoic acid, 3,3'-thiobis-, diethyl ester |
115352 |
Propanoic acid, 3-bromo-, methyl ester |
24737 |
Propanoic acid, 3-chloro- |
1714638 |
Propanoic acid, 3-ethoxy-, propyl ester |
24752 |
Propanoic acid, 3-mercapto- |
17002940 |
Propanoic acid, 3-nitro- |
56564 |
Propanoic acid, butyl ester |
22749 |
Propanoic acid, ethyl ester |
53546 |
Propanoic acid, methyl ester |
36954 |
Propanoic acid, sodium salt |
17121898 |
Propanol |
233023 |
Propanol, [2-(2-methoxymethylethoxy)methylethoxy]- |
231514 |
Propanol, oxybis- |
17127358 |
Propionic acid, 2-(2,4,5-trichlorophenoxy)-, 3-butoxypropyl ester |
1714639 |
Propionic acid, 3-ethoxy-, hexyl ester |
17098708 |
Prorocentrum micans |
1858786 |
Prorocentrum minimum |
17078916 |
Proseriata |
1917657 |
Prosimulium magnum |
17106972 |
Prosopis chilensis |
17110396 |
Prosopis glandulosa |
17110727 |
Prosopis juliflora |
17082389 |
Prosopium williamsoni |
17093659 |
Prostigmata |
1914001 |
Prostoma graecense |
17093220 |
Proterorhinus marmoratus |
17093881 |
Protogamasellus sp. |
17084906 |
Protonemura meyeri |
17093790 |
Protorhabditis sp. |
1907773 |
Protothaca staminea |
17111063 |
Prototheca chlorelloides |
17098831 |
Prototheca zopfii |
1914860 |
Protozoa |
17109943 |
Prunus |
17106980 |
Prunus armeniaca |
17106998 |
Prunus avium |
17107004 |
Prunus cerasus |
17107012 |
Prunus domestica |
17107020 |
Prunus mahaleb |
17107038 |
Prunus padus |
17115213 |
Prunus pensylvanica |
17107046 |
Prunus persica |
17109281 |
Prunus persica nucipersica |
17107053 |
Prunus salicina |
17107061 |
Prunus serotina |
17107079 |
Prunus serrulata |
17107087 |
Prunus triloba |
17107095 |
Prunus virginiana |
1858166 |
Prymnesiophyceae |
17101346 |
Prymnesium parvum |
17076001 |
Psammechinus |
17075995 |
Psammechinus miliaris |
17108440 |
Psathyrostachys juncea |
1880467 |
Psectrocladius |
1874791 |
Psephenus herricki |
17077611 |
Psetta maeotica |
17082439 |
Psetta maxima |
1958701 |
Psettichthys melanostictus |
17086299 |
Pseudacris regilla |
17089244 |
Pseudacris triseriata |
17080482 |
Pseudacris triseriata triseria |
17117961 |
Pseudanabaena galeata |
17117912 |
Pseudanabaena mucicola |
17117888 |
Pseudanabaena sp. |
17090671 |
Pseudaphritis urvillii |
17083817 |
Pseudechinus magellanicus |
17088709 |
Pseudechinus novaezealandiae |
17089731 |
Pseudemys scripta elegans |
17093824 |
Pseudhalenchus sp. |
17075888 |
Pseudocalanus elongatus |
17093006 |
Pseudocentrotus depressus |
17082587 |
Pseudocrenilabrus philander |
17092545 |
Pseudodactylogyrus |
17092537 |
Pseudodactylogyrus anguillae |
17092529 |
Pseudodactylogyrus bini |
17092552 |
Pseudodactylogyrus microrchis |
17078049 |
Pseudodiaptomus coronatus |
17101650 |
Pseudoisochrysis paradoxa |
1881184 |
Pseudolimnophila |
17083122 |
Pseudomalacoceros tridentata |
17097544 |
Pseudomugil signifer |
17076100 |
Pseudopleuronectes yokohamae |
17118951 |
Pseudorasbora parva |
17094129 |
Pseudosinella alba |
1908383 |
Pseudosuccinea columella |
17107103 |
Pseudotsuga menziesii |
17151465 |
Pseudourea, 2-hexadecyl-1,3-dimethyl-2-thio-, monohydrobromide |
17107111 |
Psidium guajava |
17094566 |
Psila rosae |
1883495 |
Psilotreta |
17094798 |
Psilotreta indecisa |
1877596 |
Psorophora columbiae |
17076597 |
Psorophora confinnis |
17096744 |
Psorophora sp. |
1880970 |
Psychoda |
1883875 |
Psychomyia |
1931294 |
Psychomyia flavida |
17095969 |
Pteria colymbus |
17110685 |
Pteridium aquilinum |
17115221 |
Pteridium sp. |
1887496 |
Pteronarcella badia |
1887504 |
Pteronarcys |
17097635 |
Pteronarcys biloba |
17074378 |
Pteronarcys californicus |
1887520 |
Pteronarcys dorsata |
1887538 |
Pteronarcys pictetii |
17088873 |
Pteronarcys proteus |
17093238 |
Pterophyllum scalare |
17090374 |
Pterostichus chalcites |
17094004 |
Pterostichus cupreus |
17094574 |
Pterostichus madidus |
17090382 |
Pterostichus melanarius |
17096173 |
Pterostichus nigrita |
52451226 |
Ptychocheilus lucius |
52451234 |
Ptychocheilus oregonensis |
17110818 |
Pueraria montana lobata |
17110800 |
Pueraria montana montana |
17107129 |
Pueraria phaseoloides |
1931336 |
Pungitius pungitius |
52451424 |
Pungitius pungitius pungitius |
17107137 |
Punica granatum |
17096264 |
Puntius cumingii |
17093485 |
Puntius tetrazona |
1714640 |
Purigal P 21 |
17077439 |
Purpura lapillus |
17092214 |
Pycnocentria evecta |
1883420 |
Pycnopsyche |
1883438 |
Pycnopsyche guttifer |
695288 |
Pydraul 115E |
695270 |
Pydraul 50E |
17093493 |
Pyganodon grandis |
1901065 |
Pylodictis olivaris |
17152612 |
Pyprr |
17109950 |
Pyracantha |
17107145 |
Pyracantha coccinea |
1881408 |
Pyralidae |
1858471 |
Pyramimonas |
17100868 |
Pyramimonas grossii |
41103 |
Pyrazine |
17295148 |
Pyrazinol, 6-(1-methylpropyl)-3-(2-methylpropyl)-, 1-oxide, (+)- |
17126053 |
Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-[(diethoxyphosphinothioyl)oxy]-5-methyl-, ethyl ester |
34843 |
Pyrene |
133595 |
Pyrene, 1-nitro- |
157362 |
Pyrethrins and Pyrethroids |
41087 |
Pyridazine |
1714669 |
Pyridazine, 3-(2-methylphenoxy)- |
38273 |
Pyridazine, 3,6-dichloro- |
27037 |
Pyridine |
20388 |
Pyridine, 2-(phenylmethyl)- |
25346 |
Pyridine, 2,4,6-trimethyl- |
1714281 |
Pyridine, 2,6-bis(2-phenylethenyl)- |
101345 |
Pyridine, 2,6-dichloro- |
25155 |
Pyridine, 2,6-dimethyl- |
17129776 |
Pyridine, 2-[[1-(2,5-dimethylphenyl)ethyl]sulfonyl]-, 1-oxide |
605915 |
Pyridine, 2-[1-methyl-2-(4-phenoxyphenoxy)ethoxy]- |
25635 |
Pyridine, 2-chloro- |
94466 |
Pyridine, 2-chloro-6-(trichloromethyl)- |
17153131 |
Pyridine, 2-chloro-6-methyl- |
19679 |
Pyridine, 2-ethyl- |
25601 |
Pyridine, 2-methyl- |
1714270 |
Pyridine, 2-phenyl- |
17295213 |
Pyridine, 3-(2S)-2-pyrrolidinyl- |
55749 |
Pyridine, 3,4-dimethyl- |
1727 |
Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]- |
3962 |
Pyridine, 3-[(2S)-1-methyl-2-pyrrolidinyl]-, sulfate (2:1) |
63818 |
Pyridine, 3-chloro- |
25544 |
Pyridine, 3-methyl- |
76471 |
Pyridine, 3-phenyl- |
97196 |
Pyridine, 4-(phenylmethyl)- |
17153677 |
Pyridine, 4-bromo-, hydrochloride |
17123084 |
Pyridine, 4-chloro-, 1-oxide |
148908 |
Pyridine, 4-chloro-, hydrochloride |
19422 |
Pyridine, 4-ethenyl- |
51334 |
Pyridine, 4-ethyl- |
25460 |
Pyridine, 4-methyl- |
1714402 |
Pyridine, 4-nitro- |
74799 |
Pyridine, 4-phenyl- |
22442 |
Pyridine, 5-ethyl-2-methyl- |
98111 |
Pyridine, pentachloro- |
139097 |
Pyridinium, 1-(carboxymethyl)-, chloride |
1714464 |
Pyridinium, 1-[(4-amino-2-propyl-5-pyrimidinyl)methyl]-2-methyl-, chloride |
1714595 |
Pyridinium, 1-[(4-amino-2-propyl-5-pyrimidinyl)methyl]-2-methyl-, chloride, monohydrochloride |
17127754 |
Pyridinium, 1-[(dodecylphenyl)methyl]-, chloride |
22301 |
Pyridinium, 1-dodecyl-, chloride |
17124736 |
Pyridinium, 1-dodecyl-, salt with 5-chloro-2(3H)-benzothiazolethione (1:1) |
37846 |
Pyridinium, 1-hexadecyl-, bromide |
32706 |
Pyridinium, 1-hexadecyl-, chloride |
52466596 |
Pyridinium, 1-methyl-4-phenyl- |
52466539 |
Pyridinium, 1-methyl-4-phenyl-, chloride |
17163528 |
Pyridinium, 2-[(hydroxyimino)methyl]-1-methyl-, chloride |
1714656 |
Pyridinium, 2-chloro-1-methyl-, iodide |
17151564 |
Pyridinium, 3-hydroxy-1-phenyl-, chloride |
41095 |
Pyrimidine |
17116484 |
Pyrocystis lunula |
17109216 |
Pyrrhopappus carolinianus |
31500 |
Pyrrolidine, 1-methyl- |
2543 |
Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS,8aR)- |
3863 |
Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS,8aR)-, sulfate (2:1) (salt) |
1858505 |
Pyrrophycophyta |
17107152 |
Pyrus calleryana |
17107160 |
Pyrus communis |
17117755 |
Pythium sp. |
156943 |
Quaternary ammonium compounds, alkylbenzyldimethyl, chlorides |
429654 |
Quaternary ammonium compounds, benzyl-C12-16-alkyldimethyl, chlorides |
331611 |
Quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides |
502385 |
Quaternary ammonium compounds, C12-18-alkyl[(ethylphenyl)methyl]dimethyl, chlorides |
422857 |
Quaternary ammonium compounds, C12-18-alkyltrimethyl, chlorides |
446526 |
Quaternary ammonium compounds, di-C12-20-alkyldimethyl, chlorides |
321554 |
Quaternary ammonium compounds, dicoco alkyldimethyl, chlorides |
475426 |
Quaternary ammonium compounds, dimethylditallow alkyl, chlorides |
159764 |
Quaternary ammonium compounds, trimethyltallow alkyl, chlorides |
17096165 |
Quedius molochinus |
17090051 |
Quelea quelea |
17109968 |
Quercus |
17115239 |
Quercus alba |
17115247 |
Quercus bicolor Willd |
17107178 |
Quercus coccinea |
17107186 |
Quercus dumosa |
17109349 |
Quercus falcata |
17115254 |
Quercus gambelii |
17115262 |
Quercus lyrata |
17115270 |
Quercus marilandica |
17107194 |
Quercus palustris |
17115288 |
Quercus palustris Muench |
17107202 |
Quercus phellos |
17109356 |
Quercus prinus |
17107210 |
Quercus rubra |
17115296 |
Quercus stellata |
17107228 |
Quercus turbinella |
17107236 |
Quercus velutina |
17107244 |
Quercus virginiana |
17155409 |
Quinazoline |
699991 |
Quinazoline, 4-[2-[4-(1,1-dimethylethyl)phenyl]ethoxy]- |
13342 |
Quinoline |
65524 |
Quinoline, 1,2,3,4-tetrahydro- |
241976 |
Quinoline, 1,2-dihydro-2,2,4-trimethyl-, homopolymer |
80929 |
Quinoline, 2,4-dimethyl- |
72975 |
Quinoline, 2,6-dimethyl- |
13581 |
Quinoline, 2-methyl- |
17152810 |
Quinoline, 2-methyl-, compd. with 2,4,6-trinitrophenol |
11015 |
Quinoline, 4,7-dichloro- |
47589 |
Quinoline, 4-methyl- |
684852 |
Quinoline, 4-nitro-, 1-oxide |
17156423 |
Quinoline, 5-nitro- |
60087 |
Quinoline, 6-chloro- |
13490 |
Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl- |
13573 |
Quinoline, 6-methyl- |
17156449 |
Quinoline, 6-nitro- |
59907 |
Quinoline, 8-methyl- |
59022 |
Quinoline, 8-nitro- |
691709 |
Quinoline, dimethyl- |
65409 |
Quinolinium, 1-ethyl-, iodide |
1714583 |
Quinolinium, 6,6'-(carbonyldiimino)bis[1-methyl-, bis(methyl sulfate) |
13318 |
Quinoxaline |
100719 |
Quinoxaline, 2,3-dimethyl- |
1931377 |
Quiscalus quiscula |
17085655 |
Quistadrilus multisetosus |
149765 |
Radium |
17085002 |
Radix auricularia |
17083577 |
Radix plicatula |
17080987 |
Raja clavata |
1931393 |
Raja eglanteria |
17081548 |
Raja radiata |
17086810 |
Rallus longirostris |
17079294 |
Rana |
17085358 |
Rana arvalis |
17097494 |
Rana aurora |
17087453 |
Rana berlandieri |
17088782 |
Rana blairi |
17077199 |
Rana breviceps |
17087529 |
Rana brevipoda porosa |
17078312 |
Rana catesbeiana |
17079542 |
Rana chensinensis |
17082330 |
Rana clamitans |
17090879 |
Rana clamitans melanota |
17079567 |
Rana cyanophlyctis |
17080649 |
Rana esculenta |
17093030 |
Rana grylio |
17087420 |
Rana heckscheri |
17083916 |
Rana hexadactyla |
17089509 |
Rana limnocharis |
17094947 |
Rana luteiventris |
17094590 |
Rana muscosa |
17091067 |
Rana nigromaculata |
17080938 |
Rana palustris |
17089228 |
Rana perezi |
17076639 |
Rana pipiens |
17094376 |
Rana ridibunda |
17078106 |
Rana sphenocephala |
17076548 |
Rana sylvatica |
17078718 |
Rana temporaria |
17076654 |
Rana tigrina |
1885011 |
Ranatra |
17083692 |
Ranatra elongata |
17082181 |
Ranatra filiformis |
1906650 |
Rangia cuneata |
17083429 |
Rangifer sp. |
17112145 |
Ranunculus aquatilis |
17111865 |
Ranunculus flammula |
17101494 |
Ranunculus fluitans |
17098872 |
Ranunculus penicillatus |
17107251 |
Ranunculus sceleratus |
17112228 |
Ranunculus trichophyllus |
157107 |
Rape oil |
17107269 |
Raphanus raphanistrum |
17107277 |
Raphanus sativus |
17113184 |
Raphanus sp. |
17086539 |
Rasbora |
17077959 |
Rasbora daniconia |
17091000 |
Rasbora daniconius neilgeriens |
17074345 |
Rasbora heteromorpha |
17077553 |
Rasbora neilgherriensis |
17074501 |
Rasbora trilineata |
17086828 |
Rattus norvegicus |
17086836 |
Rattus rattus |
17083320 |
Rattus sp. |
1714613 |
Rawflex |
17089749 |
Redunca redunca |
17086844 |
Reithrodontomys humulis |
17097882 |
Reithrodontomys megalotis |
1714692 |
Remazol Green C 4B |
321448 |
Resin acids and Rosin acids, aluminum salts |
162602 |
Resin acids and Rosin acids, calcium salts |
162636 |
Resin acids and Rosin acids, copper salts |
162800 |
Resin acids and Rosin acids, zinc salts |
41590 |
Retinoic acid |
17118126 |
Retropinna retropinna |
17093808 |
Rhabditidae |
17083247 |
Rhabditis |
17085564 |
Rhabdosargus holubi |
17085846 |
Rhamdia sapo |
17107285 |
Rhamnus californica |
1879469 |
Rheotanytarsus |
1852607 |
Rhepoxynius abronius |
1900810 |
Rhinichthys |
17097460 |
Rhinichthys atratulatus atratulatus |
1900828 |
Rhinichthys atratulus |
1900836 |
Rhinichthys cataractae |
1900844 |
Rhinichthys osculus |
17084013 |
Rhinomugil corsula |
17089756 |
Rhinopoma microphyllum |
1871052 |
Rhithrogena |
1871060 |
Rhithrogena hageni |
17088717 |
Rhithrogena semicolorata |
1890920 |
Rhithropanopeus harrisii |
17100058 |
Rhizoclonium |
17099714 |
Rhizoclonium hieroglyphicum |
17099573 |
Rhizoselenia hebetata semis |
1931559 |
Rhodeus sericeus |
17081100 |
Rhodeus sericeus amarus |
17110248 |
Rhododendron |
17103011 |
Rhododendron catawbiense |
17103029 |
Rhododendron japonicum |
17107293 |
Rhododendron nudiflorum |
1857952 |
Rhodomonas |
17100488 |
Rhodomonas baltica |
17098278 |
Rhodomonas lens |
17116138 |
Rhodomonas salina |
17100140 |
Rhodymenia pseudopalmata |
1853936 |
Rhoicosphenia curvata |
1854363 |
Rhopalodia gibba |
17107301 |
Rhus hirta |
17084393 |
Rhyacodrilus montanus |
1883933 |
Rhyacophila |
17118555 |
Rhyacophila dorsalis |
1884006 |
Rhyacophila fuscula |
1861319 |
Rhynchelmis |
17110263 |
Ribes |
17107319 |
Ribes roezlii |
17107327 |
Ribes triste |
9795 |
Riboflavin |
17115320 |
Ricardia scabra |
17112152 |
Riccia |
17107335 |
Richardia scabra |
1900869 |
Richardsonius balteatus |
17107343 |
Ricinus communis |
17085051 |
Rita rita |
17101791 |
Rivularia |
17075979 |
Rivulus cylindraceus |
17081092 |
Rivulus marmoratus |
17088352 |
Rivulus ocellatus marmoratus |
17103037 |
Robinia pseudoacacia |
1714508 |
Rodine 213 |
17092313 |
Romanomermis iyengari |
17109455 |
Rorippa islandica |
17105974 |
Rorippa nasturtium-aquaticum |
17109984 |
Rosa |
17109976 |
Rosa acicularis |
17109299 |
Rosa bracteata |
17103052 |
Rosa damascena |
17115338 |
Rosa eglanteria |
17107350 |
Rosa multiflora |
17107368 |
Rosa wichuraiana |
1714394 |
Rose Bengal |
17119090 |
Rosin Amine D |
17117169 |
Rotala sp. |
17088469 |
Rotatoria |
1914969 |
Rotifera |
17110321 |
Rottboellia cochinchinensis |
17093501 |
Rotylenchus sp. |
17132721 |
Rubber, silicone, di-Me |
17152620 |
Rubberizer |
149799 |
Rubidium |
156448 |
Rubidium chloride (RbCl) |
17109992 |
Rubus |
17107376 |
Rubus chamaemorus |
17115346 |
Rubus cuneifolius |
17109323 |
Rubus flagellaris |
17107384 |
Rubus idaeus |
17110875 |
Rubus praecox |
17107392 |
Rubus spectabilis |
17107400 |
Rubus trivialis |
17090010 |
Rudarius ercodes |
17115973 |
Rudbeckia hirta |
17115353 |
Rudbeckia serotina |
17088147 |
Ruditapes decussatus |
17088154 |
Ruditapes philippinarum |
17110560 |
Rumex |
17112160 |
Rumex acetosa |
17107418 |
Rumex acetosella |
17107426 |
Rumex crispus |
17111568 |
Rumex hydrolapathum |
17107434 |
Rumex obtusifolius |
17115361 |
Rumex venosus Pursh |
17099219 |
Ruppia maritima |
149807 |
Ruthenium |
167338 |
Ruthenium chloride (RuCl3) |
1714383 |
Ruthenium red |
17079286 |
Rutilus frisii kutum |
17074386 |
Rutilus rutilus |
17080003 |
Rutilus rutilus caspicus |
17095365 |
Sabacon crassipalpe |
17107442 |
Sabal palmetto |
17085440 |
Sabella penicillus |
1865617 |
Sabellaria vulgaris |
17110008 |
Saccharum |
17107459 |
Saccharum officinarum |
17078353 |
Saccostrea commercialis |
17092628 |
Saccostrea cuccullata |
17096603 |
Saccostrea echinata |
52453750 |
Saduria entomon |
1897867 |
Sagitta |
17101460 |
Sagittaria |
17107467 |
Sagittaria lancifolia |
17111626 |
Sagittaria latifolia |
17099276 |
Sagittaria montevidensis |
17089921 |
Saimiri sciureus |
17115379 |
Saintpaulia ionantha |
17110016 |
Salix |
17108887 |
Salix alba vitellina |
17107475 |
Salix fragilis |
17109331 |
Salix pentandra |
17115387 |
Salix purpurea |
17107483 |
Salix triandra |
17115395 |
Salmalia malabarica |
1931641 |
Salmo salar |
17095472 |
Salmo sp. |
1901362 |
Salmo trutta |
17097726 |
Salmo trutta caspius |
17088360 |
Salmo trutta fario |
17083932 |
Salmo trutta lacustris |
17083064 |
Salmo trutta levensis |
1901321 |
Salmonidae |
17110297 |
Salsola kali |
1901370 |
Salvelinus |
1931658 |
Salvelinus alpinus |
17097734 |
Salvelinus alpinus erythrinus |
1901388 |
Salvelinus fontinalis |
17080953 |
Salvelinus leucomaenis |
17075458 |
Salvelinus malma |
1931666 |
Salvelinus namaycush |
17107491 |
Salvia officinalis |
17112525 |
Salvia sclarea |
17108457 |
Salvia splendens |
17111162 |
Salvinia minima |
17101825 |
Salvinia molesta |
17100637 |
Salvinia natans |
170654 |
Samarium chloride (SmCl3) |
17107509 |
Sambucus nigra canadensis |
17107517 |
Sambucus racemosa |
1714498 |
Sancowad AN |
1714682 |
Sandozin NIS |
17153925 |
Santicizer 711P |
1714502 |
Santicizer HB 40 |
17107525 |
Saponaria officinalis |
17125568 |
Saponins |
17117540 |
Saprolegnia ferax |
17117581 |
Saprolegnia parasitica |
17117698 |
Saprolegnia sp. |
17117706 |
Saprolegniales |
17109364 |
Sarcobatus vermiculatus |
1955244 |
Sardinops sagax |
17099136 |
Sargassum |
17101437 |
Sargassum filipendula |
17117128 |
Sargassum muticum |
17112400 |
Sargassum pallidum |
17116633 |
Sargassum siliquosum |
17082256 |
Sarotherodon galilaeus |
17107533 |
Sassafras albidum |
17115411 |
Saxifraga sp. |
17115403 |
Saxifraga stolonifera |
17115429 |
Scabiosa pratensis - Morning brid |
170670 |
Scandium chloride (ScCl3) |
17101833 |
Scapania undulata |
17088501 |
Scapharca broughtonii |
17092081 |
Scapharca inaequivalvis |
17080920 |
Scaphiopus couchii |
17081191 |
Scaphiopus hammondii |
17094731 |
Scaphiopus holbrookii |
1962000 |
Scapholeberis |
1931708 |
Scapholeberis kingi |
1931716 |
Scapholeberis mucronata |
17095696 |
Scarabaeidae |
1931724 |
Scardinius erythrophthalmus |
17097064 |
Scarites quadriceps |
17092925 |
Scarites substriatus |
17089939 |
Sceloporus undulatus |
1856517 |
Scenedesmus |
1856525 |
Scenedesmus abundans |
1856533 |
Scenedesmus acuminatus |
17101304 |
Scenedesmus acutiformis |
17102062 |
Scenedesmus acutus |
17116799 |
Scenedesmus acutus alternans |
1856558 |
Scenedesmus armatus |
1856582 |
Scenedesmus bijuga |
17099508 |
Scenedesmus bijugatus |
17099516 |
Scenedesmus brasiliensis |
1856608 |
Scenedesmus dimorphus |
17102161 |
Scenedesmus incrassatulus |
1856624 |
Scenedesmus longus |
17098591 |
Scenedesmus obtusiusculus |
17099151 |
Scenedesmus opoliensis |
17101619 |
Scenedesmus pannonicus |
1856640 |
Scenedesmus quadricauda |
17101924 |
Scenedesmus subspicatus |
17108465 |
Schefflera actinophylla |
17097320 |
Schendylidae |
17082611 |
Schilbe mystus |
17108473 |
Schinus terebinthifolius |
17084559 |
Schistocephalus solidus |
1862572 |
Schistomeringos rudolphi |
17085275 |
Schistosoma haematobium |
17086448 |
Schistosoma mansoni |
17108481 |
Schizachyrium scoparium |
17100025 |
Schizogonium |
17100397 |
Schizomeris leibleinii |
1853175 |
Schizothrix |
17098310 |
Schizothrix calcicola |
17115999 |
Schoenoplectus californicus |
17112509 |
Schoenoplectus lacustris |
17115817 |
Schoenoplectus mucronatus |
17101668 |
Schroederella schroderi |
1899152 |
Sciaenidae |
17079948 |
Sciaenops ocellatus |
17097932 |
Scinax nasica |
17090069 |
Scincella lateralis |
17112434 |
Scirpus acutus |
17098492 |
Scirpus validus |
17086851 |
Sciurus carolinensis |
17115445 |
Scleria sp. |
17117680 |
Sclerotium rolfsii |
17077900 |
Scolelepis fuliginosa |
17078411 |
Scolelepis squamatus |
17087669 |
Scolymia cubensis |
1931807 |
Scophthalmus aquosus |
17085499 |
Scophthalmus maximus |
1956556 |
Scorpaena guttata |
1956937 |
Scorpaenichthys marmoratus |
17117268 |
Scorpidium scorpioides |
17117201 |
Scorpidium sp. |
17098690 |
Scrippsiella faeroense |
17117193 |
Scrippsiella trochoidea |
17112368 |
Scripus lacustris |
17100272 |
Scripus radicans |
17077413 |
Scrobicularia plana |
17111345 |
Scrophularia auriculata |
17077652 |
Scutellidium |
17078296 |
Scyliorhinus canicula |
17084294 |
Scylla serrata |
17295130 |
scyllo-Inositol |
17111097 |
Scytonema hofmannii |
17099532 |
Scytosiphon lomentaria |
17091489 |
Sebastes schlegeli |
17107558 |
Secale cereale |
17107566 |
Sedum brevifolium |
17086257 |
Segestes lucens |
1714742 |
Selcote |
1856657 |
Selenastrum |
17098427 |
Selenastrum capricornutum |
1714637 |
Selenate |
154534 |
Selenic acid |
156257 |
Selenic acid, dipotassium salt |
185892 |
Selenic acid, disodium salt |
1714718 |
Selenic acid, nickel(2+) salt (1:1) |
154484 |
Selenious acid |
171272 |
Selenious acid, dipotassium salt |
167882 |
Selenious acid, disodium salt |
1714636 |
Selenite |
154310 |
Selenium |
150359 |
Selenium oxide (SeO2) |
17117045 |
Sellaphora pupula |
17084807 |
Semaprochilodus insignis |
17086240 |
Semibalanus balanoides |
17078676 |
Semisulcospira libertina |
1900885 |
Semotilus atromaculatus |
17092776 |
Semotilus atromaculatus atromaculatus |
17115452 |
Senebiera didyma Persoon |
17115460 |
Senecio aquaticus |
17109224 |
Senecio jacobaea |
17107574 |
Senecio vulgaris |
17108580 |
Senna obtusifolia |
17108598 |
Senna occidentalis |
17110743 |
Senna tora |
1714391 |
Separan AP 30 |
17077918 |
Sepedon fuscipennis |
17087180 |
Sepia officinalis |
41608 |
Serine |
17093105 |
Serinus canaria |
17078775 |
Seriola quinqueradiata |
17078056 |
Serranus cabrilla |
17077355 |
Serranus scriba |
1972918 |
Sesamum orientale |
1890169 |
Sesarma cinereum |
17090275 |
Sesarma reticulatum |
17107582 |
Sesbania herbacea |
17110024 |
Setaria |
17108986 |
Setaria faberi |
17107590 |
Setaria italica |
17107608 |
Setaria macrostachys |
17107616 |
Setaria verticillata |
17107624 |
Setaria viridis |
17115478 |
Seymeria cassioides |
1881747 |
Sialidae |
1881754 |
Sialis |
17080193 |
Sialis lutaria |
1917947 |
Sialis velata |
17152638 |
Siallon Emulsifier |
17115486 |
Sicyos angulatus |
1869114 |
Sida (Family Sididae) |
1869122 |
Sida crystallina |
17115494 |
Sida fallax |
17107632 |
Sida spinosa |
17088725 |
Siderastrea |
17086265 |
Siganus fuscescens |
17086273 |
Sigara alternata |
17078478 |
Sigara dorsalis |
17082819 |
Sigara sp. |
17118340 |
Sigara striata |
17092115 |
Sigara substriata |
17086869 |
Sigmodon hispidus |
144410 |
Silane, (1-cyclohexen-1-yloxy)trimethyl- |
17128307 |
Silane, (2-chloroethyl)methylbis(phenylmethoxy)- |
17153149 |
Silane, (decyloxy)trimethyl- |
7195 |
Silane, diethoxydimethyl- |
17814 |
Silane, trichlorophenyl- |
75036 |
Silanediol, diphenyl- |
206045 |
Silicate(2-), hexafluoro-, disodium |
145425 |
Silicic acid (H2SiO3), disodium salt |
17153065 |
Silicic acid (H4SiO4), tetrakis(2-chloroethyl) ester |
86082 |
Silicic acid, aluminum sodium salt |
86116 |
Silicic acid, sodium salt |
17086281 |
Sillago bassensis |
17088857 |
Sillago japonica |
17080219 |
Silo pallipes |
328815 |
Siloxanes and Silicones, di-Me |
17095704 |
Silphidae |
17088386 |
Silurus asotus |
17076076 |
Silurus glanis |
149849 |
Silver |
154880 |
Silver chloride (AgCl) |
49031 |
Silver cyanide (Ag(CN)) |
154914 |
Silver iodide (AgI) |
219998 |
Silver sulfide (Ag2S) |
17152794 |
Silv-Ex (fire suppressant) |
17154121 |
Silyl, trimethoxy- |
758888 |
Simethicone |
1869031 |
Simocephalus |
1917954 |
Simocephalus exspinosus |
1931997 |
Simocephalus serrulatus |
1932003 |
Simocephalus vetulus |
1880772 |
Simuliidae |
1880822 |
Simulium |
17080490 |
Simulium arcticum |
17089046 |
Simulium argus |
17087479 |
Simulium damnosum |
17080276 |
Simulium equinum |
17091109 |
Simulium janzi |
17090887 |
Simulium luggeri |
17091083 |
Simulium medusaeforme |
17078569 |
Simulium ornatipes |
17118613 |
Simulium ornatum |
17077520 |
Simulium pugetense |
17087958 |
Simulium squamosum |
1880921 |
Simulium venustum |
17089053 |
Simulium virgatum |
1880939 |
Simulium vittatum |
17107640 |
Sinapis alba |
17107657 |
Sinapis arvensis |
17115502 |
Sinocalamous oldhami |
17092420 |
Sinonovacula constricta |
1871516 |
Siphlonurus |
17075532 |
Siphlonurus linnaeanus |
17085788 |
Siphonalia pfeifferi |
1915354 |
Sipuncula |
17092867 |
Siriella armata |
17107665 |
Sisymbrium officinale |
1881689 |
Sisyridae |
1853597 |
Skeletonema costatum |
1932045 |
Skistodiaptomus oregonensis |
17153834 |
Skot-Free |
1888494 |
Skwala |
1888502 |
Skwala parallela |
17107673 |
Smilax bona-nox |
1869858 |
Sminthuridae |
17095563 |
Sminthurinus aureus |
17095597 |
Sminthurus viridis |
498980 |
Soaps, stocks, vegetable-oil, acidulated |
149856 |
Sodium |
17121625 |
Sodium arsenide (NaAs) |
240754 |
Sodium azide (Na(N3)) |
152264 |
Sodium bromide (NaBr) |
152256 |
Sodium chloride (NaCl) |
39305 |
Sodium cyanide (Na(CN)) |
152504 |
Sodium fluoride (NaF) |
82644 |
Sodium hydroxide (Na(OH)) |
152561 |
Sodium iodide (NaI) |
82842 |
Sodium peroxide (Na2(O2)) |
205468 |
Sodium sulfide (Na(SH)) |
82859 |
Sodium sulfide (Na2S) |
17121385 |
Sodium sulfide (Na2S), nonahydrate |
190264 |
Sodium vanadium oxide (Na3VO4) |
17074295 |
Soil Community |
17108630 |
Solanum carolinense |
17108648 |
Solanum chacoense |
17102385 |
Solanum demissum |
17115510 |
Solanum elaeagnifolium |
17110255 |
Solanum jamesii |
17111410 |
Solanum lycopersicum lycopersicum |
17108671 |
Solanum melongena |
17110313 |
Solanum nigrum |
17108697 |
Solanum nodiflorum |
17108663 |
Solanum phureja |
17108812 |
Solanum physalifolium |
17115528 |
Solanum pinnatisectum |
17115536 |
Solanum ptycanthum |
17108903 |
Solanum tuberosum |
17094939 |
Solea senegalensis |
17079252 |
Solea solea |
17078866 |
Solenofilmorpha funilis |
17094970 |
Soletellina siliqua |
17113077 |
Solidago rupestris |
17115544 |
Soliva sessilis |
17115551 |
Soliva sp. |
351486 |
Solvent naphtha (coal) |
17076332 |
Somatochlora cingulata |
17107681 |
Sonchus arvensis |
17107699 |
Sonchus asper |
17107707 |
Sonchus oleraceus |
17115569 |
Sonchus sp. |
86009 |
Sorbitan, mono-(9Z)-9-octadecenoate |
162354 |
Sorbitan, mono-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
162347 |
Sorbitan, monododecanoate, poly(oxy-1,2-ethanediyl) derivs. |
162362 |
Sorbitan, monohexadecanoate, poly(oxy-1,2-ethanediyl) derivs. |
162370 |
Sorbitan, monooctadecanoate, poly(oxy-1,2-ethanediyl) derivs. |
162388 |
Sorbitan, tri-(9Z)-9-octadecenoate, poly(oxy-1,2-ethanediyl) derivs. |
162396 |
Sorbitan, trioctadecanoate, poly(oxy-1,2-ethanediyl) derivs. |
17110339 |
Sorbus aucuparia |
17097718 |
Sorex araneus |
17089764 |
Sorex sp. |
1640127 |
Sorghum |
17107715 |
Sorghum bicolor |
17115890 |
Sorghum bicolor bicolor |
17107723 |
Sorghum bicolor drummondii |
17107731 |
Sorghum halepense |
156836 |
Soybean oil |
158345 |
Soybean oil, epoxidized |
17117359 |
Sparganium angustifolium |
17098484 |
Sparganium eurycarpum |
1899202 |
Sparidae |
17099342 |
Spartina alterniflora |
17098799 |
Spartina cynosuroides |
17107749 |
Spartina x townsendii |
17096504 |
Sparus aurata |
17082926 |
Sparus macrocephalus |
17096272 |
Sparus sp. |
17107756 |
Spergula arvensis |
17097841 |
Spermophilus beecheyi |
17112707 |
Spermothamnion repens |
17109489 |
Sphaeralcea coccinea |
17078585 |
Sphaerechinus granularis |
1873769 |
Sphaeriidae (Insecta) |
1906924 |
Sphaerium |
1932136 |
Sphaerium corneum |
17092255 |
Sphaerium novaezelandiae |
1906940 |
Sphaerium striatinum |
17111584 |
Sphaerocysts schroeteri |
17096348 |
Sphaerodema sp. |
17082199 |
Sphaeroma annulatum |
17081670 |
Sphaeroma serratum |
17107764 |
Sphaerophysa salsula |
17100850 |
Sphaeroplea annulina |
17095050 |
Sphaerosyllis semiverrucosa |
17115858 |
Sphagnum sp. |
17095712 |
Sphecidae |
1932185 |
Sphoeroides maculatus |
17081829 |
Spicodiaptomus chilospinus |
1714617 |
Spillwash L.T. |
17081282 |
Spinachia vulgaris |
17107772 |
Spinacia oleracea |
17092610 |
Spinicauda spinicauda |
1866961 |
Spio setosa |
1866987 |
Spiophanes bombyx |
17110529 |
Spiraea |
17110446 |
Spiraea douglasii |
17115577 |
Spiraea x billiardi |
17002452 |
Spiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione, 7-chloro-2',4,6-trimethoxy-6'-methyl-, (1'S,6'R)- |
1714481 |
Spiro[furan-2(5H),2'(1'H)-naphtho[2,1-b]furan]-5-one, 3'a,4',5',5'a,6',7',8',9',9'a,9'b-decahydro-3,3'a,6',6',9'a-pentamethyl-, (2R,3'aR,5'aS,9'aR,9'bR)- |
208066 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy-, disodium salt |
212167 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3',6'-dihydroxy-, disodium salt |
100198 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy- |
49866 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-, disodium salt |
204040 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-2',4',5',7'-tetraiodo-, disodium salt |
65284 |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodo-, dipotassium salt |
17101130 |
Spirodela oligorhiza |
17099698 |
Spirodela polyrhiza |
17102179 |
Spirodela punctata |
1857556 |
Spirogyra |
17098039 |
Spirogyra crassa |
17101916 |
Spirogyra grevilleana |
17101700 |
Spirogyra juergensii |
17116237 |
Spirogyra setiformis |
17101338 |
Spirogyra singularis |
1866243 |
Spirorbis |
1918036 |
Spirosperma nikolskyi |
17094707 |
Spirostomum ambiguum |
17083254 |
Spirostomum teres |
17101148 |
Spirulina labyrinthiformis |
17099656 |
Spirulina platensis |
1906676 |
Spisula solidissima |
17097403 |
Spodoptera littoralis |
1914811 |
Spongilla lacustris |
17111048 |
Spongomorpha arcta |
17107780 |
Sporobolus indicus |
17100215 |
Sporotetras pyriformis |
17116328 |
Spyridia filamentosa |
1954742 |
Squalus acanthias |
17107798 |
Stachytarpheta jamaicensis |
17153842 |
STAFLO |
17091190 |
Stagnicola attenuta |
17090663 |
Stagnicola elodes |
2121 |
Stannane, (acetyloxy)tributyl- |
687251 |
Stannane, (acetyloxy)triethyl- |
73296 |
Stannane, (acetyloxy)triphenyl- |
123752 |
Stannane, (benzoyloxy)tributyl- |
692053 |
Stannane, [(3,4,5,6-tetrachloro-1,2-phenylene)bis(carbonyloxy)]bis[tributyl- |
17152919 |
Stannane, [[(diethylamino)thioxomethyl]thio]triphenyl- |
1714579 |
Stannane, [phosphinylidynetris(oxy)]tris[triphenyl- |
77073 |
Stannane, bis(acetyloxy)dibutyl- |
208645 |
Stannane, bis(acetyloxy)dioctyl- |
17151481 |
Stannane, bis[(1-oxododecyl)oxy]diphenyl- |
107110 |
Stannane, bromotriethyl- |
17119025 |
Stannane, butyl- |
291930 |
Stannane, butyloxo- |
78659 |
Stannane, butyltrichloro- |
111740 |
Stannane, chlorotricyclohexyl- |
17148206 |
Stannane, chlorotriethyl- |
77008 |
Stannane, chlorotrimethyl- |
66183 |
Stannane, chlorotriphenyl- |
961334 |
Stannane, dibutyl- |
6551 |
Stannane, dibutylbis[(1-oxododecyl)oxy]- |
135251 |
Stannane, dibutylbis[(1-oxooctadecyl)oxy]- |
107268 |
Stannane, dibutylbis[(2-ethyl-1-oxohexyl)oxy]- |
67389 |
Stannane, dibutyldichloro- |
54593 |
Stannane, dibutyldifluoro- |
142943 |
Stannane, dibutyldiphenyl- |
71019 |
Stannane, dibutyloxo- |
123026 |
Stannane, dibutylthioxo- |
69088 |
Stannane, dichlorodimethyl- |
116590 |
Stannane, dichlorodioctyl- |
1714411 |
Stannane, dichlorodiphenyl- |
72553 |
Stannane, dioctyloxo- |
44628 |
Stannane, fluorotriphenyl- |
684845 |
Stannane, hydroxytrimethyl- |
6403 |
Stannane, hydroxytriphenyl- |
688630 |
Stannane, hydroxytripropyl- |
87056 |
Stannane, tetrabutyl- |
152199 |
Stannane, tetrachloro- |
1714265 |
Stannane, tetrachloro-, pentahydrate |
1714396 |
Stannane, tetraethenyl- |
57885 |
Stannane, tetraethyl- |
57612 |
Stannane, tetramethyl- |
117143 |
Stannane, tetraoctyl- |
57737 |
Stannane, tetraphenyl- |
67579 |
Stannane, tributyl- |
688358 |
Stannane, tributyl(pentachlorophenoxy)- |
17126004 |
Stannane, tributyl[(1-oxo-2-propenyl)oxy]- |
250761 |
Stannane, tributyl[(1-oxoneodecyl)oxy]- |
1714484 |
Stannane, tributyl[(2-chloro-1-oxo-2-propenyl)oxy]- |
97709 |
Stannane, tributyl[(2-methyl-1-oxo-2-propenyl)oxy]- |
1714560 |
Stannane, tributyl[(methylsulfonyl)oxy]- |
688101 |
Stannane, tributyl[[(9Z)-1-oxo-9-octadecenyl]oxy]- |
87049 |
Stannane, tributylchloro- |
95125 |
Stannane, tributylfluoro- |
1714346 |
Stannane, tributylhydroxy- |
1714345 |
Stannane, tributylmethoxy- |
75630 |
Stannane, trichloromethyl- |
1714404 |
Stannane, trichlorophenyl- |
690065 |
Stannane, tricyclohexylhydroxy- |
17154113 |
Stannane, triethylhydroxy- |
963736 |
Stannanetriylium, butyl- |
178343 |
Stannate (SnO32-), disodium |
1875517 |
Staphylinidae |
162230 |
Starch |
1857457 |
Staurastrum |
17112277 |
Staurastrum boreale |
17111592 |
Staurastrum chaetoceras |
17111600 |
Staurastrum manfeldtii |
17101197 |
Stauroneis amphoroides |
17100926 |
Stauroneis constricta |
17096769 |
Steganacarus carinatus |
17092875 |
Steinernema carpocapsae |
17110404 |
Stellaria media |
1902584 |
Stelleroidea |
1879501 |
Stempellina |
1871086 |
Stenacron |
1871102 |
Stenacron interpunctatum |
1874528 |
Stenelmis |
1874551 |
Stenelmis crenata |
17091042 |
Stenelmis parva |
1874601 |
Stenelmis sexlineata |
17092180 |
Stenocypris major |
1869643 |
Stenocypris malcolmsoni |
17097197 |
Stenolophus comma |
1871136 |
Stenonema |
17074485 |
Stenonema candidum |
1871185 |
Stenonema femoratum |
17077462 |
Stenonema frontale |
1871193 |
Stenonema fuscum |
1918150 |
Stenonema ithaca |
1871227 |
Stenonema luteum |
1871243 |
Stenonema modestum |
1871318 |
Stenonema rubrum |
1871334 |
Stenonema terminatum |
1871342 |
Stenonema tripunctatum |
1871359 |
Stenonema vicarium |
17078825 |
Stenopsyche griseipennis |
17107806 |
Stenotaphrum secundatum |
1932540 |
Stenotomus chrysops |
17082264 |
Stentor |
17080656 |
Stentor coeruleus |
17087438 |
Stephanocoenia michelini |
1853613 |
Stephanodiscus |
1853654 |
Stephanodiscus hantzschii |
1853662 |
Stephanodiscus invisitatus |
17111212 |
Stephanodiscus rotula |
1932607 |
Sterna hirundo |
17092933 |
Stethorus punctum |
17107814 |
Stevia rebaudiana |
17107822 |
Stewartia ovata |
1866359 |
Sthenelais boa |
687855 |
Stibine, chlorodiphenyl- |
156422 |
Stibine, chlorooxo- |
146969 |
Stibine, oxybis[diphenyl- |
166496 |
Stibine, trichloro- |
17100108 |
Stichococcus |
17098203 |
Stichococcus bacillaris |
17096363 |
Stichopus sp. |
1879204 |
Stictochironomus |
17090945 |
Stictochironomus histrio |
1855444 |
Stigeoclonium |
17100769 |
Stigeoclonium helveticum |
17099979 |
Stigeoclonium nanum |
17098724 |
Stigeoclonium pachydermum |
17111873 |
Stigeoclonium subsecundum |
17100231 |
Stigeoclonium tenue |
17148248 |
Stigmast-5-en-3-ol, (3.beta.)- |
17272907 |
Stigmasta-5,22-dien-3-ol, (3.beta.,22E)- |
17107830 |
Stipa comata - comata |
1899095 |
Stizostedion canadense |
17075805 |
Stizostedion lucioperca |
1899103 |
Stizostedion vitreum |
1899111 |
Stizostedion vitreum vitreum |
160101 |
Stoddard solvent |
1912559 |
Stramonita haemastoma |
17082488 |
Stratiomyia |
1875830 |
Stratiomyidae |
1867019 |
Streblospio benedicti |
17087487 |
Streptocephalus dichotomus |
17077736 |
Streptocephalus proboscideus |
17092503 |
Streptocephalus rubricaudatus |
17077165 |
Streptocephalus seali |
17084732 |
Streptocephalus texanus |
17087065 |
Streptocephalus torvicornis |
17089129 |
Streptopelia risoria |
17108846 |
Striga asiatica |
17108838 |
Striga hermonthica |
650473 |
Strobane |
17088840 |
Strombus gigas |
17087446 |
Strombus pugilis |
1953496 |
Strongylocentrotus |
1932698 |
Strongylocentrotus droebachiensis |
1953504 |
Strongylocentrotus franciscanus |
17081456 |
Strongylocentrotus intermedius |
17078064 |
Strongylocentrotus nudus |
17083585 |
Strongylocentrotus pallidus |
1953512 |
Strongylocentrotus purpuratus |
149864 |
Strontium |
171587 |
Strontium chloride (SrCl2) |
2485 |
Strychnidin-10-one |
43794 |
Strychnidin-10-one, 2,3-dimethoxy- |
1714643 |
Strychnidin-10-one, monohydrochloride |
3392 |
Strychnidin-10-one, sulfate (2:1) |
1932714 |
Sturnella magna |
1932722 |
Sturnus vulgaris |
1898212 |
Styela plicata |
1860006 |
Stylaria lacustris |
1908094 |
Stylocheilus longicauda |
1932748 |
Stylodrilus heringianus |
17092453 |
Stylonychia lemnae |
17079195 |
Stylonychia mytilus |
17079773 |
Stylonychia notophora |
17094608 |
Suberites domuncula |
17092941 |
Subeucalanus pileatus |
163329 |
Subtilisin |
17097288 |
Suctobelbella sp. |
130906 |
Sulfamic acid |
19802 |
Sulfamic acid, cyclohexyl- |
37325 |
Sulfamic acid, cyclohexyl-, monosodium salt |
758763 |
Sulfamic acid, dimethyl- |
52466562 |
Sulfamic acid, dimethyl-, 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester |
153668 |
Sulfamic acid, monoammonium salt |
1714497 |
Sulfanol |
197301 |
Sulfate |
212290 |
Sulfide |
52466604 |
Sulfilimine, N-[[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl]-S,S-dimethyl- |
465492 |
Sulfonic acids, alkane, sodium salts |
431387 |
Sulfonic acids, C14-16-alkane hydroxy and C14-16-alkene, sodium salts |
1714564 |
Sulfonic acids, sodium salts |
98186 |
Sulfonium, trimethyl-, iodide |
152744 |
Sulfur |
150367 |
Sulfur dioxide |
152405 |
Sulfuric acid |
153536 |
Sulfuric acid copper(2+) salt (1:1) |
153544 |
Sulfuric acid copper(2+) salt (1:1), pentahydrate |
154559 |
Sulfuric acid diammonium salt |
153999 |
Sulfuric acid dipotassium salt |
153320 |
Sulfuric acid disodium salt |
150771 |
Sulfuric acid magnesium salt (1:1) |
40220 |
Sulfuric acid monododecyl ester sodium salt |
155002 |
Sulfuric acid, aluminum ammonium salt (2:1:1) |
167163 |
Sulfuric acid, aluminum potassium salt (2:1:1) |
167106 |
Sulfuric acid, aluminum salt (3:2) |
1714594 |
Sulfuric acid, ammonium iron salt (2:1:1), decahydrate |
167221 |
Sulfuric acid, ammonium iron(2+) salt (2:2:1) |
200964 |
Sulfuric acid, ammonium nickel(2+) salt (2:2:1) |
153130 |
Sulfuric acid, barium salt (1:1) |
187930 |
Sulfuric acid, beryllium salt (1:1) |
168294 |
Sulfuric acid, cadmium salt (1:1) |
153858 |
Sulfuric acid, calcium salt (1:1) |
188839 |
Sulfuric acid, cerium(4+) salt (2:1) |
169870 |
Sulfuric acid, chromium potassium salt |
168765 |
Sulfuric acid, chromium(3+) potassium salt (2:1:1) |
167759 |
Sulfuric acid, chromium(3+) salt (3:2) |
168328 |
Sulfuric acid, cobalt(2+) salt (1:1) |
85274 |
Sulfuric acid, copper(2+) salt, basic |
3889 |
Sulfuric acid, diethyl ester |
170761 |
Sulfuric acid, dilithium salt |
1714783 |
Sulfuric acid, dimercury(1+) salt |
6684 |
Sulfuric acid, dimethyl ester |
169946 |
Sulfuric acid, disilver(1+) salt |
150417 |
Sulfuric acid, dithallium(1+) salt |
187815 |
Sulfuric acid, gallium salt (3:2) |
168344 |
Sulfuric acid, iron salt |
152926 |
Sulfuric acid, iron(2+) salt (1:1) |
154336 |
Sulfuric acid, iron(2+) salt (1:1), heptahydrate |
208090 |
Sulfuric acid, iron(2+) salt (1:1), monohydrate |
166702 |
Sulfuric acid, iron(3+) salt (3:2) |
150383 |
Sulfuric acid, lead(2+) salt (1:1) |
155259 |
Sulfuric acid, manganese(2+) salt (1:1) |
186270 |
Sulfuric acid, manganese(3+) salt (3:2) |
154609 |
Sulfuric acid, mercury(2+) salt (1:1) |
407395 |
Sulfuric acid, mono-C>10-alkyl esters, sodium salts |
459883 |
Sulfuric acid, mono-C10-16-alkyl esters, sodium salts |
39024 |
Sulfuric acid, monodecyl ester, sodium salt |
99218 |
Sulfuric acid, monododecyl ester, ammonium salt |
111773 |
Sulfuric acid, monododecyl ester, magnesium salt |
38760 |
Sulfuric acid, monooctyl ester, sodium salt |
152496 |
Sulfuric acid, monosodium salt |
155366 |
Sulfuric acid, nickel(2+) salt (1:1) |
167858 |
Sulfuric acid, nickel(2+) salt (1:1), hexahydrate |
153569 |
Sulfuric acid, strontium salt (1:1) |
166801 |
Sulfuric acid, thallium salt |
170423 |
Sulfuric acid, titanium(3+) salt (3:2) |
153189 |
Sulfuric acid, zinc salt (1:1) |
17157728 |
Sulfuric acid, zinc salt (1:1), heptahydrate |
196519 |
Sulfuric acid, zirconium(4+) salt (2:1) |
154476 |
Sulfurous acid |
100073 |
Sulfurous acid, 2-[4-(1,1-dimethylethyl)phenoxy]cyclohexyl 2-propynyl ester |
37804 |
Sulfurous acid, 2-chloroethyl 2-[4-(1,1-dimethylethyl)phenoxy]-1-methylethyl ester |
63883 |
Sulfurous acid, dibutyl ester |
153338 |
Sulfurous acid, disodium salt |
153650 |
Sulfurous acid, monopotassium salt |
151993 |
Sulfurous acid, monosodium salt |
188995 |
Sulfurous acid, zinc salt (1:1) |
17085770 |
Sunetta scripta |
156828 |
Sunflower oil |
158246 |
Superphosphates |
1873686 |
Suphisellus |
1714262 |
Suquin |
1932763 |
Surirella angusta |
17117003 |
Surirella ovalis brightwelli |
1855386 |
Surirella ovata |
17089301 |
Sus scrofa |
1887801 |
Sweltsa |
17153859 |
Swift's Rigwash |
17115593 |
Sygonium podophyllum |
17097890 |
Sylvilagus audubonii |
17086877 |
Sylvilagus floridanus |
17117425 |
Symbiodinium microadriaticum |
1886795 |
Sympetrum |
17118266 |
Sympetrum flaveolum |
1882554 |
Symphitopsyche riola |
17094079 |
Symphyla |
17113523 |
Symphyotrichum subspicatum |
1869841 |
Symphypleona |
17107855 |
Symphytum officinale |
17099888 |
Symploca |
17079310 |
Synaptura kleini |
1932920 |
Synchaeta |
1852896 |
Synechococcus |
17117417 |
Synechococcus aeruginosus |
17101767 |
Synechococcus leopoliensis |
1852904 |
Synechocystis |
17101866 |
Synechocystis aquatilis |
1854215 |
Synedra |
1854223 |
Synedra acus |
17112491 |
Synedra minuscula |
1854256 |
Synedra radians |
1854264 |
Synedra rumpens |
1854272 |
Synedra tabulata |
17111881 |
Synedra tenera |
1854280 |
Synedra ulna |
1933175 |
Syngnathus fuscus |
17094657 |
Syngnathus sp. |
17082629 |
Synodontis |
1714521 |
Syntaryl A 990 |
17097015 |
Syntomus truncatellus |
17100546 |
Syracosphaera carterae |
17115601 |
Syringa sp. |
17107863 |
Syringa vulgaris |
1875806 |
Syrphidae |
17108366 |
Syzygium jambos |
1875988 |
Tabanidae |
1876002 |
Tabanus |
17117060 |
Tabularia fasciculata |
17096678 |
Tachypleus gigas |
17084518 |
Tachypleus tridentatus |
17093568 |
Tachypodoiulus niger |
17086885 |
Tadarida brasiliensis |
17107871 |
Taeniatherum caput-medusae |
1887611 |
Taeniopteryx burksi |
1887645 |
Taeniopteryx nivalis |
17110032 |
Tagetes |
17107889 |
Tagetes erecta |
17107897 |
Tagetes patula |
1894526 |
Talitridae |
343913 |
Tall oil, ethoxylated |
17094772 |
Tallaperla maria |
17083346 |
Talpidae |
17107905 |
Tamarindus indica |
17108374 |
Tamarix ramosissima |
17089335 |
Tamias striatus |
17089350 |
Tamiasciurus hudsonicus |
1896539 |
Tanaidacea |
17093519 |
Tanais stanfordi |
17088394 |
Tandanus tandanus |
17087206 |
Tanichthys albonubes |
86454 |
Tannins |
1933258 |
Tanypodinae |
17083668 |
Tanypus bilobatus |
1877281 |
Tanypus neopunctipennis |
17080581 |
Tanypus nubifer |
1933274 |
Tanytarsini |
1879543 |
Tanytarsus |
1962331 |
Tanytarsus dissimilis |
1907815 |
Tapes philippinarum |
17095993 |
Tapes pullastra |
1896521 |
Taphromysis louisianae |
157958 |
Tar, coal |
17108515 |
Taraxacum officinale |
17093675 |
Tardigrada |
17093527 |
Tardigrada sp. |
17079443 |
Taricha granulosa |
1933316 |
Tautogolabrus adspersus |
17108523 |
Taxodium distichum |
17108531 |
Taxus cuspidata |
17115619 |
Taxus x media |
1714587 |
Technetate (TcO41-), ammonium, (T-4)- |
1714590 |
Technetate (TcO41-), potassium, (T-4)- |
17132747 |
Technetium |
17097304 |
Tectocepheus sp. |
17108549 |
Tectona grandis |
1963610 |
Tectura testudinalis |
1714422 |
Tego-Betain T |
17081597 |
Tegula brunnea |
17086422 |
Tegula funebralis |
17095241 |
Telenomus remus |
17091885 |
Tellina liliana |
17081274 |
Tellina tenuis |
156240 |
Telluric acid (H2TeO3), dipotassium salt |
167890 |
Telluric acid (H2TeO3), disodium salt |
187799 |
Tellurium |
166561 |
Tellurium chloride (TeCl4), (T-4)- |
150342 |
Tellurium oxide (TeO2) |
17084468 |
Temnopleurus toreumaticus |
17075870 |
Temora longicornis |
17087214 |
Temora stylifera |
17090077 |
Tenebrio molitor |
17094020 |
Tenebrionidae |
149880 |
Terbium |
167098 |
Terbium chloride (TbCl3) |
1867738 |
Terebellidae |
320408 |
Terphenyl, chlorinated |
17089947 |
Terrapene carolina |
693598 |
tert-Decanoic acid |
17152588 |
Tesoro Pes 41 |
17151648 |
Tesoro PES 51 |
17080557 |
Testudinella patina |
33506 |
Tetradecanal |
62521 |
Tetradecanamide, N-phenyl- |
64808 |
Tetradecane |
17151622 |
Tetradecane, 1-chloro-2,2-bis(chloromethyl)- |
694299 |
Tetradecanoic acid, (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-9a-(acetyloxy)-1a,1b,4,4a,5,7a,7b,8,9,9a-decahydro-7b-hydroxy-3-(hydroxymethyl)-4a-methoxy-1,1,6,8-tetramethyl-5-oxo-1H-cyclopropa[3,4]benz[1,2-e]azulen-9-yl ester |
26534 |
Tetradecanoic acid, 1-methylethyl ester |
1714679 |
Tetradecanoic acid, 4-nitrophenyl ester |
690503 |
Tetradecanoic acid, 9a-(acetyloxy)-1a,1b,4,4a,5,7a,7b,8,9, 9a-decahydro-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1H-cyclopropa(3,4)benz(1,2-e)azulen-9-yl ester, (1aR-(1aa,1bb,4ab,7aa,7ba, 8a,9b,9aa))- |
33399 |
Tetradecanoic acid, methyl ester |
1855568 |
Tetraedron |
17083940 |
Tetrahymena |
17091224 |
Tetrahymena pigmentosa |
17077066 |
Tetrahymena pyriformis |
17088451 |
Tetrahymena thermophila |
17082090 |
Tetrahymena vorax |
17082413 |
Tetramastix |
17094343 |
Tetramitus rostratus |
17095720 |
Tetranychidae |
198044 |
Tetraphosphoric acid, hexasodium salt |
1858455 |
Tetraselmis |
17100561 |
Tetraselmis chuii |
17112764 |
Tetraselmis gracilis |
17098179 |
Tetraselmis maculata |
17098765 |
Tetraselmis suecica |
17112301 |
Tetraselmis tetrathele |
17095555 |
Tetrodontophora bielanensis |
159236 |
Tetrosan |
1887025 |
Tettigoniidae |
17115627 |
Teucrium canadense canadense |
17079690 |
Thais clavigera |
17099425 |
Thalassia testudinum |
1853704 |
Thalassiosira |
17100595 |
Thalassiosira aestivalis |
17111311 |
Thalassiosira decipiens |
1853712 |
Thalassiosira fluviatilus |
17098104 |
Thalassiosira guillardii |
17100512 |
Thalassiosira nordenskioeldii |
17111220 |
Thalassiosira pseudonana |
17100520 |
Thalassiosira rotula |
17098237 |
Thalassiosira weissflogii |
17074477 |
Thalassoma bifasciatum |
17111337 |
Thalictrum flavum |
149898 |
Thallium |
156455 |
Thallium chloride (TlCl) |
186593 |
Thallium chloride (TlCl3) |
17084724 |
Thamnocephalus platyurus |
1862366 |
Tharyx |
1915479 |
Themiste |
17095977 |
Themisto abyssorum |
17095985 |
Themisto libellula |
17085341 |
Theodoxus fluviatilis |
17082579 |
Therapon jarbua |
17079534 |
Thermocyclops oithonoides |
1873140 |
Thermonectus basillaris |
17085119 |
Thiara lineata |
17085127 |
Thiara scabra |
17096280 |
Thiara sp. |
17083551 |
Thias haemastoma floridana |
92106 |
Thiazole, 5-ethenyl-4-methyl- |
3087 |
Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl- chloride |
4168 |
Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl- chloride, monohydrochloride |
17096488 |
Thienemanniella majuscula |
17104571 |
Thinopyrum intermedium |
17108796 |
Thinopyrum junceiforme |
17116187 |
Thinopyrum ponticum |
41558 |
Thiocyanate |
220012 |
Thiocyanic acid, (2-benzothiazolylthio)methyl ester |
1714559 |
Thiocyanic acid, (4-nitrophenyl)methyl ester |
64659 |
Thiocyanic acid, 1,2-ethanediyl ester |
28530 |
Thiocyanic acid, 2-(2-butoxyethoxy)ethyl ester |
687038 |
Thiocyanic acid, 2,4-dinitrophenyl ester |
17153545 |
Thiocyanic acid, 2-oxo-1,2-diphenylethyl ester |
92197 |
Thiocyanic acid, ammonium salt |
96800 |
Thiocyanic acid, barium salt |
96792 |
Thiocyanic acid, calcium salt |
57505 |
Thiocyanic acid, compd. with guanidine (1:1) |
78147 |
Thiocyanic acid, copper(1+) salt |
17122896 |
Thiocyanic acid, dodecyl ester |
139857 |
Thiocyanic acid, methylene ester |
110254 |
Thiocyanic acid, phenylmethyl ester |
42671 |
Thiocyanic acid, potassium salt |
51938 |
Thiocyanic acid, sodium salt |
690859 |
Thiocyanic acid, trichloromethyl ester |
17273053 |
Thiodicarbonic diamide ([(H2N)C(S)]2S), tetraethyl- |
17517 |
Thiodicarbonic diamide ([(H2N)C(S)]2S), tetramethyl- |
17121344 |
Thiodiphosphoric acid ((HO)2P(O)OP(S)(OH)2), tetraethyl ester |
118141 |
Thiodiphosphoric acid ([(HO)2P(S)]2O), tetraethyl ester |
113530 |
Thiodiphosphoric acid ([(HO)2P(S)]2O), tetrapropyl ester |
52167 |
Thioimidodicarbonic diamide ([(H2N)C(S)]2NH) |
48439 |
Thioperoxydicarbonic acid ([(HO)C(S)]2S2), diethyl ester |
17123308 |
Thioperoxydicarbonic acid ([(HO)C(S)]2S2), dimethyl ester |
89862 |
Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetrabutyl- |
17525 |
Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetraethyl- |
36913 |
Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetramethyl- |
17128075 |
Thioperoxydiphosphoric acid ([(HO)2P(S)]2S2), ethyl tris(1-methylethyl) ester, mixt. with thioperoxydiphosphoric acid ([(HO)2P(S)]2S2) triethyl 1-methylethyl ester |
26344 |
Thiophene |
72728 |
Thiophene, 3-bromo- |
33845 |
Thiophene, tetrahydro-, 1,1-dioxide |
154542 |
Thiosulfuric acid (H2S2O3), diammonium salt |
223214 |
Thiosulfuric acid (H2S2O3), disilver(1+) salt |
153627 |
Thiosulfuric acid (H2S2O3), disodium salt |
109074 |
Thiosulfuric acid (H2S2O3), S-(2-aminoethyl) ester |
3665 |
Thiourea |
10967 |
Thiourea, 1-naphthalenyl- |
25940 |
Thiourea, 2-propenyl- |
87858 |
Thiourea, butyl- |
63511 |
Thiourea, ethyl- |
109660 |
Thiourea, N,N'-bis(1-methylethyl)- |
25874 |
Thiourea, N,N'-dibutyl- |
22871 |
Thiourea, N,N'-diethyl- |
51037 |
Thiourea, N,N'-dimethyl- |
20578 |
Thiourea, N,N'-diphenyl- |
119974 |
Thiourea, N,N-diphenyl- |
106765 |
Thiourea, N-ethyl-N'-phenyl- |
21733 |
Thiourea, phenyl- |
107300 |
Thiourea, tetramethyl- |
103135 |
Thiourea, trimethyl- |
17109463 |
Thlaspi arvense |
17116112 |
Thlaspi caerulescens |
166579 |
Thorium chloride (ThCl4) |
17117516 |
Thraustotheca clavata |
17107913 |
Thuja occidentalis |
17115635 |
Thuja plicata Atrovirens |
188292 |
Thulium chloride (TmCl3) |
17076787 |
Thymallus arcticus |
17089061 |
Thymallus thymallus |
1230 |
Thymidine |
17076498 |
Thysanoessa spinifera |
17094087 |
Thysanoptera |
17087883 |
Tigriopus brevicornis |
17079054 |
Tigriopus californicus |
17092982 |
Tigriopus japanicus |
17075375 |
Tilapia |
17077108 |
Tilapia aurea |
17085259 |
Tilapia galilaea |
17086455 |
Tilapia hornorum |
17082249 |
Tilapia kottae |
17075433 |
Tilapia leucosticta |
17081803 |
Tilapia macrochir |
17076118 |
Tilapia melanopleura |
17075417 |
Tilapia mossambica |
17090903 |
Tilapia mossambica x urolepis |
17096918 |
Tilapia natalensis |
17077074 |
Tilapia nilotica |
17089111 |
Tilapia niloticus mossambica |
17092834 |
Tilapia pangani |
17075441 |
Tilapia rendalli |
17082652 |
Tilapia sparrmanii |
17088907 |
Tilapia spilurus |
17084583 |
Tilapia zillii |
149922 |
Tin |
153635 |
Tin chloride (SnCl2) |
220194 |
Tin oxide (SnO) |
17152695 |
Tin, (diethylcarbamodithioato-.kappa.S,.kappa.S')triphenyl-, (TB-5-12)- |
1933472 |
Tinca tinca |
17112848 |
Tiniaria convolvulus |
1881309 |
Tipula |
1881077 |
Tipulidae |
17087677 |
Tisbe battagliai |
17077488 |
Tisbe bulbisetosa |
17079435 |
Tisbe clodiensis |
17082900 |
Tisbe furcata |
17079427 |
Tisbe holothuriae |
17094558 |
Tisbe longicornis |
149930 |
Titanium |
152785 |
Titanium chloride (TiCl3) |
151449 |
Titanium chloride (TiCl4) (T-4)- |
187310 |
Titanium fluoride (TiF3) |
186908 |
Titanium oxide (TiO2) |
760637 |
Tobacco, ext. |
17083262 |
Tobrilus gracilis |
17102187 |
Tolypothrix lanata |
17111899 |
Tolypothrix limbata |
17118027 |
Tolypothrix sp. |
17099755 |
Tolypothrix tenuis |
17093188 |
Tomocerus minor |
1714614 |
Tornado (surfactant) |
17085861 |
Torpedo marmorata |
17153867 |
Torq-Trim |
17077827 |
Tortanus forcipatus |
156919 |
Toxaphene |
17108754 |
Toxicodendron diversilobum |
17115312 |
Toxicodendron pubescens |
17108762 |
Toxicodendron radicans |
17113168 |
Toxicodendron sp. |
1714509 |
Toxicol FLC |
17091349 |
Toxolasma texasensis |
17087685 |
Toxorhynchites splendens |
1933498 |
Toxostoma rufum |
17096157 |
Trachelipus rathkei |
1858117 |
Trachelomonas |
17086802 |
Trachemys scripta |
17101106 |
Tracheophyta |
1933506 |
Trachinotus carolinus |
17088402 |
Trachurus japonicus |
17111519 |
Tradescantia |
17107921 |
Tradescantia fluminensis |
17115643 |
Tradescantia paludosa |
17115304 |
Tradescantia spathacea |
173005 |
Transferrin |
17112210 |
Trapa natans |
1914100 |
Trematoda |
1944792 |
Tresus |
17078650 |
Tresus capax |
17091281 |
Tresus nuttalli |
17096967 |
Triatoma sp. |
17158197 |
Triazine |
17090085 |
Tribolium castaneum |
17081746 |
Tribolodon hakonensis |
1859016 |
Tribonema |
17100785 |
Tribonema inequale |
17116492 |
Triceratium sp. |
1933589 |
Trichocerca cylindrica |
1884444 |
Trichocorixa louisianae |
17094426 |
Trichocorixa reticulata |
17091687 |
Trichodactylus panoplus |
762526 |
Trichoderma hamatum |
17093535 |
Trichodorus sp. |
17091935 |
Trichodrilus tenuis |
17076126 |
Trichogaster pectoralis |
17078304 |
Trichogaster trichopterus |
17095142 |
Trichogramma cacoeciae |
17090390 |
Trichogramma pretiosum |
17092586 |
Trichomycterus brasiliensis |
17096819 |
Trichomycterus zonatus |
1881812 |
Trichoptera |
17089772 |
Trichosurus vulpecula |
17116666 |
Tricladium splendens |
1872126 |
Tricorythidae |
1872159 |
Tricorythodes |
1872175 |
Tricorythodes minutus |
17092784 |
Tricorythus |
66159 |
Tricosane |
17153875 |
Tri-Cron |
49262 |
Tricyclo[2.2.1.02,6]heptane, 1,7,7-trimethyl- |
70003 |
Tricyclo[3.3.1.13,7]decan-1-amine |
40931 |
Tricyclo[3.3.1.13,7]decane |
17091273 |
Tridacha crocea |
17078338 |
Tridacna derasa |
17107939 |
Tridax procumbens |
64782 |
Tridecane |
17119165 |
Tridecanol |
696724 |
Tridemorph |
17086307 |
Tridentiger trigonocephalus |
17110081 |
Trifolium |
17115650 |
Trifolium agrarium |
17112855 |
Trifolium alexandrinum |
17107947 |
Trifolium fragiferum |
17107954 |
Trifolium hirtum |
17110040 |
Trifolium hybridum |
17110057 |
Trifolium incarnatum |
17110065 |
Trifolium pratense |
17110073 |
Trifolium repens |
17110099 |
Trifolium subterraneum |
17110107 |
Trifolium vesiculosum |
17107962 |
Trigonella foenum-graecum |
1899327 |
Trinectes maculatus |
17118365 |
Triogoma |
17080565 |
Triops longicaudatus |
40725 |
Triphenylene |
153460 |
Triphosphoric acid, pentasodium salt |
17114752 |
Tripleurospermum maritima |
17109158 |
Tripleurospermum perforata |
17117599 |
Triscelophorus |
17116716 |
Triscelophorus acuminatus |
17116708 |
Triscelophorus monosporus |
1640085 |
Triticum |
17107970 |
Triticum aestivum |
17107988 |
Triticum boeoticum |
17107996 |
Triticum compactum |
17111444 |
Triticum dicoccon |
17108002 |
Triticum durum |
17108010 |
Triticum monococcum |
166686 |
Tritium |
17119082 |
Triton DF 16 |
17076167 |
Triturus |
17081944 |
Triturus alpestris |
17083437 |
Triturus carnifex |
17118969 |
Triturus cristatus |
17079757 |
Triturus cristatus carnifex |
17080912 |
Triturus helviticus |
17079609 |
Triturus vulgaris |
17094640 |
Triturus vulgaris meridionalis |
17092388 |
Trochilia minuta |
17094202 |
Trochosa terricola |
17108028 |
Tropaeolum majus |
1875434 |
Tropisternus |
1875467 |
Tropisternus lateralis |
17080045 |
Tropisternus lateralis nimbatu |
17091075 |
Tropocyclops parsinus |
17086323 |
Tropocyclops prasinus mexicanu |
17116955 |
Tryblionella apiculata |
17117011 |
Tryblionella hungarica |
1735 |
Tryptophan |
17108036 |
Tsuga canadensis |
1860592 |
Tubifex |
17086315 |
Tubifex costatus |
17083825 |
Tubifex rivulorum |
1860618 |
Tubifex tubifex |
1860089 |
Tubificidae |
17110859 |
Tulipa |
1962166 |
Tullbergia |
17121617 |
Tungstate (WO31-), sodium |
187401 |
Tungstate (WO42-), disodium, (T-4)- |
149948 |
Tungsten |
17078940 |
Turbanella mustela |
17082009 |
Turbatrix |
1914142 |
Turbellaria |
1933902 |
Turdus migratorius |
17095084 |
Turdus philomelos |
162446 |
Turpentine |
157636 |
Turpentine, oil |
17095076 |
Tylencholaimus sp. |
17093964 |
Tylenchorhynchus sp. |
17094210 |
Tylenchulus semipenetrans |
17091604 |
Tylenchus elegans |
17093543 |
Tylenchus sp. |
17084195 |
Tylodiplax blephariskios |
17096462 |
Tylolaimophorus sp. |
17086893 |
Tympanuchus phasianellus |
17111493 |
Typha |
17112004 |
Typha angustifolia |
17112863 |
Typha domingensis |
17111618 |
Typha latifolia |
1933936 |
Tyrannus tyrannus |
53827 |
Tyrosine |
148726 |
Tyrosine, .alpha.-methyl-, methyl ester, hydrochloride |
17086901 |
Tyto alba |
1714322 |
UC 84572 |
1890367 |
Uca |
17085283 |
Uca annulipes |
17097445 |
Uca lactea annulipes |
1890383 |
Uca minax |
1890391 |
Uca pugilator |
17078130 |
Uca pugnax |
17081506 |
Uca rapax |
17081514 |
Uca thayeri |
17085580 |
Uca triangularis |
17091919 |
Uca uruguayensis |
1714423 |
Ufasan 65 |
1714424 |
Ufasoft 75 |
1714399 |
Ugilec 141 |
17108044 |
Ulex europaeus |
17108051 |
Ulmus alata |
17108069 |
Ulmus americana |
17108077 |
Ulmus parvifolia |
17108085 |
Ulmus procera |
17108093 |
Ulmus pumila |
1857002 |
Ulothrix |
17100371 |
Ulothrix fimbriata |
17101080 |
Ulothrix flacca |
17101809 |
Ulothrix subconstricta |
17112624 |
Ulothrix tenerrima |
17116732 |
Ulva conglobata |
17102195 |
Ulva fenestrata |
17099094 |
Ulva lactuca |
17116211 |
Ulva pertusa |
17099771 |
Ulva rigida |
17100223 |
Ulvella frequens |
1901313 |
Umbra limi |
1972702 |
Umbra pygmaea |
1714738 |
Undecanamide, N-hydroxy- |
78907 |
Undecane |
28373 |
Undecanoic acid |
17077322 |
Undinula vulgaris |
1714425 |
Ungerol N 2-70 |
17088162 |
Unio elongatulus |
17118654 |
Unio pictorum |
17118696 |
Unio tumidus |
17082751 |
Unionicola crassipes |
1889955 |
Upogebia |
150185 |
Uranium |
86207 |
Uranium oxide (UO2) |
52035 |
Uranium, bis(acetato-.kappa.O)dioxo-, (T-4)- |
167874 |
Uranium, bis(nitrato-.kappa.O)dioxo-, (T-4)- |
83121 |
Uranium, dioxo[sulfato(2-)-.kappa.O]- |
2451 |
Urea |
17418 |
Urea, (2,5-dioxo-4-imidazolidinyl)- |
1714542 |
Urea, (2-bromophenyl)- |
1714416 |
Urea, (2-chlorophenyl)- |
1714544 |
Urea, (3-ethoxyphenyl)- |
68338 |
Urea, (3-hydroxyphenyl)- |
17272675 |
Urea, (3-methylphenyl)- |
1714628 |
Urea, (4-chlorophenyl)- |
17002619 |
Urea, (4-ethoxyphenyl)- |
17151408 |
Urea, (4-methoxyphenyl)- |
17003237 |
Urea, (4-methylphenyl)- |
1714291 |
Urea, 1,3-dithiolan-2-ylidene- |
17002544 |
Urea, 1-ethyl-3-(5-nitro-2-thiazolyl)- |
17157686 |
Urea, 1-naphthalenyl- |
1714541 |
Urea, 2-naphthalenyl- |
54171 |
Urea, 2-propenyl- |
57117 |
Urea, butyl- |
63503 |
Urea, ethyl- |
685156 |
Urea, hydroxy- |
58073 |
Urea, methyl- |
712349 |
Urea, N-(2,2-dimethoxyethyl)-N'-(5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl)-N-methyl- |
17001074 |
Urea, N-(2-chloroethyl)-N'-cyclohexyl-N-nitroso- |
95109 |
Urea, N-(2-methylcyclohexyl)-N'-phenyl- |
42606 |
Urea, N'-(3,4-dichlorophenyl)-N,N-dimethyl- |
42614 |
Urea, N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl- |
17126871 |
Urea, N'-(3-chloro-4-methoxyphenyl)-N,N-dimethyl- |
200212 |
Urea, N'-(3-chloro-4-methylphenyl)-N,N-dimethyl- |
17126038 |
Urea, N'-(4-bromo-3-chlorophenyl)-N-methoxy-N-methyl- |
52466406 |
Urea, N'-(4-bromophenyl)-N-methoxy-N-methyl- |
19976 |
Urea, N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)- |
40071 |
Urea, N'-(4-chlorophenyl)-N,N-dimethyl- |
91967 |
Urea, N'-(4-chlorophenyl)-N-methoxy-N-methyl- |
17124322 |
Urea, N'-(4-chlorophenyl)-N-methyl-N-(1-methyl-2-propynyl)- |
299271 |
Urea, N-(4-nitrophenyl)-N'-(3-pyridinylmethyl)- |
87148 |
Urea, N,N'-bis(phenylmethyl)- |
59030 |
Urea, N,N'-di-1-naphthalenyl- |
10603 |
Urea, N,N'-diethyl-N,N'-diphenyl- |
16774 |
Urea, N,N'-dimethyl- |
17121401 |
Urea, N,N-dimethyl-N'-(octahydro-4,7-methano-1H-inden-5-yl)- |
749101 |
Urea, N,N-dimethyl-N'-[(3aR,4S,5R,7S,7aR)-octahydro-4,7-methano-1H-inden-5-yl]-, rel- |
52466471 |
Urea, N,N-dimethyl-N'-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]- |
98004 |
Urea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- |
17127853 |
Urea, N,N-dimethyl-N'-[4-(1-methylethyl)phenyl]- |
17127572 |
Urea, N,N-dimethyl-N'-[octahydro-4,7-methano-1H-inden-1(or 2)-yl]- |
1714556 |
Urea, N,N'-dimethyl-N-nitroso- |
20081 |
Urea, N,N-dimethyl-N'-phenyl- |
20560 |
Urea, N,N'-diphenyl- |
58610 |
Urea, N,N-diphenyl- |
17129974 |
Urea, N-[(4-chlorophenyl)methyl]-N-cyclopentyl-N'-phenyl- |
1714747 |
Urea, N'-[3-chloro-4-(trifluoromethoxy)phenyl]-N,N-dimethyl- |
692368 |
Urea, N'-[3-chloro-4-[5-(1,1-dimethylethyl)-2-oxo-1,3,4-oxadiazol-3(2H)-yl]phenyl]-N,N-dimethyl- |
95091 |
Urea, N'-[4-(4-chlorophenoxy)phenyl]-N,N-dimethyl- |
265652 |
Urea, N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethyl- |
17127663 |
Urea, N-[5-(ethylsulfonyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethyl- |
17126772 |
Urea, N-2-benzothiazolyl-N,N'-dimethyl- |
17123498 |
Urea, N-2-benzothiazolyl-N'-methyl- |
748962 |
Urea, N-butyl-N'-(3,4-dichlorophenyl)-N-methyl- |
17123548 |
Urea, N'-cyclooctyl-N,N-dimethyl- |
69245 |
Urea, N-ethyl-N-nitroso- |
67462 |
Urea, N-methyl-N-nitroso- |
1714268 |
Urea, N-methyl-N'-phenyl- |
292250 |
Urea, N-phenyl-N'-1,2,3-thiadiazol-5-yl- |
3814 |
Urea, phenyl- |
63974 |
Urea, propyl- |
219709 |
Urea, sulfate (1:1) |
65243 |
Urea, tetramethyl- |
17086919 |
Uria aalge |
2972 |
Uridine |
17272667 |
Uridine 5'-(tetrahydrogen triphosphate) |
684738 |
Uridine, 2'-deoxy-5-fluoro |
3020 |
Uridine, 5-bromo-2'-deoxy- |
17114943 |
Urochloa fasciculata |
17103300 |
Urochloa mutica |
17106220 |
Urochloa texana |
17086927 |
Urocyon cinereoargenteus |
17083569 |
Urodela |
17102039 |
Uroglena |
1955012 |
Urolophus halleri |
17112814 |
Uronema confervicolum |
17087230 |
Uronema marinum |
17086513 |
Uronema nigricans |
17091505 |
Uronema parduczi |
17116989 |
Uronema sp. |
17093709 |
Uropodina |
1912575 |
Urosalpinx cinerea |
17089376 |
Ursus americanus |
17108101 |
Urtica dioica |
17108747 |
Urtica urens |
17099383 |
Utricularia |
17117318 |
Utricularia ochroleuca |
17098526 |
Utricularia vulgaris |
17092644 |
Utterbackia imbecilis |
17110115 |
Vaccinium |
17108119 |
Vaccinium angustifolium |
17108127 |
Vaccinium corymbosum |
17116021 |
Vaccinium elliottii |
17108135 |
Vaccinium macrocarpon |
17115668 |
Vaccinium virgatum |
17111907 |
Valeriana dioica |
17111915 |
Valeriana officinalis |
49783 |
Valine |
515775 |
Valine, N-[2-chloro-4-(trifluoromethyl)phenyl]-, cyano(3-phenoxyphenyl)methyl ester |
95356 |
Valinomycin |
17099391 |
Vallisneria |
17099722 |
Vallisneria americana |
17110974 |
Vallisneria spiralis |
156596 |
Vanadate (VO31-), ammonium |
190165 |
Vanadate (VO31-), sodium |
1714653 |
Vanadate (VO43-), (T-4)- |
150193 |
Vanadium |
152876 |
Vanadium chloride (VCl3) |
83113 |
Vanadium oxide (V2O5) |
1714295 |
Vanadium, dichlorooxo- |
246876 |
Vanadium, oxo[sulfato(2-)-.kappa.O]- |
153098 |
Vanadium, trichlorooxo-, (T-4)- |
17082918 |
Varichaeta pacifica |
17116690 |
Varicosporium elodeae |
17094475 |
Veigaia nemorensis |
17085176 |
Velesunio ambiguus |
17085135 |
Velesunio angasi |
1959014 |
Venerupis |
17076506 |
Venerupis decussata |
17082975 |
Venerupis japonica |
17083163 |
Venus gallina |
160077 |
Veratrine (mixture) |
17108143 |
Verbena hastata |
17102682 |
Vernicia fordii |
17113234 |
Vernicia sp. |
17115684 |
Vernonia baldwinii |
17109232 |
Vernonia gigantea |
17092792 |
Verongia aerophoba |
17108556 |
Veronica arvensis |
17108564 |
Veronica filiformis |
17115692 |
Veronica hederifolia |
17108572 |
Veronica persica |
17115700 |
Veronica sp. |
17152117 |
Verrucarin A, 2',3'-didehydro-7'-deoxo-2'-deoxy-7'-[(1R)-1-hydroxyethyl]-, (2'E,7'R)- |
1714690 |
Verrucarin A, 7'-deoxo-7'-[(1R)-1-hydroxyethyl]-, (7'R)- |
17116781 |
Vesicularia dubyana |
17108150 |
Viburnum opulus |
17108168 |
Viburnum suspensum |
17110123 |
Vicia cracca |
17110131 |
Vicia faba |
17110149 |
Vicia sativa |
17110156 |
Vicia sp. |
17110164 |
Vicia villosa |
17112897 |
Vigna angularis |
17115718 |
Vigna marina |
17108176 |
Vigna mungo |
17108184 |
Vigna radiata |
17110586 |
Vigna radiata radiata |
17116120 |
Vigna sp. |
17108200 |
Vigna unguiculata |
17108192 |
Vigna unguiculata cylindrica |
17115833 |
Vigna unguiculata sesquipedalis subsp. |
17110172 |
Vigna unguiculata unguiculata |
17083767 |
Villorita cyprinoides |
17082025 |
Villorita cyprinoides cochi |
17087222 |
Villosa iris |
17091307 |
Villosa lienosa |
1905793 |
Villosa villosa |
17088733 |
Vimba vimba |
17108218 |
Vinca major |
17108226 |
Vinca minor |
686428 |
Vincaleukoblastine |
17002056 |
Vincaleukoblastine, 22-oxo- |
17003732 |
Vincaleukoblastine, 22-oxo-, sulfate (1:1) (salt) |
17110537 |
Viola |
17108234 |
Viola arvensis |
173138 |
Vitamin A |
4424 |
Vitamin B12 |
1640101 |
Vitis |
17108242 |
Vitis labrusca |
17108259 |
Vitis rotundifolia |
17108267 |
Vitis vinifera |
17108275 |
Vitis vulpina |
17115726 |
Vitis x champini |
1911940 |
Viviparus |
17084625 |
Viviparus ater |
17080755 |
Viviparus bengalensis |
17096652 |
Viviparus contectus |
1911957 |
Viviparus georgianus |
17077280 |
Viviparus viviparus |
17090994 |
Volutharpa ampullacea perryi |
1857317 |
Volvox |
17112616 |
Volvox aureus |
17102054 |
Volvox globator |
17080698 |
Vorticella campanula |
17090895 |
Vorticella convallaria |
17076381 |
Vorticella microstoma |
17078668 |
Vorticella nebulifera |
17096371 |
Vorticella sp. |
17090515 |
Vulpes fulva |
17097791 |
Vulpes macrotis |
17086935 |
Vulpes vulpes |
17108283 |
Vulpia myuros |
17095399 |
Wadotes calcaratus |
17088915 |
Wallago attu |
17115734 |
Waltheria americana |
153171 |
Water |
155705 |
Water-d2 |
17110370 |
Weigela floribunda |
17101213 |
Westiellopsis |
17101726 |
Westiellopsis prolifica |
17117771 |
Wiesneriomyces javanicus |
17091547 |
Wilhelmia equina |
17094228 |
Willemia anophthalma |
17094327 |
Willemia intermedia |
17094285 |
Willowsia buski |
17101940 |
Wolffia arrhiza |
17112558 |
Wolffia globosa |
17099821 |
Wolffia papulifera |
17116443 |
Wolffia sp. |
17100686 |
Wollea bharadwajae |
17153909 |
Woodbrite 24 |
17084369 |
Wyeomyia mitchellii |
17084617 |
Wyeomyia smithii |
1714344 |
X 77 (resist) |
17110180 |
X Triticosecale |
17154105 |
XA 2020 |
173575 |
Xanthan gum |
17108291 |
Xanthisma texanum |
17108309 |
Xanthium strumarium |
17109240 |
Xanthium strumarium canadense |
17085416 |
Xantho hydrophilus |
1858794 |
Xanthophyta |
14050 |
Xanthylium, 3,6-bis(dimethylamino)-, chloride |
759738 |
Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, disodium salt |
9027 |
Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride |
75531 |
Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, chloride |
17080979 |
Xenopus |
17118506 |
Xenopus laevis |
17081787 |
Xiphophorus helleri |
17118787 |
Xiphophorus maculatus |
17081233 |
Xylota |
17114265 |
Xylothamia palmeri |
17084682 |
Xyrauchen texanus |
1156 |
Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3.beta.,16.beta.,17.alpha.,18.beta.,20.alpha.)- |
3939 |
Yohimban-16-carboxylic acid, 17-hydroxy-, methyl ester, monohydrochloride, (16.alpha.,17.alpha.)- |
1934231 |
Yoldia limatula |
17109257 |
Youngia japonica |
170696 |
Ytterbium chloride (YbCl3) |
170704 |
Yttrium chloride (YCl3) |
17108317 |
Yucca aloifolia |
17108325 |
Yucca glauca |
1934249 |
Yugus |
17078270 |
Zacco platypus |
17076068 |
Zacco temmincki |
17108333 |
Zea mays |
17110578 |
Zea mays mays |
17116104 |
Zea mexicana |
17089210 |
Zenaida asiatica |
1934264 |
Zenaida macroura |
1714547 |
Zeolites |
17131426 |
Zeolites, AgCu |
150235 |
Zinc |
152710 |
Zinc bromide (ZnBr2) |
152215 |
Zinc chloride (ZnCl2) |
168724 |
Zinc iodide (ZnI2) |
82941 |
Zinc oxide (ZnO) |
83154 |
Zinc phosphide (Zn3P2) |
83212 |
Zinc sulfide (ZnS) |
179374 |
Zinc, [[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-.kappa.S,.kappa.S']- |
193193 |
Zinc, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (T-4)- |
194951 |
Zinc, bis(diethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
36939 |
Zinc, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)- |
17149121 |
Zinc, bis(dimethylcarbamodithioato-.kappa.S,.kappa.S')-, (T-4)-, mixt. with 2(3H)-benzothiazolethione zinc salt |
186882 |
Zinc, bis[1-(hydroxy-.kappa.O)-2(1H)-pyridinethionato-.kappa.S2]-, (T-4)- |
17151598 |
Zinc, bis[2-(hydroxy-.kappa.O)propanoato-.kappa.O]-, (T-4)- |
193227 |
Zincate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
194225 |
Zincate(2-), tetrakis(cyano-.kappa.C)-, dipotassium, (T-4)- |
17115759 |
Zingiber officinale Roscoe |
17110198 |
Zinnia sp. |
17109265 |
Zinnia violacea |
150243 |
Zirconium |
166595 |
Zirconium chloride (ZrCl4), (T-4)- |
154799 |
Zirconium fluoride (ZrF4), (T-4)- |
152702 |
Zirconium, dichlorooxo- |
17112699 |
Zizania aquatica |
17115767 |
Ziziphus jujuba |
1901776 |
Zoanthidae |
17095795 |
Zoanthus pacificus |
17097536 |
Zoarces viviparus |
1934272 |
Zonotrichia albicollis |
17090499 |
Zonotrichia atricapilla |
17086943 |
Zonotrichia leucophrys |
17101684 |
Zostera capensis |
17099763 |
Zostera marina |
17112640 |
Zostera muelleri |
17116146 |
Zostera noltii |
17085382 |
Zosterisessor ophiocephalus |
17110206 |
Zoysia |
17108341 |
Zoysia japonica |
1857564 |
Zygnema |
17100777 |
Zygnema circumcarinatum |
1857325 |
Zygnematales |
17117086 |
Zygnematophyceae |
1888528 |
Zygoptera |